diff options
Diffstat (limited to 'python/pytest')
54 files changed, 15000 insertions, 0 deletions
diff --git a/python/pytest/.coveragerc b/python/pytest/.coveragerc new file mode 100644 index 0000000000..27db64e09c --- /dev/null +++ b/python/pytest/.coveragerc @@ -0,0 +1,7 @@ +[run] +omit = + # standlonetemplate is read dynamically and tested by test_genscript + *standalonetemplate.py + # oldinterpret could be removed, as it is no longer used in py26+ + *oldinterpret.py + vendored_packages diff --git a/python/pytest/AUTHORS b/python/pytest/AUTHORS new file mode 100644 index 0000000000..f4a21b22dd --- /dev/null +++ b/python/pytest/AUTHORS @@ -0,0 +1,91 @@ +Holger Krekel, holger at merlinux eu +merlinux GmbH, Germany, office at merlinux eu + +Contributors include:: + +Abhijeet Kasurde +Anatoly Bubenkoff +Andreas Zeidler +Andy Freeland +Anthon van der Neut +Armin Rigo +Aron Curzon +Aviv Palivoda +Benjamin Peterson +Bob Ippolito +Brian Dorsey +Brian Okken +Brianna Laugher +Bruno Oliveira +Carl Friedrich Bolz +Charles Cloud +Chris Lamb +Christian Theunert +Christian Tismer +Christopher Gilling +Daniel Grana +Daniel Hahler +Daniel Nuri +Dave Hunt +David Mohr +David Vierra +Edison Gustavo Muenz +Eduardo Schettino +Endre Galaczi +Elizaveta Shashkova +Eric Hunsberger +Eric Siegerman +Erik M. Bray +Florian Bruhin +Floris Bruynooghe +Gabriel Reis +Georgy Dyuldin +Graham Horler +Grig Gheorghiu +Guido Wesdorp +Harald Armin Massa +Ian Bicking +Jaap Broekhuizen +Jan Balster +Janne Vanhala +Jason R. Coombs +John Towler +Joshua Bronson +Jurko Gospodnetić +Katarzyna Jachim +Kevin Cox +Lee Kamentsky +Lukas Bednar +Maciek Fijalkowski +Maho +Marc Schlaich +Mark Abramowitz +Markus Unterwaditzer +Martijn Faassen +Martin Prusse +Matt Bachmann +Michael Aquilina +Michael Birtwell +Michael Droettboom +Nicolas Delaby +Pieter Mulder +Piotr Banaszkiewicz +Punyashloka Biswal +Quentin Pradet +Ralf Schmitt +Raphael Pierzina +Ronny Pfannschmidt +Ross Lawley +Ryan Wooden +Samuele Pedroni +Tom Viner +Trevor Bekolay +Wouter van Ackooy +David Díaz-Barquero +Eric Hunsberger +Simon Gomizelj +Russel Winder +Ben Webb +Alexei Kozlenok +Cal Leeming +Feng Ma diff --git a/python/pytest/LICENSE b/python/pytest/LICENSE new file mode 100644 index 0000000000..9e27bd7841 --- /dev/null +++ b/python/pytest/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2004-2016 Holger Krekel and others + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/python/pytest/MANIFEST.in b/python/pytest/MANIFEST.in new file mode 100644 index 0000000000..266a9184dc --- /dev/null +++ b/python/pytest/MANIFEST.in @@ -0,0 +1,34 @@ +include CHANGELOG.rst +include LICENSE +include AUTHORS + +include README.rst +include CONTRIBUTING.rst + +include tox.ini +include setup.py + +include .coveragerc + +include plugin-test.sh +include requirements-docs.txt +include runtox.py + +recursive-include bench *.py +recursive-include extra *.py + +graft testing +graft doc + +exclude _pytest/impl + +graft _pytest/vendored_packages + +recursive-exclude * *.pyc *.pyo + +exclude appveyor/install.ps1 +exclude appveyor.yml +exclude appveyor + +exclude ISSUES.txt +exclude HOWTORELEASE.rst diff --git a/python/pytest/PKG-INFO b/python/pytest/PKG-INFO new file mode 100644 index 0000000000..7b801be0d7 --- /dev/null +++ b/python/pytest/PKG-INFO @@ -0,0 +1,133 @@ +Metadata-Version: 1.1 +Name: pytest +Version: 2.9.2 +Summary: pytest: simple powerful testing with Python +Home-page: http://pytest.org +Author: Holger Krekel, Bruno Oliveira, Ronny Pfannschmidt, Floris Bruynooghe, Brianna Laugher, Florian Bruhin and others +Author-email: holger at merlinux.eu +License: MIT license +Description: .. image:: http://pytest.org/latest/_static/pytest1.png + :target: http://pytest.org + :align: center + :alt: pytest + + ------ + + .. image:: https://img.shields.io/pypi/v/pytest.svg + :target: https://pypi.python.org/pypi/pytest + .. image:: https://img.shields.io/pypi/pyversions/pytest.svg + :target: https://pypi.python.org/pypi/pytest + .. image:: https://img.shields.io/coveralls/pytest-dev/pytest/master.svg + :target: https://coveralls.io/r/pytest-dev/pytest + .. image:: https://travis-ci.org/pytest-dev/pytest.svg?branch=master + :target: https://travis-ci.org/pytest-dev/pytest + .. image:: https://ci.appveyor.com/api/projects/status/mrgbjaua7t33pg6b?svg=true + :target: https://ci.appveyor.com/project/pytestbot/pytest + + The ``pytest`` framework makes it easy to write small tests, yet + scales to support complex functional testing for applications and libraries. + + An example of a simple test: + + .. code-block:: python + + # content of test_sample.py + def func(x): + return x + 1 + + def test_answer(): + assert func(3) == 5 + + + To execute it:: + + $ py.test + ======= test session starts ======== + platform linux -- Python 3.4.3, pytest-2.8.5, py-1.4.31, pluggy-0.3.1 + collected 1 items + + test_sample.py F + + ======= FAILURES ======== + _______ test_answer ________ + + def test_answer(): + > assert func(3) == 5 + E assert 4 == 5 + E + where 4 = func(3) + + test_sample.py:5: AssertionError + ======= 1 failed in 0.12 seconds ======== + + Due to ``py.test``'s detailed assertion introspection, only plain ``assert`` statements are used. See `getting-started <http://pytest.org/latest/getting-started.html#our-first-test-run>`_ for more examples. + + + Features + -------- + + - Detailed info on failing `assert statements <http://pytest.org/latest/assert.html>`_ (no need to remember ``self.assert*`` names); + + - `Auto-discovery + <http://pytest.org/latest/goodpractices.html#python-test-discovery>`_ + of test modules and functions; + + - `Modular fixtures <http://pytest.org/latest/fixture.html>`_ for + managing small or parametrized long-lived test resources; + + - Can run `unittest <http://pytest.org/latest/unittest.html>`_ (or trial), + `nose <http://pytest.org/latest/nose.html>`_ test suites out of the box; + + - Python2.6+, Python3.2+, PyPy-2.3, Jython-2.5 (untested); + + - Rich plugin architecture, with over 150+ `external plugins <http://pytest.org/latest/plugins.html#installing-external-plugins-searching>`_ and thriving community; + + + Documentation + ------------- + + For full documentation, including installation, tutorials and PDF documents, please see http://pytest.org. + + + Bugs/Requests + ------------- + + Please use the `GitHub issue tracker <https://github.com/pytest-dev/pytest/issues>`_ to submit bugs or request features. + + + Changelog + --------- + + Consult the `Changelog <http://pytest.org/latest/changelog.html>`_ page for fixes and enhancements of each version. + + + License + ------- + + Copyright Holger Krekel and others, 2004-2016. + + Distributed under the terms of the `MIT`_ license, pytest is free and open source software. + + .. _`MIT`: https://github.com/pytest-dev/pytest/blob/master/LICENSE + +Platform: unix +Platform: linux +Platform: osx +Platform: cygwin +Platform: win32 +Classifier: Development Status :: 6 - Mature +Classifier: Intended Audience :: Developers +Classifier: License :: OSI Approved :: MIT License +Classifier: Operating System :: POSIX +Classifier: Operating System :: Microsoft :: Windows +Classifier: Operating System :: MacOS :: MacOS X +Classifier: Topic :: Software Development :: Testing +Classifier: Topic :: Software Development :: Libraries +Classifier: Topic :: Utilities +Classifier: Programming Language :: Python :: 2 +Classifier: Programming Language :: Python :: 2.6 +Classifier: Programming Language :: Python :: 2.7 +Classifier: Programming Language :: Python :: 3 +Classifier: Programming Language :: Python :: 3.2 +Classifier: Programming Language :: Python :: 3.3 +Classifier: Programming Language :: Python :: 3.4 +Classifier: Programming Language :: Python :: 3.5 diff --git a/python/pytest/README.rst b/python/pytest/README.rst new file mode 100644 index 0000000000..68fc92211d --- /dev/null +++ b/python/pytest/README.rst @@ -0,0 +1,102 @@ +.. image:: http://pytest.org/latest/_static/pytest1.png + :target: http://pytest.org + :align: center + :alt: pytest + +------ + +.. image:: https://img.shields.io/pypi/v/pytest.svg + :target: https://pypi.python.org/pypi/pytest +.. image:: https://img.shields.io/pypi/pyversions/pytest.svg + :target: https://pypi.python.org/pypi/pytest +.. image:: https://img.shields.io/coveralls/pytest-dev/pytest/master.svg + :target: https://coveralls.io/r/pytest-dev/pytest +.. image:: https://travis-ci.org/pytest-dev/pytest.svg?branch=master + :target: https://travis-ci.org/pytest-dev/pytest +.. image:: https://ci.appveyor.com/api/projects/status/mrgbjaua7t33pg6b?svg=true + :target: https://ci.appveyor.com/project/pytestbot/pytest + +The ``pytest`` framework makes it easy to write small tests, yet +scales to support complex functional testing for applications and libraries. + +An example of a simple test: + +.. code-block:: python + + # content of test_sample.py + def func(x): + return x + 1 + + def test_answer(): + assert func(3) == 5 + + +To execute it:: + + $ py.test + ======= test session starts ======== + platform linux -- Python 3.4.3, pytest-2.8.5, py-1.4.31, pluggy-0.3.1 + collected 1 items + + test_sample.py F + + ======= FAILURES ======== + _______ test_answer ________ + + def test_answer(): + > assert func(3) == 5 + E assert 4 == 5 + E + where 4 = func(3) + + test_sample.py:5: AssertionError + ======= 1 failed in 0.12 seconds ======== + +Due to ``py.test``'s detailed assertion introspection, only plain ``assert`` statements are used. See `getting-started <http://pytest.org/latest/getting-started.html#our-first-test-run>`_ for more examples. + + +Features +-------- + +- Detailed info on failing `assert statements <http://pytest.org/latest/assert.html>`_ (no need to remember ``self.assert*`` names); + +- `Auto-discovery + <http://pytest.org/latest/goodpractices.html#python-test-discovery>`_ + of test modules and functions; + +- `Modular fixtures <http://pytest.org/latest/fixture.html>`_ for + managing small or parametrized long-lived test resources; + +- Can run `unittest <http://pytest.org/latest/unittest.html>`_ (or trial), + `nose <http://pytest.org/latest/nose.html>`_ test suites out of the box; + +- Python2.6+, Python3.2+, PyPy-2.3, Jython-2.5 (untested); + +- Rich plugin architecture, with over 150+ `external plugins <http://pytest.org/latest/plugins.html#installing-external-plugins-searching>`_ and thriving community; + + +Documentation +------------- + +For full documentation, including installation, tutorials and PDF documents, please see http://pytest.org. + + +Bugs/Requests +------------- + +Please use the `GitHub issue tracker <https://github.com/pytest-dev/pytest/issues>`_ to submit bugs or request features. + + +Changelog +--------- + +Consult the `Changelog <http://pytest.org/latest/changelog.html>`_ page for fixes and enhancements of each version. + + +License +------- + +Copyright Holger Krekel and others, 2004-2016. + +Distributed under the terms of the `MIT`_ license, pytest is free and open source software. + +.. _`MIT`: https://github.com/pytest-dev/pytest/blob/master/LICENSE diff --git a/python/pytest/_pytest/__init__.py b/python/pytest/_pytest/__init__.py new file mode 100644 index 0000000000..23dac6d055 --- /dev/null +++ b/python/pytest/_pytest/__init__.py @@ -0,0 +1,2 @@ +# +__version__ = '2.9.2' diff --git a/python/pytest/_pytest/_argcomplete.py b/python/pytest/_pytest/_argcomplete.py new file mode 100644 index 0000000000..955855a964 --- /dev/null +++ b/python/pytest/_pytest/_argcomplete.py @@ -0,0 +1,101 @@ + +"""allow bash-completion for argparse with argcomplete if installed +needs argcomplete>=0.5.6 for python 3.2/3.3 (older versions fail +to find the magic string, so _ARGCOMPLETE env. var is never set, and +this does not need special code. + +argcomplete does not support python 2.5 (although the changes for that +are minor). + +Function try_argcomplete(parser) should be called directly before +the call to ArgumentParser.parse_args(). + +The filescompleter is what you normally would use on the positional +arguments specification, in order to get "dirname/" after "dirn<TAB>" +instead of the default "dirname ": + + optparser.add_argument(Config._file_or_dir, nargs='*' + ).completer=filescompleter + +Other, application specific, completers should go in the file +doing the add_argument calls as they need to be specified as .completer +attributes as well. (If argcomplete is not installed, the function the +attribute points to will not be used). + +SPEEDUP +======= +The generic argcomplete script for bash-completion +(/etc/bash_completion.d/python-argcomplete.sh ) +uses a python program to determine startup script generated by pip. +You can speed up completion somewhat by changing this script to include + # PYTHON_ARGCOMPLETE_OK +so the the python-argcomplete-check-easy-install-script does not +need to be called to find the entry point of the code and see if that is +marked with PYTHON_ARGCOMPLETE_OK + +INSTALL/DEBUGGING +================= +To include this support in another application that has setup.py generated +scripts: +- add the line: + # PYTHON_ARGCOMPLETE_OK + near the top of the main python entry point +- include in the file calling parse_args(): + from _argcomplete import try_argcomplete, filescompleter + , call try_argcomplete just before parse_args(), and optionally add + filescompleter to the positional arguments' add_argument() +If things do not work right away: +- switch on argcomplete debugging with (also helpful when doing custom + completers): + export _ARC_DEBUG=1 +- run: + python-argcomplete-check-easy-install-script $(which appname) + echo $? + will echo 0 if the magic line has been found, 1 if not +- sometimes it helps to find early on errors using: + _ARGCOMPLETE=1 _ARC_DEBUG=1 appname + which should throw a KeyError: 'COMPLINE' (which is properly set by the + global argcomplete script). +""" + +import sys +import os +from glob import glob + +class FastFilesCompleter: + 'Fast file completer class' + def __init__(self, directories=True): + self.directories = directories + + def __call__(self, prefix, **kwargs): + """only called on non option completions""" + if os.path.sep in prefix[1:]: # + prefix_dir = len(os.path.dirname(prefix) + os.path.sep) + else: + prefix_dir = 0 + completion = [] + globbed = [] + if '*' not in prefix and '?' not in prefix: + if prefix[-1] == os.path.sep: # we are on unix, otherwise no bash + globbed.extend(glob(prefix + '.*')) + prefix += '*' + globbed.extend(glob(prefix)) + for x in sorted(globbed): + if os.path.isdir(x): + x += '/' + # append stripping the prefix (like bash, not like compgen) + completion.append(x[prefix_dir:]) + return completion + +if os.environ.get('_ARGCOMPLETE'): + try: + import argcomplete.completers + except ImportError: + sys.exit(-1) + filescompleter = FastFilesCompleter() + + def try_argcomplete(parser): + argcomplete.autocomplete(parser) +else: + def try_argcomplete(parser): pass + filescompleter = None diff --git a/python/pytest/_pytest/_code/__init__.py b/python/pytest/_pytest/_code/__init__.py new file mode 100644 index 0000000000..c046b9716c --- /dev/null +++ b/python/pytest/_pytest/_code/__init__.py @@ -0,0 +1,12 @@ +""" python inspection/code generation API """ +from .code import Code # noqa +from .code import ExceptionInfo # noqa +from .code import Frame # noqa +from .code import Traceback # noqa +from .code import getrawcode # noqa +from .code import patch_builtins # noqa +from .code import unpatch_builtins # noqa +from .source import Source # noqa +from .source import compile_ as compile # noqa +from .source import getfslineno # noqa + diff --git a/python/pytest/_pytest/_code/_py2traceback.py b/python/pytest/_pytest/_code/_py2traceback.py new file mode 100644 index 0000000000..a830d9899a --- /dev/null +++ b/python/pytest/_pytest/_code/_py2traceback.py @@ -0,0 +1,81 @@ +# copied from python-2.7.3's traceback.py +# CHANGES: +# - some_str is replaced, trying to create unicode strings +# +import types + +def format_exception_only(etype, value): + """Format the exception part of a traceback. + + The arguments are the exception type and value such as given by + sys.last_type and sys.last_value. The return value is a list of + strings, each ending in a newline. + + Normally, the list contains a single string; however, for + SyntaxError exceptions, it contains several lines that (when + printed) display detailed information about where the syntax + error occurred. + + The message indicating which exception occurred is always the last + string in the list. + + """ + + # An instance should not have a meaningful value parameter, but + # sometimes does, particularly for string exceptions, such as + # >>> raise string1, string2 # deprecated + # + # Clear these out first because issubtype(string1, SyntaxError) + # would throw another exception and mask the original problem. + if (isinstance(etype, BaseException) or + isinstance(etype, types.InstanceType) or + etype is None or type(etype) is str): + return [_format_final_exc_line(etype, value)] + + stype = etype.__name__ + + if not issubclass(etype, SyntaxError): + return [_format_final_exc_line(stype, value)] + + # It was a syntax error; show exactly where the problem was found. + lines = [] + try: + msg, (filename, lineno, offset, badline) = value.args + except Exception: + pass + else: + filename = filename or "<string>" + lines.append(' File "%s", line %d\n' % (filename, lineno)) + if badline is not None: + if isinstance(badline, bytes): # python 2 only + badline = badline.decode('utf-8', 'replace') + lines.append(u' %s\n' % badline.strip()) + if offset is not None: + caretspace = badline.rstrip('\n')[:offset].lstrip() + # non-space whitespace (likes tabs) must be kept for alignment + caretspace = ((c.isspace() and c or ' ') for c in caretspace) + # only three spaces to account for offset1 == pos 0 + lines.append(' %s^\n' % ''.join(caretspace)) + value = msg + + lines.append(_format_final_exc_line(stype, value)) + return lines + +def _format_final_exc_line(etype, value): + """Return a list of a single line -- normal case for format_exception_only""" + valuestr = _some_str(value) + if value is None or not valuestr: + line = "%s\n" % etype + else: + line = "%s: %s\n" % (etype, valuestr) + return line + +def _some_str(value): + try: + return unicode(value) + except Exception: + try: + return str(value) + except Exception: + pass + return '<unprintable %s object>' % type(value).__name__ diff --git a/python/pytest/_pytest/_code/code.py b/python/pytest/_pytest/_code/code.py new file mode 100644 index 0000000000..8995cc1f71 --- /dev/null +++ b/python/pytest/_pytest/_code/code.py @@ -0,0 +1,805 @@ +import sys +from inspect import CO_VARARGS, CO_VARKEYWORDS + +import py + +builtin_repr = repr + +reprlib = py.builtin._tryimport('repr', 'reprlib') + +if sys.version_info[0] >= 3: + from traceback import format_exception_only +else: + from ._py2traceback import format_exception_only + +class Code(object): + """ wrapper around Python code objects """ + def __init__(self, rawcode): + if not hasattr(rawcode, "co_filename"): + rawcode = getrawcode(rawcode) + try: + self.filename = rawcode.co_filename + self.firstlineno = rawcode.co_firstlineno - 1 + self.name = rawcode.co_name + except AttributeError: + raise TypeError("not a code object: %r" %(rawcode,)) + self.raw = rawcode + + def __eq__(self, other): + return self.raw == other.raw + + def __ne__(self, other): + return not self == other + + @property + def path(self): + """ return a path object pointing to source code (note that it + might not point to an actually existing file). """ + p = py.path.local(self.raw.co_filename) + # maybe don't try this checking + if not p.check(): + # XXX maybe try harder like the weird logic + # in the standard lib [linecache.updatecache] does? + p = self.raw.co_filename + return p + + @property + def fullsource(self): + """ return a _pytest._code.Source object for the full source file of the code + """ + from _pytest._code import source + full, _ = source.findsource(self.raw) + return full + + def source(self): + """ return a _pytest._code.Source object for the code object's source only + """ + # return source only for that part of code + import _pytest._code + return _pytest._code.Source(self.raw) + + def getargs(self, var=False): + """ return a tuple with the argument names for the code object + + if 'var' is set True also return the names of the variable and + keyword arguments when present + """ + # handfull shortcut for getting args + raw = self.raw + argcount = raw.co_argcount + if var: + argcount += raw.co_flags & CO_VARARGS + argcount += raw.co_flags & CO_VARKEYWORDS + return raw.co_varnames[:argcount] + +class Frame(object): + """Wrapper around a Python frame holding f_locals and f_globals + in which expressions can be evaluated.""" + + def __init__(self, frame): + self.lineno = frame.f_lineno - 1 + self.f_globals = frame.f_globals + self.f_locals = frame.f_locals + self.raw = frame + self.code = Code(frame.f_code) + + @property + def statement(self): + """ statement this frame is at """ + import _pytest._code + if self.code.fullsource is None: + return _pytest._code.Source("") + return self.code.fullsource.getstatement(self.lineno) + + def eval(self, code, **vars): + """ evaluate 'code' in the frame + + 'vars' are optional additional local variables + + returns the result of the evaluation + """ + f_locals = self.f_locals.copy() + f_locals.update(vars) + return eval(code, self.f_globals, f_locals) + + def exec_(self, code, **vars): + """ exec 'code' in the frame + + 'vars' are optiona; additional local variables + """ + f_locals = self.f_locals.copy() + f_locals.update(vars) + py.builtin.exec_(code, self.f_globals, f_locals ) + + def repr(self, object): + """ return a 'safe' (non-recursive, one-line) string repr for 'object' + """ + return py.io.saferepr(object) + + def is_true(self, object): + return object + + def getargs(self, var=False): + """ return a list of tuples (name, value) for all arguments + + if 'var' is set True also include the variable and keyword + arguments when present + """ + retval = [] + for arg in self.code.getargs(var): + try: + retval.append((arg, self.f_locals[arg])) + except KeyError: + pass # this can occur when using Psyco + return retval + +class TracebackEntry(object): + """ a single entry in a traceback """ + + _repr_style = None + exprinfo = None + + def __init__(self, rawentry): + self._rawentry = rawentry + self.lineno = rawentry.tb_lineno - 1 + + def set_repr_style(self, mode): + assert mode in ("short", "long") + self._repr_style = mode + + @property + def frame(self): + import _pytest._code + return _pytest._code.Frame(self._rawentry.tb_frame) + + @property + def relline(self): + return self.lineno - self.frame.code.firstlineno + + def __repr__(self): + return "<TracebackEntry %s:%d>" %(self.frame.code.path, self.lineno+1) + + @property + def statement(self): + """ _pytest._code.Source object for the current statement """ + source = self.frame.code.fullsource + return source.getstatement(self.lineno) + + @property + def path(self): + """ path to the source code """ + return self.frame.code.path + + def getlocals(self): + return self.frame.f_locals + locals = property(getlocals, None, None, "locals of underlaying frame") + + def reinterpret(self): + """Reinterpret the failing statement and returns a detailed information + about what operations are performed.""" + from _pytest.assertion.reinterpret import reinterpret + if self.exprinfo is None: + source = py.builtin._totext(self.statement).strip() + x = reinterpret(source, self.frame, should_fail=True) + if not py.builtin._istext(x): + raise TypeError("interpret returned non-string %r" % (x,)) + self.exprinfo = x + return self.exprinfo + + def getfirstlinesource(self): + # on Jython this firstlineno can be -1 apparently + return max(self.frame.code.firstlineno, 0) + + def getsource(self, astcache=None): + """ return failing source code. """ + # we use the passed in astcache to not reparse asttrees + # within exception info printing + from _pytest._code.source import getstatementrange_ast + source = self.frame.code.fullsource + if source is None: + return None + key = astnode = None + if astcache is not None: + key = self.frame.code.path + if key is not None: + astnode = astcache.get(key, None) + start = self.getfirstlinesource() + try: + astnode, _, end = getstatementrange_ast(self.lineno, source, + astnode=astnode) + except SyntaxError: + end = self.lineno + 1 + else: + if key is not None: + astcache[key] = astnode + return source[start:end] + + source = property(getsource) + + def ishidden(self): + """ return True if the current frame has a var __tracebackhide__ + resolving to True + + mostly for internal use + """ + try: + return self.frame.f_locals['__tracebackhide__'] + except KeyError: + try: + return self.frame.f_globals['__tracebackhide__'] + except KeyError: + return False + + def __str__(self): + try: + fn = str(self.path) + except py.error.Error: + fn = '???' + name = self.frame.code.name + try: + line = str(self.statement).lstrip() + except KeyboardInterrupt: + raise + except: + line = "???" + return " File %r:%d in %s\n %s\n" %(fn, self.lineno+1, name, line) + + def name(self): + return self.frame.code.raw.co_name + name = property(name, None, None, "co_name of underlaying code") + +class Traceback(list): + """ Traceback objects encapsulate and offer higher level + access to Traceback entries. + """ + Entry = TracebackEntry + def __init__(self, tb): + """ initialize from given python traceback object. """ + if hasattr(tb, 'tb_next'): + def f(cur): + while cur is not None: + yield self.Entry(cur) + cur = cur.tb_next + list.__init__(self, f(tb)) + else: + list.__init__(self, tb) + + def cut(self, path=None, lineno=None, firstlineno=None, excludepath=None): + """ return a Traceback instance wrapping part of this Traceback + + by provding any combination of path, lineno and firstlineno, the + first frame to start the to-be-returned traceback is determined + + this allows cutting the first part of a Traceback instance e.g. + for formatting reasons (removing some uninteresting bits that deal + with handling of the exception/traceback) + """ + for x in self: + code = x.frame.code + codepath = code.path + if ((path is None or codepath == path) and + (excludepath is None or not hasattr(codepath, 'relto') or + not codepath.relto(excludepath)) and + (lineno is None or x.lineno == lineno) and + (firstlineno is None or x.frame.code.firstlineno == firstlineno)): + return Traceback(x._rawentry) + return self + + def __getitem__(self, key): + val = super(Traceback, self).__getitem__(key) + if isinstance(key, type(slice(0))): + val = self.__class__(val) + return val + + def filter(self, fn=lambda x: not x.ishidden()): + """ return a Traceback instance with certain items removed + + fn is a function that gets a single argument, a TracebackEntry + instance, and should return True when the item should be added + to the Traceback, False when not + + by default this removes all the TracebackEntries which are hidden + (see ishidden() above) + """ + return Traceback(filter(fn, self)) + + def getcrashentry(self): + """ return last non-hidden traceback entry that lead + to the exception of a traceback. + """ + for i in range(-1, -len(self)-1, -1): + entry = self[i] + if not entry.ishidden(): + return entry + return self[-1] + + def recursionindex(self): + """ return the index of the frame/TracebackEntry where recursion + originates if appropriate, None if no recursion occurred + """ + cache = {} + for i, entry in enumerate(self): + # id for the code.raw is needed to work around + # the strange metaprogramming in the decorator lib from pypi + # which generates code objects that have hash/value equality + #XXX needs a test + key = entry.frame.code.path, id(entry.frame.code.raw), entry.lineno + #print "checking for recursion at", key + l = cache.setdefault(key, []) + if l: + f = entry.frame + loc = f.f_locals + for otherloc in l: + if f.is_true(f.eval(co_equal, + __recursioncache_locals_1=loc, + __recursioncache_locals_2=otherloc)): + return i + l.append(entry.frame.f_locals) + return None + +co_equal = compile('__recursioncache_locals_1 == __recursioncache_locals_2', + '?', 'eval') + +class ExceptionInfo(object): + """ wraps sys.exc_info() objects and offers + help for navigating the traceback. + """ + _striptext = '' + def __init__(self, tup=None, exprinfo=None): + import _pytest._code + if tup is None: + tup = sys.exc_info() + if exprinfo is None and isinstance(tup[1], AssertionError): + exprinfo = getattr(tup[1], 'msg', None) + if exprinfo is None: + exprinfo = str(tup[1]) + if exprinfo and exprinfo.startswith('assert '): + self._striptext = 'AssertionError: ' + self._excinfo = tup + #: the exception class + self.type = tup[0] + #: the exception instance + self.value = tup[1] + #: the exception raw traceback + self.tb = tup[2] + #: the exception type name + self.typename = self.type.__name__ + #: the exception traceback (_pytest._code.Traceback instance) + self.traceback = _pytest._code.Traceback(self.tb) + + def __repr__(self): + return "<ExceptionInfo %s tblen=%d>" % (self.typename, len(self.traceback)) + + def exconly(self, tryshort=False): + """ return the exception as a string + + when 'tryshort' resolves to True, and the exception is a + _pytest._code._AssertionError, only the actual exception part of + the exception representation is returned (so 'AssertionError: ' is + removed from the beginning) + """ + lines = format_exception_only(self.type, self.value) + text = ''.join(lines) + text = text.rstrip() + if tryshort: + if text.startswith(self._striptext): + text = text[len(self._striptext):] + return text + + def errisinstance(self, exc): + """ return True if the exception is an instance of exc """ + return isinstance(self.value, exc) + + def _getreprcrash(self): + exconly = self.exconly(tryshort=True) + entry = self.traceback.getcrashentry() + path, lineno = entry.frame.code.raw.co_filename, entry.lineno + return ReprFileLocation(path, lineno+1, exconly) + + def getrepr(self, showlocals=False, style="long", + abspath=False, tbfilter=True, funcargs=False): + """ return str()able representation of this exception info. + showlocals: show locals per traceback entry + style: long|short|no|native traceback style + tbfilter: hide entries (where __tracebackhide__ is true) + + in case of style==native, tbfilter and showlocals is ignored. + """ + if style == 'native': + return ReprExceptionInfo(ReprTracebackNative( + py.std.traceback.format_exception( + self.type, + self.value, + self.traceback[0]._rawentry, + )), self._getreprcrash()) + + fmt = FormattedExcinfo(showlocals=showlocals, style=style, + abspath=abspath, tbfilter=tbfilter, funcargs=funcargs) + return fmt.repr_excinfo(self) + + def __str__(self): + entry = self.traceback[-1] + loc = ReprFileLocation(entry.path, entry.lineno + 1, self.exconly()) + return str(loc) + + def __unicode__(self): + entry = self.traceback[-1] + loc = ReprFileLocation(entry.path, entry.lineno + 1, self.exconly()) + return unicode(loc) + + +class FormattedExcinfo(object): + """ presenting information about failing Functions and Generators. """ + # for traceback entries + flow_marker = ">" + fail_marker = "E" + + def __init__(self, showlocals=False, style="long", abspath=True, tbfilter=True, funcargs=False): + self.showlocals = showlocals + self.style = style + self.tbfilter = tbfilter + self.funcargs = funcargs + self.abspath = abspath + self.astcache = {} + + def _getindent(self, source): + # figure out indent for given source + try: + s = str(source.getstatement(len(source)-1)) + except KeyboardInterrupt: + raise + except: + try: + s = str(source[-1]) + except KeyboardInterrupt: + raise + except: + return 0 + return 4 + (len(s) - len(s.lstrip())) + + def _getentrysource(self, entry): + source = entry.getsource(self.astcache) + if source is not None: + source = source.deindent() + return source + + def _saferepr(self, obj): + return py.io.saferepr(obj) + + def repr_args(self, entry): + if self.funcargs: + args = [] + for argname, argvalue in entry.frame.getargs(var=True): + args.append((argname, self._saferepr(argvalue))) + return ReprFuncArgs(args) + + def get_source(self, source, line_index=-1, excinfo=None, short=False): + """ return formatted and marked up source lines. """ + import _pytest._code + lines = [] + if source is None or line_index >= len(source.lines): + source = _pytest._code.Source("???") + line_index = 0 + if line_index < 0: + line_index += len(source) + space_prefix = " " + if short: + lines.append(space_prefix + source.lines[line_index].strip()) + else: + for line in source.lines[:line_index]: + lines.append(space_prefix + line) + lines.append(self.flow_marker + " " + source.lines[line_index]) + for line in source.lines[line_index+1:]: + lines.append(space_prefix + line) + if excinfo is not None: + indent = 4 if short else self._getindent(source) + lines.extend(self.get_exconly(excinfo, indent=indent, markall=True)) + return lines + + def get_exconly(self, excinfo, indent=4, markall=False): + lines = [] + indent = " " * indent + # get the real exception information out + exlines = excinfo.exconly(tryshort=True).split('\n') + failindent = self.fail_marker + indent[1:] + for line in exlines: + lines.append(failindent + line) + if not markall: + failindent = indent + return lines + + def repr_locals(self, locals): + if self.showlocals: + lines = [] + keys = [loc for loc in locals if loc[0] != "@"] + keys.sort() + for name in keys: + value = locals[name] + if name == '__builtins__': + lines.append("__builtins__ = <builtins>") + else: + # This formatting could all be handled by the + # _repr() function, which is only reprlib.Repr in + # disguise, so is very configurable. + str_repr = self._saferepr(value) + #if len(str_repr) < 70 or not isinstance(value, + # (list, tuple, dict)): + lines.append("%-10s = %s" %(name, str_repr)) + #else: + # self._line("%-10s =\\" % (name,)) + # # XXX + # py.std.pprint.pprint(value, stream=self.excinfowriter) + return ReprLocals(lines) + + def repr_traceback_entry(self, entry, excinfo=None): + import _pytest._code + source = self._getentrysource(entry) + if source is None: + source = _pytest._code.Source("???") + line_index = 0 + else: + # entry.getfirstlinesource() can be -1, should be 0 on jython + line_index = entry.lineno - max(entry.getfirstlinesource(), 0) + + lines = [] + style = entry._repr_style + if style is None: + style = self.style + if style in ("short", "long"): + short = style == "short" + reprargs = self.repr_args(entry) if not short else None + s = self.get_source(source, line_index, excinfo, short=short) + lines.extend(s) + if short: + message = "in %s" %(entry.name) + else: + message = excinfo and excinfo.typename or "" + path = self._makepath(entry.path) + filelocrepr = ReprFileLocation(path, entry.lineno+1, message) + localsrepr = None + if not short: + localsrepr = self.repr_locals(entry.locals) + return ReprEntry(lines, reprargs, localsrepr, filelocrepr, style) + if excinfo: + lines.extend(self.get_exconly(excinfo, indent=4)) + return ReprEntry(lines, None, None, None, style) + + def _makepath(self, path): + if not self.abspath: + try: + np = py.path.local().bestrelpath(path) + except OSError: + return path + if len(np) < len(str(path)): + path = np + return path + + def repr_traceback(self, excinfo): + traceback = excinfo.traceback + if self.tbfilter: + traceback = traceback.filter() + recursionindex = None + if is_recursion_error(excinfo): + recursionindex = traceback.recursionindex() + last = traceback[-1] + entries = [] + extraline = None + for index, entry in enumerate(traceback): + einfo = (last == entry) and excinfo or None + reprentry = self.repr_traceback_entry(entry, einfo) + entries.append(reprentry) + if index == recursionindex: + extraline = "!!! Recursion detected (same locals & position)" + break + return ReprTraceback(entries, extraline, style=self.style) + + def repr_excinfo(self, excinfo): + reprtraceback = self.repr_traceback(excinfo) + reprcrash = excinfo._getreprcrash() + return ReprExceptionInfo(reprtraceback, reprcrash) + +class TerminalRepr: + def __str__(self): + s = self.__unicode__() + if sys.version_info[0] < 3: + s = s.encode('utf-8') + return s + + def __unicode__(self): + # FYI this is called from pytest-xdist's serialization of exception + # information. + io = py.io.TextIO() + tw = py.io.TerminalWriter(file=io) + self.toterminal(tw) + return io.getvalue().strip() + + def __repr__(self): + return "<%s instance at %0x>" %(self.__class__, id(self)) + + +class ReprExceptionInfo(TerminalRepr): + def __init__(self, reprtraceback, reprcrash): + self.reprtraceback = reprtraceback + self.reprcrash = reprcrash + self.sections = [] + + def addsection(self, name, content, sep="-"): + self.sections.append((name, content, sep)) + + def toterminal(self, tw): + self.reprtraceback.toterminal(tw) + for name, content, sep in self.sections: + tw.sep(sep, name) + tw.line(content) + +class ReprTraceback(TerminalRepr): + entrysep = "_ " + + def __init__(self, reprentries, extraline, style): + self.reprentries = reprentries + self.extraline = extraline + self.style = style + + def toterminal(self, tw): + # the entries might have different styles + for i, entry in enumerate(self.reprentries): + if entry.style == "long": + tw.line("") + entry.toterminal(tw) + if i < len(self.reprentries) - 1: + next_entry = self.reprentries[i+1] + if entry.style == "long" or \ + entry.style == "short" and next_entry.style == "long": + tw.sep(self.entrysep) + + if self.extraline: + tw.line(self.extraline) + +class ReprTracebackNative(ReprTraceback): + def __init__(self, tblines): + self.style = "native" + self.reprentries = [ReprEntryNative(tblines)] + self.extraline = None + +class ReprEntryNative(TerminalRepr): + style = "native" + + def __init__(self, tblines): + self.lines = tblines + + def toterminal(self, tw): + tw.write("".join(self.lines)) + +class ReprEntry(TerminalRepr): + localssep = "_ " + + def __init__(self, lines, reprfuncargs, reprlocals, filelocrepr, style): + self.lines = lines + self.reprfuncargs = reprfuncargs + self.reprlocals = reprlocals + self.reprfileloc = filelocrepr + self.style = style + + def toterminal(self, tw): + if self.style == "short": + self.reprfileloc.toterminal(tw) + for line in self.lines: + red = line.startswith("E ") + tw.line(line, bold=True, red=red) + #tw.line("") + return + if self.reprfuncargs: + self.reprfuncargs.toterminal(tw) + for line in self.lines: + red = line.startswith("E ") + tw.line(line, bold=True, red=red) + if self.reprlocals: + #tw.sep(self.localssep, "Locals") + tw.line("") + self.reprlocals.toterminal(tw) + if self.reprfileloc: + if self.lines: + tw.line("") + self.reprfileloc.toterminal(tw) + + def __str__(self): + return "%s\n%s\n%s" % ("\n".join(self.lines), + self.reprlocals, + self.reprfileloc) + +class ReprFileLocation(TerminalRepr): + def __init__(self, path, lineno, message): + self.path = str(path) + self.lineno = lineno + self.message = message + + def toterminal(self, tw): + # filename and lineno output for each entry, + # using an output format that most editors unterstand + msg = self.message + i = msg.find("\n") + if i != -1: + msg = msg[:i] + tw.line("%s:%s: %s" %(self.path, self.lineno, msg)) + +class ReprLocals(TerminalRepr): + def __init__(self, lines): + self.lines = lines + + def toterminal(self, tw): + for line in self.lines: + tw.line(line) + +class ReprFuncArgs(TerminalRepr): + def __init__(self, args): + self.args = args + + def toterminal(self, tw): + if self.args: + linesofar = "" + for name, value in self.args: + ns = "%s = %s" %(name, value) + if len(ns) + len(linesofar) + 2 > tw.fullwidth: + if linesofar: + tw.line(linesofar) + linesofar = ns + else: + if linesofar: + linesofar += ", " + ns + else: + linesofar = ns + if linesofar: + tw.line(linesofar) + tw.line("") + + + +oldbuiltins = {} + +def patch_builtins(assertion=True, compile=True): + """ put compile and AssertionError builtins to Python's builtins. """ + if assertion: + from _pytest.assertion import reinterpret + l = oldbuiltins.setdefault('AssertionError', []) + l.append(py.builtin.builtins.AssertionError) + py.builtin.builtins.AssertionError = reinterpret.AssertionError + if compile: + import _pytest._code + l = oldbuiltins.setdefault('compile', []) + l.append(py.builtin.builtins.compile) + py.builtin.builtins.compile = _pytest._code.compile + +def unpatch_builtins(assertion=True, compile=True): + """ remove compile and AssertionError builtins from Python builtins. """ + if assertion: + py.builtin.builtins.AssertionError = oldbuiltins['AssertionError'].pop() + if compile: + py.builtin.builtins.compile = oldbuiltins['compile'].pop() + +def getrawcode(obj, trycall=True): + """ return code object for given function. """ + try: + return obj.__code__ + except AttributeError: + obj = getattr(obj, 'im_func', obj) + obj = getattr(obj, 'func_code', obj) + obj = getattr(obj, 'f_code', obj) + obj = getattr(obj, '__code__', obj) + if trycall and not hasattr(obj, 'co_firstlineno'): + if hasattr(obj, '__call__') and not py.std.inspect.isclass(obj): + x = getrawcode(obj.__call__, trycall=False) + if hasattr(x, 'co_firstlineno'): + return x + return obj + +if sys.version_info[:2] >= (3, 5): # RecursionError introduced in 3.5 + def is_recursion_error(excinfo): + return excinfo.errisinstance(RecursionError) # noqa +else: + def is_recursion_error(excinfo): + if not excinfo.errisinstance(RuntimeError): + return False + try: + return "maximum recursion depth exceeded" in str(excinfo.value) + except UnicodeError: + return False diff --git a/python/pytest/_pytest/_code/source.py b/python/pytest/_pytest/_code/source.py new file mode 100644 index 0000000000..a1521f8a21 --- /dev/null +++ b/python/pytest/_pytest/_code/source.py @@ -0,0 +1,421 @@ +from __future__ import generators + +from bisect import bisect_right +import sys +import inspect, tokenize +import py +from types import ModuleType +cpy_compile = compile + +try: + import _ast + from _ast import PyCF_ONLY_AST as _AST_FLAG +except ImportError: + _AST_FLAG = 0 + _ast = None + + +class Source(object): + """ a immutable object holding a source code fragment, + possibly deindenting it. + """ + _compilecounter = 0 + def __init__(self, *parts, **kwargs): + self.lines = lines = [] + de = kwargs.get('deindent', True) + rstrip = kwargs.get('rstrip', True) + for part in parts: + if not part: + partlines = [] + if isinstance(part, Source): + partlines = part.lines + elif isinstance(part, (tuple, list)): + partlines = [x.rstrip("\n") for x in part] + elif isinstance(part, py.builtin._basestring): + partlines = part.split('\n') + if rstrip: + while partlines: + if partlines[-1].strip(): + break + partlines.pop() + else: + partlines = getsource(part, deindent=de).lines + if de: + partlines = deindent(partlines) + lines.extend(partlines) + + def __eq__(self, other): + try: + return self.lines == other.lines + except AttributeError: + if isinstance(other, str): + return str(self) == other + return False + + def __getitem__(self, key): + if isinstance(key, int): + return self.lines[key] + else: + if key.step not in (None, 1): + raise IndexError("cannot slice a Source with a step") + return self.__getslice__(key.start, key.stop) + + def __len__(self): + return len(self.lines) + + def __getslice__(self, start, end): + newsource = Source() + newsource.lines = self.lines[start:end] + return newsource + + def strip(self): + """ return new source object with trailing + and leading blank lines removed. + """ + start, end = 0, len(self) + while start < end and not self.lines[start].strip(): + start += 1 + while end > start and not self.lines[end-1].strip(): + end -= 1 + source = Source() + source.lines[:] = self.lines[start:end] + return source + + def putaround(self, before='', after='', indent=' ' * 4): + """ return a copy of the source object with + 'before' and 'after' wrapped around it. + """ + before = Source(before) + after = Source(after) + newsource = Source() + lines = [ (indent + line) for line in self.lines] + newsource.lines = before.lines + lines + after.lines + return newsource + + def indent(self, indent=' ' * 4): + """ return a copy of the source object with + all lines indented by the given indent-string. + """ + newsource = Source() + newsource.lines = [(indent+line) for line in self.lines] + return newsource + + def getstatement(self, lineno, assertion=False): + """ return Source statement which contains the + given linenumber (counted from 0). + """ + start, end = self.getstatementrange(lineno, assertion) + return self[start:end] + + def getstatementrange(self, lineno, assertion=False): + """ return (start, end) tuple which spans the minimal + statement region which containing the given lineno. + """ + if not (0 <= lineno < len(self)): + raise IndexError("lineno out of range") + ast, start, end = getstatementrange_ast(lineno, self) + return start, end + + def deindent(self, offset=None): + """ return a new source object deindented by offset. + If offset is None then guess an indentation offset from + the first non-blank line. Subsequent lines which have a + lower indentation offset will be copied verbatim as + they are assumed to be part of multilines. + """ + # XXX maybe use the tokenizer to properly handle multiline + # strings etc.pp? + newsource = Source() + newsource.lines[:] = deindent(self.lines, offset) + return newsource + + def isparseable(self, deindent=True): + """ return True if source is parseable, heuristically + deindenting it by default. + """ + try: + import parser + except ImportError: + syntax_checker = lambda x: compile(x, 'asd', 'exec') + else: + syntax_checker = parser.suite + + if deindent: + source = str(self.deindent()) + else: + source = str(self) + try: + #compile(source+'\n', "x", "exec") + syntax_checker(source+'\n') + except KeyboardInterrupt: + raise + except Exception: + return False + else: + return True + + def __str__(self): + return "\n".join(self.lines) + + def compile(self, filename=None, mode='exec', + flag=generators.compiler_flag, + dont_inherit=0, _genframe=None): + """ return compiled code object. if filename is None + invent an artificial filename which displays + the source/line position of the caller frame. + """ + if not filename or py.path.local(filename).check(file=0): + if _genframe is None: + _genframe = sys._getframe(1) # the caller + fn,lineno = _genframe.f_code.co_filename, _genframe.f_lineno + base = "<%d-codegen " % self._compilecounter + self.__class__._compilecounter += 1 + if not filename: + filename = base + '%s:%d>' % (fn, lineno) + else: + filename = base + '%r %s:%d>' % (filename, fn, lineno) + source = "\n".join(self.lines) + '\n' + try: + co = cpy_compile(source, filename, mode, flag) + except SyntaxError: + ex = sys.exc_info()[1] + # re-represent syntax errors from parsing python strings + msglines = self.lines[:ex.lineno] + if ex.offset: + msglines.append(" "*ex.offset + '^') + msglines.append("(code was compiled probably from here: %s)" % filename) + newex = SyntaxError('\n'.join(msglines)) + newex.offset = ex.offset + newex.lineno = ex.lineno + newex.text = ex.text + raise newex + else: + if flag & _AST_FLAG: + return co + lines = [(x + "\n") for x in self.lines] + if sys.version_info[0] >= 3: + # XXX py3's inspect.getsourcefile() checks for a module + # and a pep302 __loader__ ... we don't have a module + # at code compile-time so we need to fake it here + m = ModuleType("_pycodecompile_pseudo_module") + py.std.inspect.modulesbyfile[filename] = None + py.std.sys.modules[None] = m + m.__loader__ = 1 + py.std.linecache.cache[filename] = (1, None, lines, filename) + return co + +# +# public API shortcut functions +# + +def compile_(source, filename=None, mode='exec', flags= + generators.compiler_flag, dont_inherit=0): + """ compile the given source to a raw code object, + and maintain an internal cache which allows later + retrieval of the source code for the code object + and any recursively created code objects. + """ + if _ast is not None and isinstance(source, _ast.AST): + # XXX should Source support having AST? + return cpy_compile(source, filename, mode, flags, dont_inherit) + _genframe = sys._getframe(1) # the caller + s = Source(source) + co = s.compile(filename, mode, flags, _genframe=_genframe) + return co + + +def getfslineno(obj): + """ Return source location (path, lineno) for the given object. + If the source cannot be determined return ("", -1) + """ + import _pytest._code + try: + code = _pytest._code.Code(obj) + except TypeError: + try: + fn = (py.std.inspect.getsourcefile(obj) or + py.std.inspect.getfile(obj)) + except TypeError: + return "", -1 + + fspath = fn and py.path.local(fn) or None + lineno = -1 + if fspath: + try: + _, lineno = findsource(obj) + except IOError: + pass + else: + fspath = code.path + lineno = code.firstlineno + assert isinstance(lineno, int) + return fspath, lineno + +# +# helper functions +# + +def findsource(obj): + try: + sourcelines, lineno = py.std.inspect.findsource(obj) + except py.builtin._sysex: + raise + except: + return None, -1 + source = Source() + source.lines = [line.rstrip() for line in sourcelines] + return source, lineno + +def getsource(obj, **kwargs): + import _pytest._code + obj = _pytest._code.getrawcode(obj) + try: + strsrc = inspect.getsource(obj) + except IndentationError: + strsrc = "\"Buggy python version consider upgrading, cannot get source\"" + assert isinstance(strsrc, str) + return Source(strsrc, **kwargs) + +def deindent(lines, offset=None): + if offset is None: + for line in lines: + line = line.expandtabs() + s = line.lstrip() + if s: + offset = len(line)-len(s) + break + else: + offset = 0 + if offset == 0: + return list(lines) + newlines = [] + def readline_generator(lines): + for line in lines: + yield line + '\n' + while True: + yield '' + + it = readline_generator(lines) + + try: + for _, _, (sline, _), (eline, _), _ in tokenize.generate_tokens(lambda: next(it)): + if sline > len(lines): + break # End of input reached + if sline > len(newlines): + line = lines[sline - 1].expandtabs() + if line.lstrip() and line[:offset].isspace(): + line = line[offset:] # Deindent + newlines.append(line) + + for i in range(sline, eline): + # Don't deindent continuing lines of + # multiline tokens (i.e. multiline strings) + newlines.append(lines[i]) + except (IndentationError, tokenize.TokenError): + pass + # Add any lines we didn't see. E.g. if an exception was raised. + newlines.extend(lines[len(newlines):]) + return newlines + + +def get_statement_startend2(lineno, node): + import ast + # flatten all statements and except handlers into one lineno-list + # AST's line numbers start indexing at 1 + l = [] + for x in ast.walk(node): + if isinstance(x, _ast.stmt) or isinstance(x, _ast.ExceptHandler): + l.append(x.lineno - 1) + for name in "finalbody", "orelse": + val = getattr(x, name, None) + if val: + # treat the finally/orelse part as its own statement + l.append(val[0].lineno - 1 - 1) + l.sort() + insert_index = bisect_right(l, lineno) + start = l[insert_index - 1] + if insert_index >= len(l): + end = None + else: + end = l[insert_index] + return start, end + + +def getstatementrange_ast(lineno, source, assertion=False, astnode=None): + if astnode is None: + content = str(source) + if sys.version_info < (2,7): + content += "\n" + try: + astnode = compile(content, "source", "exec", 1024) # 1024 for AST + except ValueError: + start, end = getstatementrange_old(lineno, source, assertion) + return None, start, end + start, end = get_statement_startend2(lineno, astnode) + # we need to correct the end: + # - ast-parsing strips comments + # - there might be empty lines + # - we might have lesser indented code blocks at the end + if end is None: + end = len(source.lines) + + if end > start + 1: + # make sure we don't span differently indented code blocks + # by using the BlockFinder helper used which inspect.getsource() uses itself + block_finder = inspect.BlockFinder() + # if we start with an indented line, put blockfinder to "started" mode + block_finder.started = source.lines[start][0].isspace() + it = ((x + "\n") for x in source.lines[start:end]) + try: + for tok in tokenize.generate_tokens(lambda: next(it)): + block_finder.tokeneater(*tok) + except (inspect.EndOfBlock, IndentationError): + end = block_finder.last + start + except Exception: + pass + + # the end might still point to a comment or empty line, correct it + while end: + line = source.lines[end - 1].lstrip() + if line.startswith("#") or not line: + end -= 1 + else: + break + return astnode, start, end + + +def getstatementrange_old(lineno, source, assertion=False): + """ return (start, end) tuple which spans the minimal + statement region which containing the given lineno. + raise an IndexError if no such statementrange can be found. + """ + # XXX this logic is only used on python2.4 and below + # 1. find the start of the statement + from codeop import compile_command + for start in range(lineno, -1, -1): + if assertion: + line = source.lines[start] + # the following lines are not fully tested, change with care + if 'super' in line and 'self' in line and '__init__' in line: + raise IndexError("likely a subclass") + if "assert" not in line and "raise" not in line: + continue + trylines = source.lines[start:lineno+1] + # quick hack to prepare parsing an indented line with + # compile_command() (which errors on "return" outside defs) + trylines.insert(0, 'def xxx():') + trysource = '\n '.join(trylines) + # ^ space here + try: + compile_command(trysource) + except (SyntaxError, OverflowError, ValueError): + continue + + # 2. find the end of the statement + for end in range(lineno+1, len(source)+1): + trysource = source[start:end] + if trysource.isparseable(): + return start, end + raise SyntaxError("no valid source range around line %d " % (lineno,)) + + diff --git a/python/pytest/_pytest/_pluggy.py b/python/pytest/_pytest/_pluggy.py new file mode 100644 index 0000000000..87d32cf8dd --- /dev/null +++ b/python/pytest/_pytest/_pluggy.py @@ -0,0 +1,11 @@ +""" +imports symbols from vendored "pluggy" if available, otherwise +falls back to importing "pluggy" from the default namespace. +""" + +try: + from _pytest.vendored_packages.pluggy import * # noqa + from _pytest.vendored_packages.pluggy import __version__ # noqa +except ImportError: + from pluggy import * # noqa + from pluggy import __version__ # noqa diff --git a/python/pytest/_pytest/assertion/__init__.py b/python/pytest/_pytest/assertion/__init__.py new file mode 100644 index 0000000000..6921deb2a6 --- /dev/null +++ b/python/pytest/_pytest/assertion/__init__.py @@ -0,0 +1,176 @@ +""" +support for presenting detailed information in failing assertions. +""" +import py +import os +import sys +from _pytest.monkeypatch import monkeypatch +from _pytest.assertion import util + + +def pytest_addoption(parser): + group = parser.getgroup("debugconfig") + group.addoption('--assert', + action="store", + dest="assertmode", + choices=("rewrite", "reinterp", "plain",), + default="rewrite", + metavar="MODE", + help="""control assertion debugging tools. 'plain' + performs no assertion debugging. 'reinterp' + reinterprets assert statements after they failed + to provide assertion expression information. + 'rewrite' (the default) rewrites assert + statements in test modules on import to + provide assert expression information. """) + group.addoption('--no-assert', + action="store_true", + default=False, + dest="noassert", + help="DEPRECATED equivalent to --assert=plain") + group.addoption('--nomagic', '--no-magic', + action="store_true", + default=False, + help="DEPRECATED equivalent to --assert=plain") + + +class AssertionState: + """State for the assertion plugin.""" + + def __init__(self, config, mode): + self.mode = mode + self.trace = config.trace.root.get("assertion") + + +def pytest_configure(config): + mode = config.getvalue("assertmode") + if config.getvalue("noassert") or config.getvalue("nomagic"): + mode = "plain" + if mode == "rewrite": + try: + import ast # noqa + except ImportError: + mode = "reinterp" + else: + # Both Jython and CPython 2.6.0 have AST bugs that make the + # assertion rewriting hook malfunction. + if (sys.platform.startswith('java') or + sys.version_info[:3] == (2, 6, 0)): + mode = "reinterp" + if mode != "plain": + _load_modules(mode) + m = monkeypatch() + config._cleanup.append(m.undo) + m.setattr(py.builtin.builtins, 'AssertionError', + reinterpret.AssertionError) # noqa + hook = None + if mode == "rewrite": + hook = rewrite.AssertionRewritingHook() # noqa + sys.meta_path.insert(0, hook) + warn_about_missing_assertion(mode) + config._assertstate = AssertionState(config, mode) + config._assertstate.hook = hook + config._assertstate.trace("configured with mode set to %r" % (mode,)) + def undo(): + hook = config._assertstate.hook + if hook is not None and hook in sys.meta_path: + sys.meta_path.remove(hook) + config.add_cleanup(undo) + + +def pytest_collection(session): + # this hook is only called when test modules are collected + # so for example not in the master process of pytest-xdist + # (which does not collect test modules) + hook = session.config._assertstate.hook + if hook is not None: + hook.set_session(session) + + +def _running_on_ci(): + """Check if we're currently running on a CI system.""" + env_vars = ['CI', 'BUILD_NUMBER'] + return any(var in os.environ for var in env_vars) + + +def pytest_runtest_setup(item): + """Setup the pytest_assertrepr_compare hook + + The newinterpret and rewrite modules will use util._reprcompare if + it exists to use custom reporting via the + pytest_assertrepr_compare hook. This sets up this custom + comparison for the test. + """ + def callbinrepr(op, left, right): + """Call the pytest_assertrepr_compare hook and prepare the result + + This uses the first result from the hook and then ensures the + following: + * Overly verbose explanations are dropped unless -vv was used or + running on a CI. + * Embedded newlines are escaped to help util.format_explanation() + later. + * If the rewrite mode is used embedded %-characters are replaced + to protect later % formatting. + + The result can be formatted by util.format_explanation() for + pretty printing. + """ + hook_result = item.ihook.pytest_assertrepr_compare( + config=item.config, op=op, left=left, right=right) + for new_expl in hook_result: + if new_expl: + if (sum(len(p) for p in new_expl[1:]) > 80*8 and + item.config.option.verbose < 2 and + not _running_on_ci()): + show_max = 10 + truncated_lines = len(new_expl) - show_max + new_expl[show_max:] = [py.builtin._totext( + 'Detailed information truncated (%d more lines)' + ', use "-vv" to show' % truncated_lines)] + new_expl = [line.replace("\n", "\\n") for line in new_expl] + res = py.builtin._totext("\n~").join(new_expl) + if item.config.getvalue("assertmode") == "rewrite": + res = res.replace("%", "%%") + return res + util._reprcompare = callbinrepr + + +def pytest_runtest_teardown(item): + util._reprcompare = None + + +def pytest_sessionfinish(session): + hook = session.config._assertstate.hook + if hook is not None: + hook.session = None + + +def _load_modules(mode): + """Lazily import assertion related code.""" + global rewrite, reinterpret + from _pytest.assertion import reinterpret # noqa + if mode == "rewrite": + from _pytest.assertion import rewrite # noqa + + +def warn_about_missing_assertion(mode): + try: + assert False + except AssertionError: + pass + else: + if mode == "rewrite": + specifically = ("assertions which are not in test modules " + "will be ignored") + else: + specifically = "failing tests may report as passing" + + sys.stderr.write("WARNING: " + specifically + + " because assert statements are not executed " + "by the underlying Python interpreter " + "(are you using python -O?)\n") + + +# Expose this plugin's implementation for the pytest_assertrepr_compare hook +pytest_assertrepr_compare = util.assertrepr_compare diff --git a/python/pytest/_pytest/assertion/reinterpret.py b/python/pytest/_pytest/assertion/reinterpret.py new file mode 100644 index 0000000000..f4262c3ace --- /dev/null +++ b/python/pytest/_pytest/assertion/reinterpret.py @@ -0,0 +1,407 @@ +""" +Find intermediate evalutation results in assert statements through builtin AST. +""" +import ast +import sys + +import _pytest._code +import py +from _pytest.assertion import util +u = py.builtin._totext + + +class AssertionError(util.BuiltinAssertionError): + def __init__(self, *args): + util.BuiltinAssertionError.__init__(self, *args) + if args: + # on Python2.6 we get len(args)==2 for: assert 0, (x,y) + # on Python2.7 and above we always get len(args) == 1 + # with args[0] being the (x,y) tuple. + if len(args) > 1: + toprint = args + else: + toprint = args[0] + try: + self.msg = u(toprint) + except Exception: + self.msg = u( + "<[broken __repr__] %s at %0xd>" + % (toprint.__class__, id(toprint))) + else: + f = _pytest._code.Frame(sys._getframe(1)) + try: + source = f.code.fullsource + if source is not None: + try: + source = source.getstatement(f.lineno, assertion=True) + except IndexError: + source = None + else: + source = str(source.deindent()).strip() + except py.error.ENOENT: + source = None + # this can also occur during reinterpretation, when the + # co_filename is set to "<run>". + if source: + self.msg = reinterpret(source, f, should_fail=True) + else: + self.msg = "<could not determine information>" + if not self.args: + self.args = (self.msg,) + +if sys.version_info > (3, 0): + AssertionError.__module__ = "builtins" + +if sys.platform.startswith("java"): + # See http://bugs.jython.org/issue1497 + _exprs = ("BoolOp", "BinOp", "UnaryOp", "Lambda", "IfExp", "Dict", + "ListComp", "GeneratorExp", "Yield", "Compare", "Call", + "Repr", "Num", "Str", "Attribute", "Subscript", "Name", + "List", "Tuple") + _stmts = ("FunctionDef", "ClassDef", "Return", "Delete", "Assign", + "AugAssign", "Print", "For", "While", "If", "With", "Raise", + "TryExcept", "TryFinally", "Assert", "Import", "ImportFrom", + "Exec", "Global", "Expr", "Pass", "Break", "Continue") + _expr_nodes = set(getattr(ast, name) for name in _exprs) + _stmt_nodes = set(getattr(ast, name) for name in _stmts) + def _is_ast_expr(node): + return node.__class__ in _expr_nodes + def _is_ast_stmt(node): + return node.__class__ in _stmt_nodes +else: + def _is_ast_expr(node): + return isinstance(node, ast.expr) + def _is_ast_stmt(node): + return isinstance(node, ast.stmt) + +try: + _Starred = ast.Starred +except AttributeError: + # Python 2. Define a dummy class so isinstance() will always be False. + class _Starred(object): pass + + +class Failure(Exception): + """Error found while interpreting AST.""" + + def __init__(self, explanation=""): + self.cause = sys.exc_info() + self.explanation = explanation + + +def reinterpret(source, frame, should_fail=False): + mod = ast.parse(source) + visitor = DebugInterpreter(frame) + try: + visitor.visit(mod) + except Failure: + failure = sys.exc_info()[1] + return getfailure(failure) + if should_fail: + return ("(assertion failed, but when it was re-run for " + "printing intermediate values, it did not fail. Suggestions: " + "compute assert expression before the assert or use --assert=plain)") + +def run(offending_line, frame=None): + if frame is None: + frame = _pytest._code.Frame(sys._getframe(1)) + return reinterpret(offending_line, frame) + +def getfailure(e): + explanation = util.format_explanation(e.explanation) + value = e.cause[1] + if str(value): + lines = explanation.split('\n') + lines[0] += " << %s" % (value,) + explanation = '\n'.join(lines) + text = "%s: %s" % (e.cause[0].__name__, explanation) + if text.startswith('AssertionError: assert '): + text = text[16:] + return text + +operator_map = { + ast.BitOr : "|", + ast.BitXor : "^", + ast.BitAnd : "&", + ast.LShift : "<<", + ast.RShift : ">>", + ast.Add : "+", + ast.Sub : "-", + ast.Mult : "*", + ast.Div : "/", + ast.FloorDiv : "//", + ast.Mod : "%", + ast.Eq : "==", + ast.NotEq : "!=", + ast.Lt : "<", + ast.LtE : "<=", + ast.Gt : ">", + ast.GtE : ">=", + ast.Pow : "**", + ast.Is : "is", + ast.IsNot : "is not", + ast.In : "in", + ast.NotIn : "not in" +} + +unary_map = { + ast.Not : "not %s", + ast.Invert : "~%s", + ast.USub : "-%s", + ast.UAdd : "+%s" +} + + +class DebugInterpreter(ast.NodeVisitor): + """Interpret AST nodes to gleam useful debugging information. """ + + def __init__(self, frame): + self.frame = frame + + def generic_visit(self, node): + # Fallback when we don't have a special implementation. + if _is_ast_expr(node): + mod = ast.Expression(node) + co = self._compile(mod) + try: + result = self.frame.eval(co) + except Exception: + raise Failure() + explanation = self.frame.repr(result) + return explanation, result + elif _is_ast_stmt(node): + mod = ast.Module([node]) + co = self._compile(mod, "exec") + try: + self.frame.exec_(co) + except Exception: + raise Failure() + return None, None + else: + raise AssertionError("can't handle %s" %(node,)) + + def _compile(self, source, mode="eval"): + return compile(source, "<assertion interpretation>", mode) + + def visit_Expr(self, expr): + return self.visit(expr.value) + + def visit_Module(self, mod): + for stmt in mod.body: + self.visit(stmt) + + def visit_Name(self, name): + explanation, result = self.generic_visit(name) + # See if the name is local. + source = "%r in locals() is not globals()" % (name.id,) + co = self._compile(source) + try: + local = self.frame.eval(co) + except Exception: + # have to assume it isn't + local = None + if local is None or not self.frame.is_true(local): + return name.id, result + return explanation, result + + def visit_Compare(self, comp): + left = comp.left + left_explanation, left_result = self.visit(left) + for op, next_op in zip(comp.ops, comp.comparators): + next_explanation, next_result = self.visit(next_op) + op_symbol = operator_map[op.__class__] + explanation = "%s %s %s" % (left_explanation, op_symbol, + next_explanation) + source = "__exprinfo_left %s __exprinfo_right" % (op_symbol,) + co = self._compile(source) + try: + result = self.frame.eval(co, __exprinfo_left=left_result, + __exprinfo_right=next_result) + except Exception: + raise Failure(explanation) + try: + if not self.frame.is_true(result): + break + except KeyboardInterrupt: + raise + except: + break + left_explanation, left_result = next_explanation, next_result + + if util._reprcompare is not None: + res = util._reprcompare(op_symbol, left_result, next_result) + if res: + explanation = res + return explanation, result + + def visit_BoolOp(self, boolop): + is_or = isinstance(boolop.op, ast.Or) + explanations = [] + for operand in boolop.values: + explanation, result = self.visit(operand) + explanations.append(explanation) + if result == is_or: + break + name = is_or and " or " or " and " + explanation = "(" + name.join(explanations) + ")" + return explanation, result + + def visit_UnaryOp(self, unary): + pattern = unary_map[unary.op.__class__] + operand_explanation, operand_result = self.visit(unary.operand) + explanation = pattern % (operand_explanation,) + co = self._compile(pattern % ("__exprinfo_expr",)) + try: + result = self.frame.eval(co, __exprinfo_expr=operand_result) + except Exception: + raise Failure(explanation) + return explanation, result + + def visit_BinOp(self, binop): + left_explanation, left_result = self.visit(binop.left) + right_explanation, right_result = self.visit(binop.right) + symbol = operator_map[binop.op.__class__] + explanation = "(%s %s %s)" % (left_explanation, symbol, + right_explanation) + source = "__exprinfo_left %s __exprinfo_right" % (symbol,) + co = self._compile(source) + try: + result = self.frame.eval(co, __exprinfo_left=left_result, + __exprinfo_right=right_result) + except Exception: + raise Failure(explanation) + return explanation, result + + def visit_Call(self, call): + func_explanation, func = self.visit(call.func) + arg_explanations = [] + ns = {"__exprinfo_func" : func} + arguments = [] + for arg in call.args: + arg_explanation, arg_result = self.visit(arg) + if isinstance(arg, _Starred): + arg_name = "__exprinfo_star" + ns[arg_name] = arg_result + arguments.append("*%s" % (arg_name,)) + arg_explanations.append("*%s" % (arg_explanation,)) + else: + arg_name = "__exprinfo_%s" % (len(ns),) + ns[arg_name] = arg_result + arguments.append(arg_name) + arg_explanations.append(arg_explanation) + for keyword in call.keywords: + arg_explanation, arg_result = self.visit(keyword.value) + if keyword.arg: + arg_name = "__exprinfo_%s" % (len(ns),) + keyword_source = "%s=%%s" % (keyword.arg) + arguments.append(keyword_source % (arg_name,)) + arg_explanations.append(keyword_source % (arg_explanation,)) + else: + arg_name = "__exprinfo_kwds" + arguments.append("**%s" % (arg_name,)) + arg_explanations.append("**%s" % (arg_explanation,)) + + ns[arg_name] = arg_result + + if getattr(call, 'starargs', None): + arg_explanation, arg_result = self.visit(call.starargs) + arg_name = "__exprinfo_star" + ns[arg_name] = arg_result + arguments.append("*%s" % (arg_name,)) + arg_explanations.append("*%s" % (arg_explanation,)) + + if getattr(call, 'kwargs', None): + arg_explanation, arg_result = self.visit(call.kwargs) + arg_name = "__exprinfo_kwds" + ns[arg_name] = arg_result + arguments.append("**%s" % (arg_name,)) + arg_explanations.append("**%s" % (arg_explanation,)) + args_explained = ", ".join(arg_explanations) + explanation = "%s(%s)" % (func_explanation, args_explained) + args = ", ".join(arguments) + source = "__exprinfo_func(%s)" % (args,) + co = self._compile(source) + try: + result = self.frame.eval(co, **ns) + except Exception: + raise Failure(explanation) + pattern = "%s\n{%s = %s\n}" + rep = self.frame.repr(result) + explanation = pattern % (rep, rep, explanation) + return explanation, result + + def _is_builtin_name(self, name): + pattern = "%r not in globals() and %r not in locals()" + source = pattern % (name.id, name.id) + co = self._compile(source) + try: + return self.frame.eval(co) + except Exception: + return False + + def visit_Attribute(self, attr): + if not isinstance(attr.ctx, ast.Load): + return self.generic_visit(attr) + source_explanation, source_result = self.visit(attr.value) + explanation = "%s.%s" % (source_explanation, attr.attr) + source = "__exprinfo_expr.%s" % (attr.attr,) + co = self._compile(source) + try: + try: + result = self.frame.eval(co, __exprinfo_expr=source_result) + except AttributeError: + # Maybe the attribute name needs to be mangled? + if not attr.attr.startswith("__") or attr.attr.endswith("__"): + raise + source = "getattr(__exprinfo_expr.__class__, '__name__', '')" + co = self._compile(source) + class_name = self.frame.eval(co, __exprinfo_expr=source_result) + mangled_attr = "_" + class_name + attr.attr + source = "__exprinfo_expr.%s" % (mangled_attr,) + co = self._compile(source) + result = self.frame.eval(co, __exprinfo_expr=source_result) + except Exception: + raise Failure(explanation) + explanation = "%s\n{%s = %s.%s\n}" % (self.frame.repr(result), + self.frame.repr(result), + source_explanation, attr.attr) + # Check if the attr is from an instance. + source = "%r in getattr(__exprinfo_expr, '__dict__', {})" + source = source % (attr.attr,) + co = self._compile(source) + try: + from_instance = self.frame.eval(co, __exprinfo_expr=source_result) + except Exception: + from_instance = None + if from_instance is None or self.frame.is_true(from_instance): + rep = self.frame.repr(result) + pattern = "%s\n{%s = %s\n}" + explanation = pattern % (rep, rep, explanation) + return explanation, result + + def visit_Assert(self, assrt): + test_explanation, test_result = self.visit(assrt.test) + explanation = "assert %s" % (test_explanation,) + if not self.frame.is_true(test_result): + try: + raise util.BuiltinAssertionError + except Exception: + raise Failure(explanation) + return explanation, test_result + + def visit_Assign(self, assign): + value_explanation, value_result = self.visit(assign.value) + explanation = "... = %s" % (value_explanation,) + name = ast.Name("__exprinfo_expr", ast.Load(), + lineno=assign.value.lineno, + col_offset=assign.value.col_offset) + new_assign = ast.Assign(assign.targets, name, lineno=assign.lineno, + col_offset=assign.col_offset) + mod = ast.Module([new_assign]) + co = self._compile(mod, "exec") + try: + self.frame.exec_(co, __exprinfo_expr=value_result) + except Exception: + raise Failure(explanation) + return explanation, value_result + diff --git a/python/pytest/_pytest/assertion/rewrite.py b/python/pytest/_pytest/assertion/rewrite.py new file mode 100644 index 0000000000..14b8e49db2 --- /dev/null +++ b/python/pytest/_pytest/assertion/rewrite.py @@ -0,0 +1,885 @@ +"""Rewrite assertion AST to produce nice error messages""" + +import ast +import errno +import itertools +import imp +import marshal +import os +import re +import struct +import sys +import types + +import py +from _pytest.assertion import util + + +# pytest caches rewritten pycs in __pycache__. +if hasattr(imp, "get_tag"): + PYTEST_TAG = imp.get_tag() + "-PYTEST" +else: + if hasattr(sys, "pypy_version_info"): + impl = "pypy" + elif sys.platform == "java": + impl = "jython" + else: + impl = "cpython" + ver = sys.version_info + PYTEST_TAG = "%s-%s%s-PYTEST" % (impl, ver[0], ver[1]) + del ver, impl + +PYC_EXT = ".py" + (__debug__ and "c" or "o") +PYC_TAIL = "." + PYTEST_TAG + PYC_EXT + +REWRITE_NEWLINES = sys.version_info[:2] != (2, 7) and sys.version_info < (3, 2) +ASCII_IS_DEFAULT_ENCODING = sys.version_info[0] < 3 + +if sys.version_info >= (3,5): + ast_Call = ast.Call +else: + ast_Call = lambda a,b,c: ast.Call(a, b, c, None, None) + + +class AssertionRewritingHook(object): + """PEP302 Import hook which rewrites asserts.""" + + def __init__(self): + self.session = None + self.modules = {} + self._register_with_pkg_resources() + + def set_session(self, session): + self.fnpats = session.config.getini("python_files") + self.session = session + + def find_module(self, name, path=None): + if self.session is None: + return None + sess = self.session + state = sess.config._assertstate + state.trace("find_module called for: %s" % name) + names = name.rsplit(".", 1) + lastname = names[-1] + pth = None + if path is not None: + # Starting with Python 3.3, path is a _NamespacePath(), which + # causes problems if not converted to list. + path = list(path) + if len(path) == 1: + pth = path[0] + if pth is None: + try: + fd, fn, desc = imp.find_module(lastname, path) + except ImportError: + return None + if fd is not None: + fd.close() + tp = desc[2] + if tp == imp.PY_COMPILED: + if hasattr(imp, "source_from_cache"): + fn = imp.source_from_cache(fn) + else: + fn = fn[:-1] + elif tp != imp.PY_SOURCE: + # Don't know what this is. + return None + else: + fn = os.path.join(pth, name.rpartition(".")[2] + ".py") + fn_pypath = py.path.local(fn) + # Is this a test file? + if not sess.isinitpath(fn): + # We have to be very careful here because imports in this code can + # trigger a cycle. + self.session = None + try: + for pat in self.fnpats: + if fn_pypath.fnmatch(pat): + state.trace("matched test file %r" % (fn,)) + break + else: + return None + finally: + self.session = sess + else: + state.trace("matched test file (was specified on cmdline): %r" % + (fn,)) + # The requested module looks like a test file, so rewrite it. This is + # the most magical part of the process: load the source, rewrite the + # asserts, and load the rewritten source. We also cache the rewritten + # module code in a special pyc. We must be aware of the possibility of + # concurrent pytest processes rewriting and loading pycs. To avoid + # tricky race conditions, we maintain the following invariant: The + # cached pyc is always a complete, valid pyc. Operations on it must be + # atomic. POSIX's atomic rename comes in handy. + write = not sys.dont_write_bytecode + cache_dir = os.path.join(fn_pypath.dirname, "__pycache__") + if write: + try: + os.mkdir(cache_dir) + except OSError: + e = sys.exc_info()[1].errno + if e == errno.EEXIST: + # Either the __pycache__ directory already exists (the + # common case) or it's blocked by a non-dir node. In the + # latter case, we'll ignore it in _write_pyc. + pass + elif e in [errno.ENOENT, errno.ENOTDIR]: + # One of the path components was not a directory, likely + # because we're in a zip file. + write = False + elif e in [errno.EACCES, errno.EROFS, errno.EPERM]: + state.trace("read only directory: %r" % fn_pypath.dirname) + write = False + else: + raise + cache_name = fn_pypath.basename[:-3] + PYC_TAIL + pyc = os.path.join(cache_dir, cache_name) + # Notice that even if we're in a read-only directory, I'm going + # to check for a cached pyc. This may not be optimal... + co = _read_pyc(fn_pypath, pyc, state.trace) + if co is None: + state.trace("rewriting %r" % (fn,)) + source_stat, co = _rewrite_test(state, fn_pypath) + if co is None: + # Probably a SyntaxError in the test. + return None + if write: + _make_rewritten_pyc(state, source_stat, pyc, co) + else: + state.trace("found cached rewritten pyc for %r" % (fn,)) + self.modules[name] = co, pyc + return self + + def load_module(self, name): + # If there is an existing module object named 'fullname' in + # sys.modules, the loader must use that existing module. (Otherwise, + # the reload() builtin will not work correctly.) + if name in sys.modules: + return sys.modules[name] + + co, pyc = self.modules.pop(name) + # I wish I could just call imp.load_compiled here, but __file__ has to + # be set properly. In Python 3.2+, this all would be handled correctly + # by load_compiled. + mod = sys.modules[name] = imp.new_module(name) + try: + mod.__file__ = co.co_filename + # Normally, this attribute is 3.2+. + mod.__cached__ = pyc + mod.__loader__ = self + py.builtin.exec_(co, mod.__dict__) + except: + del sys.modules[name] + raise + return sys.modules[name] + + + + def is_package(self, name): + try: + fd, fn, desc = imp.find_module(name) + except ImportError: + return False + if fd is not None: + fd.close() + tp = desc[2] + return tp == imp.PKG_DIRECTORY + + @classmethod + def _register_with_pkg_resources(cls): + """ + Ensure package resources can be loaded from this loader. May be called + multiple times, as the operation is idempotent. + """ + try: + import pkg_resources + # access an attribute in case a deferred importer is present + pkg_resources.__name__ + except ImportError: + return + + # Since pytest tests are always located in the file system, the + # DefaultProvider is appropriate. + pkg_resources.register_loader_type(cls, pkg_resources.DefaultProvider) + + def get_data(self, pathname): + """Optional PEP302 get_data API. + """ + with open(pathname, 'rb') as f: + return f.read() + + +def _write_pyc(state, co, source_stat, pyc): + # Technically, we don't have to have the same pyc format as + # (C)Python, since these "pycs" should never be seen by builtin + # import. However, there's little reason deviate, and I hope + # sometime to be able to use imp.load_compiled to load them. (See + # the comment in load_module above.) + try: + fp = open(pyc, "wb") + except IOError: + err = sys.exc_info()[1].errno + state.trace("error writing pyc file at %s: errno=%s" %(pyc, err)) + # we ignore any failure to write the cache file + # there are many reasons, permission-denied, __pycache__ being a + # file etc. + return False + try: + fp.write(imp.get_magic()) + mtime = int(source_stat.mtime) + size = source_stat.size & 0xFFFFFFFF + fp.write(struct.pack("<ll", mtime, size)) + marshal.dump(co, fp) + finally: + fp.close() + return True + +RN = "\r\n".encode("utf-8") +N = "\n".encode("utf-8") + +cookie_re = re.compile(r"^[ \t\f]*#.*coding[:=][ \t]*[-\w.]+") +BOM_UTF8 = '\xef\xbb\xbf' + +def _rewrite_test(state, fn): + """Try to read and rewrite *fn* and return the code object.""" + try: + stat = fn.stat() + source = fn.read("rb") + except EnvironmentError: + return None, None + if ASCII_IS_DEFAULT_ENCODING: + # ASCII is the default encoding in Python 2. Without a coding + # declaration, Python 2 will complain about any bytes in the file + # outside the ASCII range. Sadly, this behavior does not extend to + # compile() or ast.parse(), which prefer to interpret the bytes as + # latin-1. (At least they properly handle explicit coding cookies.) To + # preserve this error behavior, we could force ast.parse() to use ASCII + # as the encoding by inserting a coding cookie. Unfortunately, that + # messes up line numbers. Thus, we have to check ourselves if anything + # is outside the ASCII range in the case no encoding is explicitly + # declared. For more context, see issue #269. Yay for Python 3 which + # gets this right. + end1 = source.find("\n") + end2 = source.find("\n", end1 + 1) + if (not source.startswith(BOM_UTF8) and + cookie_re.match(source[0:end1]) is None and + cookie_re.match(source[end1 + 1:end2]) is None): + if hasattr(state, "_indecode"): + # encodings imported us again, so don't rewrite. + return None, None + state._indecode = True + try: + try: + source.decode("ascii") + except UnicodeDecodeError: + # Let it fail in real import. + return None, None + finally: + del state._indecode + # On Python versions which are not 2.7 and less than or equal to 3.1, the + # parser expects *nix newlines. + if REWRITE_NEWLINES: + source = source.replace(RN, N) + N + try: + tree = ast.parse(source) + except SyntaxError: + # Let this pop up again in the real import. + state.trace("failed to parse: %r" % (fn,)) + return None, None + rewrite_asserts(tree) + try: + co = compile(tree, fn.strpath, "exec") + except SyntaxError: + # It's possible that this error is from some bug in the + # assertion rewriting, but I don't know of a fast way to tell. + state.trace("failed to compile: %r" % (fn,)) + return None, None + return stat, co + +def _make_rewritten_pyc(state, source_stat, pyc, co): + """Try to dump rewritten code to *pyc*.""" + if sys.platform.startswith("win"): + # Windows grants exclusive access to open files and doesn't have atomic + # rename, so just write into the final file. + _write_pyc(state, co, source_stat, pyc) + else: + # When not on windows, assume rename is atomic. Dump the code object + # into a file specific to this process and atomically replace it. + proc_pyc = pyc + "." + str(os.getpid()) + if _write_pyc(state, co, source_stat, proc_pyc): + os.rename(proc_pyc, pyc) + +def _read_pyc(source, pyc, trace=lambda x: None): + """Possibly read a pytest pyc containing rewritten code. + + Return rewritten code if successful or None if not. + """ + try: + fp = open(pyc, "rb") + except IOError: + return None + with fp: + try: + mtime = int(source.mtime()) + size = source.size() + data = fp.read(12) + except EnvironmentError as e: + trace('_read_pyc(%s): EnvironmentError %s' % (source, e)) + return None + # Check for invalid or out of date pyc file. + if (len(data) != 12 or data[:4] != imp.get_magic() or + struct.unpack("<ll", data[4:]) != (mtime, size)): + trace('_read_pyc(%s): invalid or out of date pyc' % source) + return None + try: + co = marshal.load(fp) + except Exception as e: + trace('_read_pyc(%s): marshal.load error %s' % (source, e)) + return None + if not isinstance(co, types.CodeType): + trace('_read_pyc(%s): not a code object' % source) + return None + return co + + +def rewrite_asserts(mod): + """Rewrite the assert statements in mod.""" + AssertionRewriter().run(mod) + + +def _saferepr(obj): + """Get a safe repr of an object for assertion error messages. + + The assertion formatting (util.format_explanation()) requires + newlines to be escaped since they are a special character for it. + Normally assertion.util.format_explanation() does this but for a + custom repr it is possible to contain one of the special escape + sequences, especially '\n{' and '\n}' are likely to be present in + JSON reprs. + + """ + repr = py.io.saferepr(obj) + if py.builtin._istext(repr): + t = py.builtin.text + else: + t = py.builtin.bytes + return repr.replace(t("\n"), t("\\n")) + + +from _pytest.assertion.util import format_explanation as _format_explanation # noqa + +def _format_assertmsg(obj): + """Format the custom assertion message given. + + For strings this simply replaces newlines with '\n~' so that + util.format_explanation() will preserve them instead of escaping + newlines. For other objects py.io.saferepr() is used first. + + """ + # reprlib appears to have a bug which means that if a string + # contains a newline it gets escaped, however if an object has a + # .__repr__() which contains newlines it does not get escaped. + # However in either case we want to preserve the newline. + if py.builtin._istext(obj) or py.builtin._isbytes(obj): + s = obj + is_repr = False + else: + s = py.io.saferepr(obj) + is_repr = True + if py.builtin._istext(s): + t = py.builtin.text + else: + t = py.builtin.bytes + s = s.replace(t("\n"), t("\n~")).replace(t("%"), t("%%")) + if is_repr: + s = s.replace(t("\\n"), t("\n~")) + return s + +def _should_repr_global_name(obj): + return not hasattr(obj, "__name__") and not py.builtin.callable(obj) + +def _format_boolop(explanations, is_or): + explanation = "(" + (is_or and " or " or " and ").join(explanations) + ")" + if py.builtin._istext(explanation): + t = py.builtin.text + else: + t = py.builtin.bytes + return explanation.replace(t('%'), t('%%')) + +def _call_reprcompare(ops, results, expls, each_obj): + for i, res, expl in zip(range(len(ops)), results, expls): + try: + done = not res + except Exception: + done = True + if done: + break + if util._reprcompare is not None: + custom = util._reprcompare(ops[i], each_obj[i], each_obj[i + 1]) + if custom is not None: + return custom + return expl + + +unary_map = { + ast.Not: "not %s", + ast.Invert: "~%s", + ast.USub: "-%s", + ast.UAdd: "+%s" +} + +binop_map = { + ast.BitOr: "|", + ast.BitXor: "^", + ast.BitAnd: "&", + ast.LShift: "<<", + ast.RShift: ">>", + ast.Add: "+", + ast.Sub: "-", + ast.Mult: "*", + ast.Div: "/", + ast.FloorDiv: "//", + ast.Mod: "%%", # escaped for string formatting + ast.Eq: "==", + ast.NotEq: "!=", + ast.Lt: "<", + ast.LtE: "<=", + ast.Gt: ">", + ast.GtE: ">=", + ast.Pow: "**", + ast.Is: "is", + ast.IsNot: "is not", + ast.In: "in", + ast.NotIn: "not in" +} +# Python 3.5+ compatibility +try: + binop_map[ast.MatMult] = "@" +except AttributeError: + pass + +# Python 3.4+ compatibility +if hasattr(ast, "NameConstant"): + _NameConstant = ast.NameConstant +else: + def _NameConstant(c): + return ast.Name(str(c), ast.Load()) + + +def set_location(node, lineno, col_offset): + """Set node location information recursively.""" + def _fix(node, lineno, col_offset): + if "lineno" in node._attributes: + node.lineno = lineno + if "col_offset" in node._attributes: + node.col_offset = col_offset + for child in ast.iter_child_nodes(node): + _fix(child, lineno, col_offset) + _fix(node, lineno, col_offset) + return node + + +class AssertionRewriter(ast.NodeVisitor): + """Assertion rewriting implementation. + + The main entrypoint is to call .run() with an ast.Module instance, + this will then find all the assert statements and re-write them to + provide intermediate values and a detailed assertion error. See + http://pybites.blogspot.be/2011/07/behind-scenes-of-pytests-new-assertion.html + for an overview of how this works. + + The entry point here is .run() which will iterate over all the + statements in an ast.Module and for each ast.Assert statement it + finds call .visit() with it. Then .visit_Assert() takes over and + is responsible for creating new ast statements to replace the + original assert statement: it re-writes the test of an assertion + to provide intermediate values and replace it with an if statement + which raises an assertion error with a detailed explanation in + case the expression is false. + + For this .visit_Assert() uses the visitor pattern to visit all the + AST nodes of the ast.Assert.test field, each visit call returning + an AST node and the corresponding explanation string. During this + state is kept in several instance attributes: + + :statements: All the AST statements which will replace the assert + statement. + + :variables: This is populated by .variable() with each variable + used by the statements so that they can all be set to None at + the end of the statements. + + :variable_counter: Counter to create new unique variables needed + by statements. Variables are created using .variable() and + have the form of "@py_assert0". + + :on_failure: The AST statements which will be executed if the + assertion test fails. This is the code which will construct + the failure message and raises the AssertionError. + + :explanation_specifiers: A dict filled by .explanation_param() + with %-formatting placeholders and their corresponding + expressions to use in the building of an assertion message. + This is used by .pop_format_context() to build a message. + + :stack: A stack of the explanation_specifiers dicts maintained by + .push_format_context() and .pop_format_context() which allows + to build another %-formatted string while already building one. + + This state is reset on every new assert statement visited and used + by the other visitors. + + """ + + def run(self, mod): + """Find all assert statements in *mod* and rewrite them.""" + if not mod.body: + # Nothing to do. + return + # Insert some special imports at the top of the module but after any + # docstrings and __future__ imports. + aliases = [ast.alias(py.builtin.builtins.__name__, "@py_builtins"), + ast.alias("_pytest.assertion.rewrite", "@pytest_ar")] + expect_docstring = True + pos = 0 + lineno = 0 + for item in mod.body: + if (expect_docstring and isinstance(item, ast.Expr) and + isinstance(item.value, ast.Str)): + doc = item.value.s + if "PYTEST_DONT_REWRITE" in doc: + # The module has disabled assertion rewriting. + return + lineno += len(doc) - 1 + expect_docstring = False + elif (not isinstance(item, ast.ImportFrom) or item.level > 0 or + item.module != "__future__"): + lineno = item.lineno + break + pos += 1 + imports = [ast.Import([alias], lineno=lineno, col_offset=0) + for alias in aliases] + mod.body[pos:pos] = imports + # Collect asserts. + nodes = [mod] + while nodes: + node = nodes.pop() + for name, field in ast.iter_fields(node): + if isinstance(field, list): + new = [] + for i, child in enumerate(field): + if isinstance(child, ast.Assert): + # Transform assert. + new.extend(self.visit(child)) + else: + new.append(child) + if isinstance(child, ast.AST): + nodes.append(child) + setattr(node, name, new) + elif (isinstance(field, ast.AST) and + # Don't recurse into expressions as they can't contain + # asserts. + not isinstance(field, ast.expr)): + nodes.append(field) + + def variable(self): + """Get a new variable.""" + # Use a character invalid in python identifiers to avoid clashing. + name = "@py_assert" + str(next(self.variable_counter)) + self.variables.append(name) + return name + + def assign(self, expr): + """Give *expr* a name.""" + name = self.variable() + self.statements.append(ast.Assign([ast.Name(name, ast.Store())], expr)) + return ast.Name(name, ast.Load()) + + def display(self, expr): + """Call py.io.saferepr on the expression.""" + return self.helper("saferepr", expr) + + def helper(self, name, *args): + """Call a helper in this module.""" + py_name = ast.Name("@pytest_ar", ast.Load()) + attr = ast.Attribute(py_name, "_" + name, ast.Load()) + return ast_Call(attr, list(args), []) + + def builtin(self, name): + """Return the builtin called *name*.""" + builtin_name = ast.Name("@py_builtins", ast.Load()) + return ast.Attribute(builtin_name, name, ast.Load()) + + def explanation_param(self, expr): + """Return a new named %-formatting placeholder for expr. + + This creates a %-formatting placeholder for expr in the + current formatting context, e.g. ``%(py0)s``. The placeholder + and expr are placed in the current format context so that it + can be used on the next call to .pop_format_context(). + + """ + specifier = "py" + str(next(self.variable_counter)) + self.explanation_specifiers[specifier] = expr + return "%(" + specifier + ")s" + + def push_format_context(self): + """Create a new formatting context. + + The format context is used for when an explanation wants to + have a variable value formatted in the assertion message. In + this case the value required can be added using + .explanation_param(). Finally .pop_format_context() is used + to format a string of %-formatted values as added by + .explanation_param(). + + """ + self.explanation_specifiers = {} + self.stack.append(self.explanation_specifiers) + + def pop_format_context(self, expl_expr): + """Format the %-formatted string with current format context. + + The expl_expr should be an ast.Str instance constructed from + the %-placeholders created by .explanation_param(). This will + add the required code to format said string to .on_failure and + return the ast.Name instance of the formatted string. + + """ + current = self.stack.pop() + if self.stack: + self.explanation_specifiers = self.stack[-1] + keys = [ast.Str(key) for key in current.keys()] + format_dict = ast.Dict(keys, list(current.values())) + form = ast.BinOp(expl_expr, ast.Mod(), format_dict) + name = "@py_format" + str(next(self.variable_counter)) + self.on_failure.append(ast.Assign([ast.Name(name, ast.Store())], form)) + return ast.Name(name, ast.Load()) + + def generic_visit(self, node): + """Handle expressions we don't have custom code for.""" + assert isinstance(node, ast.expr) + res = self.assign(node) + return res, self.explanation_param(self.display(res)) + + def visit_Assert(self, assert_): + """Return the AST statements to replace the ast.Assert instance. + + This re-writes the test of an assertion to provide + intermediate values and replace it with an if statement which + raises an assertion error with a detailed explanation in case + the expression is false. + + """ + self.statements = [] + self.variables = [] + self.variable_counter = itertools.count() + self.stack = [] + self.on_failure = [] + self.push_format_context() + # Rewrite assert into a bunch of statements. + top_condition, explanation = self.visit(assert_.test) + # Create failure message. + body = self.on_failure + negation = ast.UnaryOp(ast.Not(), top_condition) + self.statements.append(ast.If(negation, body, [])) + if assert_.msg: + assertmsg = self.helper('format_assertmsg', assert_.msg) + explanation = "\n>assert " + explanation + else: + assertmsg = ast.Str("") + explanation = "assert " + explanation + template = ast.BinOp(assertmsg, ast.Add(), ast.Str(explanation)) + msg = self.pop_format_context(template) + fmt = self.helper("format_explanation", msg) + err_name = ast.Name("AssertionError", ast.Load()) + exc = ast_Call(err_name, [fmt], []) + if sys.version_info[0] >= 3: + raise_ = ast.Raise(exc, None) + else: + raise_ = ast.Raise(exc, None, None) + body.append(raise_) + # Clear temporary variables by setting them to None. + if self.variables: + variables = [ast.Name(name, ast.Store()) + for name in self.variables] + clear = ast.Assign(variables, _NameConstant(None)) + self.statements.append(clear) + # Fix line numbers. + for stmt in self.statements: + set_location(stmt, assert_.lineno, assert_.col_offset) + return self.statements + + def visit_Name(self, name): + # Display the repr of the name if it's a local variable or + # _should_repr_global_name() thinks it's acceptable. + locs = ast_Call(self.builtin("locals"), [], []) + inlocs = ast.Compare(ast.Str(name.id), [ast.In()], [locs]) + dorepr = self.helper("should_repr_global_name", name) + test = ast.BoolOp(ast.Or(), [inlocs, dorepr]) + expr = ast.IfExp(test, self.display(name), ast.Str(name.id)) + return name, self.explanation_param(expr) + + def visit_BoolOp(self, boolop): + res_var = self.variable() + expl_list = self.assign(ast.List([], ast.Load())) + app = ast.Attribute(expl_list, "append", ast.Load()) + is_or = int(isinstance(boolop.op, ast.Or)) + body = save = self.statements + fail_save = self.on_failure + levels = len(boolop.values) - 1 + self.push_format_context() + # Process each operand, short-circuting if needed. + for i, v in enumerate(boolop.values): + if i: + fail_inner = [] + # cond is set in a prior loop iteration below + self.on_failure.append(ast.If(cond, fail_inner, [])) # noqa + self.on_failure = fail_inner + self.push_format_context() + res, expl = self.visit(v) + body.append(ast.Assign([ast.Name(res_var, ast.Store())], res)) + expl_format = self.pop_format_context(ast.Str(expl)) + call = ast_Call(app, [expl_format], []) + self.on_failure.append(ast.Expr(call)) + if i < levels: + cond = res + if is_or: + cond = ast.UnaryOp(ast.Not(), cond) + inner = [] + self.statements.append(ast.If(cond, inner, [])) + self.statements = body = inner + self.statements = save + self.on_failure = fail_save + expl_template = self.helper("format_boolop", expl_list, ast.Num(is_or)) + expl = self.pop_format_context(expl_template) + return ast.Name(res_var, ast.Load()), self.explanation_param(expl) + + def visit_UnaryOp(self, unary): + pattern = unary_map[unary.op.__class__] + operand_res, operand_expl = self.visit(unary.operand) + res = self.assign(ast.UnaryOp(unary.op, operand_res)) + return res, pattern % (operand_expl,) + + def visit_BinOp(self, binop): + symbol = binop_map[binop.op.__class__] + left_expr, left_expl = self.visit(binop.left) + right_expr, right_expl = self.visit(binop.right) + explanation = "(%s %s %s)" % (left_expl, symbol, right_expl) + res = self.assign(ast.BinOp(left_expr, binop.op, right_expr)) + return res, explanation + + def visit_Call_35(self, call): + """ + visit `ast.Call` nodes on Python3.5 and after + """ + new_func, func_expl = self.visit(call.func) + arg_expls = [] + new_args = [] + new_kwargs = [] + for arg in call.args: + res, expl = self.visit(arg) + arg_expls.append(expl) + new_args.append(res) + for keyword in call.keywords: + res, expl = self.visit(keyword.value) + new_kwargs.append(ast.keyword(keyword.arg, res)) + if keyword.arg: + arg_expls.append(keyword.arg + "=" + expl) + else: ## **args have `arg` keywords with an .arg of None + arg_expls.append("**" + expl) + + expl = "%s(%s)" % (func_expl, ', '.join(arg_expls)) + new_call = ast.Call(new_func, new_args, new_kwargs) + res = self.assign(new_call) + res_expl = self.explanation_param(self.display(res)) + outer_expl = "%s\n{%s = %s\n}" % (res_expl, res_expl, expl) + return res, outer_expl + + def visit_Starred(self, starred): + # From Python 3.5, a Starred node can appear in a function call + res, expl = self.visit(starred.value) + return starred, '*' + expl + + def visit_Call_legacy(self, call): + """ + visit `ast.Call nodes on 3.4 and below` + """ + new_func, func_expl = self.visit(call.func) + arg_expls = [] + new_args = [] + new_kwargs = [] + new_star = new_kwarg = None + for arg in call.args: + res, expl = self.visit(arg) + new_args.append(res) + arg_expls.append(expl) + for keyword in call.keywords: + res, expl = self.visit(keyword.value) + new_kwargs.append(ast.keyword(keyword.arg, res)) + arg_expls.append(keyword.arg + "=" + expl) + if call.starargs: + new_star, expl = self.visit(call.starargs) + arg_expls.append("*" + expl) + if call.kwargs: + new_kwarg, expl = self.visit(call.kwargs) + arg_expls.append("**" + expl) + expl = "%s(%s)" % (func_expl, ', '.join(arg_expls)) + new_call = ast.Call(new_func, new_args, new_kwargs, + new_star, new_kwarg) + res = self.assign(new_call) + res_expl = self.explanation_param(self.display(res)) + outer_expl = "%s\n{%s = %s\n}" % (res_expl, res_expl, expl) + return res, outer_expl + + # ast.Call signature changed on 3.5, + # conditionally change which methods is named + # visit_Call depending on Python version + if sys.version_info >= (3, 5): + visit_Call = visit_Call_35 + else: + visit_Call = visit_Call_legacy + + + def visit_Attribute(self, attr): + if not isinstance(attr.ctx, ast.Load): + return self.generic_visit(attr) + value, value_expl = self.visit(attr.value) + res = self.assign(ast.Attribute(value, attr.attr, ast.Load())) + res_expl = self.explanation_param(self.display(res)) + pat = "%s\n{%s = %s.%s\n}" + expl = pat % (res_expl, res_expl, value_expl, attr.attr) + return res, expl + + def visit_Compare(self, comp): + self.push_format_context() + left_res, left_expl = self.visit(comp.left) + res_variables = [self.variable() for i in range(len(comp.ops))] + load_names = [ast.Name(v, ast.Load()) for v in res_variables] + store_names = [ast.Name(v, ast.Store()) for v in res_variables] + it = zip(range(len(comp.ops)), comp.ops, comp.comparators) + expls = [] + syms = [] + results = [left_res] + for i, op, next_operand in it: + next_res, next_expl = self.visit(next_operand) + results.append(next_res) + sym = binop_map[op.__class__] + syms.append(ast.Str(sym)) + expl = "%s %s %s" % (left_expl, sym, next_expl) + expls.append(ast.Str(expl)) + res_expr = ast.Compare(left_res, [op], [next_res]) + self.statements.append(ast.Assign([store_names[i]], res_expr)) + left_res, left_expl = next_res, next_expl + # Use pytest.assertion.util._reprcompare if that's available. + expl_call = self.helper("call_reprcompare", + ast.Tuple(syms, ast.Load()), + ast.Tuple(load_names, ast.Load()), + ast.Tuple(expls, ast.Load()), + ast.Tuple(results, ast.Load())) + if len(comp.ops) > 1: + res = ast.BoolOp(ast.And(), load_names) + else: + res = load_names[0] + return res, self.explanation_param(self.pop_format_context(expl_call)) diff --git a/python/pytest/_pytest/assertion/util.py b/python/pytest/_pytest/assertion/util.py new file mode 100644 index 0000000000..f2f23efea2 --- /dev/null +++ b/python/pytest/_pytest/assertion/util.py @@ -0,0 +1,332 @@ +"""Utilities for assertion debugging""" +import pprint + +import _pytest._code +import py +try: + from collections import Sequence +except ImportError: + Sequence = list + +BuiltinAssertionError = py.builtin.builtins.AssertionError +u = py.builtin._totext + +# The _reprcompare attribute on the util module is used by the new assertion +# interpretation code and assertion rewriter to detect this plugin was +# loaded and in turn call the hooks defined here as part of the +# DebugInterpreter. +_reprcompare = None + + +# the re-encoding is needed for python2 repr +# with non-ascii characters (see issue 877 and 1379) +def ecu(s): + try: + return u(s, 'utf-8', 'replace') + except TypeError: + return s + + +def format_explanation(explanation): + """This formats an explanation + + Normally all embedded newlines are escaped, however there are + three exceptions: \n{, \n} and \n~. The first two are intended + cover nested explanations, see function and attribute explanations + for examples (.visit_Call(), visit_Attribute()). The last one is + for when one explanation needs to span multiple lines, e.g. when + displaying diffs. + """ + explanation = ecu(explanation) + explanation = _collapse_false(explanation) + lines = _split_explanation(explanation) + result = _format_lines(lines) + return u('\n').join(result) + + +def _collapse_false(explanation): + """Collapse expansions of False + + So this strips out any "assert False\n{where False = ...\n}" + blocks. + """ + where = 0 + while True: + start = where = explanation.find("False\n{False = ", where) + if where == -1: + break + level = 0 + prev_c = explanation[start] + for i, c in enumerate(explanation[start:]): + if prev_c + c == "\n{": + level += 1 + elif prev_c + c == "\n}": + level -= 1 + if not level: + break + prev_c = c + else: + raise AssertionError("unbalanced braces: %r" % (explanation,)) + end = start + i + where = end + if explanation[end - 1] == '\n': + explanation = (explanation[:start] + explanation[start+15:end-1] + + explanation[end+1:]) + where -= 17 + return explanation + + +def _split_explanation(explanation): + """Return a list of individual lines in the explanation + + This will return a list of lines split on '\n{', '\n}' and '\n~'. + Any other newlines will be escaped and appear in the line as the + literal '\n' characters. + """ + raw_lines = (explanation or u('')).split('\n') + lines = [raw_lines[0]] + for l in raw_lines[1:]: + if l and l[0] in ['{', '}', '~', '>']: + lines.append(l) + else: + lines[-1] += '\\n' + l + return lines + + +def _format_lines(lines): + """Format the individual lines + + This will replace the '{', '}' and '~' characters of our mini + formatting language with the proper 'where ...', 'and ...' and ' + + ...' text, taking care of indentation along the way. + + Return a list of formatted lines. + """ + result = lines[:1] + stack = [0] + stackcnt = [0] + for line in lines[1:]: + if line.startswith('{'): + if stackcnt[-1]: + s = u('and ') + else: + s = u('where ') + stack.append(len(result)) + stackcnt[-1] += 1 + stackcnt.append(0) + result.append(u(' +') + u(' ')*(len(stack)-1) + s + line[1:]) + elif line.startswith('}'): + stack.pop() + stackcnt.pop() + result[stack[-1]] += line[1:] + else: + assert line[0] in ['~', '>'] + stack[-1] += 1 + indent = len(stack) if line.startswith('~') else len(stack) - 1 + result.append(u(' ')*indent + line[1:]) + assert len(stack) == 1 + return result + + +# Provide basestring in python3 +try: + basestring = basestring +except NameError: + basestring = str + + +def assertrepr_compare(config, op, left, right): + """Return specialised explanations for some operators/operands""" + width = 80 - 15 - len(op) - 2 # 15 chars indentation, 1 space around op + left_repr = py.io.saferepr(left, maxsize=int(width/2)) + right_repr = py.io.saferepr(right, maxsize=width-len(left_repr)) + + summary = u('%s %s %s') % (ecu(left_repr), op, ecu(right_repr)) + + issequence = lambda x: (isinstance(x, (list, tuple, Sequence)) and + not isinstance(x, basestring)) + istext = lambda x: isinstance(x, basestring) + isdict = lambda x: isinstance(x, dict) + isset = lambda x: isinstance(x, (set, frozenset)) + + def isiterable(obj): + try: + iter(obj) + return not istext(obj) + except TypeError: + return False + + verbose = config.getoption('verbose') + explanation = None + try: + if op == '==': + if istext(left) and istext(right): + explanation = _diff_text(left, right, verbose) + else: + if issequence(left) and issequence(right): + explanation = _compare_eq_sequence(left, right, verbose) + elif isset(left) and isset(right): + explanation = _compare_eq_set(left, right, verbose) + elif isdict(left) and isdict(right): + explanation = _compare_eq_dict(left, right, verbose) + if isiterable(left) and isiterable(right): + expl = _compare_eq_iterable(left, right, verbose) + if explanation is not None: + explanation.extend(expl) + else: + explanation = expl + elif op == 'not in': + if istext(left) and istext(right): + explanation = _notin_text(left, right, verbose) + except Exception: + explanation = [ + u('(pytest_assertion plugin: representation of details failed. ' + 'Probably an object has a faulty __repr__.)'), + u(_pytest._code.ExceptionInfo())] + + if not explanation: + return None + + return [summary] + explanation + + +def _diff_text(left, right, verbose=False): + """Return the explanation for the diff between text or bytes + + Unless --verbose is used this will skip leading and trailing + characters which are identical to keep the diff minimal. + + If the input are bytes they will be safely converted to text. + """ + from difflib import ndiff + explanation = [] + if isinstance(left, py.builtin.bytes): + left = u(repr(left)[1:-1]).replace(r'\n', '\n') + if isinstance(right, py.builtin.bytes): + right = u(repr(right)[1:-1]).replace(r'\n', '\n') + if not verbose: + i = 0 # just in case left or right has zero length + for i in range(min(len(left), len(right))): + if left[i] != right[i]: + break + if i > 42: + i -= 10 # Provide some context + explanation = [u('Skipping %s identical leading ' + 'characters in diff, use -v to show') % i] + left = left[i:] + right = right[i:] + if len(left) == len(right): + for i in range(len(left)): + if left[-i] != right[-i]: + break + if i > 42: + i -= 10 # Provide some context + explanation += [u('Skipping %s identical trailing ' + 'characters in diff, use -v to show') % i] + left = left[:-i] + right = right[:-i] + explanation += [line.strip('\n') + for line in ndiff(left.splitlines(), + right.splitlines())] + return explanation + + +def _compare_eq_iterable(left, right, verbose=False): + if not verbose: + return [u('Use -v to get the full diff')] + # dynamic import to speedup pytest + import difflib + + try: + left_formatting = pprint.pformat(left).splitlines() + right_formatting = pprint.pformat(right).splitlines() + explanation = [u('Full diff:')] + except Exception: + # hack: PrettyPrinter.pformat() in python 2 fails when formatting items that can't be sorted(), ie, calling + # sorted() on a list would raise. See issue #718. + # As a workaround, the full diff is generated by using the repr() string of each item of each container. + left_formatting = sorted(repr(x) for x in left) + right_formatting = sorted(repr(x) for x in right) + explanation = [u('Full diff (fallback to calling repr on each item):')] + explanation.extend(line.strip() for line in difflib.ndiff(left_formatting, right_formatting)) + return explanation + + +def _compare_eq_sequence(left, right, verbose=False): + explanation = [] + for i in range(min(len(left), len(right))): + if left[i] != right[i]: + explanation += [u('At index %s diff: %r != %r') + % (i, left[i], right[i])] + break + if len(left) > len(right): + explanation += [u('Left contains more items, first extra item: %s') + % py.io.saferepr(left[len(right)],)] + elif len(left) < len(right): + explanation += [ + u('Right contains more items, first extra item: %s') % + py.io.saferepr(right[len(left)],)] + return explanation + + +def _compare_eq_set(left, right, verbose=False): + explanation = [] + diff_left = left - right + diff_right = right - left + if diff_left: + explanation.append(u('Extra items in the left set:')) + for item in diff_left: + explanation.append(py.io.saferepr(item)) + if diff_right: + explanation.append(u('Extra items in the right set:')) + for item in diff_right: + explanation.append(py.io.saferepr(item)) + return explanation + + +def _compare_eq_dict(left, right, verbose=False): + explanation = [] + common = set(left).intersection(set(right)) + same = dict((k, left[k]) for k in common if left[k] == right[k]) + if same and not verbose: + explanation += [u('Omitting %s identical items, use -v to show') % + len(same)] + elif same: + explanation += [u('Common items:')] + explanation += pprint.pformat(same).splitlines() + diff = set(k for k in common if left[k] != right[k]) + if diff: + explanation += [u('Differing items:')] + for k in diff: + explanation += [py.io.saferepr({k: left[k]}) + ' != ' + + py.io.saferepr({k: right[k]})] + extra_left = set(left) - set(right) + if extra_left: + explanation.append(u('Left contains more items:')) + explanation.extend(pprint.pformat( + dict((k, left[k]) for k in extra_left)).splitlines()) + extra_right = set(right) - set(left) + if extra_right: + explanation.append(u('Right contains more items:')) + explanation.extend(pprint.pformat( + dict((k, right[k]) for k in extra_right)).splitlines()) + return explanation + + +def _notin_text(term, text, verbose=False): + index = text.find(term) + head = text[:index] + tail = text[index+len(term):] + correct_text = head + tail + diff = _diff_text(correct_text, text, verbose) + newdiff = [u('%s is contained here:') % py.io.saferepr(term, maxsize=42)] + for line in diff: + if line.startswith(u('Skipping')): + continue + if line.startswith(u('- ')): + continue + if line.startswith(u('+ ')): + newdiff.append(u(' ') + line[2:]) + else: + newdiff.append(line) + return newdiff diff --git a/python/pytest/_pytest/cacheprovider.py b/python/pytest/_pytest/cacheprovider.py new file mode 100755 index 0000000000..0657001f2d --- /dev/null +++ b/python/pytest/_pytest/cacheprovider.py @@ -0,0 +1,245 @@ +""" +merged implementation of the cache provider + +the name cache was not choosen to ensure pluggy automatically +ignores the external pytest-cache +""" + +import py +import pytest +import json +from os.path import sep as _sep, altsep as _altsep + + +class Cache(object): + def __init__(self, config): + self.config = config + self._cachedir = config.rootdir.join(".cache") + self.trace = config.trace.root.get("cache") + if config.getvalue("cacheclear"): + self.trace("clearing cachedir") + if self._cachedir.check(): + self._cachedir.remove() + self._cachedir.mkdir() + + def makedir(self, name): + """ return a directory path object with the given name. If the + directory does not yet exist, it will be created. You can use it + to manage files likes e. g. store/retrieve database + dumps across test sessions. + + :param name: must be a string not containing a ``/`` separator. + Make sure the name contains your plugin or application + identifiers to prevent clashes with other cache users. + """ + if _sep in name or _altsep is not None and _altsep in name: + raise ValueError("name is not allowed to contain path separators") + return self._cachedir.ensure_dir("d", name) + + def _getvaluepath(self, key): + return self._cachedir.join('v', *key.split('/')) + + def get(self, key, default): + """ return cached value for the given key. If no value + was yet cached or the value cannot be read, the specified + default is returned. + + :param key: must be a ``/`` separated value. Usually the first + name is the name of your plugin or your application. + :param default: must be provided in case of a cache-miss or + invalid cache values. + + """ + path = self._getvaluepath(key) + if path.check(): + try: + with path.open("r") as f: + return json.load(f) + except ValueError: + self.trace("cache-invalid at %s" % (path,)) + return default + + def set(self, key, value): + """ save value for the given key. + + :param key: must be a ``/`` separated value. Usually the first + name is the name of your plugin or your application. + :param value: must be of any combination of basic + python types, including nested types + like e. g. lists of dictionaries. + """ + path = self._getvaluepath(key) + try: + path.dirpath().ensure_dir() + except (py.error.EEXIST, py.error.EACCES): + self.config.warn( + code='I9', message='could not create cache path %s' % (path,) + ) + return + try: + f = path.open('w') + except py.error.ENOTDIR: + self.config.warn( + code='I9', message='cache could not write path %s' % (path,)) + else: + with f: + self.trace("cache-write %s: %r" % (key, value,)) + json.dump(value, f, indent=2, sort_keys=True) + + +class LFPlugin: + """ Plugin which implements the --lf (run last-failing) option """ + def __init__(self, config): + self.config = config + active_keys = 'lf', 'failedfirst' + self.active = any(config.getvalue(key) for key in active_keys) + if self.active: + self.lastfailed = config.cache.get("cache/lastfailed", {}) + else: + self.lastfailed = {} + + def pytest_report_header(self): + if self.active: + if not self.lastfailed: + mode = "run all (no recorded failures)" + else: + mode = "rerun last %d failures%s" % ( + len(self.lastfailed), + " first" if self.config.getvalue("failedfirst") else "") + return "run-last-failure: %s" % mode + + def pytest_runtest_logreport(self, report): + if report.failed and "xfail" not in report.keywords: + self.lastfailed[report.nodeid] = True + elif not report.failed: + if report.when == "call": + self.lastfailed.pop(report.nodeid, None) + + def pytest_collectreport(self, report): + passed = report.outcome in ('passed', 'skipped') + if passed: + if report.nodeid in self.lastfailed: + self.lastfailed.pop(report.nodeid) + self.lastfailed.update( + (item.nodeid, True) + for item in report.result) + else: + self.lastfailed[report.nodeid] = True + + def pytest_collection_modifyitems(self, session, config, items): + if self.active and self.lastfailed: + previously_failed = [] + previously_passed = [] + for item in items: + if item.nodeid in self.lastfailed: + previously_failed.append(item) + else: + previously_passed.append(item) + if not previously_failed and previously_passed: + # running a subset of all tests with recorded failures outside + # of the set of tests currently executing + pass + elif self.config.getvalue("failedfirst"): + items[:] = previously_failed + previously_passed + else: + items[:] = previously_failed + config.hook.pytest_deselected(items=previously_passed) + + def pytest_sessionfinish(self, session): + config = self.config + if config.getvalue("cacheshow") or hasattr(config, "slaveinput"): + return + prev_failed = config.cache.get("cache/lastfailed", None) is not None + if (session.testscollected and prev_failed) or self.lastfailed: + config.cache.set("cache/lastfailed", self.lastfailed) + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group.addoption( + '--lf', '--last-failed', action='store_true', dest="lf", + help="rerun only the tests that failed " + "at the last run (or all if none failed)") + group.addoption( + '--ff', '--failed-first', action='store_true', dest="failedfirst", + help="run all tests but run the last failures first. " + "This may re-order tests and thus lead to " + "repeated fixture setup/teardown") + group.addoption( + '--cache-show', action='store_true', dest="cacheshow", + help="show cache contents, don't perform collection or tests") + group.addoption( + '--cache-clear', action='store_true', dest="cacheclear", + help="remove all cache contents at start of test run.") + + +def pytest_cmdline_main(config): + if config.option.cacheshow: + from _pytest.main import wrap_session + return wrap_session(config, cacheshow) + + + +@pytest.hookimpl(tryfirst=True) +def pytest_configure(config): + config.cache = Cache(config) + config.pluginmanager.register(LFPlugin(config), "lfplugin") + + +@pytest.fixture +def cache(request): + """ + Return a cache object that can persist state between testing sessions. + + cache.get(key, default) + cache.set(key, value) + + Keys must be a ``/`` separated value, where the first part is usually the + name of your plugin or application to avoid clashes with other cache users. + + Values can be any object handled by the json stdlib module. + """ + return request.config.cache + + +def pytest_report_header(config): + if config.option.verbose: + relpath = py.path.local().bestrelpath(config.cache._cachedir) + return "cachedir: %s" % relpath + + +def cacheshow(config, session): + from pprint import pprint + tw = py.io.TerminalWriter() + tw.line("cachedir: " + str(config.cache._cachedir)) + if not config.cache._cachedir.check(): + tw.line("cache is empty") + return 0 + dummy = object() + basedir = config.cache._cachedir + vdir = basedir.join("v") + tw.sep("-", "cache values") + for valpath in vdir.visit(lambda x: x.isfile()): + key = valpath.relto(vdir).replace(valpath.sep, "/") + val = config.cache.get(key, dummy) + if val is dummy: + tw.line("%s contains unreadable content, " + "will be ignored" % key) + else: + tw.line("%s contains:" % key) + stream = py.io.TextIO() + pprint(val, stream=stream) + for line in stream.getvalue().splitlines(): + tw.line(" " + line) + + ddir = basedir.join("d") + if ddir.isdir() and ddir.listdir(): + tw.sep("-", "cache directories") + for p in basedir.join("d").visit(): + #if p.check(dir=1): + # print("%s/" % p.relto(basedir)) + if p.isfile(): + key = p.relto(basedir) + tw.line("%s is a file of length %d" % ( + key, p.size())) + return 0 diff --git a/python/pytest/_pytest/capture.py b/python/pytest/_pytest/capture.py new file mode 100644 index 0000000000..3895a714aa --- /dev/null +++ b/python/pytest/_pytest/capture.py @@ -0,0 +1,472 @@ +""" +per-test stdout/stderr capturing mechanism. + +""" +from __future__ import with_statement + +import sys +import os +from tempfile import TemporaryFile + +import py +import pytest + +from py.io import TextIO +unicode = py.builtin.text + +patchsysdict = {0: 'stdin', 1: 'stdout', 2: 'stderr'} + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group._addoption( + '--capture', action="store", + default="fd" if hasattr(os, "dup") else "sys", + metavar="method", choices=['fd', 'sys', 'no'], + help="per-test capturing method: one of fd|sys|no.") + group._addoption( + '-s', action="store_const", const="no", dest="capture", + help="shortcut for --capture=no.") + + +@pytest.hookimpl(hookwrapper=True) +def pytest_load_initial_conftests(early_config, parser, args): + _readline_workaround() + ns = early_config.known_args_namespace + pluginmanager = early_config.pluginmanager + capman = CaptureManager(ns.capture) + pluginmanager.register(capman, "capturemanager") + + # make sure that capturemanager is properly reset at final shutdown + early_config.add_cleanup(capman.reset_capturings) + + # make sure logging does not raise exceptions at the end + def silence_logging_at_shutdown(): + if "logging" in sys.modules: + sys.modules["logging"].raiseExceptions = False + early_config.add_cleanup(silence_logging_at_shutdown) + + # finally trigger conftest loading but while capturing (issue93) + capman.init_capturings() + outcome = yield + out, err = capman.suspendcapture() + if outcome.excinfo is not None: + sys.stdout.write(out) + sys.stderr.write(err) + + +class CaptureManager: + def __init__(self, method): + self._method = method + + def _getcapture(self, method): + if method == "fd": + return MultiCapture(out=True, err=True, Capture=FDCapture) + elif method == "sys": + return MultiCapture(out=True, err=True, Capture=SysCapture) + elif method == "no": + return MultiCapture(out=False, err=False, in_=False) + else: + raise ValueError("unknown capturing method: %r" % method) + + def init_capturings(self): + assert not hasattr(self, "_capturing") + self._capturing = self._getcapture(self._method) + self._capturing.start_capturing() + + def reset_capturings(self): + cap = self.__dict__.pop("_capturing", None) + if cap is not None: + cap.pop_outerr_to_orig() + cap.stop_capturing() + + def resumecapture(self): + self._capturing.resume_capturing() + + def suspendcapture(self, in_=False): + self.deactivate_funcargs() + cap = getattr(self, "_capturing", None) + if cap is not None: + try: + outerr = cap.readouterr() + finally: + cap.suspend_capturing(in_=in_) + return outerr + + def activate_funcargs(self, pyfuncitem): + capfuncarg = pyfuncitem.__dict__.pop("_capfuncarg", None) + if capfuncarg is not None: + capfuncarg._start() + self._capfuncarg = capfuncarg + + def deactivate_funcargs(self): + capfuncarg = self.__dict__.pop("_capfuncarg", None) + if capfuncarg is not None: + capfuncarg.close() + + @pytest.hookimpl(hookwrapper=True) + def pytest_make_collect_report(self, collector): + if isinstance(collector, pytest.File): + self.resumecapture() + outcome = yield + out, err = self.suspendcapture() + rep = outcome.get_result() + if out: + rep.sections.append(("Captured stdout", out)) + if err: + rep.sections.append(("Captured stderr", err)) + else: + yield + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_setup(self, item): + self.resumecapture() + yield + self.suspendcapture_item(item, "setup") + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_call(self, item): + self.resumecapture() + self.activate_funcargs(item) + yield + #self.deactivate_funcargs() called from suspendcapture() + self.suspendcapture_item(item, "call") + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_teardown(self, item): + self.resumecapture() + yield + self.suspendcapture_item(item, "teardown") + + @pytest.hookimpl(tryfirst=True) + def pytest_keyboard_interrupt(self, excinfo): + self.reset_capturings() + + @pytest.hookimpl(tryfirst=True) + def pytest_internalerror(self, excinfo): + self.reset_capturings() + + def suspendcapture_item(self, item, when): + out, err = self.suspendcapture() + item.add_report_section(when, "stdout", out) + item.add_report_section(when, "stderr", err) + +error_capsysfderror = "cannot use capsys and capfd at the same time" + + +@pytest.fixture +def capsys(request): + """enables capturing of writes to sys.stdout/sys.stderr and makes + captured output available via ``capsys.readouterr()`` method calls + which return a ``(out, err)`` tuple. + """ + if "capfd" in request._funcargs: + raise request.raiseerror(error_capsysfderror) + request.node._capfuncarg = c = CaptureFixture(SysCapture) + return c + +@pytest.fixture +def capfd(request): + """enables capturing of writes to file descriptors 1 and 2 and makes + captured output available via ``capfd.readouterr()`` method calls + which return a ``(out, err)`` tuple. + """ + if "capsys" in request._funcargs: + request.raiseerror(error_capsysfderror) + if not hasattr(os, 'dup'): + pytest.skip("capfd funcarg needs os.dup") + request.node._capfuncarg = c = CaptureFixture(FDCapture) + return c + + +class CaptureFixture: + def __init__(self, captureclass): + self.captureclass = captureclass + + def _start(self): + self._capture = MultiCapture(out=True, err=True, in_=False, + Capture=self.captureclass) + self._capture.start_capturing() + + def close(self): + cap = self.__dict__.pop("_capture", None) + if cap is not None: + self._outerr = cap.pop_outerr_to_orig() + cap.stop_capturing() + + def readouterr(self): + try: + return self._capture.readouterr() + except AttributeError: + return self._outerr + + +def safe_text_dupfile(f, mode, default_encoding="UTF8"): + """ return a open text file object that's a duplicate of f on the + FD-level if possible. + """ + encoding = getattr(f, "encoding", None) + try: + fd = f.fileno() + except Exception: + if "b" not in getattr(f, "mode", "") and hasattr(f, "encoding"): + # we seem to have a text stream, let's just use it + return f + else: + newfd = os.dup(fd) + if "b" not in mode: + mode += "b" + f = os.fdopen(newfd, mode, 0) # no buffering + return EncodedFile(f, encoding or default_encoding) + + +class EncodedFile(object): + errors = "strict" # possibly needed by py3 code (issue555) + def __init__(self, buffer, encoding): + self.buffer = buffer + self.encoding = encoding + + def write(self, obj): + if isinstance(obj, unicode): + obj = obj.encode(self.encoding, "replace") + self.buffer.write(obj) + + def writelines(self, linelist): + data = ''.join(linelist) + self.write(data) + + def __getattr__(self, name): + return getattr(object.__getattribute__(self, "buffer"), name) + + +class MultiCapture(object): + out = err = in_ = None + + def __init__(self, out=True, err=True, in_=True, Capture=None): + if in_: + self.in_ = Capture(0) + if out: + self.out = Capture(1) + if err: + self.err = Capture(2) + + def start_capturing(self): + if self.in_: + self.in_.start() + if self.out: + self.out.start() + if self.err: + self.err.start() + + def pop_outerr_to_orig(self): + """ pop current snapshot out/err capture and flush to orig streams. """ + out, err = self.readouterr() + if out: + self.out.writeorg(out) + if err: + self.err.writeorg(err) + return out, err + + def suspend_capturing(self, in_=False): + if self.out: + self.out.suspend() + if self.err: + self.err.suspend() + if in_ and self.in_: + self.in_.suspend() + self._in_suspended = True + + def resume_capturing(self): + if self.out: + self.out.resume() + if self.err: + self.err.resume() + if hasattr(self, "_in_suspended"): + self.in_.resume() + del self._in_suspended + + def stop_capturing(self): + """ stop capturing and reset capturing streams """ + if hasattr(self, '_reset'): + raise ValueError("was already stopped") + self._reset = True + if self.out: + self.out.done() + if self.err: + self.err.done() + if self.in_: + self.in_.done() + + def readouterr(self): + """ return snapshot unicode value of stdout/stderr capturings. """ + return (self.out.snap() if self.out is not None else "", + self.err.snap() if self.err is not None else "") + +class NoCapture: + __init__ = start = done = suspend = resume = lambda *args: None + +class FDCapture: + """ Capture IO to/from a given os-level filedescriptor. """ + + def __init__(self, targetfd, tmpfile=None): + self.targetfd = targetfd + try: + self.targetfd_save = os.dup(self.targetfd) + except OSError: + self.start = lambda: None + self.done = lambda: None + else: + if targetfd == 0: + assert not tmpfile, "cannot set tmpfile with stdin" + tmpfile = open(os.devnull, "r") + self.syscapture = SysCapture(targetfd) + else: + if tmpfile is None: + f = TemporaryFile() + with f: + tmpfile = safe_text_dupfile(f, mode="wb+") + if targetfd in patchsysdict: + self.syscapture = SysCapture(targetfd, tmpfile) + else: + self.syscapture = NoCapture() + self.tmpfile = tmpfile + self.tmpfile_fd = tmpfile.fileno() + + def __repr__(self): + return "<FDCapture %s oldfd=%s>" % (self.targetfd, self.targetfd_save) + + def start(self): + """ Start capturing on targetfd using memorized tmpfile. """ + try: + os.fstat(self.targetfd_save) + except (AttributeError, OSError): + raise ValueError("saved filedescriptor not valid anymore") + os.dup2(self.tmpfile_fd, self.targetfd) + self.syscapture.start() + + def snap(self): + f = self.tmpfile + f.seek(0) + res = f.read() + if res: + enc = getattr(f, "encoding", None) + if enc and isinstance(res, bytes): + res = py.builtin._totext(res, enc, "replace") + f.truncate(0) + f.seek(0) + return res + return '' + + def done(self): + """ stop capturing, restore streams, return original capture file, + seeked to position zero. """ + targetfd_save = self.__dict__.pop("targetfd_save") + os.dup2(targetfd_save, self.targetfd) + os.close(targetfd_save) + self.syscapture.done() + self.tmpfile.close() + + def suspend(self): + self.syscapture.suspend() + os.dup2(self.targetfd_save, self.targetfd) + + def resume(self): + self.syscapture.resume() + os.dup2(self.tmpfile_fd, self.targetfd) + + def writeorg(self, data): + """ write to original file descriptor. """ + if py.builtin._istext(data): + data = data.encode("utf8") # XXX use encoding of original stream + os.write(self.targetfd_save, data) + + +class SysCapture: + def __init__(self, fd, tmpfile=None): + name = patchsysdict[fd] + self._old = getattr(sys, name) + self.name = name + if tmpfile is None: + if name == "stdin": + tmpfile = DontReadFromInput() + else: + tmpfile = TextIO() + self.tmpfile = tmpfile + + def start(self): + setattr(sys, self.name, self.tmpfile) + + def snap(self): + f = self.tmpfile + res = f.getvalue() + f.truncate(0) + f.seek(0) + return res + + def done(self): + setattr(sys, self.name, self._old) + del self._old + self.tmpfile.close() + + def suspend(self): + setattr(sys, self.name, self._old) + + def resume(self): + setattr(sys, self.name, self.tmpfile) + + def writeorg(self, data): + self._old.write(data) + self._old.flush() + + +class DontReadFromInput: + """Temporary stub class. Ideally when stdin is accessed, the + capturing should be turned off, with possibly all data captured + so far sent to the screen. This should be configurable, though, + because in automated test runs it is better to crash than + hang indefinitely. + """ + + encoding = None + + def read(self, *args): + raise IOError("reading from stdin while output is captured") + readline = read + readlines = read + __iter__ = read + + def fileno(self): + raise ValueError("redirected Stdin is pseudofile, has no fileno()") + + def isatty(self): + return False + + def close(self): + pass + + +def _readline_workaround(): + """ + Ensure readline is imported so that it attaches to the correct stdio + handles on Windows. + + Pdb uses readline support where available--when not running from the Python + prompt, the readline module is not imported until running the pdb REPL. If + running py.test with the --pdb option this means the readline module is not + imported until after I/O capture has been started. + + This is a problem for pyreadline, which is often used to implement readline + support on Windows, as it does not attach to the correct handles for stdout + and/or stdin if they have been redirected by the FDCapture mechanism. This + workaround ensures that readline is imported before I/O capture is setup so + that it can attach to the actual stdin/out for the console. + + See https://github.com/pytest-dev/pytest/pull/1281 + """ + + if not sys.platform.startswith('win32'): + return + try: + import readline # noqa + except ImportError: + pass diff --git a/python/pytest/_pytest/config.py b/python/pytest/_pytest/config.py new file mode 100644 index 0000000000..9a308df2bb --- /dev/null +++ b/python/pytest/_pytest/config.py @@ -0,0 +1,1192 @@ +""" command line options, ini-file and conftest.py processing. """ +import argparse +import shlex +import traceback +import types +import warnings + +import py +# DON't import pytest here because it causes import cycle troubles +import sys, os +import _pytest._code +import _pytest.hookspec # the extension point definitions +from _pytest._pluggy import PluginManager, HookimplMarker, HookspecMarker + +hookimpl = HookimplMarker("pytest") +hookspec = HookspecMarker("pytest") + +# pytest startup +# + + +class ConftestImportFailure(Exception): + def __init__(self, path, excinfo): + Exception.__init__(self, path, excinfo) + self.path = path + self.excinfo = excinfo + + +def main(args=None, plugins=None): + """ return exit code, after performing an in-process test run. + + :arg args: list of command line arguments. + + :arg plugins: list of plugin objects to be auto-registered during + initialization. + """ + try: + try: + config = _prepareconfig(args, plugins) + except ConftestImportFailure as e: + tw = py.io.TerminalWriter(sys.stderr) + for line in traceback.format_exception(*e.excinfo): + tw.line(line.rstrip(), red=True) + tw.line("ERROR: could not load %s\n" % (e.path), red=True) + return 4 + else: + try: + config.pluginmanager.check_pending() + return config.hook.pytest_cmdline_main(config=config) + finally: + config._ensure_unconfigure() + except UsageError as e: + for msg in e.args: + sys.stderr.write("ERROR: %s\n" %(msg,)) + return 4 + +class cmdline: # compatibility namespace + main = staticmethod(main) + +class UsageError(Exception): + """ error in pytest usage or invocation""" + +_preinit = [] + +default_plugins = ( + "mark main terminal runner python pdb unittest capture skipping " + "tmpdir monkeypatch recwarn pastebin helpconfig nose assertion genscript " + "junitxml resultlog doctest cacheprovider").split() + +builtin_plugins = set(default_plugins) +builtin_plugins.add("pytester") + + +def _preloadplugins(): + assert not _preinit + _preinit.append(get_config()) + +def get_config(): + if _preinit: + return _preinit.pop(0) + # subsequent calls to main will create a fresh instance + pluginmanager = PytestPluginManager() + config = Config(pluginmanager) + for spec in default_plugins: + pluginmanager.import_plugin(spec) + return config + +def get_plugin_manager(): + """ + Obtain a new instance of the + :py:class:`_pytest.config.PytestPluginManager`, with default plugins + already loaded. + + This function can be used by integration with other tools, like hooking + into pytest to run tests into an IDE. + """ + return get_config().pluginmanager + +def _prepareconfig(args=None, plugins=None): + if args is None: + args = sys.argv[1:] + elif isinstance(args, py.path.local): + args = [str(args)] + elif not isinstance(args, (tuple, list)): + if not isinstance(args, str): + raise ValueError("not a string or argument list: %r" % (args,)) + args = shlex.split(args, posix=sys.platform != "win32") + config = get_config() + pluginmanager = config.pluginmanager + try: + if plugins: + for plugin in plugins: + if isinstance(plugin, py.builtin._basestring): + pluginmanager.consider_pluginarg(plugin) + else: + pluginmanager.register(plugin) + return pluginmanager.hook.pytest_cmdline_parse( + pluginmanager=pluginmanager, args=args) + except BaseException: + config._ensure_unconfigure() + raise + + +class PytestPluginManager(PluginManager): + """ + Overwrites :py:class:`pluggy.PluginManager` to add pytest-specific + functionality: + + * loading plugins from the command line, ``PYTEST_PLUGIN`` env variable and + ``pytest_plugins`` global variables found in plugins being loaded; + * ``conftest.py`` loading during start-up; + """ + def __init__(self): + super(PytestPluginManager, self).__init__("pytest", implprefix="pytest_") + self._conftest_plugins = set() + + # state related to local conftest plugins + self._path2confmods = {} + self._conftestpath2mod = {} + self._confcutdir = None + self._noconftest = False + + self.add_hookspecs(_pytest.hookspec) + self.register(self) + if os.environ.get('PYTEST_DEBUG'): + err = sys.stderr + encoding = getattr(err, 'encoding', 'utf8') + try: + err = py.io.dupfile(err, encoding=encoding) + except Exception: + pass + self.trace.root.setwriter(err.write) + self.enable_tracing() + + def addhooks(self, module_or_class): + """ + .. deprecated:: 2.8 + + Use :py:meth:`pluggy.PluginManager.add_hookspecs` instead. + """ + warning = dict(code="I2", + fslocation=_pytest._code.getfslineno(sys._getframe(1)), + nodeid=None, + message="use pluginmanager.add_hookspecs instead of " + "deprecated addhooks() method.") + self._warn(warning) + return self.add_hookspecs(module_or_class) + + def parse_hookimpl_opts(self, plugin, name): + # pytest hooks are always prefixed with pytest_ + # so we avoid accessing possibly non-readable attributes + # (see issue #1073) + if not name.startswith("pytest_"): + return + # ignore some historic special names which can not be hooks anyway + if name == "pytest_plugins" or name.startswith("pytest_funcarg__"): + return + + method = getattr(plugin, name) + opts = super(PytestPluginManager, self).parse_hookimpl_opts(plugin, name) + if opts is not None: + for name in ("tryfirst", "trylast", "optionalhook", "hookwrapper"): + opts.setdefault(name, hasattr(method, name)) + return opts + + def parse_hookspec_opts(self, module_or_class, name): + opts = super(PytestPluginManager, self).parse_hookspec_opts( + module_or_class, name) + if opts is None: + method = getattr(module_or_class, name) + if name.startswith("pytest_"): + opts = {"firstresult": hasattr(method, "firstresult"), + "historic": hasattr(method, "historic")} + return opts + + def _verify_hook(self, hook, hookmethod): + super(PytestPluginManager, self)._verify_hook(hook, hookmethod) + if "__multicall__" in hookmethod.argnames: + fslineno = _pytest._code.getfslineno(hookmethod.function) + warning = dict(code="I1", + fslocation=fslineno, + nodeid=None, + message="%r hook uses deprecated __multicall__ " + "argument" % (hook.name)) + self._warn(warning) + + def register(self, plugin, name=None): + ret = super(PytestPluginManager, self).register(plugin, name) + if ret: + self.hook.pytest_plugin_registered.call_historic( + kwargs=dict(plugin=plugin, manager=self)) + return ret + + def getplugin(self, name): + # support deprecated naming because plugins (xdist e.g.) use it + return self.get_plugin(name) + + def hasplugin(self, name): + """Return True if the plugin with the given name is registered.""" + return bool(self.get_plugin(name)) + + def pytest_configure(self, config): + # XXX now that the pluginmanager exposes hookimpl(tryfirst...) + # we should remove tryfirst/trylast as markers + config.addinivalue_line("markers", + "tryfirst: mark a hook implementation function such that the " + "plugin machinery will try to call it first/as early as possible.") + config.addinivalue_line("markers", + "trylast: mark a hook implementation function such that the " + "plugin machinery will try to call it last/as late as possible.") + + def _warn(self, message): + kwargs = message if isinstance(message, dict) else { + 'code': 'I1', + 'message': message, + 'fslocation': None, + 'nodeid': None, + } + self.hook.pytest_logwarning.call_historic(kwargs=kwargs) + + # + # internal API for local conftest plugin handling + # + def _set_initial_conftests(self, namespace): + """ load initial conftest files given a preparsed "namespace". + As conftest files may add their own command line options + which have arguments ('--my-opt somepath') we might get some + false positives. All builtin and 3rd party plugins will have + been loaded, however, so common options will not confuse our logic + here. + """ + current = py.path.local() + self._confcutdir = current.join(namespace.confcutdir, abs=True) \ + if namespace.confcutdir else None + self._noconftest = namespace.noconftest + testpaths = namespace.file_or_dir + foundanchor = False + for path in testpaths: + path = str(path) + # remove node-id syntax + i = path.find("::") + if i != -1: + path = path[:i] + anchor = current.join(path, abs=1) + if exists(anchor): # we found some file object + self._try_load_conftest(anchor) + foundanchor = True + if not foundanchor: + self._try_load_conftest(current) + + def _try_load_conftest(self, anchor): + self._getconftestmodules(anchor) + # let's also consider test* subdirs + if anchor.check(dir=1): + for x in anchor.listdir("test*"): + if x.check(dir=1): + self._getconftestmodules(x) + + def _getconftestmodules(self, path): + if self._noconftest: + return [] + try: + return self._path2confmods[path] + except KeyError: + if path.isfile(): + clist = self._getconftestmodules(path.dirpath()) + else: + # XXX these days we may rather want to use config.rootdir + # and allow users to opt into looking into the rootdir parent + # directories instead of requiring to specify confcutdir + clist = [] + for parent in path.parts(): + if self._confcutdir and self._confcutdir.relto(parent): + continue + conftestpath = parent.join("conftest.py") + if conftestpath.isfile(): + mod = self._importconftest(conftestpath) + clist.append(mod) + + self._path2confmods[path] = clist + return clist + + def _rget_with_confmod(self, name, path): + modules = self._getconftestmodules(path) + for mod in reversed(modules): + try: + return mod, getattr(mod, name) + except AttributeError: + continue + raise KeyError(name) + + def _importconftest(self, conftestpath): + try: + return self._conftestpath2mod[conftestpath] + except KeyError: + pkgpath = conftestpath.pypkgpath() + if pkgpath is None: + _ensure_removed_sysmodule(conftestpath.purebasename) + try: + mod = conftestpath.pyimport() + except Exception: + raise ConftestImportFailure(conftestpath, sys.exc_info()) + + self._conftest_plugins.add(mod) + self._conftestpath2mod[conftestpath] = mod + dirpath = conftestpath.dirpath() + if dirpath in self._path2confmods: + for path, mods in self._path2confmods.items(): + if path and path.relto(dirpath) or path == dirpath: + assert mod not in mods + mods.append(mod) + self.trace("loaded conftestmodule %r" %(mod)) + self.consider_conftest(mod) + return mod + + # + # API for bootstrapping plugin loading + # + # + + def consider_preparse(self, args): + for opt1,opt2 in zip(args, args[1:]): + if opt1 == "-p": + self.consider_pluginarg(opt2) + + def consider_pluginarg(self, arg): + if arg.startswith("no:"): + name = arg[3:] + self.set_blocked(name) + if not name.startswith("pytest_"): + self.set_blocked("pytest_" + name) + else: + self.import_plugin(arg) + + def consider_conftest(self, conftestmodule): + if self.register(conftestmodule, name=conftestmodule.__file__): + self.consider_module(conftestmodule) + + def consider_env(self): + self._import_plugin_specs(os.environ.get("PYTEST_PLUGINS")) + + def consider_module(self, mod): + self._import_plugin_specs(getattr(mod, "pytest_plugins", None)) + + def _import_plugin_specs(self, spec): + if spec: + if isinstance(spec, str): + spec = spec.split(",") + for import_spec in spec: + self.import_plugin(import_spec) + + def import_plugin(self, modname): + # most often modname refers to builtin modules, e.g. "pytester", + # "terminal" or "capture". Those plugins are registered under their + # basename for historic purposes but must be imported with the + # _pytest prefix. + assert isinstance(modname, str) + if self.get_plugin(modname) is not None: + return + if modname in builtin_plugins: + importspec = "_pytest." + modname + else: + importspec = modname + try: + __import__(importspec) + except ImportError as e: + new_exc = ImportError('Error importing plugin "%s": %s' % (modname, e)) + # copy over name and path attributes + for attr in ('name', 'path'): + if hasattr(e, attr): + setattr(new_exc, attr, getattr(e, attr)) + raise new_exc + except Exception as e: + import pytest + if not hasattr(pytest, 'skip') or not isinstance(e, pytest.skip.Exception): + raise + self._warn("skipped plugin %r: %s" %((modname, e.msg))) + else: + mod = sys.modules[importspec] + self.register(mod, modname) + self.consider_module(mod) + + +class Parser: + """ Parser for command line arguments and ini-file values. + + :ivar extra_info: dict of generic param -> value to display in case + there's an error processing the command line arguments. + """ + + def __init__(self, usage=None, processopt=None): + self._anonymous = OptionGroup("custom options", parser=self) + self._groups = [] + self._processopt = processopt + self._usage = usage + self._inidict = {} + self._ininames = [] + self.extra_info = {} + + def processoption(self, option): + if self._processopt: + if option.dest: + self._processopt(option) + + def getgroup(self, name, description="", after=None): + """ get (or create) a named option Group. + + :name: name of the option group. + :description: long description for --help output. + :after: name of other group, used for ordering --help output. + + The returned group object has an ``addoption`` method with the same + signature as :py:func:`parser.addoption + <_pytest.config.Parser.addoption>` but will be shown in the + respective group in the output of ``pytest. --help``. + """ + for group in self._groups: + if group.name == name: + return group + group = OptionGroup(name, description, parser=self) + i = 0 + for i, grp in enumerate(self._groups): + if grp.name == after: + break + self._groups.insert(i+1, group) + return group + + def addoption(self, *opts, **attrs): + """ register a command line option. + + :opts: option names, can be short or long options. + :attrs: same attributes which the ``add_option()`` function of the + `argparse library + <http://docs.python.org/2/library/argparse.html>`_ + accepts. + + After command line parsing options are available on the pytest config + object via ``config.option.NAME`` where ``NAME`` is usually set + by passing a ``dest`` attribute, for example + ``addoption("--long", dest="NAME", ...)``. + """ + self._anonymous.addoption(*opts, **attrs) + + def parse(self, args, namespace=None): + from _pytest._argcomplete import try_argcomplete + self.optparser = self._getparser() + try_argcomplete(self.optparser) + return self.optparser.parse_args([str(x) for x in args], namespace=namespace) + + def _getparser(self): + from _pytest._argcomplete import filescompleter + optparser = MyOptionParser(self, self.extra_info) + groups = self._groups + [self._anonymous] + for group in groups: + if group.options: + desc = group.description or group.name + arggroup = optparser.add_argument_group(desc) + for option in group.options: + n = option.names() + a = option.attrs() + arggroup.add_argument(*n, **a) + # bash like autocompletion for dirs (appending '/') + optparser.add_argument(FILE_OR_DIR, nargs='*').completer=filescompleter + return optparser + + def parse_setoption(self, args, option, namespace=None): + parsedoption = self.parse(args, namespace=namespace) + for name, value in parsedoption.__dict__.items(): + setattr(option, name, value) + return getattr(parsedoption, FILE_OR_DIR) + + def parse_known_args(self, args, namespace=None): + """parses and returns a namespace object with known arguments at this + point. + """ + return self.parse_known_and_unknown_args(args, namespace=namespace)[0] + + def parse_known_and_unknown_args(self, args, namespace=None): + """parses and returns a namespace object with known arguments, and + the remaining arguments unknown at this point. + """ + optparser = self._getparser() + args = [str(x) for x in args] + return optparser.parse_known_args(args, namespace=namespace) + + def addini(self, name, help, type=None, default=None): + """ register an ini-file option. + + :name: name of the ini-variable + :type: type of the variable, can be ``pathlist``, ``args``, ``linelist`` + or ``bool``. + :default: default value if no ini-file option exists but is queried. + + The value of ini-variables can be retrieved via a call to + :py:func:`config.getini(name) <_pytest.config.Config.getini>`. + """ + assert type in (None, "pathlist", "args", "linelist", "bool") + self._inidict[name] = (help, type, default) + self._ininames.append(name) + + +class ArgumentError(Exception): + """ + Raised if an Argument instance is created with invalid or + inconsistent arguments. + """ + + def __init__(self, msg, option): + self.msg = msg + self.option_id = str(option) + + def __str__(self): + if self.option_id: + return "option %s: %s" % (self.option_id, self.msg) + else: + return self.msg + + +class Argument: + """class that mimics the necessary behaviour of optparse.Option """ + _typ_map = { + 'int': int, + 'string': str, + } + # enable after some grace period for plugin writers + TYPE_WARN = False + + def __init__(self, *names, **attrs): + """store parms in private vars for use in add_argument""" + self._attrs = attrs + self._short_opts = [] + self._long_opts = [] + self.dest = attrs.get('dest') + if self.TYPE_WARN: + try: + help = attrs['help'] + if '%default' in help: + warnings.warn( + 'pytest now uses argparse. "%default" should be' + ' changed to "%(default)s" ', + FutureWarning, + stacklevel=3) + except KeyError: + pass + try: + typ = attrs['type'] + except KeyError: + pass + else: + # this might raise a keyerror as well, don't want to catch that + if isinstance(typ, py.builtin._basestring): + if typ == 'choice': + if self.TYPE_WARN: + warnings.warn( + 'type argument to addoption() is a string %r.' + ' For parsearg this is optional and when supplied ' + ' should be a type.' + ' (options: %s)' % (typ, names), + FutureWarning, + stacklevel=3) + # argparse expects a type here take it from + # the type of the first element + attrs['type'] = type(attrs['choices'][0]) + else: + if self.TYPE_WARN: + warnings.warn( + 'type argument to addoption() is a string %r.' + ' For parsearg this should be a type.' + ' (options: %s)' % (typ, names), + FutureWarning, + stacklevel=3) + attrs['type'] = Argument._typ_map[typ] + # used in test_parseopt -> test_parse_defaultgetter + self.type = attrs['type'] + else: + self.type = typ + try: + # attribute existence is tested in Config._processopt + self.default = attrs['default'] + except KeyError: + pass + self._set_opt_strings(names) + if not self.dest: + if self._long_opts: + self.dest = self._long_opts[0][2:].replace('-', '_') + else: + try: + self.dest = self._short_opts[0][1:] + except IndexError: + raise ArgumentError( + 'need a long or short option', self) + + def names(self): + return self._short_opts + self._long_opts + + def attrs(self): + # update any attributes set by processopt + attrs = 'default dest help'.split() + if self.dest: + attrs.append(self.dest) + for attr in attrs: + try: + self._attrs[attr] = getattr(self, attr) + except AttributeError: + pass + if self._attrs.get('help'): + a = self._attrs['help'] + a = a.replace('%default', '%(default)s') + #a = a.replace('%prog', '%(prog)s') + self._attrs['help'] = a + return self._attrs + + def _set_opt_strings(self, opts): + """directly from optparse + + might not be necessary as this is passed to argparse later on""" + for opt in opts: + if len(opt) < 2: + raise ArgumentError( + "invalid option string %r: " + "must be at least two characters long" % opt, self) + elif len(opt) == 2: + if not (opt[0] == "-" and opt[1] != "-"): + raise ArgumentError( + "invalid short option string %r: " + "must be of the form -x, (x any non-dash char)" % opt, + self) + self._short_opts.append(opt) + else: + if not (opt[0:2] == "--" and opt[2] != "-"): + raise ArgumentError( + "invalid long option string %r: " + "must start with --, followed by non-dash" % opt, + self) + self._long_opts.append(opt) + + def __repr__(self): + retval = 'Argument(' + if self._short_opts: + retval += '_short_opts: ' + repr(self._short_opts) + ', ' + if self._long_opts: + retval += '_long_opts: ' + repr(self._long_opts) + ', ' + retval += 'dest: ' + repr(self.dest) + ', ' + if hasattr(self, 'type'): + retval += 'type: ' + repr(self.type) + ', ' + if hasattr(self, 'default'): + retval += 'default: ' + repr(self.default) + ', ' + if retval[-2:] == ', ': # always long enough to test ("Argument(" ) + retval = retval[:-2] + retval += ')' + return retval + + +class OptionGroup: + def __init__(self, name, description="", parser=None): + self.name = name + self.description = description + self.options = [] + self.parser = parser + + def addoption(self, *optnames, **attrs): + """ add an option to this group. + + if a shortened version of a long option is specified it will + be suppressed in the help. addoption('--twowords', '--two-words') + results in help showing '--two-words' only, but --twowords gets + accepted **and** the automatic destination is in args.twowords + """ + option = Argument(*optnames, **attrs) + self._addoption_instance(option, shortupper=False) + + def _addoption(self, *optnames, **attrs): + option = Argument(*optnames, **attrs) + self._addoption_instance(option, shortupper=True) + + def _addoption_instance(self, option, shortupper=False): + if not shortupper: + for opt in option._short_opts: + if opt[0] == '-' and opt[1].islower(): + raise ValueError("lowercase shortoptions reserved") + if self.parser: + self.parser.processoption(option) + self.options.append(option) + + +class MyOptionParser(argparse.ArgumentParser): + def __init__(self, parser, extra_info=None): + if not extra_info: + extra_info = {} + self._parser = parser + argparse.ArgumentParser.__init__(self, usage=parser._usage, + add_help=False, formatter_class=DropShorterLongHelpFormatter) + # extra_info is a dict of (param -> value) to display if there's + # an usage error to provide more contextual information to the user + self.extra_info = extra_info + + def parse_args(self, args=None, namespace=None): + """allow splitting of positional arguments""" + args, argv = self.parse_known_args(args, namespace) + if argv: + for arg in argv: + if arg and arg[0] == '-': + lines = ['unrecognized arguments: %s' % (' '.join(argv))] + for k, v in sorted(self.extra_info.items()): + lines.append(' %s: %s' % (k, v)) + self.error('\n'.join(lines)) + getattr(args, FILE_OR_DIR).extend(argv) + return args + + +class DropShorterLongHelpFormatter(argparse.HelpFormatter): + """shorten help for long options that differ only in extra hyphens + + - collapse **long** options that are the same except for extra hyphens + - special action attribute map_long_option allows surpressing additional + long options + - shortcut if there are only two options and one of them is a short one + - cache result on action object as this is called at least 2 times + """ + def _format_action_invocation(self, action): + orgstr = argparse.HelpFormatter._format_action_invocation(self, action) + if orgstr and orgstr[0] != '-': # only optional arguments + return orgstr + res = getattr(action, '_formatted_action_invocation', None) + if res: + return res + options = orgstr.split(', ') + if len(options) == 2 and (len(options[0]) == 2 or len(options[1]) == 2): + # a shortcut for '-h, --help' or '--abc', '-a' + action._formatted_action_invocation = orgstr + return orgstr + return_list = [] + option_map = getattr(action, 'map_long_option', {}) + if option_map is None: + option_map = {} + short_long = {} + for option in options: + if len(option) == 2 or option[2] == ' ': + continue + if not option.startswith('--'): + raise ArgumentError('long optional argument without "--": [%s]' + % (option), self) + xxoption = option[2:] + if xxoption.split()[0] not in option_map: + shortened = xxoption.replace('-', '') + if shortened not in short_long or \ + len(short_long[shortened]) < len(xxoption): + short_long[shortened] = xxoption + # now short_long has been filled out to the longest with dashes + # **and** we keep the right option ordering from add_argument + for option in options: # + if len(option) == 2 or option[2] == ' ': + return_list.append(option) + if option[2:] == short_long.get(option.replace('-', '')): + return_list.append(option.replace(' ', '=')) + action._formatted_action_invocation = ', '.join(return_list) + return action._formatted_action_invocation + + + +def _ensure_removed_sysmodule(modname): + try: + del sys.modules[modname] + except KeyError: + pass + +class CmdOptions(object): + """ holds cmdline options as attributes.""" + def __init__(self, values=()): + self.__dict__.update(values) + def __repr__(self): + return "<CmdOptions %r>" %(self.__dict__,) + def copy(self): + return CmdOptions(self.__dict__) + +class Notset: + def __repr__(self): + return "<NOTSET>" + +notset = Notset() +FILE_OR_DIR = 'file_or_dir' + +class Config(object): + """ access to configuration values, pluginmanager and plugin hooks. """ + + def __init__(self, pluginmanager): + #: access to command line option as attributes. + #: (deprecated), use :py:func:`getoption() <_pytest.config.Config.getoption>` instead + self.option = CmdOptions() + _a = FILE_OR_DIR + self._parser = Parser( + usage="%%(prog)s [options] [%s] [%s] [...]" % (_a, _a), + processopt=self._processopt, + ) + #: a pluginmanager instance + self.pluginmanager = pluginmanager + self.trace = self.pluginmanager.trace.root.get("config") + self.hook = self.pluginmanager.hook + self._inicache = {} + self._opt2dest = {} + self._cleanup = [] + self._warn = self.pluginmanager._warn + self.pluginmanager.register(self, "pytestconfig") + self._configured = False + def do_setns(dic): + import pytest + setns(pytest, dic) + self.hook.pytest_namespace.call_historic(do_setns, {}) + self.hook.pytest_addoption.call_historic(kwargs=dict(parser=self._parser)) + + def add_cleanup(self, func): + """ Add a function to be called when the config object gets out of + use (usually coninciding with pytest_unconfigure).""" + self._cleanup.append(func) + + def _do_configure(self): + assert not self._configured + self._configured = True + self.hook.pytest_configure.call_historic(kwargs=dict(config=self)) + + def _ensure_unconfigure(self): + if self._configured: + self._configured = False + self.hook.pytest_unconfigure(config=self) + self.hook.pytest_configure._call_history = [] + while self._cleanup: + fin = self._cleanup.pop() + fin() + + def warn(self, code, message, fslocation=None): + """ generate a warning for this test session. """ + self.hook.pytest_logwarning.call_historic(kwargs=dict( + code=code, message=message, + fslocation=fslocation, nodeid=None)) + + def get_terminal_writer(self): + return self.pluginmanager.get_plugin("terminalreporter")._tw + + def pytest_cmdline_parse(self, pluginmanager, args): + # REF1 assert self == pluginmanager.config, (self, pluginmanager.config) + self.parse(args) + return self + + def notify_exception(self, excinfo, option=None): + if option and option.fulltrace: + style = "long" + else: + style = "native" + excrepr = excinfo.getrepr(funcargs=True, + showlocals=getattr(option, 'showlocals', False), + style=style, + ) + res = self.hook.pytest_internalerror(excrepr=excrepr, + excinfo=excinfo) + if not py.builtin.any(res): + for line in str(excrepr).split("\n"): + sys.stderr.write("INTERNALERROR> %s\n" %line) + sys.stderr.flush() + + def cwd_relative_nodeid(self, nodeid): + # nodeid's are relative to the rootpath, compute relative to cwd + if self.invocation_dir != self.rootdir: + fullpath = self.rootdir.join(nodeid) + nodeid = self.invocation_dir.bestrelpath(fullpath) + return nodeid + + @classmethod + def fromdictargs(cls, option_dict, args): + """ constructor useable for subprocesses. """ + config = get_config() + config.option.__dict__.update(option_dict) + config.parse(args, addopts=False) + for x in config.option.plugins: + config.pluginmanager.consider_pluginarg(x) + return config + + def _processopt(self, opt): + for name in opt._short_opts + opt._long_opts: + self._opt2dest[name] = opt.dest + + if hasattr(opt, 'default') and opt.dest: + if not hasattr(self.option, opt.dest): + setattr(self.option, opt.dest, opt.default) + + @hookimpl(trylast=True) + def pytest_load_initial_conftests(self, early_config): + self.pluginmanager._set_initial_conftests(early_config.known_args_namespace) + + def _initini(self, args): + ns, unknown_args = self._parser.parse_known_and_unknown_args(args, namespace=self.option.copy()) + r = determine_setup(ns.inifilename, ns.file_or_dir + unknown_args) + self.rootdir, self.inifile, self.inicfg = r + self._parser.extra_info['rootdir'] = self.rootdir + self._parser.extra_info['inifile'] = self.inifile + self.invocation_dir = py.path.local() + self._parser.addini('addopts', 'extra command line options', 'args') + self._parser.addini('minversion', 'minimally required pytest version') + + def _preparse(self, args, addopts=True): + self._initini(args) + if addopts: + args[:] = shlex.split(os.environ.get('PYTEST_ADDOPTS', '')) + args + args[:] = self.getini("addopts") + args + self._checkversion() + self.pluginmanager.consider_preparse(args) + try: + self.pluginmanager.load_setuptools_entrypoints("pytest11") + except ImportError as e: + self.warn("I2", "could not load setuptools entry import: %s" % (e,)) + self.pluginmanager.consider_env() + self.known_args_namespace = ns = self._parser.parse_known_args(args, namespace=self.option.copy()) + if self.known_args_namespace.confcutdir is None and self.inifile: + confcutdir = py.path.local(self.inifile).dirname + self.known_args_namespace.confcutdir = confcutdir + try: + self.hook.pytest_load_initial_conftests(early_config=self, + args=args, parser=self._parser) + except ConftestImportFailure: + e = sys.exc_info()[1] + if ns.help or ns.version: + # we don't want to prevent --help/--version to work + # so just let is pass and print a warning at the end + self._warn("could not load initial conftests (%s)\n" % e.path) + else: + raise + + def _checkversion(self): + import pytest + minver = self.inicfg.get('minversion', None) + if minver: + ver = minver.split(".") + myver = pytest.__version__.split(".") + if myver < ver: + raise pytest.UsageError( + "%s:%d: requires pytest-%s, actual pytest-%s'" %( + self.inicfg.config.path, self.inicfg.lineof('minversion'), + minver, pytest.__version__)) + + def parse(self, args, addopts=True): + # parse given cmdline arguments into this config object. + assert not hasattr(self, 'args'), ( + "can only parse cmdline args at most once per Config object") + self._origargs = args + self.hook.pytest_addhooks.call_historic( + kwargs=dict(pluginmanager=self.pluginmanager)) + self._preparse(args, addopts=addopts) + # XXX deprecated hook: + self.hook.pytest_cmdline_preparse(config=self, args=args) + args = self._parser.parse_setoption(args, self.option, namespace=self.option) + if not args: + cwd = os.getcwd() + if cwd == self.rootdir: + args = self.getini('testpaths') + if not args: + args = [cwd] + self.args = args + + def addinivalue_line(self, name, line): + """ add a line to an ini-file option. The option must have been + declared but might not yet be set in which case the line becomes the + the first line in its value. """ + x = self.getini(name) + assert isinstance(x, list) + x.append(line) # modifies the cached list inline + + def getini(self, name): + """ return configuration value from an :ref:`ini file <inifiles>`. If the + specified name hasn't been registered through a prior + :py:func:`parser.addini <pytest.config.Parser.addini>` + call (usually from a plugin), a ValueError is raised. """ + try: + return self._inicache[name] + except KeyError: + self._inicache[name] = val = self._getini(name) + return val + + def _getini(self, name): + try: + description, type, default = self._parser._inidict[name] + except KeyError: + raise ValueError("unknown configuration value: %r" %(name,)) + try: + value = self.inicfg[name] + except KeyError: + if default is not None: + return default + if type is None: + return '' + return [] + if type == "pathlist": + dp = py.path.local(self.inicfg.config.path).dirpath() + l = [] + for relpath in shlex.split(value): + l.append(dp.join(relpath, abs=True)) + return l + elif type == "args": + return shlex.split(value) + elif type == "linelist": + return [t for t in map(lambda x: x.strip(), value.split("\n")) if t] + elif type == "bool": + return bool(_strtobool(value.strip())) + else: + assert type is None + return value + + def _getconftest_pathlist(self, name, path): + try: + mod, relroots = self.pluginmanager._rget_with_confmod(name, path) + except KeyError: + return None + modpath = py.path.local(mod.__file__).dirpath() + l = [] + for relroot in relroots: + if not isinstance(relroot, py.path.local): + relroot = relroot.replace("/", py.path.local.sep) + relroot = modpath.join(relroot, abs=True) + l.append(relroot) + return l + + def getoption(self, name, default=notset, skip=False): + """ return command line option value. + + :arg name: name of the option. You may also specify + the literal ``--OPT`` option instead of the "dest" option name. + :arg default: default value if no option of that name exists. + :arg skip: if True raise pytest.skip if option does not exists + or has a None value. + """ + name = self._opt2dest.get(name, name) + try: + val = getattr(self.option, name) + if val is None and skip: + raise AttributeError(name) + return val + except AttributeError: + if default is not notset: + return default + if skip: + import pytest + pytest.skip("no %r option found" %(name,)) + raise ValueError("no option named %r" % (name,)) + + def getvalue(self, name, path=None): + """ (deprecated, use getoption()) """ + return self.getoption(name) + + def getvalueorskip(self, name, path=None): + """ (deprecated, use getoption(skip=True)) """ + return self.getoption(name, skip=True) + +def exists(path, ignore=EnvironmentError): + try: + return path.check() + except ignore: + return False + +def getcfg(args, inibasenames): + args = [x for x in args if not str(x).startswith("-")] + if not args: + args = [py.path.local()] + for arg in args: + arg = py.path.local(arg) + for base in arg.parts(reverse=True): + for inibasename in inibasenames: + p = base.join(inibasename) + if exists(p): + iniconfig = py.iniconfig.IniConfig(p) + if 'pytest' in iniconfig.sections: + return base, p, iniconfig['pytest'] + elif inibasename == "pytest.ini": + # allowed to be empty + return base, p, {} + return None, None, None + + +def get_common_ancestor(args): + # args are what we get after early command line parsing (usually + # strings, but can be py.path.local objects as well) + common_ancestor = None + for arg in args: + if str(arg)[0] == "-": + continue + p = py.path.local(arg) + if common_ancestor is None: + common_ancestor = p + else: + if p.relto(common_ancestor) or p == common_ancestor: + continue + elif common_ancestor.relto(p): + common_ancestor = p + else: + shared = p.common(common_ancestor) + if shared is not None: + common_ancestor = shared + if common_ancestor is None: + common_ancestor = py.path.local() + elif not common_ancestor.isdir(): + common_ancestor = common_ancestor.dirpath() + return common_ancestor + + +def determine_setup(inifile, args): + if inifile: + iniconfig = py.iniconfig.IniConfig(inifile) + try: + inicfg = iniconfig["pytest"] + except KeyError: + inicfg = None + rootdir = get_common_ancestor(args) + else: + ancestor = get_common_ancestor(args) + rootdir, inifile, inicfg = getcfg( + [ancestor], ["pytest.ini", "tox.ini", "setup.cfg"]) + if rootdir is None: + for rootdir in ancestor.parts(reverse=True): + if rootdir.join("setup.py").exists(): + break + else: + rootdir = ancestor + return rootdir, inifile, inicfg or {} + + +def setns(obj, dic): + import pytest + for name, value in dic.items(): + if isinstance(value, dict): + mod = getattr(obj, name, None) + if mod is None: + modname = "pytest.%s" % name + mod = types.ModuleType(modname) + sys.modules[modname] = mod + mod.__all__ = [] + setattr(obj, name, mod) + obj.__all__.append(name) + setns(mod, value) + else: + setattr(obj, name, value) + obj.__all__.append(name) + #if obj != pytest: + # pytest.__all__.append(name) + setattr(pytest, name, value) + + +def create_terminal_writer(config, *args, **kwargs): + """Create a TerminalWriter instance configured according to the options + in the config object. Every code which requires a TerminalWriter object + and has access to a config object should use this function. + """ + tw = py.io.TerminalWriter(*args, **kwargs) + if config.option.color == 'yes': + tw.hasmarkup = True + if config.option.color == 'no': + tw.hasmarkup = False + return tw + + +def _strtobool(val): + """Convert a string representation of truth to true (1) or false (0). + + True values are 'y', 'yes', 't', 'true', 'on', and '1'; false values + are 'n', 'no', 'f', 'false', 'off', and '0'. Raises ValueError if + 'val' is anything else. + + .. note:: copied from distutils.util + """ + val = val.lower() + if val in ('y', 'yes', 't', 'true', 'on', '1'): + return 1 + elif val in ('n', 'no', 'f', 'false', 'off', '0'): + return 0 + else: + raise ValueError("invalid truth value %r" % (val,)) diff --git a/python/pytest/_pytest/doctest.py b/python/pytest/_pytest/doctest.py new file mode 100644 index 0000000000..a57f7a4949 --- /dev/null +++ b/python/pytest/_pytest/doctest.py @@ -0,0 +1,290 @@ +""" discover and run doctests in modules and test files.""" +from __future__ import absolute_import + +import traceback + +import pytest +from _pytest._code.code import TerminalRepr, ReprFileLocation, ExceptionInfo +from _pytest.python import FixtureRequest + + + +def pytest_addoption(parser): + parser.addini('doctest_optionflags', 'option flags for doctests', + type="args", default=["ELLIPSIS"]) + group = parser.getgroup("collect") + group.addoption("--doctest-modules", + action="store_true", default=False, + help="run doctests in all .py modules", + dest="doctestmodules") + group.addoption("--doctest-glob", + action="append", default=[], metavar="pat", + help="doctests file matching pattern, default: test*.txt", + dest="doctestglob") + group.addoption("--doctest-ignore-import-errors", + action="store_true", default=False, + help="ignore doctest ImportErrors", + dest="doctest_ignore_import_errors") + + +def pytest_collect_file(path, parent): + config = parent.config + if path.ext == ".py": + if config.option.doctestmodules: + return DoctestModule(path, parent) + elif _is_doctest(config, path, parent): + return DoctestTextfile(path, parent) + + +def _is_doctest(config, path, parent): + if path.ext in ('.txt', '.rst') and parent.session.isinitpath(path): + return True + globs = config.getoption("doctestglob") or ['test*.txt'] + for glob in globs: + if path.check(fnmatch=glob): + return True + return False + + +class ReprFailDoctest(TerminalRepr): + + def __init__(self, reprlocation, lines): + self.reprlocation = reprlocation + self.lines = lines + + def toterminal(self, tw): + for line in self.lines: + tw.line(line) + self.reprlocation.toterminal(tw) + + +class DoctestItem(pytest.Item): + + def __init__(self, name, parent, runner=None, dtest=None): + super(DoctestItem, self).__init__(name, parent) + self.runner = runner + self.dtest = dtest + self.obj = None + self.fixture_request = None + + def setup(self): + if self.dtest is not None: + self.fixture_request = _setup_fixtures(self) + globs = dict(getfixture=self.fixture_request.getfuncargvalue) + self.dtest.globs.update(globs) + + def runtest(self): + _check_all_skipped(self.dtest) + self.runner.run(self.dtest) + + def repr_failure(self, excinfo): + import doctest + if excinfo.errisinstance((doctest.DocTestFailure, + doctest.UnexpectedException)): + doctestfailure = excinfo.value + example = doctestfailure.example + test = doctestfailure.test + filename = test.filename + if test.lineno is None: + lineno = None + else: + lineno = test.lineno + example.lineno + 1 + message = excinfo.type.__name__ + reprlocation = ReprFileLocation(filename, lineno, message) + checker = _get_checker() + REPORT_UDIFF = doctest.REPORT_UDIFF + if lineno is not None: + lines = doctestfailure.test.docstring.splitlines(False) + # add line numbers to the left of the error message + lines = ["%03d %s" % (i + test.lineno + 1, x) + for (i, x) in enumerate(lines)] + # trim docstring error lines to 10 + lines = lines[example.lineno - 9:example.lineno + 1] + else: + lines = ['EXAMPLE LOCATION UNKNOWN, not showing all tests of that example'] + indent = '>>>' + for line in example.source.splitlines(): + lines.append('??? %s %s' % (indent, line)) + indent = '...' + if excinfo.errisinstance(doctest.DocTestFailure): + lines += checker.output_difference(example, + doctestfailure.got, REPORT_UDIFF).split("\n") + else: + inner_excinfo = ExceptionInfo(excinfo.value.exc_info) + lines += ["UNEXPECTED EXCEPTION: %s" % + repr(inner_excinfo.value)] + lines += traceback.format_exception(*excinfo.value.exc_info) + return ReprFailDoctest(reprlocation, lines) + else: + return super(DoctestItem, self).repr_failure(excinfo) + + def reportinfo(self): + return self.fspath, None, "[doctest] %s" % self.name + + +def _get_flag_lookup(): + import doctest + return dict(DONT_ACCEPT_TRUE_FOR_1=doctest.DONT_ACCEPT_TRUE_FOR_1, + DONT_ACCEPT_BLANKLINE=doctest.DONT_ACCEPT_BLANKLINE, + NORMALIZE_WHITESPACE=doctest.NORMALIZE_WHITESPACE, + ELLIPSIS=doctest.ELLIPSIS, + IGNORE_EXCEPTION_DETAIL=doctest.IGNORE_EXCEPTION_DETAIL, + COMPARISON_FLAGS=doctest.COMPARISON_FLAGS, + ALLOW_UNICODE=_get_allow_unicode_flag(), + ALLOW_BYTES=_get_allow_bytes_flag(), + ) + + +def get_optionflags(parent): + optionflags_str = parent.config.getini("doctest_optionflags") + flag_lookup_table = _get_flag_lookup() + flag_acc = 0 + for flag in optionflags_str: + flag_acc |= flag_lookup_table[flag] + return flag_acc + + +class DoctestTextfile(DoctestItem, pytest.Module): + + def runtest(self): + import doctest + fixture_request = _setup_fixtures(self) + + # inspired by doctest.testfile; ideally we would use it directly, + # but it doesn't support passing a custom checker + text = self.fspath.read() + filename = str(self.fspath) + name = self.fspath.basename + globs = dict(getfixture=fixture_request.getfuncargvalue) + if '__name__' not in globs: + globs['__name__'] = '__main__' + + optionflags = get_optionflags(self) + runner = doctest.DebugRunner(verbose=0, optionflags=optionflags, + checker=_get_checker()) + + parser = doctest.DocTestParser() + test = parser.get_doctest(text, globs, name, filename, 0) + _check_all_skipped(test) + runner.run(test) + + +def _check_all_skipped(test): + """raises pytest.skip() if all examples in the given DocTest have the SKIP + option set. + """ + import doctest + all_skipped = all(x.options.get(doctest.SKIP, False) for x in test.examples) + if all_skipped: + pytest.skip('all tests skipped by +SKIP option') + + +class DoctestModule(pytest.Module): + def collect(self): + import doctest + if self.fspath.basename == "conftest.py": + module = self.config.pluginmanager._importconftest(self.fspath) + else: + try: + module = self.fspath.pyimport() + except ImportError: + if self.config.getvalue('doctest_ignore_import_errors'): + pytest.skip('unable to import module %r' % self.fspath) + else: + raise + # uses internal doctest module parsing mechanism + finder = doctest.DocTestFinder() + optionflags = get_optionflags(self) + runner = doctest.DebugRunner(verbose=0, optionflags=optionflags, + checker=_get_checker()) + for test in finder.find(module, module.__name__): + if test.examples: # skip empty doctests + yield DoctestItem(test.name, self, runner, test) + + +def _setup_fixtures(doctest_item): + """ + Used by DoctestTextfile and DoctestItem to setup fixture information. + """ + def func(): + pass + + doctest_item.funcargs = {} + fm = doctest_item.session._fixturemanager + doctest_item._fixtureinfo = fm.getfixtureinfo(node=doctest_item, func=func, + cls=None, funcargs=False) + fixture_request = FixtureRequest(doctest_item) + fixture_request._fillfixtures() + return fixture_request + + +def _get_checker(): + """ + Returns a doctest.OutputChecker subclass that takes in account the + ALLOW_UNICODE option to ignore u'' prefixes in strings and ALLOW_BYTES + to strip b'' prefixes. + Useful when the same doctest should run in Python 2 and Python 3. + + An inner class is used to avoid importing "doctest" at the module + level. + """ + if hasattr(_get_checker, 'LiteralsOutputChecker'): + return _get_checker.LiteralsOutputChecker() + + import doctest + import re + + class LiteralsOutputChecker(doctest.OutputChecker): + """ + Copied from doctest_nose_plugin.py from the nltk project: + https://github.com/nltk/nltk + + Further extended to also support byte literals. + """ + + _unicode_literal_re = re.compile(r"(\W|^)[uU]([rR]?[\'\"])", re.UNICODE) + _bytes_literal_re = re.compile(r"(\W|^)[bB]([rR]?[\'\"])", re.UNICODE) + + def check_output(self, want, got, optionflags): + res = doctest.OutputChecker.check_output(self, want, got, + optionflags) + if res: + return True + + allow_unicode = optionflags & _get_allow_unicode_flag() + allow_bytes = optionflags & _get_allow_bytes_flag() + if not allow_unicode and not allow_bytes: + return False + + else: # pragma: no cover + def remove_prefixes(regex, txt): + return re.sub(regex, r'\1\2', txt) + + if allow_unicode: + want = remove_prefixes(self._unicode_literal_re, want) + got = remove_prefixes(self._unicode_literal_re, got) + if allow_bytes: + want = remove_prefixes(self._bytes_literal_re, want) + got = remove_prefixes(self._bytes_literal_re, got) + res = doctest.OutputChecker.check_output(self, want, got, + optionflags) + return res + + _get_checker.LiteralsOutputChecker = LiteralsOutputChecker + return _get_checker.LiteralsOutputChecker() + + +def _get_allow_unicode_flag(): + """ + Registers and returns the ALLOW_UNICODE flag. + """ + import doctest + return doctest.register_optionflag('ALLOW_UNICODE') + + +def _get_allow_bytes_flag(): + """ + Registers and returns the ALLOW_BYTES flag. + """ + import doctest + return doctest.register_optionflag('ALLOW_BYTES') diff --git a/python/pytest/_pytest/genscript.py b/python/pytest/_pytest/genscript.py new file mode 100755 index 0000000000..d2962d8fc8 --- /dev/null +++ b/python/pytest/_pytest/genscript.py @@ -0,0 +1,132 @@ +""" (deprecated) generate a single-file self-contained version of pytest """ +import os +import sys +import pkgutil + +import py +import _pytest + + + +def find_toplevel(name): + for syspath in sys.path: + base = py.path.local(syspath) + lib = base/name + if lib.check(dir=1): + return lib + mod = base.join("%s.py" % name) + if mod.check(file=1): + return mod + raise LookupError(name) + +def pkgname(toplevel, rootpath, path): + parts = path.parts()[len(rootpath.parts()):] + return '.'.join([toplevel] + [x.purebasename for x in parts]) + +def pkg_to_mapping(name): + toplevel = find_toplevel(name) + name2src = {} + if toplevel.check(file=1): # module + name2src[toplevel.purebasename] = toplevel.read() + else: # package + for pyfile in toplevel.visit('*.py'): + pkg = pkgname(name, toplevel, pyfile) + name2src[pkg] = pyfile.read() + # with wheels py source code might be not be installed + # and the resulting genscript is useless, just bail out. + assert name2src, "no source code found for %r at %r" %(name, toplevel) + return name2src + +def compress_mapping(mapping): + import base64, pickle, zlib + data = pickle.dumps(mapping, 2) + data = zlib.compress(data, 9) + data = base64.encodestring(data) + data = data.decode('ascii') + return data + + +def compress_packages(names): + mapping = {} + for name in names: + mapping.update(pkg_to_mapping(name)) + return compress_mapping(mapping) + +def generate_script(entry, packages): + data = compress_packages(packages) + tmpl = py.path.local(__file__).dirpath().join('standalonetemplate.py') + exe = tmpl.read() + exe = exe.replace('@SOURCES@', data) + exe = exe.replace('@ENTRY@', entry) + return exe + + +def pytest_addoption(parser): + group = parser.getgroup("debugconfig") + group.addoption("--genscript", action="store", default=None, + dest="genscript", metavar="path", + help="create standalone pytest script at given target path.") + +def pytest_cmdline_main(config): + import _pytest.config + genscript = config.getvalue("genscript") + if genscript: + tw = _pytest.config.create_terminal_writer(config) + tw.line("WARNING: usage of genscript is deprecated.", + red=True) + deps = ['py', '_pytest', 'pytest'] # pluggy is vendored + if sys.version_info < (2,7): + deps.append("argparse") + tw.line("generated script will run on python2.6-python3.3++") + else: + tw.line("WARNING: generated script will not run on python2.6 " + "due to 'argparse' dependency. Use python2.6 " + "to generate a python2.6 compatible script", red=True) + script = generate_script( + 'import pytest; raise SystemExit(pytest.cmdline.main())', + deps, + ) + genscript = py.path.local(genscript) + genscript.write(script) + tw.line("generated pytest standalone script: %s" % genscript, + bold=True) + return 0 + + +def pytest_namespace(): + return {'freeze_includes': freeze_includes} + + +def freeze_includes(): + """ + Returns a list of module names used by py.test that should be + included by cx_freeze. + """ + result = list(_iter_all_modules(py)) + result += list(_iter_all_modules(_pytest)) + return result + + +def _iter_all_modules(package, prefix=''): + """ + Iterates over the names of all modules that can be found in the given + package, recursively. + + Example: + _iter_all_modules(_pytest) -> + ['_pytest.assertion.newinterpret', + '_pytest.capture', + '_pytest.core', + ... + ] + """ + if type(package) is not str: + path, prefix = package.__path__[0], package.__name__ + '.' + else: + path = package + for _, name, is_package in pkgutil.iter_modules([path]): + if is_package: + for m in _iter_all_modules(os.path.join(path, name), prefix=name + '.'): + yield prefix + m + else: + yield prefix + name diff --git a/python/pytest/_pytest/helpconfig.py b/python/pytest/_pytest/helpconfig.py new file mode 100644 index 0000000000..1df0c56ac7 --- /dev/null +++ b/python/pytest/_pytest/helpconfig.py @@ -0,0 +1,139 @@ +""" version info, help messages, tracing configuration. """ +import py +import pytest +import os, sys + +def pytest_addoption(parser): + group = parser.getgroup('debugconfig') + group.addoption('--version', action="store_true", + help="display pytest lib version and import information.") + group._addoption("-h", "--help", action="store_true", dest="help", + help="show help message and configuration info") + group._addoption('-p', action="append", dest="plugins", default = [], + metavar="name", + help="early-load given plugin (multi-allowed). " + "To avoid loading of plugins, use the `no:` prefix, e.g. " + "`no:doctest`.") + group.addoption('--traceconfig', '--trace-config', + action="store_true", default=False, + help="trace considerations of conftest.py files."), + group.addoption('--debug', + action="store_true", dest="debug", default=False, + help="store internal tracing debug information in 'pytestdebug.log'.") + + +@pytest.hookimpl(hookwrapper=True) +def pytest_cmdline_parse(): + outcome = yield + config = outcome.get_result() + if config.option.debug: + path = os.path.abspath("pytestdebug.log") + debugfile = open(path, 'w') + debugfile.write("versions pytest-%s, py-%s, " + "python-%s\ncwd=%s\nargs=%s\n\n" %( + pytest.__version__, py.__version__, + ".".join(map(str, sys.version_info)), + os.getcwd(), config._origargs)) + config.trace.root.setwriter(debugfile.write) + undo_tracing = config.pluginmanager.enable_tracing() + sys.stderr.write("writing pytestdebug information to %s\n" % path) + def unset_tracing(): + debugfile.close() + sys.stderr.write("wrote pytestdebug information to %s\n" % + debugfile.name) + config.trace.root.setwriter(None) + undo_tracing() + config.add_cleanup(unset_tracing) + +def pytest_cmdline_main(config): + if config.option.version: + p = py.path.local(pytest.__file__) + sys.stderr.write("This is pytest version %s, imported from %s\n" % + (pytest.__version__, p)) + plugininfo = getpluginversioninfo(config) + if plugininfo: + for line in plugininfo: + sys.stderr.write(line + "\n") + return 0 + elif config.option.help: + config._do_configure() + showhelp(config) + config._ensure_unconfigure() + return 0 + +def showhelp(config): + reporter = config.pluginmanager.get_plugin('terminalreporter') + tw = reporter._tw + tw.write(config._parser.optparser.format_help()) + tw.line() + tw.line() + #tw.sep( "=", "config file settings") + tw.line("[pytest] ini-options in the next " + "pytest.ini|tox.ini|setup.cfg file:") + tw.line() + + for name in config._parser._ininames: + help, type, default = config._parser._inidict[name] + if type is None: + type = "string" + spec = "%s (%s)" % (name, type) + line = " %-24s %s" %(spec, help) + tw.line(line[:tw.fullwidth]) + + tw.line() + tw.line("environment variables:") + vars = [ + ("PYTEST_ADDOPTS", "extra command line options"), + ("PYTEST_PLUGINS", "comma-separated plugins to load during startup"), + ("PYTEST_DEBUG", "set to enable debug tracing of pytest's internals") + ] + for name, help in vars: + tw.line(" %-24s %s" % (name, help)) + tw.line() + tw.line() + + tw.line("to see available markers type: py.test --markers") + tw.line("to see available fixtures type: py.test --fixtures") + tw.line("(shown according to specified file_or_dir or current dir " + "if not specified)") + + for warningreport in reporter.stats.get('warnings', []): + tw.line("warning : " + warningreport.message, red=True) + return + + +conftest_options = [ + ('pytest_plugins', 'list of plugin names to load'), +] + +def getpluginversioninfo(config): + lines = [] + plugininfo = config.pluginmanager.list_plugin_distinfo() + if plugininfo: + lines.append("setuptools registered plugins:") + for plugin, dist in plugininfo: + loc = getattr(plugin, '__file__', repr(plugin)) + content = "%s-%s at %s" % (dist.project_name, dist.version, loc) + lines.append(" " + content) + return lines + +def pytest_report_header(config): + lines = [] + if config.option.debug or config.option.traceconfig: + lines.append("using: pytest-%s pylib-%s" % + (pytest.__version__,py.__version__)) + + verinfo = getpluginversioninfo(config) + if verinfo: + lines.extend(verinfo) + + if config.option.traceconfig: + lines.append("active plugins:") + items = config.pluginmanager.list_name_plugin() + for name, plugin in items: + if hasattr(plugin, '__file__'): + r = plugin.__file__ + else: + r = repr(plugin) + lines.append(" %-20s: %s" %(name, r)) + return lines diff --git a/python/pytest/_pytest/hookspec.py b/python/pytest/_pytest/hookspec.py new file mode 100644 index 0000000000..60e9b47d26 --- /dev/null +++ b/python/pytest/_pytest/hookspec.py @@ -0,0 +1,295 @@ +""" hook specifications for pytest plugins, invoked from main.py and builtin plugins. """ + +from _pytest._pluggy import HookspecMarker + +hookspec = HookspecMarker("pytest") + +# ------------------------------------------------------------------------- +# Initialization hooks called for every plugin +# ------------------------------------------------------------------------- + +@hookspec(historic=True) +def pytest_addhooks(pluginmanager): + """called at plugin registration time to allow adding new hooks via a call to + pluginmanager.add_hookspecs(module_or_class, prefix).""" + + +@hookspec(historic=True) +def pytest_namespace(): + """return dict of name->object to be made globally available in + the pytest namespace. This hook is called at plugin registration + time. + """ + +@hookspec(historic=True) +def pytest_plugin_registered(plugin, manager): + """ a new pytest plugin got registered. """ + + +@hookspec(historic=True) +def pytest_addoption(parser): + """register argparse-style options and ini-style config values, + called once at the beginning of a test run. + + .. note:: + + This function should be implemented only in plugins or ``conftest.py`` + files situated at the tests root directory due to how py.test + :ref:`discovers plugins during startup <pluginorder>`. + + :arg parser: To add command line options, call + :py:func:`parser.addoption(...) <_pytest.config.Parser.addoption>`. + To add ini-file values call :py:func:`parser.addini(...) + <_pytest.config.Parser.addini>`. + + Options can later be accessed through the + :py:class:`config <_pytest.config.Config>` object, respectively: + + - :py:func:`config.getoption(name) <_pytest.config.Config.getoption>` to + retrieve the value of a command line option. + + - :py:func:`config.getini(name) <_pytest.config.Config.getini>` to retrieve + a value read from an ini-style file. + + The config object is passed around on many internal objects via the ``.config`` + attribute or can be retrieved as the ``pytestconfig`` fixture or accessed + via (deprecated) ``pytest.config``. + """ + +@hookspec(historic=True) +def pytest_configure(config): + """ called after command line options have been parsed + and all plugins and initial conftest files been loaded. + This hook is called for every plugin. + """ + +# ------------------------------------------------------------------------- +# Bootstrapping hooks called for plugins registered early enough: +# internal and 3rd party plugins as well as directly +# discoverable conftest.py local plugins. +# ------------------------------------------------------------------------- + +@hookspec(firstresult=True) +def pytest_cmdline_parse(pluginmanager, args): + """return initialized config object, parsing the specified args. """ + +def pytest_cmdline_preparse(config, args): + """(deprecated) modify command line arguments before option parsing. """ + +@hookspec(firstresult=True) +def pytest_cmdline_main(config): + """ called for performing the main command line action. The default + implementation will invoke the configure hooks and runtest_mainloop. """ + +def pytest_load_initial_conftests(early_config, parser, args): + """ implements the loading of initial conftest files ahead + of command line option parsing. """ + + +# ------------------------------------------------------------------------- +# collection hooks +# ------------------------------------------------------------------------- + +@hookspec(firstresult=True) +def pytest_collection(session): + """ perform the collection protocol for the given session. """ + +def pytest_collection_modifyitems(session, config, items): + """ called after collection has been performed, may filter or re-order + the items in-place.""" + +def pytest_collection_finish(session): + """ called after collection has been performed and modified. """ + +@hookspec(firstresult=True) +def pytest_ignore_collect(path, config): + """ return True to prevent considering this path for collection. + This hook is consulted for all files and directories prior to calling + more specific hooks. + """ + +@hookspec(firstresult=True) +def pytest_collect_directory(path, parent): + """ called before traversing a directory for collection files. """ + +def pytest_collect_file(path, parent): + """ return collection Node or None for the given path. Any new node + needs to have the specified ``parent`` as a parent.""" + +# logging hooks for collection +def pytest_collectstart(collector): + """ collector starts collecting. """ + +def pytest_itemcollected(item): + """ we just collected a test item. """ + +def pytest_collectreport(report): + """ collector finished collecting. """ + +def pytest_deselected(items): + """ called for test items deselected by keyword. """ + +@hookspec(firstresult=True) +def pytest_make_collect_report(collector): + """ perform ``collector.collect()`` and return a CollectReport. """ + +# ------------------------------------------------------------------------- +# Python test function related hooks +# ------------------------------------------------------------------------- + +@hookspec(firstresult=True) +def pytest_pycollect_makemodule(path, parent): + """ return a Module collector or None for the given path. + This hook will be called for each matching test module path. + The pytest_collect_file hook needs to be used if you want to + create test modules for files that do not match as a test module. + """ + +@hookspec(firstresult=True) +def pytest_pycollect_makeitem(collector, name, obj): + """ return custom item/collector for a python object in a module, or None. """ + +@hookspec(firstresult=True) +def pytest_pyfunc_call(pyfuncitem): + """ call underlying test function. """ + +def pytest_generate_tests(metafunc): + """ generate (multiple) parametrized calls to a test function.""" + +# ------------------------------------------------------------------------- +# generic runtest related hooks +# ------------------------------------------------------------------------- + +@hookspec(firstresult=True) +def pytest_runtestloop(session): + """ called for performing the main runtest loop + (after collection finished). """ + +def pytest_itemstart(item, node): + """ (deprecated, use pytest_runtest_logstart). """ + +@hookspec(firstresult=True) +def pytest_runtest_protocol(item, nextitem): + """ implements the runtest_setup/call/teardown protocol for + the given test item, including capturing exceptions and calling + reporting hooks. + + :arg item: test item for which the runtest protocol is performed. + + :arg nextitem: the scheduled-to-be-next test item (or None if this + is the end my friend). This argument is passed on to + :py:func:`pytest_runtest_teardown`. + + :return boolean: True if no further hook implementations should be invoked. + """ + +def pytest_runtest_logstart(nodeid, location): + """ signal the start of running a single test item. """ + +def pytest_runtest_setup(item): + """ called before ``pytest_runtest_call(item)``. """ + +def pytest_runtest_call(item): + """ called to execute the test ``item``. """ + +def pytest_runtest_teardown(item, nextitem): + """ called after ``pytest_runtest_call``. + + :arg nextitem: the scheduled-to-be-next test item (None if no further + test item is scheduled). This argument can be used to + perform exact teardowns, i.e. calling just enough finalizers + so that nextitem only needs to call setup-functions. + """ + +@hookspec(firstresult=True) +def pytest_runtest_makereport(item, call): + """ return a :py:class:`_pytest.runner.TestReport` object + for the given :py:class:`pytest.Item` and + :py:class:`_pytest.runner.CallInfo`. + """ + +def pytest_runtest_logreport(report): + """ process a test setup/call/teardown report relating to + the respective phase of executing a test. """ + +# ------------------------------------------------------------------------- +# test session related hooks +# ------------------------------------------------------------------------- + +def pytest_sessionstart(session): + """ before session.main() is called. """ + +def pytest_sessionfinish(session, exitstatus): + """ whole test run finishes. """ + +def pytest_unconfigure(config): + """ called before test process is exited. """ + + +# ------------------------------------------------------------------------- +# hooks for customising the assert methods +# ------------------------------------------------------------------------- + +def pytest_assertrepr_compare(config, op, left, right): + """return explanation for comparisons in failing assert expressions. + + Return None for no custom explanation, otherwise return a list + of strings. The strings will be joined by newlines but any newlines + *in* a string will be escaped. Note that all but the first line will + be indented sligthly, the intention is for the first line to be a summary. + """ + +# ------------------------------------------------------------------------- +# hooks for influencing reporting (invoked from _pytest_terminal) +# ------------------------------------------------------------------------- + +def pytest_report_header(config, startdir): + """ return a string to be displayed as header info for terminal reporting.""" + +@hookspec(firstresult=True) +def pytest_report_teststatus(report): + """ return result-category, shortletter and verbose word for reporting.""" + +def pytest_terminal_summary(terminalreporter): + """ add additional section in terminal summary reporting. """ + + +@hookspec(historic=True) +def pytest_logwarning(message, code, nodeid, fslocation): + """ process a warning specified by a message, a code string, + a nodeid and fslocation (both of which may be None + if the warning is not tied to a partilar node/location).""" + +# ------------------------------------------------------------------------- +# doctest hooks +# ------------------------------------------------------------------------- + +@hookspec(firstresult=True) +def pytest_doctest_prepare_content(content): + """ return processed content for a given doctest""" + +# ------------------------------------------------------------------------- +# error handling and internal debugging hooks +# ------------------------------------------------------------------------- + +def pytest_internalerror(excrepr, excinfo): + """ called for internal errors. """ + +def pytest_keyboard_interrupt(excinfo): + """ called for keyboard interrupt. """ + +def pytest_exception_interact(node, call, report): + """called when an exception was raised which can potentially be + interactively handled. + + This hook is only called if an exception was raised + that is not an internal exception like ``skip.Exception``. + """ + +def pytest_enter_pdb(config): + """ called upon pdb.set_trace(), can be used by plugins to take special + action just before the python debugger enters in interactive mode. + + :arg config: pytest config object + :type config: _pytest.config.Config + """ diff --git a/python/pytest/_pytest/junitxml.py b/python/pytest/_pytest/junitxml.py new file mode 100644 index 0000000000..f4de1343ed --- /dev/null +++ b/python/pytest/_pytest/junitxml.py @@ -0,0 +1,387 @@ +""" + report test results in JUnit-XML format, + for use with Jenkins and build integration servers. + + +Based on initial code from Ross Lawley. +""" +# Output conforms to https://github.com/jenkinsci/xunit-plugin/blob/master/ +# src/main/resources/org/jenkinsci/plugins/xunit/types/model/xsd/junit-10.xsd + +import py +import os +import re +import sys +import time +import pytest + +# Python 2.X and 3.X compatibility +if sys.version_info[0] < 3: + from codecs import open +else: + unichr = chr + unicode = str + long = int + + +class Junit(py.xml.Namespace): + pass + +# We need to get the subset of the invalid unicode ranges according to +# XML 1.0 which are valid in this python build. Hence we calculate +# this dynamically instead of hardcoding it. The spec range of valid +# chars is: Char ::= #x9 | #xA | #xD | [#x20-#xD7FF] | [#xE000-#xFFFD] +# | [#x10000-#x10FFFF] +_legal_chars = (0x09, 0x0A, 0x0d) +_legal_ranges = ( + (0x20, 0x7E), (0x80, 0xD7FF), (0xE000, 0xFFFD), (0x10000, 0x10FFFF), +) +_legal_xml_re = [ + unicode("%s-%s") % (unichr(low), unichr(high)) + for (low, high) in _legal_ranges if low < sys.maxunicode +] +_legal_xml_re = [unichr(x) for x in _legal_chars] + _legal_xml_re +illegal_xml_re = re.compile(unicode('[^%s]') % unicode('').join(_legal_xml_re)) +del _legal_chars +del _legal_ranges +del _legal_xml_re + +_py_ext_re = re.compile(r"\.py$") + + +def bin_xml_escape(arg): + def repl(matchobj): + i = ord(matchobj.group()) + if i <= 0xFF: + return unicode('#x%02X') % i + else: + return unicode('#x%04X') % i + + return py.xml.raw(illegal_xml_re.sub(repl, py.xml.escape(arg))) + + +class _NodeReporter(object): + def __init__(self, nodeid, xml): + + self.id = nodeid + self.xml = xml + self.add_stats = self.xml.add_stats + self.duration = 0 + self.properties = [] + self.nodes = [] + self.testcase = None + self.attrs = {} + + def append(self, node): + self.xml.add_stats(type(node).__name__) + self.nodes.append(node) + + def add_property(self, name, value): + self.properties.append((str(name), bin_xml_escape(value))) + + def make_properties_node(self): + """Return a Junit node containing custom properties, if any. + """ + if self.properties: + return Junit.properties([ + Junit.property(name=name, value=value) + for name, value in self.properties + ]) + return '' + + def record_testreport(self, testreport): + assert not self.testcase + names = mangle_test_address(testreport.nodeid) + classnames = names[:-1] + if self.xml.prefix: + classnames.insert(0, self.xml.prefix) + attrs = { + "classname": ".".join(classnames), + "name": bin_xml_escape(names[-1]), + "file": testreport.location[0], + } + if testreport.location[1] is not None: + attrs["line"] = testreport.location[1] + self.attrs = attrs + + def to_xml(self): + testcase = Junit.testcase(time=self.duration, **self.attrs) + testcase.append(self.make_properties_node()) + for node in self.nodes: + testcase.append(node) + return testcase + + def _add_simple(self, kind, message, data=None): + data = bin_xml_escape(data) + node = kind(data, message=message) + self.append(node) + + def _write_captured_output(self, report): + for capname in ('out', 'err'): + allcontent = "" + for name, content in report.get_sections("Captured std%s" % + capname): + allcontent += content + if allcontent: + tag = getattr(Junit, 'system-' + capname) + self.append(tag(bin_xml_escape(allcontent))) + + def append_pass(self, report): + self.add_stats('passed') + self._write_captured_output(report) + + def append_failure(self, report): + # msg = str(report.longrepr.reprtraceback.extraline) + if hasattr(report, "wasxfail"): + self._add_simple( + Junit.skipped, + "xfail-marked test passes unexpectedly") + else: + if hasattr(report.longrepr, "reprcrash"): + message = report.longrepr.reprcrash.message + elif isinstance(report.longrepr, (unicode, str)): + message = report.longrepr + else: + message = str(report.longrepr) + message = bin_xml_escape(message) + fail = Junit.failure(message=message) + fail.append(bin_xml_escape(report.longrepr)) + self.append(fail) + self._write_captured_output(report) + + def append_collect_error(self, report): + # msg = str(report.longrepr.reprtraceback.extraline) + self.append(Junit.error(bin_xml_escape(report.longrepr), + message="collection failure")) + + def append_collect_skipped(self, report): + self._add_simple( + Junit.skipped, "collection skipped", report.longrepr) + + def append_error(self, report): + self._add_simple( + Junit.error, "test setup failure", report.longrepr) + self._write_captured_output(report) + + def append_skipped(self, report): + if hasattr(report, "wasxfail"): + self._add_simple( + Junit.skipped, "expected test failure", report.wasxfail + ) + else: + filename, lineno, skipreason = report.longrepr + if skipreason.startswith("Skipped: "): + skipreason = bin_xml_escape(skipreason[9:]) + self.append( + Junit.skipped("%s:%s: %s" % (filename, lineno, skipreason), + type="pytest.skip", + message=skipreason)) + self._write_captured_output(report) + + def finalize(self): + data = self.to_xml().unicode(indent=0) + self.__dict__.clear() + self.to_xml = lambda: py.xml.raw(data) + + +@pytest.fixture +def record_xml_property(request): + """Fixture that adds extra xml properties to the tag for the calling test. + The fixture is callable with (name, value), with value being automatically + xml-encoded. + """ + request.node.warn( + code='C3', + message='record_xml_property is an experimental feature', + ) + xml = getattr(request.config, "_xml", None) + if xml is not None: + node_reporter = xml.node_reporter(request.node.nodeid) + return node_reporter.add_property + else: + def add_property_noop(name, value): + pass + + return add_property_noop + + +def pytest_addoption(parser): + group = parser.getgroup("terminal reporting") + group.addoption( + '--junitxml', '--junit-xml', + action="store", + dest="xmlpath", + metavar="path", + default=None, + help="create junit-xml style report file at given path.") + group.addoption( + '--junitprefix', '--junit-prefix', + action="store", + metavar="str", + default=None, + help="prepend prefix to classnames in junit-xml output") + + +def pytest_configure(config): + xmlpath = config.option.xmlpath + # prevent opening xmllog on slave nodes (xdist) + if xmlpath and not hasattr(config, 'slaveinput'): + config._xml = LogXML(xmlpath, config.option.junitprefix) + config.pluginmanager.register(config._xml) + + +def pytest_unconfigure(config): + xml = getattr(config, '_xml', None) + if xml: + del config._xml + config.pluginmanager.unregister(xml) + + +def mangle_test_address(address): + path, possible_open_bracket, params = address.partition('[') + names = path.split("::") + try: + names.remove('()') + except ValueError: + pass + # convert file path to dotted path + names[0] = names[0].replace("/", '.') + names[0] = _py_ext_re.sub("", names[0]) + # put any params back + names[-1] += possible_open_bracket + params + return names + + +class LogXML(object): + def __init__(self, logfile, prefix): + logfile = os.path.expanduser(os.path.expandvars(logfile)) + self.logfile = os.path.normpath(os.path.abspath(logfile)) + self.prefix = prefix + self.stats = dict.fromkeys([ + 'error', + 'passed', + 'failure', + 'skipped', + ], 0) + self.node_reporters = {} # nodeid -> _NodeReporter + self.node_reporters_ordered = [] + + def finalize(self, report): + nodeid = getattr(report, 'nodeid', report) + # local hack to handle xdist report order + slavenode = getattr(report, 'node', None) + reporter = self.node_reporters.pop((nodeid, slavenode)) + if reporter is not None: + reporter.finalize() + + def node_reporter(self, report): + nodeid = getattr(report, 'nodeid', report) + # local hack to handle xdist report order + slavenode = getattr(report, 'node', None) + + key = nodeid, slavenode + + if key in self.node_reporters: + # TODO: breasks for --dist=each + return self.node_reporters[key] + reporter = _NodeReporter(nodeid, self) + self.node_reporters[key] = reporter + self.node_reporters_ordered.append(reporter) + return reporter + + def add_stats(self, key): + if key in self.stats: + self.stats[key] += 1 + + def _opentestcase(self, report): + reporter = self.node_reporter(report) + reporter.record_testreport(report) + return reporter + + def pytest_runtest_logreport(self, report): + """handle a setup/call/teardown report, generating the appropriate + xml tags as necessary. + + note: due to plugins like xdist, this hook may be called in interlaced + order with reports from other nodes. for example: + + usual call order: + -> setup node1 + -> call node1 + -> teardown node1 + -> setup node2 + -> call node2 + -> teardown node2 + + possible call order in xdist: + -> setup node1 + -> call node1 + -> setup node2 + -> call node2 + -> teardown node2 + -> teardown node1 + """ + if report.passed: + if report.when == "call": # ignore setup/teardown + reporter = self._opentestcase(report) + reporter.append_pass(report) + elif report.failed: + reporter = self._opentestcase(report) + if report.when == "call": + reporter.append_failure(report) + else: + reporter.append_error(report) + elif report.skipped: + reporter = self._opentestcase(report) + reporter.append_skipped(report) + self.update_testcase_duration(report) + if report.when == "teardown": + self.finalize(report) + + def update_testcase_duration(self, report): + """accumulates total duration for nodeid from given report and updates + the Junit.testcase with the new total if already created. + """ + reporter = self.node_reporter(report) + reporter.duration += getattr(report, 'duration', 0.0) + + def pytest_collectreport(self, report): + if not report.passed: + reporter = self._opentestcase(report) + if report.failed: + reporter.append_collect_error(report) + else: + reporter.append_collect_skipped(report) + + def pytest_internalerror(self, excrepr): + reporter = self.node_reporter('internal') + reporter.attrs.update(classname="pytest", name='internal') + reporter._add_simple(Junit.error, 'internal error', excrepr) + + def pytest_sessionstart(self): + self.suite_start_time = time.time() + + def pytest_sessionfinish(self): + dirname = os.path.dirname(os.path.abspath(self.logfile)) + if not os.path.isdir(dirname): + os.makedirs(dirname) + logfile = open(self.logfile, 'w', encoding='utf-8') + suite_stop_time = time.time() + suite_time_delta = suite_stop_time - self.suite_start_time + + numtests = self.stats['passed'] + self.stats['failure'] + self.stats['skipped'] + + logfile.write('<?xml version="1.0" encoding="utf-8"?>') + logfile.write(Junit.testsuite( + [x.to_xml() for x in self.node_reporters_ordered], + name="pytest", + errors=self.stats['error'], + failures=self.stats['failure'], + skips=self.stats['skipped'], + tests=numtests, + time="%.3f" % suite_time_delta, ).unicode(indent=0)) + logfile.close() + + def pytest_terminal_summary(self, terminalreporter): + terminalreporter.write_sep("-", + "generated xml file: %s" % (self.logfile)) diff --git a/python/pytest/_pytest/main.py b/python/pytest/_pytest/main.py new file mode 100644 index 0000000000..8654d7af62 --- /dev/null +++ b/python/pytest/_pytest/main.py @@ -0,0 +1,744 @@ +""" core implementation of testing process: init, session, runtest loop. """ +import imp +import os +import re +import sys + +import _pytest +import _pytest._code +import py +import pytest +try: + from collections import MutableMapping as MappingMixin +except ImportError: + from UserDict import DictMixin as MappingMixin + +from _pytest.runner import collect_one_node + +tracebackcutdir = py.path.local(_pytest.__file__).dirpath() + +# exitcodes for the command line +EXIT_OK = 0 +EXIT_TESTSFAILED = 1 +EXIT_INTERRUPTED = 2 +EXIT_INTERNALERROR = 3 +EXIT_USAGEERROR = 4 +EXIT_NOTESTSCOLLECTED = 5 + +name_re = re.compile("^[a-zA-Z_]\w*$") + +def pytest_addoption(parser): + parser.addini("norecursedirs", "directory patterns to avoid for recursion", + type="args", default=['.*', 'CVS', '_darcs', '{arch}', '*.egg']) + parser.addini("testpaths", "directories to search for tests when no files or directories are given in the command line.", + type="args", default=[]) + #parser.addini("dirpatterns", + # "patterns specifying possible locations of test files", + # type="linelist", default=["**/test_*.txt", + # "**/test_*.py", "**/*_test.py"] + #) + group = parser.getgroup("general", "running and selection options") + group._addoption('-x', '--exitfirst', action="store_true", default=False, + dest="exitfirst", + help="exit instantly on first error or failed test."), + group._addoption('--maxfail', metavar="num", + action="store", type=int, dest="maxfail", default=0, + help="exit after first num failures or errors.") + group._addoption('--strict', action="store_true", + help="run pytest in strict mode, warnings become errors.") + group._addoption("-c", metavar="file", type=str, dest="inifilename", + help="load configuration from `file` instead of trying to locate one of the implicit configuration files.") + + group = parser.getgroup("collect", "collection") + group.addoption('--collectonly', '--collect-only', action="store_true", + help="only collect tests, don't execute them."), + group.addoption('--pyargs', action="store_true", + help="try to interpret all arguments as python packages.") + group.addoption("--ignore", action="append", metavar="path", + help="ignore path during collection (multi-allowed).") + # when changing this to --conf-cut-dir, config.py Conftest.setinitial + # needs upgrading as well + group.addoption('--confcutdir', dest="confcutdir", default=None, + metavar="dir", + help="only load conftest.py's relative to specified dir.") + group.addoption('--noconftest', action="store_true", + dest="noconftest", default=False, + help="Don't load any conftest.py files.") + + group = parser.getgroup("debugconfig", + "test session debugging and configuration") + group.addoption('--basetemp', dest="basetemp", default=None, metavar="dir", + help="base temporary directory for this test run.") + + +def pytest_namespace(): + collect = dict(Item=Item, Collector=Collector, File=File, Session=Session) + return dict(collect=collect) + +def pytest_configure(config): + pytest.config = config # compatibiltiy + if config.option.exitfirst: + config.option.maxfail = 1 + +def wrap_session(config, doit): + """Skeleton command line program""" + session = Session(config) + session.exitstatus = EXIT_OK + initstate = 0 + try: + try: + config._do_configure() + initstate = 1 + config.hook.pytest_sessionstart(session=session) + initstate = 2 + session.exitstatus = doit(config, session) or 0 + except pytest.UsageError: + raise + except KeyboardInterrupt: + excinfo = _pytest._code.ExceptionInfo() + config.hook.pytest_keyboard_interrupt(excinfo=excinfo) + session.exitstatus = EXIT_INTERRUPTED + except: + excinfo = _pytest._code.ExceptionInfo() + config.notify_exception(excinfo, config.option) + session.exitstatus = EXIT_INTERNALERROR + if excinfo.errisinstance(SystemExit): + sys.stderr.write("mainloop: caught Spurious SystemExit!\n") + + finally: + excinfo = None # Explicitly break reference cycle. + session.startdir.chdir() + if initstate >= 2: + config.hook.pytest_sessionfinish( + session=session, + exitstatus=session.exitstatus) + config._ensure_unconfigure() + return session.exitstatus + +def pytest_cmdline_main(config): + return wrap_session(config, _main) + +def _main(config, session): + """ default command line protocol for initialization, session, + running tests and reporting. """ + config.hook.pytest_collection(session=session) + config.hook.pytest_runtestloop(session=session) + + if session.testsfailed: + return EXIT_TESTSFAILED + elif session.testscollected == 0: + return EXIT_NOTESTSCOLLECTED + +def pytest_collection(session): + return session.perform_collect() + +def pytest_runtestloop(session): + if session.config.option.collectonly: + return True + + def getnextitem(i): + # this is a function to avoid python2 + # keeping sys.exc_info set when calling into a test + # python2 keeps sys.exc_info till the frame is left + try: + return session.items[i+1] + except IndexError: + return None + + for i, item in enumerate(session.items): + nextitem = getnextitem(i) + item.config.hook.pytest_runtest_protocol(item=item, nextitem=nextitem) + if session.shouldstop: + raise session.Interrupted(session.shouldstop) + return True + +def pytest_ignore_collect(path, config): + p = path.dirpath() + ignore_paths = config._getconftest_pathlist("collect_ignore", path=p) + ignore_paths = ignore_paths or [] + excludeopt = config.getoption("ignore") + if excludeopt: + ignore_paths.extend([py.path.local(x) for x in excludeopt]) + return path in ignore_paths + +class FSHookProxy: + def __init__(self, fspath, pm, remove_mods): + self.fspath = fspath + self.pm = pm + self.remove_mods = remove_mods + + def __getattr__(self, name): + x = self.pm.subset_hook_caller(name, remove_plugins=self.remove_mods) + self.__dict__[name] = x + return x + +def compatproperty(name): + def fget(self): + # deprecated - use pytest.name + return getattr(pytest, name) + + return property(fget) + +class NodeKeywords(MappingMixin): + def __init__(self, node): + self.node = node + self.parent = node.parent + self._markers = {node.name: True} + + def __getitem__(self, key): + try: + return self._markers[key] + except KeyError: + if self.parent is None: + raise + return self.parent.keywords[key] + + def __setitem__(self, key, value): + self._markers[key] = value + + def __delitem__(self, key): + raise ValueError("cannot delete key in keywords dict") + + def __iter__(self): + seen = set(self._markers) + if self.parent is not None: + seen.update(self.parent.keywords) + return iter(seen) + + def __len__(self): + return len(self.__iter__()) + + def keys(self): + return list(self) + + def __repr__(self): + return "<NodeKeywords for node %s>" % (self.node, ) + + +class Node(object): + """ base class for Collector and Item the test collection tree. + Collector subclasses have children, Items are terminal nodes.""" + + def __init__(self, name, parent=None, config=None, session=None): + #: a unique name within the scope of the parent node + self.name = name + + #: the parent collector node. + self.parent = parent + + #: the pytest config object + self.config = config or parent.config + + #: the session this node is part of + self.session = session or parent.session + + #: filesystem path where this node was collected from (can be None) + self.fspath = getattr(parent, 'fspath', None) + + #: keywords/markers collected from all scopes + self.keywords = NodeKeywords(self) + + #: allow adding of extra keywords to use for matching + self.extra_keyword_matches = set() + + # used for storing artificial fixturedefs for direct parametrization + self._name2pseudofixturedef = {} + + @property + def ihook(self): + """ fspath sensitive hook proxy used to call pytest hooks""" + return self.session.gethookproxy(self.fspath) + + Module = compatproperty("Module") + Class = compatproperty("Class") + Instance = compatproperty("Instance") + Function = compatproperty("Function") + File = compatproperty("File") + Item = compatproperty("Item") + + def _getcustomclass(self, name): + cls = getattr(self, name) + if cls != getattr(pytest, name): + py.log._apiwarn("2.0", "use of node.%s is deprecated, " + "use pytest_pycollect_makeitem(...) to create custom " + "collection nodes" % name) + return cls + + def __repr__(self): + return "<%s %r>" %(self.__class__.__name__, + getattr(self, 'name', None)) + + def warn(self, code, message): + """ generate a warning with the given code and message for this + item. """ + assert isinstance(code, str) + fslocation = getattr(self, "location", None) + if fslocation is None: + fslocation = getattr(self, "fspath", None) + else: + fslocation = "%s:%s" % fslocation[:2] + + self.ihook.pytest_logwarning.call_historic(kwargs=dict( + code=code, message=message, + nodeid=self.nodeid, fslocation=fslocation)) + + # methods for ordering nodes + @property + def nodeid(self): + """ a ::-separated string denoting its collection tree address. """ + try: + return self._nodeid + except AttributeError: + self._nodeid = x = self._makeid() + return x + + def _makeid(self): + return self.parent.nodeid + "::" + self.name + + def __hash__(self): + return hash(self.nodeid) + + def setup(self): + pass + + def teardown(self): + pass + + def _memoizedcall(self, attrname, function): + exattrname = "_ex_" + attrname + failure = getattr(self, exattrname, None) + if failure is not None: + py.builtin._reraise(failure[0], failure[1], failure[2]) + if hasattr(self, attrname): + return getattr(self, attrname) + try: + res = function() + except py.builtin._sysex: + raise + except: + failure = sys.exc_info() + setattr(self, exattrname, failure) + raise + setattr(self, attrname, res) + return res + + def listchain(self): + """ return list of all parent collectors up to self, + starting from root of collection tree. """ + chain = [] + item = self + while item is not None: + chain.append(item) + item = item.parent + chain.reverse() + return chain + + def add_marker(self, marker): + """ dynamically add a marker object to the node. + + ``marker`` can be a string or pytest.mark.* instance. + """ + from _pytest.mark import MarkDecorator + if isinstance(marker, py.builtin._basestring): + marker = MarkDecorator(marker) + elif not isinstance(marker, MarkDecorator): + raise ValueError("is not a string or pytest.mark.* Marker") + self.keywords[marker.name] = marker + + def get_marker(self, name): + """ get a marker object from this node or None if + the node doesn't have a marker with that name. """ + val = self.keywords.get(name, None) + if val is not None: + from _pytest.mark import MarkInfo, MarkDecorator + if isinstance(val, (MarkDecorator, MarkInfo)): + return val + + def listextrakeywords(self): + """ Return a set of all extra keywords in self and any parents.""" + extra_keywords = set() + item = self + for item in self.listchain(): + extra_keywords.update(item.extra_keyword_matches) + return extra_keywords + + def listnames(self): + return [x.name for x in self.listchain()] + + def addfinalizer(self, fin): + """ register a function to be called when this node is finalized. + + This method can only be called when this node is active + in a setup chain, for example during self.setup(). + """ + self.session._setupstate.addfinalizer(fin, self) + + def getparent(self, cls): + """ get the next parent node (including ourself) + which is an instance of the given class""" + current = self + while current and not isinstance(current, cls): + current = current.parent + return current + + def _prunetraceback(self, excinfo): + pass + + def _repr_failure_py(self, excinfo, style=None): + fm = self.session._fixturemanager + if excinfo.errisinstance(fm.FixtureLookupError): + return excinfo.value.formatrepr() + tbfilter = True + if self.config.option.fulltrace: + style="long" + else: + self._prunetraceback(excinfo) + tbfilter = False # prunetraceback already does it + if style == "auto": + style = "long" + # XXX should excinfo.getrepr record all data and toterminal() process it? + if style is None: + if self.config.option.tbstyle == "short": + style = "short" + else: + style = "long" + + return excinfo.getrepr(funcargs=True, + showlocals=self.config.option.showlocals, + style=style, tbfilter=tbfilter) + + repr_failure = _repr_failure_py + +class Collector(Node): + """ Collector instances create children through collect() + and thus iteratively build a tree. + """ + + class CollectError(Exception): + """ an error during collection, contains a custom message. """ + + def collect(self): + """ returns a list of children (items and collectors) + for this collection node. + """ + raise NotImplementedError("abstract") + + def repr_failure(self, excinfo): + """ represent a collection failure. """ + if excinfo.errisinstance(self.CollectError): + exc = excinfo.value + return str(exc.args[0]) + return self._repr_failure_py(excinfo, style="short") + + def _memocollect(self): + """ internal helper method to cache results of calling collect(). """ + return self._memoizedcall('_collected', lambda: list(self.collect())) + + def _prunetraceback(self, excinfo): + if hasattr(self, 'fspath'): + traceback = excinfo.traceback + ntraceback = traceback.cut(path=self.fspath) + if ntraceback == traceback: + ntraceback = ntraceback.cut(excludepath=tracebackcutdir) + excinfo.traceback = ntraceback.filter() + +class FSCollector(Collector): + def __init__(self, fspath, parent=None, config=None, session=None): + fspath = py.path.local(fspath) # xxx only for test_resultlog.py? + name = fspath.basename + if parent is not None: + rel = fspath.relto(parent.fspath) + if rel: + name = rel + name = name.replace(os.sep, "/") + super(FSCollector, self).__init__(name, parent, config, session) + self.fspath = fspath + + def _makeid(self): + relpath = self.fspath.relto(self.config.rootdir) + if os.sep != "/": + relpath = relpath.replace(os.sep, "/") + return relpath + +class File(FSCollector): + """ base class for collecting tests from a file. """ + +class Item(Node): + """ a basic test invocation item. Note that for a single function + there might be multiple test invocation items. + """ + nextitem = None + + def __init__(self, name, parent=None, config=None, session=None): + super(Item, self).__init__(name, parent, config, session) + self._report_sections = [] + + def add_report_section(self, when, key, content): + if content: + self._report_sections.append((when, key, content)) + + def reportinfo(self): + return self.fspath, None, "" + + @property + def location(self): + try: + return self._location + except AttributeError: + location = self.reportinfo() + # bestrelpath is a quite slow function + cache = self.config.__dict__.setdefault("_bestrelpathcache", {}) + try: + fspath = cache[location[0]] + except KeyError: + fspath = self.session.fspath.bestrelpath(location[0]) + cache[location[0]] = fspath + location = (fspath, location[1], str(location[2])) + self._location = location + return location + +class NoMatch(Exception): + """ raised if matching cannot locate a matching names. """ + +class Interrupted(KeyboardInterrupt): + """ signals an interrupted test run. """ + __module__ = 'builtins' # for py3 + +class Session(FSCollector): + Interrupted = Interrupted + + def __init__(self, config): + FSCollector.__init__(self, config.rootdir, parent=None, + config=config, session=self) + self._fs2hookproxy = {} + self.testsfailed = 0 + self.testscollected = 0 + self.shouldstop = False + self.trace = config.trace.root.get("collection") + self._norecursepatterns = config.getini("norecursedirs") + self.startdir = py.path.local() + self.config.pluginmanager.register(self, name="session") + + def _makeid(self): + return "" + + @pytest.hookimpl(tryfirst=True) + def pytest_collectstart(self): + if self.shouldstop: + raise self.Interrupted(self.shouldstop) + + @pytest.hookimpl(tryfirst=True) + def pytest_runtest_logreport(self, report): + if report.failed and not hasattr(report, 'wasxfail'): + self.testsfailed += 1 + maxfail = self.config.getvalue("maxfail") + if maxfail and self.testsfailed >= maxfail: + self.shouldstop = "stopping after %d failures" % ( + self.testsfailed) + pytest_collectreport = pytest_runtest_logreport + + def isinitpath(self, path): + return path in self._initialpaths + + def gethookproxy(self, fspath): + try: + return self._fs2hookproxy[fspath] + except KeyError: + # check if we have the common case of running + # hooks with all conftest.py filesall conftest.py + pm = self.config.pluginmanager + my_conftestmodules = pm._getconftestmodules(fspath) + remove_mods = pm._conftest_plugins.difference(my_conftestmodules) + if remove_mods: + # one or more conftests are not in use at this fspath + proxy = FSHookProxy(fspath, pm, remove_mods) + else: + # all plugis are active for this fspath + proxy = self.config.hook + + self._fs2hookproxy[fspath] = proxy + return proxy + + def perform_collect(self, args=None, genitems=True): + hook = self.config.hook + try: + items = self._perform_collect(args, genitems) + hook.pytest_collection_modifyitems(session=self, + config=self.config, items=items) + finally: + hook.pytest_collection_finish(session=self) + self.testscollected = len(items) + return items + + def _perform_collect(self, args, genitems): + if args is None: + args = self.config.args + self.trace("perform_collect", self, args) + self.trace.root.indent += 1 + self._notfound = [] + self._initialpaths = set() + self._initialparts = [] + self.items = items = [] + for arg in args: + parts = self._parsearg(arg) + self._initialparts.append(parts) + self._initialpaths.add(parts[0]) + rep = collect_one_node(self) + self.ihook.pytest_collectreport(report=rep) + self.trace.root.indent -= 1 + if self._notfound: + errors = [] + for arg, exc in self._notfound: + line = "(no name %r in any of %r)" % (arg, exc.args[0]) + errors.append("not found: %s\n%s" % (arg, line)) + #XXX: test this + raise pytest.UsageError(*errors) + if not genitems: + return rep.result + else: + if rep.passed: + for node in rep.result: + self.items.extend(self.genitems(node)) + return items + + def collect(self): + for parts in self._initialparts: + arg = "::".join(map(str, parts)) + self.trace("processing argument", arg) + self.trace.root.indent += 1 + try: + for x in self._collect(arg): + yield x + except NoMatch: + # we are inside a make_report hook so + # we cannot directly pass through the exception + self._notfound.append((arg, sys.exc_info()[1])) + + self.trace.root.indent -= 1 + + def _collect(self, arg): + names = self._parsearg(arg) + path = names.pop(0) + if path.check(dir=1): + assert not names, "invalid arg %r" %(arg,) + for path in path.visit(fil=lambda x: x.check(file=1), + rec=self._recurse, bf=True, sort=True): + for x in self._collectfile(path): + yield x + else: + assert path.check(file=1) + for x in self.matchnodes(self._collectfile(path), names): + yield x + + def _collectfile(self, path): + ihook = self.gethookproxy(path) + if not self.isinitpath(path): + if ihook.pytest_ignore_collect(path=path, config=self.config): + return () + return ihook.pytest_collect_file(path=path, parent=self) + + def _recurse(self, path): + ihook = self.gethookproxy(path.dirpath()) + if ihook.pytest_ignore_collect(path=path, config=self.config): + return + for pat in self._norecursepatterns: + if path.check(fnmatch=pat): + return False + ihook = self.gethookproxy(path) + ihook.pytest_collect_directory(path=path, parent=self) + return True + + def _tryconvertpyarg(self, x): + mod = None + path = [os.path.abspath('.')] + sys.path + for name in x.split('.'): + # ignore anything that's not a proper name here + # else something like --pyargs will mess up '.' + # since imp.find_module will actually sometimes work for it + # but it's supposed to be considered a filesystem path + # not a package + if name_re.match(name) is None: + return x + try: + fd, mod, type_ = imp.find_module(name, path) + except ImportError: + return x + else: + if fd is not None: + fd.close() + + if type_[2] != imp.PKG_DIRECTORY: + path = [os.path.dirname(mod)] + else: + path = [mod] + return mod + + def _parsearg(self, arg): + """ return (fspath, names) tuple after checking the file exists. """ + arg = str(arg) + if self.config.option.pyargs: + arg = self._tryconvertpyarg(arg) + parts = str(arg).split("::") + relpath = parts[0].replace("/", os.sep) + path = self.config.invocation_dir.join(relpath, abs=True) + if not path.check(): + if self.config.option.pyargs: + msg = "file or package not found: " + else: + msg = "file not found: " + raise pytest.UsageError(msg + arg) + parts[0] = path + return parts + + def matchnodes(self, matching, names): + self.trace("matchnodes", matching, names) + self.trace.root.indent += 1 + nodes = self._matchnodes(matching, names) + num = len(nodes) + self.trace("matchnodes finished -> ", num, "nodes") + self.trace.root.indent -= 1 + if num == 0: + raise NoMatch(matching, names[:1]) + return nodes + + def _matchnodes(self, matching, names): + if not matching or not names: + return matching + name = names[0] + assert name + nextnames = names[1:] + resultnodes = [] + for node in matching: + if isinstance(node, pytest.Item): + if not names: + resultnodes.append(node) + continue + assert isinstance(node, pytest.Collector) + rep = collect_one_node(node) + if rep.passed: + has_matched = False + for x in rep.result: + # TODO: remove parametrized workaround once collection structure contains parametrization + if x.name == name or x.name.split("[")[0] == name: + resultnodes.extend(self.matchnodes([x], nextnames)) + has_matched = True + # XXX accept IDs that don't have "()" for class instances + if not has_matched and len(rep.result) == 1 and x.name == "()": + nextnames.insert(0, name) + resultnodes.extend(self.matchnodes([x], nextnames)) + node.ihook.pytest_collectreport(report=rep) + return resultnodes + + def genitems(self, node): + self.trace("genitems", node) + if isinstance(node, pytest.Item): + node.ihook.pytest_itemcollected(item=node) + yield node + else: + assert isinstance(node, pytest.Collector) + rep = collect_one_node(node) + if rep.passed: + for subnode in rep.result: + for x in self.genitems(subnode): + yield x + node.ihook.pytest_collectreport(report=rep) diff --git a/python/pytest/_pytest/mark.py b/python/pytest/_pytest/mark.py new file mode 100644 index 0000000000..d8b60def36 --- /dev/null +++ b/python/pytest/_pytest/mark.py @@ -0,0 +1,311 @@ +""" generic mechanism for marking and selecting python functions. """ +import inspect + + +class MarkerError(Exception): + + """Error in use of a pytest marker/attribute.""" + + +def pytest_namespace(): + return {'mark': MarkGenerator()} + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group._addoption( + '-k', + action="store", dest="keyword", default='', metavar="EXPRESSION", + help="only run tests which match the given substring expression. " + "An expression is a python evaluatable expression " + "where all names are substring-matched against test names " + "and their parent classes. Example: -k 'test_method or test " + "other' matches all test functions and classes whose name " + "contains 'test_method' or 'test_other'. " + "Additionally keywords are matched to classes and functions " + "containing extra names in their 'extra_keyword_matches' set, " + "as well as functions which have names assigned directly to them." + ) + + group._addoption( + "-m", + action="store", dest="markexpr", default="", metavar="MARKEXPR", + help="only run tests matching given mark expression. " + "example: -m 'mark1 and not mark2'." + ) + + group.addoption( + "--markers", action="store_true", + help="show markers (builtin, plugin and per-project ones)." + ) + + parser.addini("markers", "markers for test functions", 'linelist') + + +def pytest_cmdline_main(config): + import _pytest.config + if config.option.markers: + config._do_configure() + tw = _pytest.config.create_terminal_writer(config) + for line in config.getini("markers"): + name, rest = line.split(":", 1) + tw.write("@pytest.mark.%s:" % name, bold=True) + tw.line(rest) + tw.line() + config._ensure_unconfigure() + return 0 +pytest_cmdline_main.tryfirst = True + + +def pytest_collection_modifyitems(items, config): + keywordexpr = config.option.keyword.lstrip() + matchexpr = config.option.markexpr + if not keywordexpr and not matchexpr: + return + # pytest used to allow "-" for negating + # but today we just allow "-" at the beginning, use "not" instead + # we probably remove "-" alltogether soon + if keywordexpr.startswith("-"): + keywordexpr = "not " + keywordexpr[1:] + selectuntil = False + if keywordexpr[-1:] == ":": + selectuntil = True + keywordexpr = keywordexpr[:-1] + + remaining = [] + deselected = [] + for colitem in items: + if keywordexpr and not matchkeyword(colitem, keywordexpr): + deselected.append(colitem) + else: + if selectuntil: + keywordexpr = None + if matchexpr: + if not matchmark(colitem, matchexpr): + deselected.append(colitem) + continue + remaining.append(colitem) + + if deselected: + config.hook.pytest_deselected(items=deselected) + items[:] = remaining + + +class MarkMapping: + """Provides a local mapping for markers where item access + resolves to True if the marker is present. """ + def __init__(self, keywords): + mymarks = set() + for key, value in keywords.items(): + if isinstance(value, MarkInfo) or isinstance(value, MarkDecorator): + mymarks.add(key) + self._mymarks = mymarks + + def __getitem__(self, name): + return name in self._mymarks + + +class KeywordMapping: + """Provides a local mapping for keywords. + Given a list of names, map any substring of one of these names to True. + """ + def __init__(self, names): + self._names = names + + def __getitem__(self, subname): + for name in self._names: + if subname in name: + return True + return False + + +def matchmark(colitem, markexpr): + """Tries to match on any marker names, attached to the given colitem.""" + return eval(markexpr, {}, MarkMapping(colitem.keywords)) + + +def matchkeyword(colitem, keywordexpr): + """Tries to match given keyword expression to given collector item. + + Will match on the name of colitem, including the names of its parents. + Only matches names of items which are either a :class:`Class` or a + :class:`Function`. + Additionally, matches on names in the 'extra_keyword_matches' set of + any item, as well as names directly assigned to test functions. + """ + mapped_names = set() + + # Add the names of the current item and any parent items + import pytest + for item in colitem.listchain(): + if not isinstance(item, pytest.Instance): + mapped_names.add(item.name) + + # Add the names added as extra keywords to current or parent items + for name in colitem.listextrakeywords(): + mapped_names.add(name) + + # Add the names attached to the current function through direct assignment + if hasattr(colitem, 'function'): + for name in colitem.function.__dict__: + mapped_names.add(name) + + mapping = KeywordMapping(mapped_names) + if " " not in keywordexpr: + # special case to allow for simple "-k pass" and "-k 1.3" + return mapping[keywordexpr] + elif keywordexpr.startswith("not ") and " " not in keywordexpr[4:]: + return not mapping[keywordexpr[4:]] + return eval(keywordexpr, {}, mapping) + + +def pytest_configure(config): + import pytest + if config.option.strict: + pytest.mark._config = config + + +class MarkGenerator: + """ Factory for :class:`MarkDecorator` objects - exposed as + a ``pytest.mark`` singleton instance. Example:: + + import pytest + @pytest.mark.slowtest + def test_function(): + pass + + will set a 'slowtest' :class:`MarkInfo` object + on the ``test_function`` object. """ + + def __getattr__(self, name): + if name[0] == "_": + raise AttributeError("Marker name must NOT start with underscore") + if hasattr(self, '_config'): + self._check(name) + return MarkDecorator(name) + + def _check(self, name): + try: + if name in self._markers: + return + except AttributeError: + pass + self._markers = l = set() + for line in self._config.getini("markers"): + beginning = line.split(":", 1) + x = beginning[0].split("(", 1)[0] + l.add(x) + if name not in self._markers: + raise AttributeError("%r not a registered marker" % (name,)) + +def istestfunc(func): + return hasattr(func, "__call__") and \ + getattr(func, "__name__", "<lambda>") != "<lambda>" + +class MarkDecorator: + """ A decorator for test functions and test classes. When applied + it will create :class:`MarkInfo` objects which may be + :ref:`retrieved by hooks as item keywords <excontrolskip>`. + MarkDecorator instances are often created like this:: + + mark1 = pytest.mark.NAME # simple MarkDecorator + mark2 = pytest.mark.NAME(name1=value) # parametrized MarkDecorator + + and can then be applied as decorators to test functions:: + + @mark2 + def test_function(): + pass + + When a MarkDecorator instance is called it does the following: + 1. If called with a single class as its only positional argument and no + additional keyword arguments, it attaches itself to the class so it + gets applied automatically to all test cases found in that class. + 2. If called with a single function as its only positional argument and + no additional keyword arguments, it attaches a MarkInfo object to the + function, containing all the arguments already stored internally in + the MarkDecorator. + 3. When called in any other case, it performs a 'fake construction' call, + i.e. it returns a new MarkDecorator instance with the original + MarkDecorator's content updated with the arguments passed to this + call. + + Note: The rules above prevent MarkDecorator objects from storing only a + single function or class reference as their positional argument with no + additional keyword or positional arguments. + + """ + def __init__(self, name, args=None, kwargs=None): + self.name = name + self.args = args or () + self.kwargs = kwargs or {} + + @property + def markname(self): + return self.name # for backward-compat (2.4.1 had this attr) + + def __repr__(self): + d = self.__dict__.copy() + name = d.pop('name') + return "<MarkDecorator %r %r>" % (name, d) + + def __call__(self, *args, **kwargs): + """ if passed a single callable argument: decorate it with mark info. + otherwise add *args/**kwargs in-place to mark information. """ + if args and not kwargs: + func = args[0] + is_class = inspect.isclass(func) + if len(args) == 1 and (istestfunc(func) or is_class): + if is_class: + if hasattr(func, 'pytestmark'): + mark_list = func.pytestmark + if not isinstance(mark_list, list): + mark_list = [mark_list] + # always work on a copy to avoid updating pytestmark + # from a superclass by accident + mark_list = mark_list + [self] + func.pytestmark = mark_list + else: + func.pytestmark = [self] + else: + holder = getattr(func, self.name, None) + if holder is None: + holder = MarkInfo( + self.name, self.args, self.kwargs + ) + setattr(func, self.name, holder) + else: + holder.add(self.args, self.kwargs) + return func + kw = self.kwargs.copy() + kw.update(kwargs) + args = self.args + args + return self.__class__(self.name, args=args, kwargs=kw) + + +class MarkInfo: + """ Marking object created by :class:`MarkDecorator` instances. """ + def __init__(self, name, args, kwargs): + #: name of attribute + self.name = name + #: positional argument list, empty if none specified + self.args = args + #: keyword argument dictionary, empty if nothing specified + self.kwargs = kwargs.copy() + self._arglist = [(args, kwargs.copy())] + + def __repr__(self): + return "<MarkInfo %r args=%r kwargs=%r>" % ( + self.name, self.args, self.kwargs + ) + + def add(self, args, kwargs): + """ add a MarkInfo with the given args and kwargs. """ + self._arglist.append((args, kwargs)) + self.args += args + self.kwargs.update(kwargs) + + def __iter__(self): + """ yield MarkInfo objects each relating to a marking-call. """ + for args, kwargs in self._arglist: + yield MarkInfo(self.name, args, kwargs) diff --git a/python/pytest/_pytest/monkeypatch.py b/python/pytest/_pytest/monkeypatch.py new file mode 100644 index 0000000000..d4c169d37a --- /dev/null +++ b/python/pytest/_pytest/monkeypatch.py @@ -0,0 +1,254 @@ +""" monkeypatching and mocking functionality. """ + +import os, sys +import re + +from py.builtin import _basestring + +RE_IMPORT_ERROR_NAME = re.compile("^No module named (.*)$") + + +def pytest_funcarg__monkeypatch(request): + """The returned ``monkeypatch`` funcarg provides these + helper methods to modify objects, dictionaries or os.environ:: + + monkeypatch.setattr(obj, name, value, raising=True) + monkeypatch.delattr(obj, name, raising=True) + monkeypatch.setitem(mapping, name, value) + monkeypatch.delitem(obj, name, raising=True) + monkeypatch.setenv(name, value, prepend=False) + monkeypatch.delenv(name, value, raising=True) + monkeypatch.syspath_prepend(path) + monkeypatch.chdir(path) + + All modifications will be undone after the requesting + test function has finished. The ``raising`` + parameter determines if a KeyError or AttributeError + will be raised if the set/deletion operation has no target. + """ + mpatch = monkeypatch() + request.addfinalizer(mpatch.undo) + return mpatch + + +def resolve(name): + # simplified from zope.dottedname + parts = name.split('.') + + used = parts.pop(0) + found = __import__(used) + for part in parts: + used += '.' + part + try: + found = getattr(found, part) + except AttributeError: + pass + else: + continue + # we use explicit un-nesting of the handling block in order + # to avoid nested exceptions on python 3 + try: + __import__(used) + except ImportError as ex: + # str is used for py2 vs py3 + expected = str(ex).split()[-1] + if expected == used: + raise + else: + raise ImportError( + 'import error in %s: %s' % (used, ex) + ) + found = annotated_getattr(found, part, used) + return found + + +def annotated_getattr(obj, name, ann): + try: + obj = getattr(obj, name) + except AttributeError: + raise AttributeError( + '%r object at %s has no attribute %r' % ( + type(obj).__name__, ann, name + ) + ) + return obj + + +def derive_importpath(import_path, raising): + if not isinstance(import_path, _basestring) or "." not in import_path: + raise TypeError("must be absolute import path string, not %r" % + (import_path,)) + module, attr = import_path.rsplit('.', 1) + target = resolve(module) + if raising: + annotated_getattr(target, attr, ann=module) + return attr, target + + +class Notset: + def __repr__(self): + return "<notset>" + + +notset = Notset() + + +class monkeypatch: + """ Object keeping a record of setattr/item/env/syspath changes. """ + + def __init__(self): + self._setattr = [] + self._setitem = [] + self._cwd = None + self._savesyspath = None + + def setattr(self, target, name, value=notset, raising=True): + """ Set attribute value on target, memorizing the old value. + By default raise AttributeError if the attribute did not exist. + + For convenience you can specify a string as ``target`` which + will be interpreted as a dotted import path, with the last part + being the attribute name. Example: + ``monkeypatch.setattr("os.getcwd", lambda x: "/")`` + would set the ``getcwd`` function of the ``os`` module. + + The ``raising`` value determines if the setattr should fail + if the attribute is not already present (defaults to True + which means it will raise). + """ + __tracebackhide__ = True + import inspect + + if value is notset: + if not isinstance(target, _basestring): + raise TypeError("use setattr(target, name, value) or " + "setattr(target, value) with target being a dotted " + "import string") + value = name + name, target = derive_importpath(target, raising) + + oldval = getattr(target, name, notset) + if raising and oldval is notset: + raise AttributeError("%r has no attribute %r" % (target, name)) + + # avoid class descriptors like staticmethod/classmethod + if inspect.isclass(target): + oldval = target.__dict__.get(name, notset) + self._setattr.append((target, name, oldval)) + setattr(target, name, value) + + def delattr(self, target, name=notset, raising=True): + """ Delete attribute ``name`` from ``target``, by default raise + AttributeError it the attribute did not previously exist. + + If no ``name`` is specified and ``target`` is a string + it will be interpreted as a dotted import path with the + last part being the attribute name. + + If ``raising`` is set to False, no exception will be raised if the + attribute is missing. + """ + __tracebackhide__ = True + if name is notset: + if not isinstance(target, _basestring): + raise TypeError("use delattr(target, name) or " + "delattr(target) with target being a dotted " + "import string") + name, target = derive_importpath(target, raising) + + if not hasattr(target, name): + if raising: + raise AttributeError(name) + else: + self._setattr.append((target, name, getattr(target, name, notset))) + delattr(target, name) + + def setitem(self, dic, name, value): + """ Set dictionary entry ``name`` to value. """ + self._setitem.append((dic, name, dic.get(name, notset))) + dic[name] = value + + def delitem(self, dic, name, raising=True): + """ Delete ``name`` from dict. Raise KeyError if it doesn't exist. + + If ``raising`` is set to False, no exception will be raised if the + key is missing. + """ + if name not in dic: + if raising: + raise KeyError(name) + else: + self._setitem.append((dic, name, dic.get(name, notset))) + del dic[name] + + def setenv(self, name, value, prepend=None): + """ Set environment variable ``name`` to ``value``. If ``prepend`` + is a character, read the current environment variable value + and prepend the ``value`` adjoined with the ``prepend`` character.""" + value = str(value) + if prepend and name in os.environ: + value = value + prepend + os.environ[name] + self.setitem(os.environ, name, value) + + def delenv(self, name, raising=True): + """ Delete ``name`` from the environment. Raise KeyError it does not + exist. + + If ``raising`` is set to False, no exception will be raised if the + environment variable is missing. + """ + self.delitem(os.environ, name, raising=raising) + + def syspath_prepend(self, path): + """ Prepend ``path`` to ``sys.path`` list of import locations. """ + if self._savesyspath is None: + self._savesyspath = sys.path[:] + sys.path.insert(0, str(path)) + + def chdir(self, path): + """ Change the current working directory to the specified path. + Path can be a string or a py.path.local object. + """ + if self._cwd is None: + self._cwd = os.getcwd() + if hasattr(path, "chdir"): + path.chdir() + else: + os.chdir(path) + + def undo(self): + """ Undo previous changes. This call consumes the + undo stack. Calling it a second time has no effect unless + you do more monkeypatching after the undo call. + + There is generally no need to call `undo()`, since it is + called automatically during tear-down. + + Note that the same `monkeypatch` fixture is used across a + single test function invocation. If `monkeypatch` is used both by + the test function itself and one of the test fixtures, + calling `undo()` will undo all of the changes made in + both functions. + """ + for obj, name, value in reversed(self._setattr): + if value is not notset: + setattr(obj, name, value) + else: + delattr(obj, name) + self._setattr[:] = [] + for dictionary, name, value in reversed(self._setitem): + if value is notset: + try: + del dictionary[name] + except KeyError: + pass # was already deleted, so we have the desired state + else: + dictionary[name] = value + self._setitem[:] = [] + if self._savesyspath is not None: + sys.path[:] = self._savesyspath + self._savesyspath = None + + if self._cwd is not None: + os.chdir(self._cwd) + self._cwd = None diff --git a/python/pytest/_pytest/nose.py b/python/pytest/_pytest/nose.py new file mode 100644 index 0000000000..0387468686 --- /dev/null +++ b/python/pytest/_pytest/nose.py @@ -0,0 +1,71 @@ +""" run test suites written for nose. """ + +import sys + +import py +import pytest +from _pytest import unittest + + +def get_skip_exceptions(): + skip_classes = set() + for module_name in ('unittest', 'unittest2', 'nose'): + mod = sys.modules.get(module_name) + if hasattr(mod, 'SkipTest'): + skip_classes.add(mod.SkipTest) + return tuple(skip_classes) + + +def pytest_runtest_makereport(item, call): + if call.excinfo and call.excinfo.errisinstance(get_skip_exceptions()): + # let's substitute the excinfo with a pytest.skip one + call2 = call.__class__(lambda: + pytest.skip(str(call.excinfo.value)), call.when) + call.excinfo = call2.excinfo + + +@pytest.hookimpl(trylast=True) +def pytest_runtest_setup(item): + if is_potential_nosetest(item): + if isinstance(item.parent, pytest.Generator): + gen = item.parent + if not hasattr(gen, '_nosegensetup'): + call_optional(gen.obj, 'setup') + if isinstance(gen.parent, pytest.Instance): + call_optional(gen.parent.obj, 'setup') + gen._nosegensetup = True + if not call_optional(item.obj, 'setup'): + # call module level setup if there is no object level one + call_optional(item.parent.obj, 'setup') + #XXX this implies we only call teardown when setup worked + item.session._setupstate.addfinalizer((lambda: teardown_nose(item)), item) + +def teardown_nose(item): + if is_potential_nosetest(item): + if not call_optional(item.obj, 'teardown'): + call_optional(item.parent.obj, 'teardown') + #if hasattr(item.parent, '_nosegensetup'): + # #call_optional(item._nosegensetup, 'teardown') + # del item.parent._nosegensetup + + +def pytest_make_collect_report(collector): + if isinstance(collector, pytest.Generator): + call_optional(collector.obj, 'setup') + + +def is_potential_nosetest(item): + # extra check needed since we do not do nose style setup/teardown + # on direct unittest style classes + return isinstance(item, pytest.Function) and \ + not isinstance(item, unittest.TestCaseFunction) + + +def call_optional(obj, name): + method = getattr(obj, name, None) + isfixture = hasattr(method, "_pytestfixturefunction") + if method is not None and not isfixture and py.builtin.callable(method): + # If there's any problems allow the exception to raise rather than + # silently ignoring them + method() + return True diff --git a/python/pytest/_pytest/pastebin.py b/python/pytest/_pytest/pastebin.py new file mode 100644 index 0000000000..4ec62d0228 --- /dev/null +++ b/python/pytest/_pytest/pastebin.py @@ -0,0 +1,92 @@ +""" submit failure or test session information to a pastebin service. """ +import pytest +import sys +import tempfile + + +def pytest_addoption(parser): + group = parser.getgroup("terminal reporting") + group._addoption('--pastebin', metavar="mode", + action='store', dest="pastebin", default=None, + choices=['failed', 'all'], + help="send failed|all info to bpaste.net pastebin service.") + +@pytest.hookimpl(trylast=True) +def pytest_configure(config): + import py + if config.option.pastebin == "all": + tr = config.pluginmanager.getplugin('terminalreporter') + # if no terminal reporter plugin is present, nothing we can do here; + # this can happen when this function executes in a slave node + # when using pytest-xdist, for example + if tr is not None: + # pastebin file will be utf-8 encoded binary file + config._pastebinfile = tempfile.TemporaryFile('w+b') + oldwrite = tr._tw.write + def tee_write(s, **kwargs): + oldwrite(s, **kwargs) + if py.builtin._istext(s): + s = s.encode('utf-8') + config._pastebinfile.write(s) + tr._tw.write = tee_write + +def pytest_unconfigure(config): + if hasattr(config, '_pastebinfile'): + # get terminal contents and delete file + config._pastebinfile.seek(0) + sessionlog = config._pastebinfile.read() + config._pastebinfile.close() + del config._pastebinfile + # undo our patching in the terminal reporter + tr = config.pluginmanager.getplugin('terminalreporter') + del tr._tw.__dict__['write'] + # write summary + tr.write_sep("=", "Sending information to Paste Service") + pastebinurl = create_new_paste(sessionlog) + tr.write_line("pastebin session-log: %s\n" % pastebinurl) + +def create_new_paste(contents): + """ + Creates a new paste using bpaste.net service. + + :contents: paste contents as utf-8 encoded bytes + :returns: url to the pasted contents + """ + import re + if sys.version_info < (3, 0): + from urllib import urlopen, urlencode + else: + from urllib.request import urlopen + from urllib.parse import urlencode + + params = { + 'code': contents, + 'lexer': 'python3' if sys.version_info[0] == 3 else 'python', + 'expiry': '1week', + } + url = 'https://bpaste.net' + response = urlopen(url, data=urlencode(params).encode('ascii')).read() + m = re.search(r'href="/raw/(\w+)"', response.decode('utf-8')) + if m: + return '%s/show/%s' % (url, m.group(1)) + else: + return 'bad response: ' + response + +def pytest_terminal_summary(terminalreporter): + import _pytest.config + if terminalreporter.config.option.pastebin != "failed": + return + tr = terminalreporter + if 'failed' in tr.stats: + terminalreporter.write_sep("=", "Sending information to Paste Service") + for rep in terminalreporter.stats.get('failed'): + try: + msg = rep.longrepr.reprtraceback.reprentries[-1].reprfileloc + except AttributeError: + msg = tr._getfailureheadline(rep) + tw = _pytest.config.create_terminal_writer(terminalreporter.config, stringio=True) + rep.toterminal(tw) + s = tw.stringio.getvalue() + assert len(s) + pastebinurl = create_new_paste(s) + tr.write_line("%s --> %s" %(msg, pastebinurl)) diff --git a/python/pytest/_pytest/pdb.py b/python/pytest/_pytest/pdb.py new file mode 100644 index 0000000000..84c920d172 --- /dev/null +++ b/python/pytest/_pytest/pdb.py @@ -0,0 +1,109 @@ +""" interactive debugging with PDB, the Python Debugger. """ +from __future__ import absolute_import +import pdb +import sys + +import pytest + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group._addoption('--pdb', + action="store_true", dest="usepdb", default=False, + help="start the interactive Python debugger on errors.") + +def pytest_namespace(): + return {'set_trace': pytestPDB().set_trace} + +def pytest_configure(config): + if config.getvalue("usepdb"): + config.pluginmanager.register(PdbInvoke(), 'pdbinvoke') + + old = (pdb.set_trace, pytestPDB._pluginmanager) + def fin(): + pdb.set_trace, pytestPDB._pluginmanager = old + pytestPDB._config = None + pdb.set_trace = pytest.set_trace + pytestPDB._pluginmanager = config.pluginmanager + pytestPDB._config = config + config._cleanup.append(fin) + +class pytestPDB: + """ Pseudo PDB that defers to the real pdb. """ + _pluginmanager = None + _config = None + + def set_trace(self): + """ invoke PDB set_trace debugging, dropping any IO capturing. """ + import _pytest.config + frame = sys._getframe().f_back + if self._pluginmanager is not None: + capman = self._pluginmanager.getplugin("capturemanager") + if capman: + capman.suspendcapture(in_=True) + tw = _pytest.config.create_terminal_writer(self._config) + tw.line() + tw.sep(">", "PDB set_trace (IO-capturing turned off)") + self._pluginmanager.hook.pytest_enter_pdb(config=self._config) + pdb.Pdb().set_trace(frame) + + +class PdbInvoke: + def pytest_exception_interact(self, node, call, report): + capman = node.config.pluginmanager.getplugin("capturemanager") + if capman: + out, err = capman.suspendcapture(in_=True) + sys.stdout.write(out) + sys.stdout.write(err) + _enter_pdb(node, call.excinfo, report) + + def pytest_internalerror(self, excrepr, excinfo): + for line in str(excrepr).split("\n"): + sys.stderr.write("INTERNALERROR> %s\n" %line) + sys.stderr.flush() + tb = _postmortem_traceback(excinfo) + post_mortem(tb) + + +def _enter_pdb(node, excinfo, rep): + # XXX we re-use the TerminalReporter's terminalwriter + # because this seems to avoid some encoding related troubles + # for not completely clear reasons. + tw = node.config.pluginmanager.getplugin("terminalreporter")._tw + tw.line() + tw.sep(">", "traceback") + rep.toterminal(tw) + tw.sep(">", "entering PDB") + tb = _postmortem_traceback(excinfo) + post_mortem(tb) + rep._pdbshown = True + return rep + + +def _postmortem_traceback(excinfo): + # A doctest.UnexpectedException is not useful for post_mortem. + # Use the underlying exception instead: + from doctest import UnexpectedException + if isinstance(excinfo.value, UnexpectedException): + return excinfo.value.exc_info[2] + else: + return excinfo._excinfo[2] + + +def _find_last_non_hidden_frame(stack): + i = max(0, len(stack) - 1) + while i and stack[i][0].f_locals.get("__tracebackhide__", False): + i -= 1 + return i + + +def post_mortem(t): + class Pdb(pdb.Pdb): + def get_stack(self, f, t): + stack, i = pdb.Pdb.get_stack(self, f, t) + if f is None: + i = _find_last_non_hidden_frame(stack) + return stack, i + p = Pdb() + p.reset() + p.interaction(None, t) diff --git a/python/pytest/_pytest/pytester.py b/python/pytest/_pytest/pytester.py new file mode 100644 index 0000000000..faed7f581c --- /dev/null +++ b/python/pytest/_pytest/pytester.py @@ -0,0 +1,1110 @@ +""" (disabled by default) support for testing pytest and pytest plugins. """ +import codecs +import gc +import os +import platform +import re +import subprocess +import sys +import time +import traceback +from fnmatch import fnmatch + +from py.builtin import print_ + +from _pytest._code import Source +import py +import pytest +from _pytest.main import Session, EXIT_OK + + +def pytest_addoption(parser): + # group = parser.getgroup("pytester", "pytester (self-tests) options") + parser.addoption('--lsof', + action="store_true", dest="lsof", default=False, + help=("run FD checks if lsof is available")) + + parser.addoption('--runpytest', default="inprocess", dest="runpytest", + choices=("inprocess", "subprocess", ), + help=("run pytest sub runs in tests using an 'inprocess' " + "or 'subprocess' (python -m main) method")) + + +def pytest_configure(config): + # This might be called multiple times. Only take the first. + global _pytest_fullpath + try: + _pytest_fullpath + except NameError: + _pytest_fullpath = os.path.abspath(pytest.__file__.rstrip("oc")) + _pytest_fullpath = _pytest_fullpath.replace("$py.class", ".py") + + if config.getvalue("lsof"): + checker = LsofFdLeakChecker() + if checker.matching_platform(): + config.pluginmanager.register(checker) + + +class LsofFdLeakChecker(object): + def get_open_files(self): + out = self._exec_lsof() + open_files = self._parse_lsof_output(out) + return open_files + + def _exec_lsof(self): + pid = os.getpid() + return py.process.cmdexec("lsof -Ffn0 -p %d" % pid) + + def _parse_lsof_output(self, out): + def isopen(line): + return line.startswith('f') and ("deleted" not in line and + 'mem' not in line and "txt" not in line and 'cwd' not in line) + + open_files = [] + + for line in out.split("\n"): + if isopen(line): + fields = line.split('\0') + fd = fields[0][1:] + filename = fields[1][1:] + if filename.startswith('/'): + open_files.append((fd, filename)) + + return open_files + + def matching_platform(self): + try: + py.process.cmdexec("lsof -v") + except (py.process.cmdexec.Error, UnicodeDecodeError): + # cmdexec may raise UnicodeDecodeError on Windows systems + # with locale other than english: + # https://bitbucket.org/pytest-dev/py/issues/66 + return False + else: + return True + + @pytest.hookimpl(hookwrapper=True, tryfirst=True) + def pytest_runtest_item(self, item): + lines1 = self.get_open_files() + yield + if hasattr(sys, "pypy_version_info"): + gc.collect() + lines2 = self.get_open_files() + + new_fds = set([t[0] for t in lines2]) - set([t[0] for t in lines1]) + leaked_files = [t for t in lines2 if t[0] in new_fds] + if leaked_files: + error = [] + error.append("***** %s FD leakage detected" % len(leaked_files)) + error.extend([str(f) for f in leaked_files]) + error.append("*** Before:") + error.extend([str(f) for f in lines1]) + error.append("*** After:") + error.extend([str(f) for f in lines2]) + error.append(error[0]) + error.append("*** function %s:%s: %s " % item.location) + pytest.fail("\n".join(error), pytrace=False) + + +# XXX copied from execnet's conftest.py - needs to be merged +winpymap = { + 'python2.7': r'C:\Python27\python.exe', + 'python2.6': r'C:\Python26\python.exe', + 'python3.1': r'C:\Python31\python.exe', + 'python3.2': r'C:\Python32\python.exe', + 'python3.3': r'C:\Python33\python.exe', + 'python3.4': r'C:\Python34\python.exe', + 'python3.5': r'C:\Python35\python.exe', +} + +def getexecutable(name, cache={}): + try: + return cache[name] + except KeyError: + executable = py.path.local.sysfind(name) + if executable: + if name == "jython": + import subprocess + popen = subprocess.Popen([str(executable), "--version"], + universal_newlines=True, stderr=subprocess.PIPE) + out, err = popen.communicate() + if not err or "2.5" not in err: + executable = None + if "2.5.2" in err: + executable = None # http://bugs.jython.org/issue1790 + cache[name] = executable + return executable + +@pytest.fixture(params=['python2.6', 'python2.7', 'python3.3', "python3.4", + 'pypy', 'pypy3']) +def anypython(request): + name = request.param + executable = getexecutable(name) + if executable is None: + if sys.platform == "win32": + executable = winpymap.get(name, None) + if executable: + executable = py.path.local(executable) + if executable.check(): + return executable + pytest.skip("no suitable %s found" % (name,)) + return executable + +# used at least by pytest-xdist plugin +@pytest.fixture +def _pytest(request): + """ Return a helper which offers a gethookrecorder(hook) + method which returns a HookRecorder instance which helps + to make assertions about called hooks. + """ + return PytestArg(request) + +class PytestArg: + def __init__(self, request): + self.request = request + + def gethookrecorder(self, hook): + hookrecorder = HookRecorder(hook._pm) + self.request.addfinalizer(hookrecorder.finish_recording) + return hookrecorder + + +def get_public_names(l): + """Only return names from iterator l without a leading underscore.""" + return [x for x in l if x[0] != "_"] + + +class ParsedCall: + def __init__(self, name, kwargs): + self.__dict__.update(kwargs) + self._name = name + + def __repr__(self): + d = self.__dict__.copy() + del d['_name'] + return "<ParsedCall %r(**%r)>" %(self._name, d) + + +class HookRecorder: + """Record all hooks called in a plugin manager. + + This wraps all the hook calls in the plugin manager, recording + each call before propagating the normal calls. + + """ + + def __init__(self, pluginmanager): + self._pluginmanager = pluginmanager + self.calls = [] + + def before(hook_name, hook_impls, kwargs): + self.calls.append(ParsedCall(hook_name, kwargs)) + + def after(outcome, hook_name, hook_impls, kwargs): + pass + + self._undo_wrapping = pluginmanager.add_hookcall_monitoring(before, after) + + def finish_recording(self): + self._undo_wrapping() + + def getcalls(self, names): + if isinstance(names, str): + names = names.split() + return [call for call in self.calls if call._name in names] + + def assert_contains(self, entries): + __tracebackhide__ = True + i = 0 + entries = list(entries) + backlocals = sys._getframe(1).f_locals + while entries: + name, check = entries.pop(0) + for ind, call in enumerate(self.calls[i:]): + if call._name == name: + print_("NAMEMATCH", name, call) + if eval(check, backlocals, call.__dict__): + print_("CHECKERMATCH", repr(check), "->", call) + else: + print_("NOCHECKERMATCH", repr(check), "-", call) + continue + i += ind + 1 + break + print_("NONAMEMATCH", name, "with", call) + else: + pytest.fail("could not find %r check %r" % (name, check)) + + def popcall(self, name): + __tracebackhide__ = True + for i, call in enumerate(self.calls): + if call._name == name: + del self.calls[i] + return call + lines = ["could not find call %r, in:" % (name,)] + lines.extend([" %s" % str(x) for x in self.calls]) + pytest.fail("\n".join(lines)) + + def getcall(self, name): + l = self.getcalls(name) + assert len(l) == 1, (name, l) + return l[0] + + # functionality for test reports + + def getreports(self, + names="pytest_runtest_logreport pytest_collectreport"): + return [x.report for x in self.getcalls(names)] + + def matchreport(self, inamepart="", + names="pytest_runtest_logreport pytest_collectreport", when=None): + """ return a testreport whose dotted import path matches """ + l = [] + for rep in self.getreports(names=names): + try: + if not when and rep.when != "call" and rep.passed: + # setup/teardown passing reports - let's ignore those + continue + except AttributeError: + pass + if when and getattr(rep, 'when', None) != when: + continue + if not inamepart or inamepart in rep.nodeid.split("::"): + l.append(rep) + if not l: + raise ValueError("could not find test report matching %r: " + "no test reports at all!" % (inamepart,)) + if len(l) > 1: + raise ValueError( + "found 2 or more testreports matching %r: %s" %(inamepart, l)) + return l[0] + + def getfailures(self, + names='pytest_runtest_logreport pytest_collectreport'): + return [rep for rep in self.getreports(names) if rep.failed] + + def getfailedcollections(self): + return self.getfailures('pytest_collectreport') + + def listoutcomes(self): + passed = [] + skipped = [] + failed = [] + for rep in self.getreports( + "pytest_collectreport pytest_runtest_logreport"): + if rep.passed: + if getattr(rep, "when", None) == "call": + passed.append(rep) + elif rep.skipped: + skipped.append(rep) + elif rep.failed: + failed.append(rep) + return passed, skipped, failed + + def countoutcomes(self): + return [len(x) for x in self.listoutcomes()] + + def assertoutcome(self, passed=0, skipped=0, failed=0): + realpassed, realskipped, realfailed = self.listoutcomes() + assert passed == len(realpassed) + assert skipped == len(realskipped) + assert failed == len(realfailed) + + def clear(self): + self.calls[:] = [] + + +@pytest.fixture +def linecomp(request): + return LineComp() + + +def pytest_funcarg__LineMatcher(request): + return LineMatcher + + +@pytest.fixture +def testdir(request, tmpdir_factory): + return Testdir(request, tmpdir_factory) + + +rex_outcome = re.compile("(\d+) ([\w-]+)") +class RunResult: + """The result of running a command. + + Attributes: + + :ret: The return value. + :outlines: List of lines captured from stdout. + :errlines: List of lines captures from stderr. + :stdout: :py:class:`LineMatcher` of stdout, use ``stdout.str()`` to + reconstruct stdout or the commonly used + ``stdout.fnmatch_lines()`` method. + :stderrr: :py:class:`LineMatcher` of stderr. + :duration: Duration in seconds. + + """ + def __init__(self, ret, outlines, errlines, duration): + self.ret = ret + self.outlines = outlines + self.errlines = errlines + self.stdout = LineMatcher(outlines) + self.stderr = LineMatcher(errlines) + self.duration = duration + + def parseoutcomes(self): + """ Return a dictionary of outcomestring->num from parsing + the terminal output that the test process produced.""" + for line in reversed(self.outlines): + if 'seconds' in line: + outcomes = rex_outcome.findall(line) + if outcomes: + d = {} + for num, cat in outcomes: + d[cat] = int(num) + return d + + def assert_outcomes(self, passed=0, skipped=0, failed=0): + """ assert that the specified outcomes appear with the respective + numbers (0 means it didn't occur) in the text output from a test run.""" + d = self.parseoutcomes() + assert passed == d.get("passed", 0) + assert skipped == d.get("skipped", 0) + assert failed == d.get("failed", 0) + + + +class Testdir: + """Temporary test directory with tools to test/run py.test itself. + + This is based on the ``tmpdir`` fixture but provides a number of + methods which aid with testing py.test itself. Unless + :py:meth:`chdir` is used all methods will use :py:attr:`tmpdir` as + current working directory. + + Attributes: + + :tmpdir: The :py:class:`py.path.local` instance of the temporary + directory. + + :plugins: A list of plugins to use with :py:meth:`parseconfig` and + :py:meth:`runpytest`. Initially this is an empty list but + plugins can be added to the list. The type of items to add to + the list depend on the method which uses them so refer to them + for details. + + """ + + def __init__(self, request, tmpdir_factory): + self.request = request + # XXX remove duplication with tmpdir plugin + basetmp = tmpdir_factory.ensuretemp("testdir") + name = request.function.__name__ + for i in range(100): + try: + tmpdir = basetmp.mkdir(name + str(i)) + except py.error.EEXIST: + continue + break + self.tmpdir = tmpdir + self.plugins = [] + self._savesyspath = (list(sys.path), list(sys.meta_path)) + self._savemodulekeys = set(sys.modules) + self.chdir() # always chdir + self.request.addfinalizer(self.finalize) + method = self.request.config.getoption("--runpytest") + if method == "inprocess": + self._runpytest_method = self.runpytest_inprocess + elif method == "subprocess": + self._runpytest_method = self.runpytest_subprocess + + def __repr__(self): + return "<Testdir %r>" % (self.tmpdir,) + + def finalize(self): + """Clean up global state artifacts. + + Some methods modify the global interpreter state and this + tries to clean this up. It does not remove the temporary + directory however so it can be looked at after the test run + has finished. + + """ + sys.path[:], sys.meta_path[:] = self._savesyspath + if hasattr(self, '_olddir'): + self._olddir.chdir() + self.delete_loaded_modules() + + def delete_loaded_modules(self): + """Delete modules that have been loaded during a test. + + This allows the interpreter to catch module changes in case + the module is re-imported. + """ + for name in set(sys.modules).difference(self._savemodulekeys): + # it seems zope.interfaces is keeping some state + # (used by twisted related tests) + if name != "zope.interface": + del sys.modules[name] + + def make_hook_recorder(self, pluginmanager): + """Create a new :py:class:`HookRecorder` for a PluginManager.""" + assert not hasattr(pluginmanager, "reprec") + pluginmanager.reprec = reprec = HookRecorder(pluginmanager) + self.request.addfinalizer(reprec.finish_recording) + return reprec + + def chdir(self): + """Cd into the temporary directory. + + This is done automatically upon instantiation. + + """ + old = self.tmpdir.chdir() + if not hasattr(self, '_olddir'): + self._olddir = old + + def _makefile(self, ext, args, kwargs): + items = list(kwargs.items()) + if args: + source = py.builtin._totext("\n").join( + map(py.builtin._totext, args)) + py.builtin._totext("\n") + basename = self.request.function.__name__ + items.insert(0, (basename, source)) + ret = None + for name, value in items: + p = self.tmpdir.join(name).new(ext=ext) + source = Source(value) + def my_totext(s, encoding="utf-8"): + if py.builtin._isbytes(s): + s = py.builtin._totext(s, encoding=encoding) + return s + source_unicode = "\n".join([my_totext(line) for line in source.lines]) + source = py.builtin._totext(source_unicode) + content = source.strip().encode("utf-8") # + "\n" + #content = content.rstrip() + "\n" + p.write(content, "wb") + if ret is None: + ret = p + return ret + + def makefile(self, ext, *args, **kwargs): + """Create a new file in the testdir. + + ext: The extension the file should use, including the dot. + E.g. ".py". + + args: All args will be treated as strings and joined using + newlines. The result will be written as contents to the + file. The name of the file will be based on the test + function requesting this fixture. + E.g. "testdir.makefile('.txt', 'line1', 'line2')" + + kwargs: Each keyword is the name of a file, while the value of + it will be written as contents of the file. + E.g. "testdir.makefile('.ini', pytest='[pytest]\naddopts=-rs\n')" + + """ + return self._makefile(ext, args, kwargs) + + def makeconftest(self, source): + """Write a contest.py file with 'source' as contents.""" + return self.makepyfile(conftest=source) + + def makeini(self, source): + """Write a tox.ini file with 'source' as contents.""" + return self.makefile('.ini', tox=source) + + def getinicfg(self, source): + """Return the pytest section from the tox.ini config file.""" + p = self.makeini(source) + return py.iniconfig.IniConfig(p)['pytest'] + + def makepyfile(self, *args, **kwargs): + """Shortcut for .makefile() with a .py extension.""" + return self._makefile('.py', args, kwargs) + + def maketxtfile(self, *args, **kwargs): + """Shortcut for .makefile() with a .txt extension.""" + return self._makefile('.txt', args, kwargs) + + def syspathinsert(self, path=None): + """Prepend a directory to sys.path, defaults to :py:attr:`tmpdir`. + + This is undone automatically after the test. + """ + if path is None: + path = self.tmpdir + sys.path.insert(0, str(path)) + # a call to syspathinsert() usually means that the caller + # wants to import some dynamically created files. + # with python3 we thus invalidate import caches. + self._possibly_invalidate_import_caches() + + def _possibly_invalidate_import_caches(self): + # invalidate caches if we can (py33 and above) + try: + import importlib + except ImportError: + pass + else: + if hasattr(importlib, "invalidate_caches"): + importlib.invalidate_caches() + + def mkdir(self, name): + """Create a new (sub)directory.""" + return self.tmpdir.mkdir(name) + + def mkpydir(self, name): + """Create a new python package. + + This creates a (sub)direcotry with an empty ``__init__.py`` + file so that is recognised as a python package. + + """ + p = self.mkdir(name) + p.ensure("__init__.py") + return p + + Session = Session + def getnode(self, config, arg): + """Return the collection node of a file. + + :param config: :py:class:`_pytest.config.Config` instance, see + :py:meth:`parseconfig` and :py:meth:`parseconfigure` to + create the configuration. + + :param arg: A :py:class:`py.path.local` instance of the file. + + """ + session = Session(config) + assert '::' not in str(arg) + p = py.path.local(arg) + config.hook.pytest_sessionstart(session=session) + res = session.perform_collect([str(p)], genitems=False)[0] + config.hook.pytest_sessionfinish(session=session, exitstatus=EXIT_OK) + return res + + def getpathnode(self, path): + """Return the collection node of a file. + + This is like :py:meth:`getnode` but uses + :py:meth:`parseconfigure` to create the (configured) py.test + Config instance. + + :param path: A :py:class:`py.path.local` instance of the file. + + """ + config = self.parseconfigure(path) + session = Session(config) + x = session.fspath.bestrelpath(path) + config.hook.pytest_sessionstart(session=session) + res = session.perform_collect([x], genitems=False)[0] + config.hook.pytest_sessionfinish(session=session, exitstatus=EXIT_OK) + return res + + def genitems(self, colitems): + """Generate all test items from a collection node. + + This recurses into the collection node and returns a list of + all the test items contained within. + + """ + session = colitems[0].session + result = [] + for colitem in colitems: + result.extend(session.genitems(colitem)) + return result + + def runitem(self, source): + """Run the "test_func" Item. + + The calling test instance (the class which contains the test + method) must provide a ``.getrunner()`` method which should + return a runner which can run the test protocol for a single + item, like e.g. :py:func:`_pytest.runner.runtestprotocol`. + + """ + # used from runner functional tests + item = self.getitem(source) + # the test class where we are called from wants to provide the runner + testclassinstance = self.request.instance + runner = testclassinstance.getrunner() + return runner(item) + + def inline_runsource(self, source, *cmdlineargs): + """Run a test module in process using ``pytest.main()``. + + This run writes "source" into a temporary file and runs + ``pytest.main()`` on it, returning a :py:class:`HookRecorder` + instance for the result. + + :param source: The source code of the test module. + + :param cmdlineargs: Any extra command line arguments to use. + + :return: :py:class:`HookRecorder` instance of the result. + + """ + p = self.makepyfile(source) + l = list(cmdlineargs) + [p] + return self.inline_run(*l) + + def inline_genitems(self, *args): + """Run ``pytest.main(['--collectonly'])`` in-process. + + Retuns a tuple of the collected items and a + :py:class:`HookRecorder` instance. + + This runs the :py:func:`pytest.main` function to run all of + py.test inside the test process itself like + :py:meth:`inline_run`. However the return value is a tuple of + the collection items and a :py:class:`HookRecorder` instance. + + """ + rec = self.inline_run("--collect-only", *args) + items = [x.item for x in rec.getcalls("pytest_itemcollected")] + return items, rec + + def inline_run(self, *args, **kwargs): + """Run ``pytest.main()`` in-process, returning a HookRecorder. + + This runs the :py:func:`pytest.main` function to run all of + py.test inside the test process itself. This means it can + return a :py:class:`HookRecorder` instance which gives more + detailed results from then run then can be done by matching + stdout/stderr from :py:meth:`runpytest`. + + :param args: Any command line arguments to pass to + :py:func:`pytest.main`. + + :param plugin: (keyword-only) Extra plugin instances the + ``pytest.main()`` instance should use. + + :return: A :py:class:`HookRecorder` instance. + + """ + rec = [] + class Collect: + def pytest_configure(x, config): + rec.append(self.make_hook_recorder(config.pluginmanager)) + + plugins = kwargs.get("plugins") or [] + plugins.append(Collect()) + ret = pytest.main(list(args), plugins=plugins) + self.delete_loaded_modules() + if len(rec) == 1: + reprec = rec.pop() + else: + class reprec: + pass + reprec.ret = ret + + # typically we reraise keyboard interrupts from the child run + # because it's our user requesting interruption of the testing + if ret == 2 and not kwargs.get("no_reraise_ctrlc"): + calls = reprec.getcalls("pytest_keyboard_interrupt") + if calls and calls[-1].excinfo.type == KeyboardInterrupt: + raise KeyboardInterrupt() + return reprec + + def runpytest_inprocess(self, *args, **kwargs): + """ Return result of running pytest in-process, providing a similar + interface to what self.runpytest() provides. """ + if kwargs.get("syspathinsert"): + self.syspathinsert() + now = time.time() + capture = py.io.StdCapture() + try: + try: + reprec = self.inline_run(*args, **kwargs) + except SystemExit as e: + class reprec: + ret = e.args[0] + except Exception: + traceback.print_exc() + class reprec: + ret = 3 + finally: + out, err = capture.reset() + sys.stdout.write(out) + sys.stderr.write(err) + + res = RunResult(reprec.ret, + out.split("\n"), err.split("\n"), + time.time()-now) + res.reprec = reprec + return res + + def runpytest(self, *args, **kwargs): + """ Run pytest inline or in a subprocess, depending on the command line + option "--runpytest" and return a :py:class:`RunResult`. + + """ + args = self._ensure_basetemp(args) + return self._runpytest_method(*args, **kwargs) + + def _ensure_basetemp(self, args): + args = [str(x) for x in args] + for x in args: + if str(x).startswith('--basetemp'): + #print ("basedtemp exists: %s" %(args,)) + break + else: + args.append("--basetemp=%s" % self.tmpdir.dirpath('basetemp')) + #print ("added basetemp: %s" %(args,)) + return args + + def parseconfig(self, *args): + """Return a new py.test Config instance from given commandline args. + + This invokes the py.test bootstrapping code in _pytest.config + to create a new :py:class:`_pytest.core.PluginManager` and + call the pytest_cmdline_parse hook to create new + :py:class:`_pytest.config.Config` instance. + + If :py:attr:`plugins` has been populated they should be plugin + modules which will be registered with the PluginManager. + + """ + args = self._ensure_basetemp(args) + + import _pytest.config + config = _pytest.config._prepareconfig(args, self.plugins) + # we don't know what the test will do with this half-setup config + # object and thus we make sure it gets unconfigured properly in any + # case (otherwise capturing could still be active, for example) + self.request.addfinalizer(config._ensure_unconfigure) + return config + + def parseconfigure(self, *args): + """Return a new py.test configured Config instance. + + This returns a new :py:class:`_pytest.config.Config` instance + like :py:meth:`parseconfig`, but also calls the + pytest_configure hook. + + """ + config = self.parseconfig(*args) + config._do_configure() + self.request.addfinalizer(config._ensure_unconfigure) + return config + + def getitem(self, source, funcname="test_func"): + """Return the test item for a test function. + + This writes the source to a python file and runs py.test's + collection on the resulting module, returning the test item + for the requested function name. + + :param source: The module source. + + :param funcname: The name of the test function for which the + Item must be returned. + + """ + items = self.getitems(source) + for item in items: + if item.name == funcname: + return item + assert 0, "%r item not found in module:\n%s\nitems: %s" %( + funcname, source, items) + + def getitems(self, source): + """Return all test items collected from the module. + + This writes the source to a python file and runs py.test's + collection on the resulting module, returning all test items + contained within. + + """ + modcol = self.getmodulecol(source) + return self.genitems([modcol]) + + def getmodulecol(self, source, configargs=(), withinit=False): + """Return the module collection node for ``source``. + + This writes ``source`` to a file using :py:meth:`makepyfile` + and then runs the py.test collection on it, returning the + collection node for the test module. + + :param source: The source code of the module to collect. + + :param configargs: Any extra arguments to pass to + :py:meth:`parseconfigure`. + + :param withinit: Whether to also write a ``__init__.py`` file + to the temporarly directory to ensure it is a package. + + """ + kw = {self.request.function.__name__: Source(source).strip()} + path = self.makepyfile(**kw) + if withinit: + self.makepyfile(__init__ = "#") + self.config = config = self.parseconfigure(path, *configargs) + node = self.getnode(config, path) + return node + + def collect_by_name(self, modcol, name): + """Return the collection node for name from the module collection. + + This will search a module collection node for a collection + node matching the given name. + + :param modcol: A module collection node, see + :py:meth:`getmodulecol`. + + :param name: The name of the node to return. + + """ + for colitem in modcol._memocollect(): + if colitem.name == name: + return colitem + + def popen(self, cmdargs, stdout, stderr, **kw): + """Invoke subprocess.Popen. + + This calls subprocess.Popen making sure the current working + directory is the PYTHONPATH. + + You probably want to use :py:meth:`run` instead. + + """ + env = os.environ.copy() + env['PYTHONPATH'] = os.pathsep.join(filter(None, [ + str(os.getcwd()), env.get('PYTHONPATH', '')])) + kw['env'] = env + return subprocess.Popen(cmdargs, + stdout=stdout, stderr=stderr, **kw) + + def run(self, *cmdargs): + """Run a command with arguments. + + Run a process using subprocess.Popen saving the stdout and + stderr. + + Returns a :py:class:`RunResult`. + + """ + return self._run(*cmdargs) + + def _run(self, *cmdargs): + cmdargs = [str(x) for x in cmdargs] + p1 = self.tmpdir.join("stdout") + p2 = self.tmpdir.join("stderr") + print_("running:", ' '.join(cmdargs)) + print_(" in:", str(py.path.local())) + f1 = codecs.open(str(p1), "w", encoding="utf8") + f2 = codecs.open(str(p2), "w", encoding="utf8") + try: + now = time.time() + popen = self.popen(cmdargs, stdout=f1, stderr=f2, + close_fds=(sys.platform != "win32")) + ret = popen.wait() + finally: + f1.close() + f2.close() + f1 = codecs.open(str(p1), "r", encoding="utf8") + f2 = codecs.open(str(p2), "r", encoding="utf8") + try: + out = f1.read().splitlines() + err = f2.read().splitlines() + finally: + f1.close() + f2.close() + self._dump_lines(out, sys.stdout) + self._dump_lines(err, sys.stderr) + return RunResult(ret, out, err, time.time()-now) + + def _dump_lines(self, lines, fp): + try: + for line in lines: + py.builtin.print_(line, file=fp) + except UnicodeEncodeError: + print("couldn't print to %s because of encoding" % (fp,)) + + def _getpytestargs(self): + # we cannot use "(sys.executable,script)" + # because on windows the script is e.g. a py.test.exe + return (sys.executable, _pytest_fullpath,) # noqa + + def runpython(self, script): + """Run a python script using sys.executable as interpreter. + + Returns a :py:class:`RunResult`. + """ + return self.run(sys.executable, script) + + def runpython_c(self, command): + """Run python -c "command", return a :py:class:`RunResult`.""" + return self.run(sys.executable, "-c", command) + + def runpytest_subprocess(self, *args, **kwargs): + """Run py.test as a subprocess with given arguments. + + Any plugins added to the :py:attr:`plugins` list will added + using the ``-p`` command line option. Addtionally + ``--basetemp`` is used put any temporary files and directories + in a numbered directory prefixed with "runpytest-" so they do + not conflict with the normal numberd pytest location for + temporary files and directories. + + Returns a :py:class:`RunResult`. + + """ + p = py.path.local.make_numbered_dir(prefix="runpytest-", + keep=None, rootdir=self.tmpdir) + args = ('--basetemp=%s' % p, ) + args + #for x in args: + # if '--confcutdir' in str(x): + # break + #else: + # pass + # args = ('--confcutdir=.',) + args + plugins = [x for x in self.plugins if isinstance(x, str)] + if plugins: + args = ('-p', plugins[0]) + args + args = self._getpytestargs() + args + return self.run(*args) + + def spawn_pytest(self, string, expect_timeout=10.0): + """Run py.test using pexpect. + + This makes sure to use the right py.test and sets up the + temporary directory locations. + + The pexpect child is returned. + + """ + basetemp = self.tmpdir.mkdir("pexpect") + invoke = " ".join(map(str, self._getpytestargs())) + cmd = "%s --basetemp=%s %s" % (invoke, basetemp, string) + return self.spawn(cmd, expect_timeout=expect_timeout) + + def spawn(self, cmd, expect_timeout=10.0): + """Run a command using pexpect. + + The pexpect child is returned. + """ + pexpect = pytest.importorskip("pexpect", "3.0") + if hasattr(sys, 'pypy_version_info') and '64' in platform.machine(): + pytest.skip("pypy-64 bit not supported") + if sys.platform == "darwin": + pytest.xfail("pexpect does not work reliably on darwin?!") + if sys.platform.startswith("freebsd"): + pytest.xfail("pexpect does not work reliably on freebsd") + logfile = self.tmpdir.join("spawn.out").open("wb") + child = pexpect.spawn(cmd, logfile=logfile) + self.request.addfinalizer(logfile.close) + child.timeout = expect_timeout + return child + +def getdecoded(out): + try: + return out.decode("utf-8") + except UnicodeDecodeError: + return "INTERNAL not-utf8-decodeable, truncated string:\n%s" % ( + py.io.saferepr(out),) + + +class LineComp: + def __init__(self): + self.stringio = py.io.TextIO() + + def assert_contains_lines(self, lines2): + """ assert that lines2 are contained (linearly) in lines1. + return a list of extralines found. + """ + __tracebackhide__ = True + val = self.stringio.getvalue() + self.stringio.truncate(0) + self.stringio.seek(0) + lines1 = val.split("\n") + return LineMatcher(lines1).fnmatch_lines(lines2) + + +class LineMatcher: + """Flexible matching of text. + + This is a convenience class to test large texts like the output of + commands. + + The constructor takes a list of lines without their trailing + newlines, i.e. ``text.splitlines()``. + + """ + + def __init__(self, lines): + self.lines = lines + + def str(self): + """Return the entire original text.""" + return "\n".join(self.lines) + + def _getlines(self, lines2): + if isinstance(lines2, str): + lines2 = Source(lines2) + if isinstance(lines2, Source): + lines2 = lines2.strip().lines + return lines2 + + def fnmatch_lines_random(self, lines2): + """Check lines exist in the output. + + The argument is a list of lines which have to occur in the + output, in any order. Each line can contain glob whildcards. + + """ + lines2 = self._getlines(lines2) + for line in lines2: + for x in self.lines: + if line == x or fnmatch(x, line): + print_("matched: ", repr(line)) + break + else: + raise ValueError("line %r not found in output" % line) + + def get_lines_after(self, fnline): + """Return all lines following the given line in the text. + + The given line can contain glob wildcards. + """ + for i, line in enumerate(self.lines): + if fnline == line or fnmatch(line, fnline): + return self.lines[i+1:] + raise ValueError("line %r not found in output" % fnline) + + def fnmatch_lines(self, lines2): + """Search the text for matching lines. + + The argument is a list of lines which have to match and can + use glob wildcards. If they do not match an pytest.fail() is + called. The matches and non-matches are also printed on + stdout. + + """ + def show(arg1, arg2): + py.builtin.print_(arg1, arg2, file=sys.stderr) + lines2 = self._getlines(lines2) + lines1 = self.lines[:] + nextline = None + extralines = [] + __tracebackhide__ = True + for line in lines2: + nomatchprinted = False + while lines1: + nextline = lines1.pop(0) + if line == nextline: + show("exact match:", repr(line)) + break + elif fnmatch(nextline, line): + show("fnmatch:", repr(line)) + show(" with:", repr(nextline)) + break + else: + if not nomatchprinted: + show("nomatch:", repr(line)) + nomatchprinted = True + show(" and:", repr(nextline)) + extralines.append(nextline) + else: + pytest.fail("remains unmatched: %r, see stderr" % (line,)) diff --git a/python/pytest/_pytest/python.py b/python/pytest/_pytest/python.py new file mode 100644 index 0000000000..21d78aea33 --- /dev/null +++ b/python/pytest/_pytest/python.py @@ -0,0 +1,2300 @@ +""" Python test discovery, setup and run of test functions. """ +import fnmatch +import functools +import inspect +import re +import types +import sys + +import py +import pytest +from _pytest._code.code import TerminalRepr +from _pytest.mark import MarkDecorator, MarkerError + +try: + import enum +except ImportError: # pragma: no cover + # Only available in Python 3.4+ or as a backport + enum = None + +import _pytest +import _pytest._pluggy as pluggy + +cutdir2 = py.path.local(_pytest.__file__).dirpath() +cutdir1 = py.path.local(pluggy.__file__.rstrip("oc")) + + +NoneType = type(None) +NOTSET = object() +isfunction = inspect.isfunction +isclass = inspect.isclass +callable = py.builtin.callable +# used to work around a python2 exception info leak +exc_clear = getattr(sys, 'exc_clear', lambda: None) +# The type of re.compile objects is not exposed in Python. +REGEX_TYPE = type(re.compile('')) + +_PY3 = sys.version_info > (3, 0) +_PY2 = not _PY3 + + +if hasattr(inspect, 'signature'): + def _format_args(func): + return str(inspect.signature(func)) +else: + def _format_args(func): + return inspect.formatargspec(*inspect.getargspec(func)) + +if sys.version_info[:2] == (2, 6): + def isclass(object): + """ Return true if the object is a class. Overrides inspect.isclass for + python 2.6 because it will return True for objects which always return + something on __getattr__ calls (see #1035). + Backport of https://hg.python.org/cpython/rev/35bf8f7a8edc + """ + return isinstance(object, (type, types.ClassType)) + +def _has_positional_arg(func): + return func.__code__.co_argcount + + +def filter_traceback(entry): + # entry.path might sometimes return a str object when the entry + # points to dynamically generated code + # see https://bitbucket.org/pytest-dev/py/issues/71 + raw_filename = entry.frame.code.raw.co_filename + is_generated = '<' in raw_filename and '>' in raw_filename + if is_generated: + return False + # entry.path might point to an inexisting file, in which case it will + # alsso return a str object. see #1133 + p = py.path.local(entry.path) + return p != cutdir1 and not p.relto(cutdir2) + + +def get_real_func(obj): + """ gets the real function object of the (possibly) wrapped object by + functools.wraps or functools.partial. + """ + while hasattr(obj, "__wrapped__"): + obj = obj.__wrapped__ + if isinstance(obj, functools.partial): + obj = obj.func + return obj + +def getfslineno(obj): + # xxx let decorators etc specify a sane ordering + obj = get_real_func(obj) + if hasattr(obj, 'place_as'): + obj = obj.place_as + fslineno = _pytest._code.getfslineno(obj) + assert isinstance(fslineno[1], int), obj + return fslineno + +def getimfunc(func): + try: + return func.__func__ + except AttributeError: + try: + return func.im_func + except AttributeError: + return func + +def safe_getattr(object, name, default): + """ Like getattr but return default upon any Exception. + + Attribute access can potentially fail for 'evil' Python objects. + See issue214 + """ + try: + return getattr(object, name, default) + except Exception: + return default + + +class FixtureFunctionMarker: + def __init__(self, scope, params, + autouse=False, yieldctx=False, ids=None): + self.scope = scope + self.params = params + self.autouse = autouse + self.yieldctx = yieldctx + self.ids = ids + + def __call__(self, function): + if isclass(function): + raise ValueError( + "class fixtures not supported (may be in the future)") + function._pytestfixturefunction = self + return function + + +def fixture(scope="function", params=None, autouse=False, ids=None): + """ (return a) decorator to mark a fixture factory function. + + This decorator can be used (with or or without parameters) to define + a fixture function. The name of the fixture function can later be + referenced to cause its invocation ahead of running tests: test + modules or classes can use the pytest.mark.usefixtures(fixturename) + marker. Test functions can directly use fixture names as input + arguments in which case the fixture instance returned from the fixture + function will be injected. + + :arg scope: the scope for which this fixture is shared, one of + "function" (default), "class", "module", "session". + + :arg params: an optional list of parameters which will cause multiple + invocations of the fixture function and all of the tests + using it. + + :arg autouse: if True, the fixture func is activated for all tests that + can see it. If False (the default) then an explicit + reference is needed to activate the fixture. + + :arg ids: list of string ids each corresponding to the params + so that they are part of the test id. If no ids are provided + they will be generated automatically from the params. + + """ + if callable(scope) and params is None and autouse == False: + # direct decoration + return FixtureFunctionMarker( + "function", params, autouse)(scope) + if params is not None and not isinstance(params, (list, tuple)): + params = list(params) + return FixtureFunctionMarker(scope, params, autouse, ids=ids) + +def yield_fixture(scope="function", params=None, autouse=False, ids=None): + """ (return a) decorator to mark a yield-fixture factory function + (EXPERIMENTAL). + + This takes the same arguments as :py:func:`pytest.fixture` but + expects a fixture function to use a ``yield`` instead of a ``return`` + statement to provide a fixture. See + http://pytest.org/en/latest/yieldfixture.html for more info. + """ + if callable(scope) and params is None and autouse == False: + # direct decoration + return FixtureFunctionMarker( + "function", params, autouse, yieldctx=True)(scope) + else: + return FixtureFunctionMarker(scope, params, autouse, + yieldctx=True, ids=ids) + +defaultfuncargprefixmarker = fixture() + +def pyobj_property(name): + def get(self): + node = self.getparent(getattr(pytest, name)) + if node is not None: + return node.obj + doc = "python %s object this node was collected from (can be None)." % ( + name.lower(),) + return property(get, None, None, doc) + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group.addoption('--fixtures', '--funcargs', + action="store_true", dest="showfixtures", default=False, + help="show available fixtures, sorted by plugin appearance") + parser.addini("usefixtures", type="args", default=[], + help="list of default fixtures to be used with this project") + parser.addini("python_files", type="args", + default=['test_*.py', '*_test.py'], + help="glob-style file patterns for Python test module discovery") + parser.addini("python_classes", type="args", default=["Test",], + help="prefixes or glob names for Python test class discovery") + parser.addini("python_functions", type="args", default=["test",], + help="prefixes or glob names for Python test function and " + "method discovery") + + group.addoption("--import-mode", default="prepend", + choices=["prepend", "append"], dest="importmode", + help="prepend/append to sys.path when importing test modules, " + "default is to prepend.") + + +def pytest_cmdline_main(config): + if config.option.showfixtures: + showfixtures(config) + return 0 + + +def pytest_generate_tests(metafunc): + # those alternative spellings are common - raise a specific error to alert + # the user + alt_spellings = ['parameterize', 'parametrise', 'parameterise'] + for attr in alt_spellings: + if hasattr(metafunc.function, attr): + msg = "{0} has '{1}', spelling should be 'parametrize'" + raise MarkerError(msg.format(metafunc.function.__name__, attr)) + try: + markers = metafunc.function.parametrize + except AttributeError: + return + for marker in markers: + metafunc.parametrize(*marker.args, **marker.kwargs) + +def pytest_configure(config): + config.addinivalue_line("markers", + "parametrize(argnames, argvalues): call a test function multiple " + "times passing in different arguments in turn. argvalues generally " + "needs to be a list of values if argnames specifies only one name " + "or a list of tuples of values if argnames specifies multiple names. " + "Example: @parametrize('arg1', [1,2]) would lead to two calls of the " + "decorated test function, one with arg1=1 and another with arg1=2." + "see http://pytest.org/latest/parametrize.html for more info and " + "examples." + ) + config.addinivalue_line("markers", + "usefixtures(fixturename1, fixturename2, ...): mark tests as needing " + "all of the specified fixtures. see http://pytest.org/latest/fixture.html#usefixtures " + ) + +def pytest_sessionstart(session): + session._fixturemanager = FixtureManager(session) + +@pytest.hookimpl(trylast=True) +def pytest_namespace(): + raises.Exception = pytest.fail.Exception + return { + 'fixture': fixture, + 'yield_fixture': yield_fixture, + 'raises' : raises, + 'collect': { + 'Module': Module, 'Class': Class, 'Instance': Instance, + 'Function': Function, 'Generator': Generator, + '_fillfuncargs': fillfixtures} + } + +@fixture(scope="session") +def pytestconfig(request): + """ the pytest config object with access to command line opts.""" + return request.config + + +@pytest.hookimpl(trylast=True) +def pytest_pyfunc_call(pyfuncitem): + testfunction = pyfuncitem.obj + if pyfuncitem._isyieldedfunction(): + testfunction(*pyfuncitem._args) + else: + funcargs = pyfuncitem.funcargs + testargs = {} + for arg in pyfuncitem._fixtureinfo.argnames: + testargs[arg] = funcargs[arg] + testfunction(**testargs) + return True + +def pytest_collect_file(path, parent): + ext = path.ext + if ext == ".py": + if not parent.session.isinitpath(path): + for pat in parent.config.getini('python_files'): + if path.fnmatch(pat): + break + else: + return + ihook = parent.session.gethookproxy(path) + return ihook.pytest_pycollect_makemodule(path=path, parent=parent) + +def pytest_pycollect_makemodule(path, parent): + return Module(path, parent) + +@pytest.hookimpl(hookwrapper=True) +def pytest_pycollect_makeitem(collector, name, obj): + outcome = yield + res = outcome.get_result() + if res is not None: + raise StopIteration + # nothing was collected elsewhere, let's do it here + if isclass(obj): + if collector.istestclass(obj, name): + Class = collector._getcustomclass("Class") + outcome.force_result(Class(name, parent=collector)) + elif collector.istestfunction(obj, name): + # mock seems to store unbound methods (issue473), normalize it + obj = getattr(obj, "__func__", obj) + # We need to try and unwrap the function if it's a functools.partial + # or a funtools.wrapped. + # We musn't if it's been wrapped with mock.patch (python 2 only) + if not (isfunction(obj) or isfunction(get_real_func(obj))): + collector.warn(code="C2", message= + "cannot collect %r because it is not a function." + % name, ) + elif getattr(obj, "__test__", True): + if is_generator(obj): + res = Generator(name, parent=collector) + else: + res = list(collector._genfunctions(name, obj)) + outcome.force_result(res) + +def is_generator(func): + try: + return _pytest._code.getrawcode(func).co_flags & 32 # generator function + except AttributeError: # builtin functions have no bytecode + # assume them to not be generators + return False + +class PyobjContext(object): + module = pyobj_property("Module") + cls = pyobj_property("Class") + instance = pyobj_property("Instance") + +class PyobjMixin(PyobjContext): + def obj(): + def fget(self): + try: + return self._obj + except AttributeError: + self._obj = obj = self._getobj() + return obj + def fset(self, value): + self._obj = value + return property(fget, fset, None, "underlying python object") + obj = obj() + + def _getobj(self): + return getattr(self.parent.obj, self.name) + + def getmodpath(self, stopatmodule=True, includemodule=False): + """ return python path relative to the containing module. """ + chain = self.listchain() + chain.reverse() + parts = [] + for node in chain: + if isinstance(node, Instance): + continue + name = node.name + if isinstance(node, Module): + assert name.endswith(".py") + name = name[:-3] + if stopatmodule: + if includemodule: + parts.append(name) + break + parts.append(name) + parts.reverse() + s = ".".join(parts) + return s.replace(".[", "[") + + def _getfslineno(self): + return getfslineno(self.obj) + + def reportinfo(self): + # XXX caching? + obj = self.obj + compat_co_firstlineno = getattr(obj, 'compat_co_firstlineno', None) + if isinstance(compat_co_firstlineno, int): + # nose compatibility + fspath = sys.modules[obj.__module__].__file__ + if fspath.endswith(".pyc"): + fspath = fspath[:-1] + lineno = compat_co_firstlineno + else: + fspath, lineno = getfslineno(obj) + modpath = self.getmodpath() + assert isinstance(lineno, int) + return fspath, lineno, modpath + +class PyCollector(PyobjMixin, pytest.Collector): + + def funcnamefilter(self, name): + return self._matches_prefix_or_glob_option('python_functions', name) + + def isnosetest(self, obj): + """ Look for the __test__ attribute, which is applied by the + @nose.tools.istest decorator + """ + # We explicitly check for "is True" here to not mistakenly treat + # classes with a custom __getattr__ returning something truthy (like a + # function) as test classes. + return safe_getattr(obj, '__test__', False) is True + + def classnamefilter(self, name): + return self._matches_prefix_or_glob_option('python_classes', name) + + def istestfunction(self, obj, name): + return ( + (self.funcnamefilter(name) or self.isnosetest(obj)) and + safe_getattr(obj, "__call__", False) and getfixturemarker(obj) is None + ) + + def istestclass(self, obj, name): + return self.classnamefilter(name) or self.isnosetest(obj) + + def _matches_prefix_or_glob_option(self, option_name, name): + """ + checks if the given name matches the prefix or glob-pattern defined + in ini configuration. + """ + for option in self.config.getini(option_name): + if name.startswith(option): + return True + # check that name looks like a glob-string before calling fnmatch + # because this is called for every name in each collected module, + # and fnmatch is somewhat expensive to call + elif ('*' in option or '?' in option or '[' in option) and \ + fnmatch.fnmatch(name, option): + return True + return False + + def collect(self): + if not getattr(self.obj, "__test__", True): + return [] + + # NB. we avoid random getattrs and peek in the __dict__ instead + # (XXX originally introduced from a PyPy need, still true?) + dicts = [getattr(self.obj, '__dict__', {})] + for basecls in inspect.getmro(self.obj.__class__): + dicts.append(basecls.__dict__) + seen = {} + l = [] + for dic in dicts: + for name, obj in list(dic.items()): + if name in seen: + continue + seen[name] = True + res = self.makeitem(name, obj) + if res is None: + continue + if not isinstance(res, list): + res = [res] + l.extend(res) + l.sort(key=lambda item: item.reportinfo()[:2]) + return l + + def makeitem(self, name, obj): + #assert self.ihook.fspath == self.fspath, self + return self.ihook.pytest_pycollect_makeitem( + collector=self, name=name, obj=obj) + + def _genfunctions(self, name, funcobj): + module = self.getparent(Module).obj + clscol = self.getparent(Class) + cls = clscol and clscol.obj or None + transfer_markers(funcobj, cls, module) + fm = self.session._fixturemanager + fixtureinfo = fm.getfixtureinfo(self, funcobj, cls) + metafunc = Metafunc(funcobj, fixtureinfo, self.config, + cls=cls, module=module) + methods = [] + if hasattr(module, "pytest_generate_tests"): + methods.append(module.pytest_generate_tests) + if hasattr(cls, "pytest_generate_tests"): + methods.append(cls().pytest_generate_tests) + if methods: + self.ihook.pytest_generate_tests.call_extra(methods, + dict(metafunc=metafunc)) + else: + self.ihook.pytest_generate_tests(metafunc=metafunc) + + Function = self._getcustomclass("Function") + if not metafunc._calls: + yield Function(name, parent=self, fixtureinfo=fixtureinfo) + else: + # add funcargs() as fixturedefs to fixtureinfo.arg2fixturedefs + add_funcarg_pseudo_fixture_def(self, metafunc, fm) + + for callspec in metafunc._calls: + subname = "%s[%s]" %(name, callspec.id) + yield Function(name=subname, parent=self, + callspec=callspec, callobj=funcobj, + fixtureinfo=fixtureinfo, + keywords={callspec.id:True}) + +def add_funcarg_pseudo_fixture_def(collector, metafunc, fixturemanager): + # this function will transform all collected calls to a functions + # if they use direct funcargs (i.e. direct parametrization) + # because we want later test execution to be able to rely on + # an existing FixtureDef structure for all arguments. + # XXX we can probably avoid this algorithm if we modify CallSpec2 + # to directly care for creating the fixturedefs within its methods. + if not metafunc._calls[0].funcargs: + return # this function call does not have direct parametrization + # collect funcargs of all callspecs into a list of values + arg2params = {} + arg2scope = {} + for callspec in metafunc._calls: + for argname, argvalue in callspec.funcargs.items(): + assert argname not in callspec.params + callspec.params[argname] = argvalue + arg2params_list = arg2params.setdefault(argname, []) + callspec.indices[argname] = len(arg2params_list) + arg2params_list.append(argvalue) + if argname not in arg2scope: + scopenum = callspec._arg2scopenum.get(argname, + scopenum_function) + arg2scope[argname] = scopes[scopenum] + callspec.funcargs.clear() + + # register artificial FixtureDef's so that later at test execution + # time we can rely on a proper FixtureDef to exist for fixture setup. + arg2fixturedefs = metafunc._arg2fixturedefs + for argname, valuelist in arg2params.items(): + # if we have a scope that is higher than function we need + # to make sure we only ever create an according fixturedef on + # a per-scope basis. We thus store and cache the fixturedef on the + # node related to the scope. + scope = arg2scope[argname] + node = None + if scope != "function": + node = get_scope_node(collector, scope) + if node is None: + assert scope == "class" and isinstance(collector, Module) + # use module-level collector for class-scope (for now) + node = collector + if node and argname in node._name2pseudofixturedef: + arg2fixturedefs[argname] = [node._name2pseudofixturedef[argname]] + else: + fixturedef = FixtureDef(fixturemanager, '', argname, + get_direct_param_fixture_func, + arg2scope[argname], + valuelist, False, False) + arg2fixturedefs[argname] = [fixturedef] + if node is not None: + node._name2pseudofixturedef[argname] = fixturedef + + +def get_direct_param_fixture_func(request): + return request.param + +class FuncFixtureInfo: + def __init__(self, argnames, names_closure, name2fixturedefs): + self.argnames = argnames + self.names_closure = names_closure + self.name2fixturedefs = name2fixturedefs + + +def _marked(func, mark): + """ Returns True if :func: is already marked with :mark:, False otherwise. + This can happen if marker is applied to class and the test file is + invoked more than once. + """ + try: + func_mark = getattr(func, mark.name) + except AttributeError: + return False + return mark.args == func_mark.args and mark.kwargs == func_mark.kwargs + + +def transfer_markers(funcobj, cls, mod): + # XXX this should rather be code in the mark plugin or the mark + # plugin should merge with the python plugin. + for holder in (cls, mod): + try: + pytestmark = holder.pytestmark + except AttributeError: + continue + if isinstance(pytestmark, list): + for mark in pytestmark: + if not _marked(funcobj, mark): + mark(funcobj) + else: + if not _marked(funcobj, pytestmark): + pytestmark(funcobj) + +class Module(pytest.File, PyCollector): + """ Collector for test classes and functions. """ + def _getobj(self): + return self._memoizedcall('_obj', self._importtestmodule) + + def collect(self): + self.session._fixturemanager.parsefactories(self) + return super(Module, self).collect() + + def _importtestmodule(self): + # we assume we are only called once per module + importmode = self.config.getoption("--import-mode") + try: + mod = self.fspath.pyimport(ensuresyspath=importmode) + except SyntaxError: + raise self.CollectError( + _pytest._code.ExceptionInfo().getrepr(style="short")) + except self.fspath.ImportMismatchError: + e = sys.exc_info()[1] + raise self.CollectError( + "import file mismatch:\n" + "imported module %r has this __file__ attribute:\n" + " %s\n" + "which is not the same as the test file we want to collect:\n" + " %s\n" + "HINT: remove __pycache__ / .pyc files and/or use a " + "unique basename for your test file modules" + % e.args + ) + #print "imported test module", mod + self.config.pluginmanager.consider_module(mod) + return mod + + def setup(self): + setup_module = xunitsetup(self.obj, "setUpModule") + if setup_module is None: + setup_module = xunitsetup(self.obj, "setup_module") + if setup_module is not None: + #XXX: nose compat hack, move to nose plugin + # if it takes a positional arg, its probably a pytest style one + # so we pass the current module object + if _has_positional_arg(setup_module): + setup_module(self.obj) + else: + setup_module() + fin = getattr(self.obj, 'tearDownModule', None) + if fin is None: + fin = getattr(self.obj, 'teardown_module', None) + if fin is not None: + #XXX: nose compat hack, move to nose plugin + # if it takes a positional arg, it's probably a pytest style one + # so we pass the current module object + if _has_positional_arg(fin): + finalizer = lambda: fin(self.obj) + else: + finalizer = fin + self.addfinalizer(finalizer) + + +class Class(PyCollector): + """ Collector for test methods. """ + def collect(self): + if hasinit(self.obj): + self.warn("C1", "cannot collect test class %r because it has a " + "__init__ constructor" % self.obj.__name__) + return [] + return [self._getcustomclass("Instance")(name="()", parent=self)] + + def setup(self): + setup_class = xunitsetup(self.obj, 'setup_class') + if setup_class is not None: + setup_class = getattr(setup_class, 'im_func', setup_class) + setup_class = getattr(setup_class, '__func__', setup_class) + setup_class(self.obj) + + fin_class = getattr(self.obj, 'teardown_class', None) + if fin_class is not None: + fin_class = getattr(fin_class, 'im_func', fin_class) + fin_class = getattr(fin_class, '__func__', fin_class) + self.addfinalizer(lambda: fin_class(self.obj)) + +class Instance(PyCollector): + def _getobj(self): + obj = self.parent.obj() + return obj + + def collect(self): + self.session._fixturemanager.parsefactories(self) + return super(Instance, self).collect() + + def newinstance(self): + self.obj = self._getobj() + return self.obj + +class FunctionMixin(PyobjMixin): + """ mixin for the code common to Function and Generator. + """ + + def setup(self): + """ perform setup for this test function. """ + if hasattr(self, '_preservedparent'): + obj = self._preservedparent + elif isinstance(self.parent, Instance): + obj = self.parent.newinstance() + self.obj = self._getobj() + else: + obj = self.parent.obj + if inspect.ismethod(self.obj): + setup_name = 'setup_method' + teardown_name = 'teardown_method' + else: + setup_name = 'setup_function' + teardown_name = 'teardown_function' + setup_func_or_method = xunitsetup(obj, setup_name) + if setup_func_or_method is not None: + setup_func_or_method(self.obj) + fin = getattr(obj, teardown_name, None) + if fin is not None: + self.addfinalizer(lambda: fin(self.obj)) + + def _prunetraceback(self, excinfo): + if hasattr(self, '_obj') and not self.config.option.fulltrace: + code = _pytest._code.Code(get_real_func(self.obj)) + path, firstlineno = code.path, code.firstlineno + traceback = excinfo.traceback + ntraceback = traceback.cut(path=path, firstlineno=firstlineno) + if ntraceback == traceback: + ntraceback = ntraceback.cut(path=path) + if ntraceback == traceback: + #ntraceback = ntraceback.cut(excludepath=cutdir2) + ntraceback = ntraceback.filter(filter_traceback) + if not ntraceback: + ntraceback = traceback + + excinfo.traceback = ntraceback.filter() + # issue364: mark all but first and last frames to + # only show a single-line message for each frame + if self.config.option.tbstyle == "auto": + if len(excinfo.traceback) > 2: + for entry in excinfo.traceback[1:-1]: + entry.set_repr_style('short') + + def _repr_failure_py(self, excinfo, style="long"): + if excinfo.errisinstance(pytest.fail.Exception): + if not excinfo.value.pytrace: + return py._builtin._totext(excinfo.value) + return super(FunctionMixin, self)._repr_failure_py(excinfo, + style=style) + + def repr_failure(self, excinfo, outerr=None): + assert outerr is None, "XXX outerr usage is deprecated" + style = self.config.option.tbstyle + if style == "auto": + style = "long" + return self._repr_failure_py(excinfo, style=style) + + +class Generator(FunctionMixin, PyCollector): + def collect(self): + # test generators are seen as collectors but they also + # invoke setup/teardown on popular request + # (induced by the common "test_*" naming shared with normal tests) + self.session._setupstate.prepare(self) + # see FunctionMixin.setup and test_setupstate_is_preserved_134 + self._preservedparent = self.parent.obj + l = [] + seen = {} + for i, x in enumerate(self.obj()): + name, call, args = self.getcallargs(x) + if not callable(call): + raise TypeError("%r yielded non callable test %r" %(self.obj, call,)) + if name is None: + name = "[%d]" % i + else: + name = "['%s']" % name + if name in seen: + raise ValueError("%r generated tests with non-unique name %r" %(self, name)) + seen[name] = True + l.append(self.Function(name, self, args=args, callobj=call)) + return l + + def getcallargs(self, obj): + if not isinstance(obj, (tuple, list)): + obj = (obj,) + # explict naming + if isinstance(obj[0], py.builtin._basestring): + name = obj[0] + obj = obj[1:] + else: + name = None + call, args = obj[0], obj[1:] + return name, call, args + + +def hasinit(obj): + init = getattr(obj, '__init__', None) + if init: + if init != object.__init__: + return True + + + +def fillfixtures(function): + """ fill missing funcargs for a test function. """ + try: + request = function._request + except AttributeError: + # XXX this special code path is only expected to execute + # with the oejskit plugin. It uses classes with funcargs + # and we thus have to work a bit to allow this. + fm = function.session._fixturemanager + fi = fm.getfixtureinfo(function.parent, function.obj, None) + function._fixtureinfo = fi + request = function._request = FixtureRequest(function) + request._fillfixtures() + # prune out funcargs for jstests + newfuncargs = {} + for name in fi.argnames: + newfuncargs[name] = function.funcargs[name] + function.funcargs = newfuncargs + else: + request._fillfixtures() + + +_notexists = object() + +class CallSpec2(object): + def __init__(self, metafunc): + self.metafunc = metafunc + self.funcargs = {} + self._idlist = [] + self.params = {} + self._globalid = _notexists + self._globalid_args = set() + self._globalparam = _notexists + self._arg2scopenum = {} # used for sorting parametrized resources + self.keywords = {} + self.indices = {} + + def copy(self, metafunc): + cs = CallSpec2(self.metafunc) + cs.funcargs.update(self.funcargs) + cs.params.update(self.params) + cs.keywords.update(self.keywords) + cs.indices.update(self.indices) + cs._arg2scopenum.update(self._arg2scopenum) + cs._idlist = list(self._idlist) + cs._globalid = self._globalid + cs._globalid_args = self._globalid_args + cs._globalparam = self._globalparam + return cs + + def _checkargnotcontained(self, arg): + if arg in self.params or arg in self.funcargs: + raise ValueError("duplicate %r" %(arg,)) + + def getparam(self, name): + try: + return self.params[name] + except KeyError: + if self._globalparam is _notexists: + raise ValueError(name) + return self._globalparam + + @property + def id(self): + return "-".join(map(str, filter(None, self._idlist))) + + def setmulti(self, valtypes, argnames, valset, id, keywords, scopenum, + param_index): + for arg,val in zip(argnames, valset): + self._checkargnotcontained(arg) + valtype_for_arg = valtypes[arg] + getattr(self, valtype_for_arg)[arg] = val + self.indices[arg] = param_index + self._arg2scopenum[arg] = scopenum + self._idlist.append(id) + self.keywords.update(keywords) + + def setall(self, funcargs, id, param): + for x in funcargs: + self._checkargnotcontained(x) + self.funcargs.update(funcargs) + if id is not _notexists: + self._idlist.append(id) + if param is not _notexists: + assert self._globalparam is _notexists + self._globalparam = param + for arg in funcargs: + self._arg2scopenum[arg] = scopenum_function + + +class FuncargnamesCompatAttr: + """ helper class so that Metafunc, Function and FixtureRequest + don't need to each define the "funcargnames" compatibility attribute. + """ + @property + def funcargnames(self): + """ alias attribute for ``fixturenames`` for pre-2.3 compatibility""" + return self.fixturenames + +class Metafunc(FuncargnamesCompatAttr): + """ + Metafunc objects are passed to the ``pytest_generate_tests`` hook. + They help to inspect a test function and to generate tests according to + test configuration or values specified in the class or module where a + test function is defined. + + :ivar fixturenames: set of fixture names required by the test function + + :ivar function: underlying python test function + + :ivar cls: class object where the test function is defined in or ``None``. + + :ivar module: the module object where the test function is defined in. + + :ivar config: access to the :class:`_pytest.config.Config` object for the + test session. + + :ivar funcargnames: + .. deprecated:: 2.3 + Use ``fixturenames`` instead. + """ + def __init__(self, function, fixtureinfo, config, cls=None, module=None): + self.config = config + self.module = module + self.function = function + self.fixturenames = fixtureinfo.names_closure + self._arg2fixturedefs = fixtureinfo.name2fixturedefs + self.cls = cls + self._calls = [] + self._ids = py.builtin.set() + + def parametrize(self, argnames, argvalues, indirect=False, ids=None, + scope=None): + """ Add new invocations to the underlying test function using the list + of argvalues for the given argnames. Parametrization is performed + during the collection phase. If you need to setup expensive resources + see about setting indirect to do it rather at test setup time. + + :arg argnames: a comma-separated string denoting one or more argument + names, or a list/tuple of argument strings. + + :arg argvalues: The list of argvalues determines how often a + test is invoked with different argument values. If only one + argname was specified argvalues is a list of values. If N + argnames were specified, argvalues must be a list of N-tuples, + where each tuple-element specifies a value for its respective + argname. + + :arg indirect: The list of argnames or boolean. A list of arguments' + names (subset of argnames). If True the list contains all names from + the argnames. Each argvalue corresponding to an argname in this list will + be passed as request.param to its respective argname fixture + function so that it can perform more expensive setups during the + setup phase of a test rather than at collection time. + + :arg ids: list of string ids, or a callable. + If strings, each is corresponding to the argvalues so that they are + part of the test id. + If callable, it should take one argument (a single argvalue) and return + a string or return None. If None, the automatically generated id for that + argument will be used. + If no ids are provided they will be generated automatically from + the argvalues. + + :arg scope: if specified it denotes the scope of the parameters. + The scope is used for grouping tests by parameter instances. + It will also override any fixture-function defined scope, allowing + to set a dynamic scope using test context or configuration. + """ + + # individual parametrized argument sets can be wrapped in a series + # of markers in which case we unwrap the values and apply the mark + # at Function init + newkeywords = {} + unwrapped_argvalues = [] + for i, argval in enumerate(argvalues): + while isinstance(argval, MarkDecorator): + newmark = MarkDecorator(argval.markname, + argval.args[:-1], argval.kwargs) + newmarks = newkeywords.setdefault(i, {}) + newmarks[newmark.markname] = newmark + argval = argval.args[-1] + unwrapped_argvalues.append(argval) + argvalues = unwrapped_argvalues + + if not isinstance(argnames, (tuple, list)): + argnames = [x.strip() for x in argnames.split(",") if x.strip()] + if len(argnames) == 1: + argvalues = [(val,) for val in argvalues] + if not argvalues: + argvalues = [(_notexists,) * len(argnames)] + # we passed a empty list to parameterize, skip that test + # + fs, lineno = getfslineno(self.function) + newmark = pytest.mark.skip( + reason="got empty parameter set %r, function %s at %s:%d" % ( + argnames, self.function.__name__, fs, lineno)) + newmarks = newkeywords.setdefault(0, {}) + newmarks[newmark.markname] = newmark + + + if scope is None: + scope = "function" + scopenum = scopes.index(scope) + valtypes = {} + for arg in argnames: + if arg not in self.fixturenames: + raise ValueError("%r uses no fixture %r" %(self.function, arg)) + + if indirect is True: + valtypes = dict.fromkeys(argnames, "params") + elif indirect is False: + valtypes = dict.fromkeys(argnames, "funcargs") + elif isinstance(indirect, (tuple, list)): + valtypes = dict.fromkeys(argnames, "funcargs") + for arg in indirect: + if arg not in argnames: + raise ValueError("indirect given to %r: fixture %r doesn't exist" %( + self.function, arg)) + valtypes[arg] = "params" + idfn = None + if callable(ids): + idfn = ids + ids = None + if ids and len(ids) != len(argvalues): + raise ValueError('%d tests specified with %d ids' %( + len(argvalues), len(ids))) + if not ids: + ids = idmaker(argnames, argvalues, idfn) + newcalls = [] + for callspec in self._calls or [CallSpec2(self)]: + for param_index, valset in enumerate(argvalues): + assert len(valset) == len(argnames) + newcallspec = callspec.copy(self) + newcallspec.setmulti(valtypes, argnames, valset, ids[param_index], + newkeywords.get(param_index, {}), scopenum, + param_index) + newcalls.append(newcallspec) + self._calls = newcalls + + def addcall(self, funcargs=None, id=_notexists, param=_notexists): + """ (deprecated, use parametrize) Add a new call to the underlying + test function during the collection phase of a test run. Note that + request.addcall() is called during the test collection phase prior and + independently to actual test execution. You should only use addcall() + if you need to specify multiple arguments of a test function. + + :arg funcargs: argument keyword dictionary used when invoking + the test function. + + :arg id: used for reporting and identification purposes. If you + don't supply an `id` an automatic unique id will be generated. + + :arg param: a parameter which will be exposed to a later fixture function + invocation through the ``request.param`` attribute. + """ + assert funcargs is None or isinstance(funcargs, dict) + if funcargs is not None: + for name in funcargs: + if name not in self.fixturenames: + pytest.fail("funcarg %r not used in this function." % name) + else: + funcargs = {} + if id is None: + raise ValueError("id=None not allowed") + if id is _notexists: + id = len(self._calls) + id = str(id) + if id in self._ids: + raise ValueError("duplicate id %r" % id) + self._ids.add(id) + + cs = CallSpec2(self) + cs.setall(funcargs, id, param) + self._calls.append(cs) + + +if _PY3: + import codecs + + def _escape_bytes(val): + """ + If val is pure ascii, returns it as a str(), otherwise escapes + into a sequence of escaped bytes: + b'\xc3\xb4\xc5\xd6' -> u'\\xc3\\xb4\\xc5\\xd6' + + note: + the obvious "v.decode('unicode-escape')" will return + valid utf-8 unicode if it finds them in the string, but we + want to return escaped bytes for any byte, even if they match + a utf-8 string. + """ + if val: + # source: http://goo.gl/bGsnwC + encoded_bytes, _ = codecs.escape_encode(val) + return encoded_bytes.decode('ascii') + else: + # empty bytes crashes codecs.escape_encode (#1087) + return '' +else: + def _escape_bytes(val): + """ + In py2 bytes and str are the same type, so return it unchanged if it + is a full ascii string, otherwise escape it into its binary form. + """ + try: + return val.decode('ascii') + except UnicodeDecodeError: + return val.encode('string-escape') + + +def _idval(val, argname, idx, idfn): + if idfn: + try: + s = idfn(val) + if s: + return s + except Exception: + pass + + if isinstance(val, bytes): + return _escape_bytes(val) + elif isinstance(val, (float, int, str, bool, NoneType)): + return str(val) + elif isinstance(val, REGEX_TYPE): + return _escape_bytes(val.pattern) if isinstance(val.pattern, bytes) else val.pattern + elif enum is not None and isinstance(val, enum.Enum): + return str(val) + elif isclass(val) and hasattr(val, '__name__'): + return val.__name__ + elif _PY2 and isinstance(val, unicode): + # special case for python 2: if a unicode string is + # convertible to ascii, return it as an str() object instead + try: + return str(val) + except UnicodeError: + # fallthrough + pass + return str(argname)+str(idx) + +def _idvalset(idx, valset, argnames, idfn): + this_id = [_idval(val, argname, idx, idfn) + for val, argname in zip(valset, argnames)] + return "-".join(this_id) + +def idmaker(argnames, argvalues, idfn=None): + ids = [_idvalset(valindex, valset, argnames, idfn) + for valindex, valset in enumerate(argvalues)] + if len(set(ids)) < len(ids): + # user may have provided a bad idfn which means the ids are not unique + ids = [str(i) + testid for i, testid in enumerate(ids)] + return ids + +def showfixtures(config): + from _pytest.main import wrap_session + return wrap_session(config, _showfixtures_main) + +def _showfixtures_main(config, session): + import _pytest.config + session.perform_collect() + curdir = py.path.local() + tw = _pytest.config.create_terminal_writer(config) + verbose = config.getvalue("verbose") + + fm = session._fixturemanager + + available = [] + for argname, fixturedefs in fm._arg2fixturedefs.items(): + assert fixturedefs is not None + if not fixturedefs: + continue + for fixturedef in fixturedefs: + loc = getlocation(fixturedef.func, curdir) + available.append((len(fixturedef.baseid), + fixturedef.func.__module__, + curdir.bestrelpath(loc), + fixturedef.argname, fixturedef)) + + available.sort() + currentmodule = None + for baseid, module, bestrel, argname, fixturedef in available: + if currentmodule != module: + if not module.startswith("_pytest."): + tw.line() + tw.sep("-", "fixtures defined from %s" %(module,)) + currentmodule = module + if verbose <= 0 and argname[0] == "_": + continue + if verbose > 0: + funcargspec = "%s -- %s" %(argname, bestrel,) + else: + funcargspec = argname + tw.line(funcargspec, green=True) + loc = getlocation(fixturedef.func, curdir) + doc = fixturedef.func.__doc__ or "" + if doc: + for line in doc.strip().split("\n"): + tw.line(" " + line.strip()) + else: + tw.line(" %s: no docstring available" %(loc,), + red=True) + +def getlocation(function, curdir): + import inspect + fn = py.path.local(inspect.getfile(function)) + lineno = py.builtin._getcode(function).co_firstlineno + if fn.relto(curdir): + fn = fn.relto(curdir) + return "%s:%d" %(fn, lineno+1) + +# builtin pytest.raises helper + +def raises(expected_exception, *args, **kwargs): + """ assert that a code block/function call raises ``expected_exception`` + and raise a failure exception otherwise. + + This helper produces a ``ExceptionInfo()`` object (see below). + + If using Python 2.5 or above, you may use this function as a + context manager:: + + >>> with raises(ZeroDivisionError): + ... 1/0 + + .. note:: + + When using ``pytest.raises`` as a context manager, it's worthwhile to + note that normal context manager rules apply and that the exception + raised *must* be the final line in the scope of the context manager. + Lines of code after that, within the scope of the context manager will + not be executed. For example:: + + >>> with raises(OSError) as exc_info: + assert 1 == 1 # this will execute as expected + raise OSError(errno.EEXISTS, 'directory exists') + assert exc_info.value.errno == errno.EEXISTS # this will not execute + + Instead, the following approach must be taken (note the difference in + scope):: + + >>> with raises(OSError) as exc_info: + assert 1 == 1 # this will execute as expected + raise OSError(errno.EEXISTS, 'directory exists') + + assert exc_info.value.errno == errno.EEXISTS # this will now execute + + Or you can specify a callable by passing a to-be-called lambda:: + + >>> raises(ZeroDivisionError, lambda: 1/0) + <ExceptionInfo ...> + + or you can specify an arbitrary callable with arguments:: + + >>> def f(x): return 1/x + ... + >>> raises(ZeroDivisionError, f, 0) + <ExceptionInfo ...> + >>> raises(ZeroDivisionError, f, x=0) + <ExceptionInfo ...> + + A third possibility is to use a string to be executed:: + + >>> raises(ZeroDivisionError, "f(0)") + <ExceptionInfo ...> + + .. autoclass:: _pytest._code.ExceptionInfo + :members: + + .. note:: + Similar to caught exception objects in Python, explicitly clearing + local references to returned ``ExceptionInfo`` objects can + help the Python interpreter speed up its garbage collection. + + Clearing those references breaks a reference cycle + (``ExceptionInfo`` --> caught exception --> frame stack raising + the exception --> current frame stack --> local variables --> + ``ExceptionInfo``) which makes Python keep all objects referenced + from that cycle (including all local variables in the current + frame) alive until the next cyclic garbage collection run. See the + official Python ``try`` statement documentation for more detailed + information. + + """ + __tracebackhide__ = True + if expected_exception is AssertionError: + # we want to catch a AssertionError + # replace our subclass with the builtin one + # see https://github.com/pytest-dev/pytest/issues/176 + from _pytest.assertion.util import BuiltinAssertionError \ + as expected_exception + msg = ("exceptions must be old-style classes or" + " derived from BaseException, not %s") + if isinstance(expected_exception, tuple): + for exc in expected_exception: + if not isclass(exc): + raise TypeError(msg % type(exc)) + elif not isclass(expected_exception): + raise TypeError(msg % type(expected_exception)) + + if not args: + return RaisesContext(expected_exception) + elif isinstance(args[0], str): + code, = args + assert isinstance(code, str) + frame = sys._getframe(1) + loc = frame.f_locals.copy() + loc.update(kwargs) + #print "raises frame scope: %r" % frame.f_locals + try: + code = _pytest._code.Source(code).compile() + py.builtin.exec_(code, frame.f_globals, loc) + # XXX didn'T mean f_globals == f_locals something special? + # this is destroyed here ... + except expected_exception: + return _pytest._code.ExceptionInfo() + else: + func = args[0] + try: + func(*args[1:], **kwargs) + except expected_exception: + return _pytest._code.ExceptionInfo() + pytest.fail("DID NOT RAISE {0}".format(expected_exception)) + +class RaisesContext(object): + def __init__(self, expected_exception): + self.expected_exception = expected_exception + self.excinfo = None + + def __enter__(self): + self.excinfo = object.__new__(_pytest._code.ExceptionInfo) + return self.excinfo + + def __exit__(self, *tp): + __tracebackhide__ = True + if tp[0] is None: + pytest.fail("DID NOT RAISE") + if sys.version_info < (2, 7): + # py26: on __exit__() exc_value often does not contain the + # exception value. + # http://bugs.python.org/issue7853 + if not isinstance(tp[1], BaseException): + exc_type, value, traceback = tp + tp = exc_type, exc_type(value), traceback + self.excinfo.__init__(tp) + return issubclass(self.excinfo.type, self.expected_exception) + +# +# the basic pytest Function item +# + +class Function(FunctionMixin, pytest.Item, FuncargnamesCompatAttr): + """ a Function Item is responsible for setting up and executing a + Python test function. + """ + _genid = None + def __init__(self, name, parent, args=None, config=None, + callspec=None, callobj=NOTSET, keywords=None, session=None, + fixtureinfo=None): + super(Function, self).__init__(name, parent, config=config, + session=session) + self._args = args + if callobj is not NOTSET: + self.obj = callobj + + self.keywords.update(self.obj.__dict__) + if callspec: + self.callspec = callspec + self.keywords.update(callspec.keywords) + if keywords: + self.keywords.update(keywords) + + if fixtureinfo is None: + fixtureinfo = self.session._fixturemanager.getfixtureinfo( + self.parent, self.obj, self.cls, + funcargs=not self._isyieldedfunction()) + self._fixtureinfo = fixtureinfo + self.fixturenames = fixtureinfo.names_closure + self._initrequest() + + def _initrequest(self): + self.funcargs = {} + if self._isyieldedfunction(): + assert not hasattr(self, "callspec"), ( + "yielded functions (deprecated) cannot have funcargs") + else: + if hasattr(self, "callspec"): + callspec = self.callspec + assert not callspec.funcargs + self._genid = callspec.id + if hasattr(callspec, "param"): + self.param = callspec.param + self._request = FixtureRequest(self) + + @property + def function(self): + "underlying python 'function' object" + return getattr(self.obj, 'im_func', self.obj) + + def _getobj(self): + name = self.name + i = name.find("[") # parametrization + if i != -1: + name = name[:i] + return getattr(self.parent.obj, name) + + @property + def _pyfuncitem(self): + "(compatonly) for code expecting pytest-2.2 style request objects" + return self + + def _isyieldedfunction(self): + return getattr(self, "_args", None) is not None + + def runtest(self): + """ execute the underlying test function. """ + self.ihook.pytest_pyfunc_call(pyfuncitem=self) + + def setup(self): + super(Function, self).setup() + fillfixtures(self) + + +scope2props = dict(session=()) +scope2props["module"] = ("fspath", "module") +scope2props["class"] = scope2props["module"] + ("cls",) +scope2props["instance"] = scope2props["class"] + ("instance", ) +scope2props["function"] = scope2props["instance"] + ("function", "keywords") + +def scopeproperty(name=None, doc=None): + def decoratescope(func): + scopename = name or func.__name__ + def provide(self): + if func.__name__ in scope2props[self.scope]: + return func(self) + raise AttributeError("%s not available in %s-scoped context" % ( + scopename, self.scope)) + return property(provide, None, None, func.__doc__) + return decoratescope + + +class FixtureRequest(FuncargnamesCompatAttr): + """ A request for a fixture from a test or fixture function. + + A request object gives access to the requesting test context + and has an optional ``param`` attribute in case + the fixture is parametrized indirectly. + """ + + def __init__(self, pyfuncitem): + self._pyfuncitem = pyfuncitem + #: fixture for which this request is being performed + self.fixturename = None + #: Scope string, one of "function", "class", "module", "session" + self.scope = "function" + self._funcargs = {} + self._fixturedefs = {} + fixtureinfo = pyfuncitem._fixtureinfo + self._arg2fixturedefs = fixtureinfo.name2fixturedefs.copy() + self._arg2index = {} + self.fixturenames = fixtureinfo.names_closure + self._fixturemanager = pyfuncitem.session._fixturemanager + + @property + def node(self): + """ underlying collection node (depends on current request scope)""" + return self._getscopeitem(self.scope) + + + def _getnextfixturedef(self, argname): + fixturedefs = self._arg2fixturedefs.get(argname, None) + if fixturedefs is None: + # we arrive here because of a a dynamic call to + # getfuncargvalue(argname) usage which was naturally + # not known at parsing/collection time + fixturedefs = self._fixturemanager.getfixturedefs( + argname, self._pyfuncitem.parent.nodeid) + self._arg2fixturedefs[argname] = fixturedefs + # fixturedefs list is immutable so we maintain a decreasing index + index = self._arg2index.get(argname, 0) - 1 + if fixturedefs is None or (-index > len(fixturedefs)): + raise FixtureLookupError(argname, self) + self._arg2index[argname] = index + return fixturedefs[index] + + @property + def config(self): + """ the pytest config object associated with this request. """ + return self._pyfuncitem.config + + + @scopeproperty() + def function(self): + """ test function object if the request has a per-function scope. """ + return self._pyfuncitem.obj + + @scopeproperty("class") + def cls(self): + """ class (can be None) where the test function was collected. """ + clscol = self._pyfuncitem.getparent(pytest.Class) + if clscol: + return clscol.obj + + @property + def instance(self): + """ instance (can be None) on which test function was collected. """ + # unittest support hack, see _pytest.unittest.TestCaseFunction + try: + return self._pyfuncitem._testcase + except AttributeError: + function = getattr(self, "function", None) + if function is not None: + return py.builtin._getimself(function) + + @scopeproperty() + def module(self): + """ python module object where the test function was collected. """ + return self._pyfuncitem.getparent(pytest.Module).obj + + @scopeproperty() + def fspath(self): + """ the file system path of the test module which collected this test. """ + return self._pyfuncitem.fspath + + @property + def keywords(self): + """ keywords/markers dictionary for the underlying node. """ + return self.node.keywords + + @property + def session(self): + """ pytest session object. """ + return self._pyfuncitem.session + + def addfinalizer(self, finalizer): + """ add finalizer/teardown function to be called after the + last test within the requesting test context finished + execution. """ + # XXX usually this method is shadowed by fixturedef specific ones + self._addfinalizer(finalizer, scope=self.scope) + + def _addfinalizer(self, finalizer, scope): + colitem = self._getscopeitem(scope) + self._pyfuncitem.session._setupstate.addfinalizer( + finalizer=finalizer, colitem=colitem) + + def applymarker(self, marker): + """ Apply a marker to a single test function invocation. + This method is useful if you don't want to have a keyword/marker + on all function invocations. + + :arg marker: a :py:class:`_pytest.mark.MarkDecorator` object + created by a call to ``pytest.mark.NAME(...)``. + """ + try: + self.node.keywords[marker.markname] = marker + except AttributeError: + raise ValueError(marker) + + def raiseerror(self, msg): + """ raise a FixtureLookupError with the given message. """ + raise self._fixturemanager.FixtureLookupError(None, self, msg) + + def _fillfixtures(self): + item = self._pyfuncitem + fixturenames = getattr(item, "fixturenames", self.fixturenames) + for argname in fixturenames: + if argname not in item.funcargs: + item.funcargs[argname] = self.getfuncargvalue(argname) + + def cached_setup(self, setup, teardown=None, scope="module", extrakey=None): + """ (deprecated) Return a testing resource managed by ``setup`` & + ``teardown`` calls. ``scope`` and ``extrakey`` determine when the + ``teardown`` function will be called so that subsequent calls to + ``setup`` would recreate the resource. With pytest-2.3 you often + do not need ``cached_setup()`` as you can directly declare a scope + on a fixture function and register a finalizer through + ``request.addfinalizer()``. + + :arg teardown: function receiving a previously setup resource. + :arg setup: a no-argument function creating a resource. + :arg scope: a string value out of ``function``, ``class``, ``module`` + or ``session`` indicating the caching lifecycle of the resource. + :arg extrakey: added to internal caching key of (funcargname, scope). + """ + if not hasattr(self.config, '_setupcache'): + self.config._setupcache = {} # XXX weakref? + cachekey = (self.fixturename, self._getscopeitem(scope), extrakey) + cache = self.config._setupcache + try: + val = cache[cachekey] + except KeyError: + self._check_scope(self.fixturename, self.scope, scope) + val = setup() + cache[cachekey] = val + if teardown is not None: + def finalizer(): + del cache[cachekey] + teardown(val) + self._addfinalizer(finalizer, scope=scope) + return val + + def getfuncargvalue(self, argname): + """ Dynamically retrieve a named fixture function argument. + + As of pytest-2.3, it is easier and usually better to access other + fixture values by stating it as an input argument in the fixture + function. If you only can decide about using another fixture at test + setup time, you may use this function to retrieve it inside a fixture + function body. + """ + return self._get_active_fixturedef(argname).cached_result[0] + + def _get_active_fixturedef(self, argname): + try: + return self._fixturedefs[argname] + except KeyError: + try: + fixturedef = self._getnextfixturedef(argname) + except FixtureLookupError: + if argname == "request": + class PseudoFixtureDef: + cached_result = (self, [0], None) + scope = "function" + return PseudoFixtureDef + raise + # remove indent to prevent the python3 exception + # from leaking into the call + result = self._getfuncargvalue(fixturedef) + self._funcargs[argname] = result + self._fixturedefs[argname] = fixturedef + return fixturedef + + def _get_fixturestack(self): + current = self + l = [] + while 1: + fixturedef = getattr(current, "_fixturedef", None) + if fixturedef is None: + l.reverse() + return l + l.append(fixturedef) + current = current._parent_request + + def _getfuncargvalue(self, fixturedef): + # prepare a subrequest object before calling fixture function + # (latter managed by fixturedef) + argname = fixturedef.argname + funcitem = self._pyfuncitem + scope = fixturedef.scope + try: + param = funcitem.callspec.getparam(argname) + except (AttributeError, ValueError): + param = NOTSET + param_index = 0 + else: + # indices might not be set if old-style metafunc.addcall() was used + param_index = funcitem.callspec.indices.get(argname, 0) + # if a parametrize invocation set a scope it will override + # the static scope defined with the fixture function + paramscopenum = funcitem.callspec._arg2scopenum.get(argname) + if paramscopenum is not None: + scope = scopes[paramscopenum] + + subrequest = SubRequest(self, scope, param, param_index, fixturedef) + + # check if a higher-level scoped fixture accesses a lower level one + subrequest._check_scope(argname, self.scope, scope) + + # clear sys.exc_info before invoking the fixture (python bug?) + # if its not explicitly cleared it will leak into the call + exc_clear() + try: + # call the fixture function + val = fixturedef.execute(request=subrequest) + finally: + # if fixture function failed it might have registered finalizers + self.session._setupstate.addfinalizer(fixturedef.finish, + subrequest.node) + return val + + def _check_scope(self, argname, invoking_scope, requested_scope): + if argname == "request": + return + if scopemismatch(invoking_scope, requested_scope): + # try to report something helpful + lines = self._factorytraceback() + pytest.fail("ScopeMismatch: You tried to access the %r scoped " + "fixture %r with a %r scoped request object, " + "involved factories\n%s" %( + (requested_scope, argname, invoking_scope, "\n".join(lines))), + pytrace=False) + + def _factorytraceback(self): + lines = [] + for fixturedef in self._get_fixturestack(): + factory = fixturedef.func + fs, lineno = getfslineno(factory) + p = self._pyfuncitem.session.fspath.bestrelpath(fs) + args = _format_args(factory) + lines.append("%s:%d: def %s%s" %( + p, lineno, factory.__name__, args)) + return lines + + def _getscopeitem(self, scope): + if scope == "function": + # this might also be a non-function Item despite its attribute name + return self._pyfuncitem + node = get_scope_node(self._pyfuncitem, scope) + if node is None and scope == "class": + # fallback to function item itself + node = self._pyfuncitem + assert node + return node + + def __repr__(self): + return "<FixtureRequest for %r>" %(self.node) + + +class SubRequest(FixtureRequest): + """ a sub request for handling getting a fixture from a + test function/fixture. """ + def __init__(self, request, scope, param, param_index, fixturedef): + self._parent_request = request + self.fixturename = fixturedef.argname + if param is not NOTSET: + self.param = param + self.param_index = param_index + self.scope = scope + self._fixturedef = fixturedef + self.addfinalizer = fixturedef.addfinalizer + self._pyfuncitem = request._pyfuncitem + self._funcargs = request._funcargs + self._fixturedefs = request._fixturedefs + self._arg2fixturedefs = request._arg2fixturedefs + self._arg2index = request._arg2index + self.fixturenames = request.fixturenames + self._fixturemanager = request._fixturemanager + + def __repr__(self): + return "<SubRequest %r for %r>" % (self.fixturename, self._pyfuncitem) + + +class ScopeMismatchError(Exception): + """ A fixture function tries to use a different fixture function which + which has a lower scope (e.g. a Session one calls a function one) + """ + +scopes = "session module class function".split() +scopenum_function = scopes.index("function") +def scopemismatch(currentscope, newscope): + return scopes.index(newscope) > scopes.index(currentscope) + + +class FixtureLookupError(LookupError): + """ could not return a requested Fixture (missing or invalid). """ + def __init__(self, argname, request, msg=None): + self.argname = argname + self.request = request + self.fixturestack = request._get_fixturestack() + self.msg = msg + + def formatrepr(self): + tblines = [] + addline = tblines.append + stack = [self.request._pyfuncitem.obj] + stack.extend(map(lambda x: x.func, self.fixturestack)) + msg = self.msg + if msg is not None: + # the last fixture raise an error, let's present + # it at the requesting side + stack = stack[:-1] + for function in stack: + fspath, lineno = getfslineno(function) + try: + lines, _ = inspect.getsourcelines(get_real_func(function)) + except (IOError, IndexError): + error_msg = "file %s, line %s: source code not available" + addline(error_msg % (fspath, lineno+1)) + else: + addline("file %s, line %s" % (fspath, lineno+1)) + for i, line in enumerate(lines): + line = line.rstrip() + addline(" " + line) + if line.lstrip().startswith('def'): + break + + if msg is None: + fm = self.request._fixturemanager + available = [] + for name, fixturedef in fm._arg2fixturedefs.items(): + parentid = self.request._pyfuncitem.parent.nodeid + faclist = list(fm._matchfactories(fixturedef, parentid)) + if faclist: + available.append(name) + msg = "fixture %r not found" % (self.argname,) + msg += "\n available fixtures: %s" %(", ".join(available),) + msg += "\n use 'py.test --fixtures [testpath]' for help on them." + + return FixtureLookupErrorRepr(fspath, lineno, tblines, msg, self.argname) + +class FixtureLookupErrorRepr(TerminalRepr): + def __init__(self, filename, firstlineno, tblines, errorstring, argname): + self.tblines = tblines + self.errorstring = errorstring + self.filename = filename + self.firstlineno = firstlineno + self.argname = argname + + def toterminal(self, tw): + #tw.line("FixtureLookupError: %s" %(self.argname), red=True) + for tbline in self.tblines: + tw.line(tbline.rstrip()) + for line in self.errorstring.split("\n"): + tw.line(" " + line.strip(), red=True) + tw.line() + tw.line("%s:%d" % (self.filename, self.firstlineno+1)) + +class FixtureManager: + """ + pytest fixtures definitions and information is stored and managed + from this class. + + During collection fm.parsefactories() is called multiple times to parse + fixture function definitions into FixtureDef objects and internal + data structures. + + During collection of test functions, metafunc-mechanics instantiate + a FuncFixtureInfo object which is cached per node/func-name. + This FuncFixtureInfo object is later retrieved by Function nodes + which themselves offer a fixturenames attribute. + + The FuncFixtureInfo object holds information about fixtures and FixtureDefs + relevant for a particular function. An initial list of fixtures is + assembled like this: + + - ini-defined usefixtures + - autouse-marked fixtures along the collection chain up from the function + - usefixtures markers at module/class/function level + - test function funcargs + + Subsequently the funcfixtureinfo.fixturenames attribute is computed + as the closure of the fixtures needed to setup the initial fixtures, + i. e. fixtures needed by fixture functions themselves are appended + to the fixturenames list. + + Upon the test-setup phases all fixturenames are instantiated, retrieved + by a lookup of their FuncFixtureInfo. + """ + + _argprefix = "pytest_funcarg__" + FixtureLookupError = FixtureLookupError + FixtureLookupErrorRepr = FixtureLookupErrorRepr + + def __init__(self, session): + self.session = session + self.config = session.config + self._arg2fixturedefs = {} + self._holderobjseen = set() + self._arg2finish = {} + self._nodeid_and_autousenames = [("", self.config.getini("usefixtures"))] + session.config.pluginmanager.register(self, "funcmanage") + + + def getfixtureinfo(self, node, func, cls, funcargs=True): + if funcargs and not hasattr(node, "nofuncargs"): + if cls is not None: + startindex = 1 + else: + startindex = None + argnames = getfuncargnames(func, startindex) + else: + argnames = () + usefixtures = getattr(func, "usefixtures", None) + initialnames = argnames + if usefixtures is not None: + initialnames = usefixtures.args + initialnames + fm = node.session._fixturemanager + names_closure, arg2fixturedefs = fm.getfixtureclosure(initialnames, + node) + return FuncFixtureInfo(argnames, names_closure, arg2fixturedefs) + + def pytest_plugin_registered(self, plugin): + nodeid = None + try: + p = py.path.local(plugin.__file__) + except AttributeError: + pass + else: + # construct the base nodeid which is later used to check + # what fixtures are visible for particular tests (as denoted + # by their test id) + if p.basename.startswith("conftest.py"): + nodeid = p.dirpath().relto(self.config.rootdir) + if p.sep != "/": + nodeid = nodeid.replace(p.sep, "/") + self.parsefactories(plugin, nodeid) + + def _getautousenames(self, nodeid): + """ return a tuple of fixture names to be used. """ + autousenames = [] + for baseid, basenames in self._nodeid_and_autousenames: + if nodeid.startswith(baseid): + if baseid: + i = len(baseid) + nextchar = nodeid[i:i+1] + if nextchar and nextchar not in ":/": + continue + autousenames.extend(basenames) + # make sure autousenames are sorted by scope, scopenum 0 is session + autousenames.sort( + key=lambda x: self._arg2fixturedefs[x][-1].scopenum) + return autousenames + + def getfixtureclosure(self, fixturenames, parentnode): + # collect the closure of all fixtures , starting with the given + # fixturenames as the initial set. As we have to visit all + # factory definitions anyway, we also return a arg2fixturedefs + # mapping so that the caller can reuse it and does not have + # to re-discover fixturedefs again for each fixturename + # (discovering matching fixtures for a given name/node is expensive) + + parentid = parentnode.nodeid + fixturenames_closure = self._getautousenames(parentid) + def merge(otherlist): + for arg in otherlist: + if arg not in fixturenames_closure: + fixturenames_closure.append(arg) + merge(fixturenames) + arg2fixturedefs = {} + lastlen = -1 + while lastlen != len(fixturenames_closure): + lastlen = len(fixturenames_closure) + for argname in fixturenames_closure: + if argname in arg2fixturedefs: + continue + fixturedefs = self.getfixturedefs(argname, parentid) + if fixturedefs: + arg2fixturedefs[argname] = fixturedefs + merge(fixturedefs[-1].argnames) + return fixturenames_closure, arg2fixturedefs + + def pytest_generate_tests(self, metafunc): + for argname in metafunc.fixturenames: + faclist = metafunc._arg2fixturedefs.get(argname) + if faclist: + fixturedef = faclist[-1] + if fixturedef.params is not None: + func_params = getattr(getattr(metafunc.function, 'parametrize', None), 'args', [[None]]) + # skip directly parametrized arguments + argnames = func_params[0] + if not isinstance(argnames, (tuple, list)): + argnames = [x.strip() for x in argnames.split(",") if x.strip()] + if argname not in func_params and argname not in argnames: + metafunc.parametrize(argname, fixturedef.params, + indirect=True, scope=fixturedef.scope, + ids=fixturedef.ids) + else: + continue # will raise FixtureLookupError at setup time + + def pytest_collection_modifyitems(self, items): + # separate parametrized setups + items[:] = reorder_items(items) + + def parsefactories(self, node_or_obj, nodeid=NOTSET, unittest=False): + if nodeid is not NOTSET: + holderobj = node_or_obj + else: + holderobj = node_or_obj.obj + nodeid = node_or_obj.nodeid + if holderobj in self._holderobjseen: + return + self._holderobjseen.add(holderobj) + autousenames = [] + for name in dir(holderobj): + obj = getattr(holderobj, name, None) + # fixture functions have a pytest_funcarg__ prefix (pre-2.3 style) + # or are "@pytest.fixture" marked + marker = getfixturemarker(obj) + if marker is None: + if not name.startswith(self._argprefix): + continue + if not callable(obj): + continue + marker = defaultfuncargprefixmarker + name = name[len(self._argprefix):] + elif not isinstance(marker, FixtureFunctionMarker): + # magic globals with __getattr__ might have got us a wrong + # fixture attribute + continue + else: + assert not name.startswith(self._argprefix) + fixturedef = FixtureDef(self, nodeid, name, obj, + marker.scope, marker.params, + yieldctx=marker.yieldctx, + unittest=unittest, ids=marker.ids) + faclist = self._arg2fixturedefs.setdefault(name, []) + if fixturedef.has_location: + faclist.append(fixturedef) + else: + # fixturedefs with no location are at the front + # so this inserts the current fixturedef after the + # existing fixturedefs from external plugins but + # before the fixturedefs provided in conftests. + i = len([f for f in faclist if not f.has_location]) + faclist.insert(i, fixturedef) + if marker.autouse: + autousenames.append(name) + if autousenames: + self._nodeid_and_autousenames.append((nodeid or '', autousenames)) + + def getfixturedefs(self, argname, nodeid): + try: + fixturedefs = self._arg2fixturedefs[argname] + except KeyError: + return None + else: + return tuple(self._matchfactories(fixturedefs, nodeid)) + + def _matchfactories(self, fixturedefs, nodeid): + for fixturedef in fixturedefs: + if nodeid.startswith(fixturedef.baseid): + yield fixturedef + + +def fail_fixturefunc(fixturefunc, msg): + fs, lineno = getfslineno(fixturefunc) + location = "%s:%s" % (fs, lineno+1) + source = _pytest._code.Source(fixturefunc) + pytest.fail(msg + ":\n\n" + str(source.indent()) + "\n" + location, + pytrace=False) + +def call_fixture_func(fixturefunc, request, kwargs, yieldctx): + if yieldctx: + if not is_generator(fixturefunc): + fail_fixturefunc(fixturefunc, + msg="yield_fixture requires yield statement in function") + iter = fixturefunc(**kwargs) + next = getattr(iter, "__next__", None) + if next is None: + next = getattr(iter, "next") + res = next() + def teardown(): + try: + next() + except StopIteration: + pass + else: + fail_fixturefunc(fixturefunc, + "yield_fixture function has more than one 'yield'") + request.addfinalizer(teardown) + else: + if is_generator(fixturefunc): + fail_fixturefunc(fixturefunc, + msg="pytest.fixture functions cannot use ``yield``. " + "Instead write and return an inner function/generator " + "and let the consumer call and iterate over it.") + res = fixturefunc(**kwargs) + return res + +class FixtureDef: + """ A container for a factory definition. """ + def __init__(self, fixturemanager, baseid, argname, func, scope, params, + yieldctx, unittest=False, ids=None): + self._fixturemanager = fixturemanager + self.baseid = baseid or '' + self.has_location = baseid is not None + self.func = func + self.argname = argname + self.scope = scope + self.scopenum = scopes.index(scope or "function") + self.params = params + startindex = unittest and 1 or None + self.argnames = getfuncargnames(func, startindex=startindex) + self.yieldctx = yieldctx + self.unittest = unittest + self.ids = ids + self._finalizer = [] + + def addfinalizer(self, finalizer): + self._finalizer.append(finalizer) + + def finish(self): + try: + while self._finalizer: + func = self._finalizer.pop() + func() + finally: + # even if finalization fails, we invalidate + # the cached fixture value + if hasattr(self, "cached_result"): + del self.cached_result + + def execute(self, request): + # get required arguments and register our own finish() + # with their finalization + kwargs = {} + for argname in self.argnames: + fixturedef = request._get_active_fixturedef(argname) + result, arg_cache_key, exc = fixturedef.cached_result + request._check_scope(argname, request.scope, fixturedef.scope) + kwargs[argname] = result + if argname != "request": + fixturedef.addfinalizer(self.finish) + + my_cache_key = request.param_index + cached_result = getattr(self, "cached_result", None) + if cached_result is not None: + result, cache_key, err = cached_result + if my_cache_key == cache_key: + if err is not None: + py.builtin._reraise(*err) + else: + return result + # we have a previous but differently parametrized fixture instance + # so we need to tear it down before creating a new one + self.finish() + assert not hasattr(self, "cached_result") + + fixturefunc = self.func + + if self.unittest: + if request.instance is not None: + # bind the unbound method to the TestCase instance + fixturefunc = self.func.__get__(request.instance) + else: + # the fixture function needs to be bound to the actual + # request.instance so that code working with "self" behaves + # as expected. + if request.instance is not None: + fixturefunc = getimfunc(self.func) + if fixturefunc != self.func: + fixturefunc = fixturefunc.__get__(request.instance) + + try: + result = call_fixture_func(fixturefunc, request, kwargs, + self.yieldctx) + except Exception: + self.cached_result = (None, my_cache_key, sys.exc_info()) + raise + self.cached_result = (result, my_cache_key, None) + return result + + def __repr__(self): + return ("<FixtureDef name=%r scope=%r baseid=%r >" % + (self.argname, self.scope, self.baseid)) + +def num_mock_patch_args(function): + """ return number of arguments used up by mock arguments (if any) """ + patchings = getattr(function, "patchings", None) + if not patchings: + return 0 + mock = sys.modules.get("mock", sys.modules.get("unittest.mock", None)) + if mock is not None: + return len([p for p in patchings + if not p.attribute_name and p.new is mock.DEFAULT]) + return len(patchings) + + +def getfuncargnames(function, startindex=None): + # XXX merge with main.py's varnames + #assert not isclass(function) + realfunction = function + while hasattr(realfunction, "__wrapped__"): + realfunction = realfunction.__wrapped__ + if startindex is None: + startindex = inspect.ismethod(function) and 1 or 0 + if realfunction != function: + startindex += num_mock_patch_args(function) + function = realfunction + if isinstance(function, functools.partial): + argnames = inspect.getargs(_pytest._code.getrawcode(function.func))[0] + partial = function + argnames = argnames[len(partial.args):] + if partial.keywords: + for kw in partial.keywords: + argnames.remove(kw) + else: + argnames = inspect.getargs(_pytest._code.getrawcode(function))[0] + defaults = getattr(function, 'func_defaults', + getattr(function, '__defaults__', None)) or () + numdefaults = len(defaults) + if numdefaults: + return tuple(argnames[startindex:-numdefaults]) + return tuple(argnames[startindex:]) + +# algorithm for sorting on a per-parametrized resource setup basis +# it is called for scopenum==0 (session) first and performs sorting +# down to the lower scopes such as to minimize number of "high scope" +# setups and teardowns + +def reorder_items(items): + argkeys_cache = {} + for scopenum in range(0, scopenum_function): + argkeys_cache[scopenum] = d = {} + for item in items: + keys = set(get_parametrized_fixture_keys(item, scopenum)) + if keys: + d[item] = keys + return reorder_items_atscope(items, set(), argkeys_cache, 0) + +def reorder_items_atscope(items, ignore, argkeys_cache, scopenum): + if scopenum >= scopenum_function or len(items) < 3: + return items + items_done = [] + while 1: + items_before, items_same, items_other, newignore = \ + slice_items(items, ignore, argkeys_cache[scopenum]) + items_before = reorder_items_atscope( + items_before, ignore, argkeys_cache,scopenum+1) + if items_same is None: + # nothing to reorder in this scope + assert items_other is None + return items_done + items_before + items_done.extend(items_before) + items = items_same + items_other + ignore = newignore + + +def slice_items(items, ignore, scoped_argkeys_cache): + # we pick the first item which uses a fixture instance in the + # requested scope and which we haven't seen yet. We slice the input + # items list into a list of items_nomatch, items_same and + # items_other + if scoped_argkeys_cache: # do we need to do work at all? + it = iter(items) + # first find a slicing key + for i, item in enumerate(it): + argkeys = scoped_argkeys_cache.get(item) + if argkeys is not None: + argkeys = argkeys.difference(ignore) + if argkeys: # found a slicing key + slicing_argkey = argkeys.pop() + items_before = items[:i] + items_same = [item] + items_other = [] + # now slice the remainder of the list + for item in it: + argkeys = scoped_argkeys_cache.get(item) + if argkeys and slicing_argkey in argkeys and \ + slicing_argkey not in ignore: + items_same.append(item) + else: + items_other.append(item) + newignore = ignore.copy() + newignore.add(slicing_argkey) + return (items_before, items_same, items_other, newignore) + return items, None, None, None + +def get_parametrized_fixture_keys(item, scopenum): + """ return list of keys for all parametrized arguments which match + the specified scope. """ + assert scopenum < scopenum_function # function + try: + cs = item.callspec + except AttributeError: + pass + else: + # cs.indictes.items() is random order of argnames but + # then again different functions (items) can change order of + # arguments so it doesn't matter much probably + for argname, param_index in cs.indices.items(): + if cs._arg2scopenum[argname] != scopenum: + continue + if scopenum == 0: # session + key = (argname, param_index) + elif scopenum == 1: # module + key = (argname, param_index, item.fspath) + elif scopenum == 2: # class + key = (argname, param_index, item.fspath, item.cls) + yield key + + +def xunitsetup(obj, name): + meth = getattr(obj, name, None) + if getfixturemarker(meth) is None: + return meth + +def getfixturemarker(obj): + """ return fixturemarker or None if it doesn't exist or raised + exceptions.""" + try: + return getattr(obj, "_pytestfixturefunction", None) + except KeyboardInterrupt: + raise + except Exception: + # some objects raise errors like request (from flask import request) + # we don't expect them to be fixture functions + return None + +scopename2class = { + 'class': Class, + 'module': Module, + 'function': pytest.Item, +} +def get_scope_node(node, scope): + cls = scopename2class.get(scope) + if cls is None: + if scope == "session": + return node.session + raise ValueError("unknown scope") + return node.getparent(cls) diff --git a/python/pytest/_pytest/recwarn.py b/python/pytest/_pytest/recwarn.py new file mode 100644 index 0000000000..a89474c036 --- /dev/null +++ b/python/pytest/_pytest/recwarn.py @@ -0,0 +1,221 @@ +""" recording warnings during test function execution. """ + +import inspect + +import _pytest._code +import py +import sys +import warnings +import pytest + + +@pytest.yield_fixture +def recwarn(request): + """Return a WarningsRecorder instance that provides these methods: + + * ``pop(category=None)``: return last warning matching the category. + * ``clear()``: clear list of warnings + + See http://docs.python.org/library/warnings.html for information + on warning categories. + """ + wrec = WarningsRecorder() + with wrec: + warnings.simplefilter('default') + yield wrec + + +def pytest_namespace(): + return {'deprecated_call': deprecated_call, + 'warns': warns} + + +def deprecated_call(func=None, *args, **kwargs): + """ assert that calling ``func(*args, **kwargs)`` triggers a + ``DeprecationWarning`` or ``PendingDeprecationWarning``. + + This function can be used as a context manager:: + + >>> with deprecated_call(): + ... myobject.deprecated_method() + + Note: we cannot use WarningsRecorder here because it is still subject + to the mechanism that prevents warnings of the same type from being + triggered twice for the same module. See #1190. + """ + if not func: + return WarningsChecker(expected_warning=DeprecationWarning) + + categories = [] + + def warn_explicit(message, category, *args, **kwargs): + categories.append(category) + old_warn_explicit(message, category, *args, **kwargs) + + def warn(message, category=None, *args, **kwargs): + if isinstance(message, Warning): + categories.append(message.__class__) + else: + categories.append(category) + old_warn(message, category, *args, **kwargs) + + old_warn = warnings.warn + old_warn_explicit = warnings.warn_explicit + warnings.warn_explicit = warn_explicit + warnings.warn = warn + try: + ret = func(*args, **kwargs) + finally: + warnings.warn_explicit = old_warn_explicit + warnings.warn = old_warn + deprecation_categories = (DeprecationWarning, PendingDeprecationWarning) + if not any(issubclass(c, deprecation_categories) for c in categories): + __tracebackhide__ = True + raise AssertionError("%r did not produce DeprecationWarning" % (func,)) + return ret + + +def warns(expected_warning, *args, **kwargs): + """Assert that code raises a particular class of warning. + + Specifically, the input @expected_warning can be a warning class or + tuple of warning classes, and the code must return that warning + (if a single class) or one of those warnings (if a tuple). + + This helper produces a list of ``warnings.WarningMessage`` objects, + one for each warning raised. + + This function can be used as a context manager, or any of the other ways + ``pytest.raises`` can be used:: + + >>> with warns(RuntimeWarning): + ... warnings.warn("my warning", RuntimeWarning) + """ + wcheck = WarningsChecker(expected_warning) + if not args: + return wcheck + elif isinstance(args[0], str): + code, = args + assert isinstance(code, str) + frame = sys._getframe(1) + loc = frame.f_locals.copy() + loc.update(kwargs) + + with wcheck: + code = _pytest._code.Source(code).compile() + py.builtin.exec_(code, frame.f_globals, loc) + else: + func = args[0] + with wcheck: + return func(*args[1:], **kwargs) + + +class RecordedWarning(object): + def __init__(self, message, category, filename, lineno, file, line): + self.message = message + self.category = category + self.filename = filename + self.lineno = lineno + self.file = file + self.line = line + + +class WarningsRecorder(object): + """A context manager to record raised warnings. + + Adapted from `warnings.catch_warnings`. + """ + + def __init__(self, module=None): + self._module = sys.modules['warnings'] if module is None else module + self._entered = False + self._list = [] + + @property + def list(self): + """The list of recorded warnings.""" + return self._list + + def __getitem__(self, i): + """Get a recorded warning by index.""" + return self._list[i] + + def __iter__(self): + """Iterate through the recorded warnings.""" + return iter(self._list) + + def __len__(self): + """The number of recorded warnings.""" + return len(self._list) + + def pop(self, cls=Warning): + """Pop the first recorded warning, raise exception if not exists.""" + for i, w in enumerate(self._list): + if issubclass(w.category, cls): + return self._list.pop(i) + __tracebackhide__ = True + raise AssertionError("%r not found in warning list" % cls) + + def clear(self): + """Clear the list of recorded warnings.""" + self._list[:] = [] + + def __enter__(self): + if self._entered: + __tracebackhide__ = True + raise RuntimeError("Cannot enter %r twice" % self) + self._entered = True + self._filters = self._module.filters + self._module.filters = self._filters[:] + self._showwarning = self._module.showwarning + + def showwarning(message, category, filename, lineno, + file=None, line=None): + self._list.append(RecordedWarning( + message, category, filename, lineno, file, line)) + + # still perform old showwarning functionality + self._showwarning( + message, category, filename, lineno, file=file, line=line) + + self._module.showwarning = showwarning + + # allow the same warning to be raised more than once + + self._module.simplefilter('always') + return self + + def __exit__(self, *exc_info): + if not self._entered: + __tracebackhide__ = True + raise RuntimeError("Cannot exit %r without entering first" % self) + self._module.filters = self._filters + self._module.showwarning = self._showwarning + + +class WarningsChecker(WarningsRecorder): + def __init__(self, expected_warning=None, module=None): + super(WarningsChecker, self).__init__(module=module) + + msg = ("exceptions must be old-style classes or " + "derived from Warning, not %s") + if isinstance(expected_warning, tuple): + for exc in expected_warning: + if not inspect.isclass(exc): + raise TypeError(msg % type(exc)) + elif inspect.isclass(expected_warning): + expected_warning = (expected_warning,) + elif expected_warning is not None: + raise TypeError(msg % type(expected_warning)) + + self.expected_warning = expected_warning + + def __exit__(self, *exc_info): + super(WarningsChecker, self).__exit__(*exc_info) + + # only check if we're not currently handling an exception + if all(a is None for a in exc_info): + if self.expected_warning is not None: + if not any(r.category in self.expected_warning for r in self): + __tracebackhide__ = True + pytest.fail("DID NOT WARN") diff --git a/python/pytest/_pytest/resultlog.py b/python/pytest/_pytest/resultlog.py new file mode 100644 index 0000000000..3670f0214c --- /dev/null +++ b/python/pytest/_pytest/resultlog.py @@ -0,0 +1,104 @@ +""" log machine-parseable test session result information in a plain +text file. +""" + +import py +import os + +def pytest_addoption(parser): + group = parser.getgroup("terminal reporting", "resultlog plugin options") + group.addoption('--resultlog', '--result-log', action="store", + metavar="path", default=None, + help="path for machine-readable result log.") + +def pytest_configure(config): + resultlog = config.option.resultlog + # prevent opening resultlog on slave nodes (xdist) + if resultlog and not hasattr(config, 'slaveinput'): + dirname = os.path.dirname(os.path.abspath(resultlog)) + if not os.path.isdir(dirname): + os.makedirs(dirname) + logfile = open(resultlog, 'w', 1) # line buffered + config._resultlog = ResultLog(config, logfile) + config.pluginmanager.register(config._resultlog) + +def pytest_unconfigure(config): + resultlog = getattr(config, '_resultlog', None) + if resultlog: + resultlog.logfile.close() + del config._resultlog + config.pluginmanager.unregister(resultlog) + +def generic_path(item): + chain = item.listchain() + gpath = [chain[0].name] + fspath = chain[0].fspath + fspart = False + for node in chain[1:]: + newfspath = node.fspath + if newfspath == fspath: + if fspart: + gpath.append(':') + fspart = False + else: + gpath.append('.') + else: + gpath.append('/') + fspart = True + name = node.name + if name[0] in '([': + gpath.pop() + gpath.append(name) + fspath = newfspath + return ''.join(gpath) + +class ResultLog(object): + def __init__(self, config, logfile): + self.config = config + self.logfile = logfile # preferably line buffered + + def write_log_entry(self, testpath, lettercode, longrepr): + py.builtin.print_("%s %s" % (lettercode, testpath), file=self.logfile) + for line in longrepr.splitlines(): + py.builtin.print_(" %s" % line, file=self.logfile) + + def log_outcome(self, report, lettercode, longrepr): + testpath = getattr(report, 'nodeid', None) + if testpath is None: + testpath = report.fspath + self.write_log_entry(testpath, lettercode, longrepr) + + def pytest_runtest_logreport(self, report): + if report.when != "call" and report.passed: + return + res = self.config.hook.pytest_report_teststatus(report=report) + code = res[1] + if code == 'x': + longrepr = str(report.longrepr) + elif code == 'X': + longrepr = '' + elif report.passed: + longrepr = "" + elif report.failed: + longrepr = str(report.longrepr) + elif report.skipped: + longrepr = str(report.longrepr[2]) + self.log_outcome(report, code, longrepr) + + def pytest_collectreport(self, report): + if not report.passed: + if report.failed: + code = "F" + longrepr = str(report.longrepr) + else: + assert report.skipped + code = "S" + longrepr = "%s:%d: %s" % report.longrepr + self.log_outcome(report, code, longrepr) + + def pytest_internalerror(self, excrepr): + reprcrash = getattr(excrepr, 'reprcrash', None) + path = getattr(reprcrash, "path", None) + if path is None: + path = "cwd:%s" % py.path.local() + self.write_log_entry(path, '!', str(excrepr)) diff --git a/python/pytest/_pytest/runner.py b/python/pytest/_pytest/runner.py new file mode 100644 index 0000000000..cde94c8c89 --- /dev/null +++ b/python/pytest/_pytest/runner.py @@ -0,0 +1,515 @@ +""" basic collect and runtest protocol implementations """ +import bdb +import sys +from time import time + +import py +import pytest +from _pytest._code.code import TerminalRepr, ExceptionInfo + + +def pytest_namespace(): + return { + 'fail' : fail, + 'skip' : skip, + 'importorskip' : importorskip, + 'exit' : exit, + } + +# +# pytest plugin hooks + +def pytest_addoption(parser): + group = parser.getgroup("terminal reporting", "reporting", after="general") + group.addoption('--durations', + action="store", type=int, default=None, metavar="N", + help="show N slowest setup/test durations (N=0 for all)."), + +def pytest_terminal_summary(terminalreporter): + durations = terminalreporter.config.option.durations + if durations is None: + return + tr = terminalreporter + dlist = [] + for replist in tr.stats.values(): + for rep in replist: + if hasattr(rep, 'duration'): + dlist.append(rep) + if not dlist: + return + dlist.sort(key=lambda x: x.duration) + dlist.reverse() + if not durations: + tr.write_sep("=", "slowest test durations") + else: + tr.write_sep("=", "slowest %s test durations" % durations) + dlist = dlist[:durations] + + for rep in dlist: + nodeid = rep.nodeid.replace("::()::", "::") + tr.write_line("%02.2fs %-8s %s" % + (rep.duration, rep.when, nodeid)) + +def pytest_sessionstart(session): + session._setupstate = SetupState() +def pytest_sessionfinish(session): + session._setupstate.teardown_all() + +class NodeInfo: + def __init__(self, location): + self.location = location + +def pytest_runtest_protocol(item, nextitem): + item.ihook.pytest_runtest_logstart( + nodeid=item.nodeid, location=item.location, + ) + runtestprotocol(item, nextitem=nextitem) + return True + +def runtestprotocol(item, log=True, nextitem=None): + hasrequest = hasattr(item, "_request") + if hasrequest and not item._request: + item._initrequest() + rep = call_and_report(item, "setup", log) + reports = [rep] + if rep.passed: + reports.append(call_and_report(item, "call", log)) + reports.append(call_and_report(item, "teardown", log, + nextitem=nextitem)) + # after all teardown hooks have been called + # want funcargs and request info to go away + if hasrequest: + item._request = False + item.funcargs = None + return reports + +def pytest_runtest_setup(item): + item.session._setupstate.prepare(item) + +def pytest_runtest_call(item): + try: + item.runtest() + except Exception: + # Store trace info to allow postmortem debugging + type, value, tb = sys.exc_info() + tb = tb.tb_next # Skip *this* frame + sys.last_type = type + sys.last_value = value + sys.last_traceback = tb + del tb # Get rid of it in this namespace + raise + +def pytest_runtest_teardown(item, nextitem): + item.session._setupstate.teardown_exact(item, nextitem) + +def pytest_report_teststatus(report): + if report.when in ("setup", "teardown"): + if report.failed: + # category, shortletter, verbose-word + return "error", "E", "ERROR" + elif report.skipped: + return "skipped", "s", "SKIPPED" + else: + return "", "", "" + + +# +# Implementation + +def call_and_report(item, when, log=True, **kwds): + call = call_runtest_hook(item, when, **kwds) + hook = item.ihook + report = hook.pytest_runtest_makereport(item=item, call=call) + if log: + hook.pytest_runtest_logreport(report=report) + if check_interactive_exception(call, report): + hook.pytest_exception_interact(node=item, call=call, report=report) + return report + +def check_interactive_exception(call, report): + return call.excinfo and not ( + hasattr(report, "wasxfail") or + call.excinfo.errisinstance(skip.Exception) or + call.excinfo.errisinstance(bdb.BdbQuit)) + +def call_runtest_hook(item, when, **kwds): + hookname = "pytest_runtest_" + when + ihook = getattr(item.ihook, hookname) + return CallInfo(lambda: ihook(item=item, **kwds), when=when) + +class CallInfo: + """ Result/Exception info a function invocation. """ + #: None or ExceptionInfo object. + excinfo = None + def __init__(self, func, when): + #: context of invocation: one of "setup", "call", + #: "teardown", "memocollect" + self.when = when + self.start = time() + try: + self.result = func() + except KeyboardInterrupt: + self.stop = time() + raise + except: + self.excinfo = ExceptionInfo() + self.stop = time() + + def __repr__(self): + if self.excinfo: + status = "exception: %s" % str(self.excinfo.value) + else: + status = "result: %r" % (self.result,) + return "<CallInfo when=%r %s>" % (self.when, status) + +def getslaveinfoline(node): + try: + return node._slaveinfocache + except AttributeError: + d = node.slaveinfo + ver = "%s.%s.%s" % d['version_info'][:3] + node._slaveinfocache = s = "[%s] %s -- Python %s %s" % ( + d['id'], d['sysplatform'], ver, d['executable']) + return s + +class BaseReport(object): + + def __init__(self, **kw): + self.__dict__.update(kw) + + def toterminal(self, out): + if hasattr(self, 'node'): + out.line(getslaveinfoline(self.node)) + + longrepr = self.longrepr + if longrepr is None: + return + + if hasattr(longrepr, 'toterminal'): + longrepr.toterminal(out) + else: + try: + out.line(longrepr) + except UnicodeEncodeError: + out.line("<unprintable longrepr>") + + def get_sections(self, prefix): + for name, content in self.sections: + if name.startswith(prefix): + yield prefix, content + + passed = property(lambda x: x.outcome == "passed") + failed = property(lambda x: x.outcome == "failed") + skipped = property(lambda x: x.outcome == "skipped") + + @property + def fspath(self): + return self.nodeid.split("::")[0] + +def pytest_runtest_makereport(item, call): + when = call.when + duration = call.stop-call.start + keywords = dict([(x,1) for x in item.keywords]) + excinfo = call.excinfo + sections = [] + if not call.excinfo: + outcome = "passed" + longrepr = None + else: + if not isinstance(excinfo, ExceptionInfo): + outcome = "failed" + longrepr = excinfo + elif excinfo.errisinstance(pytest.skip.Exception): + outcome = "skipped" + r = excinfo._getreprcrash() + longrepr = (str(r.path), r.lineno, r.message) + else: + outcome = "failed" + if call.when == "call": + longrepr = item.repr_failure(excinfo) + else: # exception in setup or teardown + longrepr = item._repr_failure_py(excinfo, + style=item.config.option.tbstyle) + for rwhen, key, content in item._report_sections: + sections.append(("Captured %s %s" %(key, rwhen), content)) + return TestReport(item.nodeid, item.location, + keywords, outcome, longrepr, when, + sections, duration) + +class TestReport(BaseReport): + """ Basic test report object (also used for setup and teardown calls if + they fail). + """ + def __init__(self, nodeid, location, keywords, outcome, + longrepr, when, sections=(), duration=0, **extra): + #: normalized collection node id + self.nodeid = nodeid + + #: a (filesystempath, lineno, domaininfo) tuple indicating the + #: actual location of a test item - it might be different from the + #: collected one e.g. if a method is inherited from a different module. + self.location = location + + #: a name -> value dictionary containing all keywords and + #: markers associated with a test invocation. + self.keywords = keywords + + #: test outcome, always one of "passed", "failed", "skipped". + self.outcome = outcome + + #: None or a failure representation. + self.longrepr = longrepr + + #: one of 'setup', 'call', 'teardown' to indicate runtest phase. + self.when = when + + #: list of (secname, data) extra information which needs to + #: marshallable + self.sections = list(sections) + + #: time it took to run just the test + self.duration = duration + + self.__dict__.update(extra) + + def __repr__(self): + return "<TestReport %r when=%r outcome=%r>" % ( + self.nodeid, self.when, self.outcome) + +class TeardownErrorReport(BaseReport): + outcome = "failed" + when = "teardown" + def __init__(self, longrepr, **extra): + self.longrepr = longrepr + self.sections = [] + self.__dict__.update(extra) + +def pytest_make_collect_report(collector): + call = CallInfo(collector._memocollect, "memocollect") + longrepr = None + if not call.excinfo: + outcome = "passed" + else: + from _pytest import nose + skip_exceptions = (Skipped,) + nose.get_skip_exceptions() + if call.excinfo.errisinstance(skip_exceptions): + outcome = "skipped" + r = collector._repr_failure_py(call.excinfo, "line").reprcrash + longrepr = (str(r.path), r.lineno, r.message) + else: + outcome = "failed" + errorinfo = collector.repr_failure(call.excinfo) + if not hasattr(errorinfo, "toterminal"): + errorinfo = CollectErrorRepr(errorinfo) + longrepr = errorinfo + rep = CollectReport(collector.nodeid, outcome, longrepr, + getattr(call, 'result', None)) + rep.call = call # see collect_one_node + return rep + + +class CollectReport(BaseReport): + def __init__(self, nodeid, outcome, longrepr, result, + sections=(), **extra): + self.nodeid = nodeid + self.outcome = outcome + self.longrepr = longrepr + self.result = result or [] + self.sections = list(sections) + self.__dict__.update(extra) + + @property + def location(self): + return (self.fspath, None, self.fspath) + + def __repr__(self): + return "<CollectReport %r lenresult=%s outcome=%r>" % ( + self.nodeid, len(self.result), self.outcome) + +class CollectErrorRepr(TerminalRepr): + def __init__(self, msg): + self.longrepr = msg + def toterminal(self, out): + out.line(self.longrepr, red=True) + +class SetupState(object): + """ shared state for setting up/tearing down test items or collectors. """ + def __init__(self): + self.stack = [] + self._finalizers = {} + + def addfinalizer(self, finalizer, colitem): + """ attach a finalizer to the given colitem. + if colitem is None, this will add a finalizer that + is called at the end of teardown_all(). + """ + assert colitem and not isinstance(colitem, tuple) + assert py.builtin.callable(finalizer) + #assert colitem in self.stack # some unit tests don't setup stack :/ + self._finalizers.setdefault(colitem, []).append(finalizer) + + def _pop_and_teardown(self): + colitem = self.stack.pop() + self._teardown_with_finalization(colitem) + + def _callfinalizers(self, colitem): + finalizers = self._finalizers.pop(colitem, None) + exc = None + while finalizers: + fin = finalizers.pop() + try: + fin() + except Exception: + # XXX Only first exception will be seen by user, + # ideally all should be reported. + if exc is None: + exc = sys.exc_info() + if exc: + py.builtin._reraise(*exc) + + def _teardown_with_finalization(self, colitem): + self._callfinalizers(colitem) + if hasattr(colitem, "teardown"): + colitem.teardown() + for colitem in self._finalizers: + assert colitem is None or colitem in self.stack \ + or isinstance(colitem, tuple) + + def teardown_all(self): + while self.stack: + self._pop_and_teardown() + for key in list(self._finalizers): + self._teardown_with_finalization(key) + assert not self._finalizers + + def teardown_exact(self, item, nextitem): + needed_collectors = nextitem and nextitem.listchain() or [] + self._teardown_towards(needed_collectors) + + def _teardown_towards(self, needed_collectors): + while self.stack: + if self.stack == needed_collectors[:len(self.stack)]: + break + self._pop_and_teardown() + + def prepare(self, colitem): + """ setup objects along the collector chain to the test-method + and teardown previously setup objects.""" + needed_collectors = colitem.listchain() + self._teardown_towards(needed_collectors) + + # check if the last collection node has raised an error + for col in self.stack: + if hasattr(col, '_prepare_exc'): + py.builtin._reraise(*col._prepare_exc) + for col in needed_collectors[len(self.stack):]: + self.stack.append(col) + try: + col.setup() + except Exception: + col._prepare_exc = sys.exc_info() + raise + +def collect_one_node(collector): + ihook = collector.ihook + ihook.pytest_collectstart(collector=collector) + rep = ihook.pytest_make_collect_report(collector=collector) + call = rep.__dict__.pop("call", None) + if call and check_interactive_exception(call, rep): + ihook.pytest_exception_interact(node=collector, call=call, report=rep) + return rep + + +# ============================================================= +# Test OutcomeExceptions and helpers for creating them. + + +class OutcomeException(Exception): + """ OutcomeException and its subclass instances indicate and + contain info about test and collection outcomes. + """ + def __init__(self, msg=None, pytrace=True): + Exception.__init__(self, msg) + self.msg = msg + self.pytrace = pytrace + + def __repr__(self): + if self.msg: + val = self.msg + if isinstance(val, bytes): + val = py._builtin._totext(val, errors='replace') + return val + return "<%s instance>" %(self.__class__.__name__,) + __str__ = __repr__ + +class Skipped(OutcomeException): + # XXX hackish: on 3k we fake to live in the builtins + # in order to have Skipped exception printing shorter/nicer + __module__ = 'builtins' + +class Failed(OutcomeException): + """ raised from an explicit call to pytest.fail() """ + __module__ = 'builtins' + +class Exit(KeyboardInterrupt): + """ raised for immediate program exits (no tracebacks/summaries)""" + def __init__(self, msg="unknown reason"): + self.msg = msg + KeyboardInterrupt.__init__(self, msg) + +# exposed helper methods + +def exit(msg): + """ exit testing process as if KeyboardInterrupt was triggered. """ + __tracebackhide__ = True + raise Exit(msg) + +exit.Exception = Exit + +def skip(msg=""): + """ skip an executing test with the given message. Note: it's usually + better to use the pytest.mark.skipif marker to declare a test to be + skipped under certain conditions like mismatching platforms or + dependencies. See the pytest_skipping plugin for details. + """ + __tracebackhide__ = True + raise Skipped(msg=msg) +skip.Exception = Skipped + +def fail(msg="", pytrace=True): + """ explicitly fail an currently-executing test with the given Message. + + :arg pytrace: if false the msg represents the full failure information + and no python traceback will be reported. + """ + __tracebackhide__ = True + raise Failed(msg=msg, pytrace=pytrace) +fail.Exception = Failed + + +def importorskip(modname, minversion=None): + """ return imported module if it has at least "minversion" as its + __version__ attribute. If no minversion is specified the a skip + is only triggered if the module can not be imported. + """ + __tracebackhide__ = True + compile(modname, '', 'eval') # to catch syntaxerrors + try: + __import__(modname) + except ImportError: + skip("could not import %r" %(modname,)) + mod = sys.modules[modname] + if minversion is None: + return mod + verattr = getattr(mod, '__version__', None) + if minversion is not None: + try: + from pkg_resources import parse_version as pv + except ImportError: + skip("we have a required version for %r but can not import " + "no pkg_resources to parse version strings." %(modname,)) + if verattr is None or pv(verattr) < pv(minversion): + skip("module %r has __version__ %r, required is: %r" %( + modname, verattr, minversion)) + return mod + diff --git a/python/pytest/_pytest/skipping.py b/python/pytest/_pytest/skipping.py new file mode 100644 index 0000000000..18e038d2c8 --- /dev/null +++ b/python/pytest/_pytest/skipping.py @@ -0,0 +1,361 @@ +""" support for skip/xfail functions and markers. """ +import os +import sys +import traceback + +import py +import pytest +from _pytest.mark import MarkInfo, MarkDecorator + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group.addoption('--runxfail', + action="store_true", dest="runxfail", default=False, + help="run tests even if they are marked xfail") + + parser.addini("xfail_strict", "default for the strict parameter of xfail " + "markers when not given explicitly (default: " + "False)", + default=False, + type="bool") + + +def pytest_configure(config): + if config.option.runxfail: + old = pytest.xfail + config._cleanup.append(lambda: setattr(pytest, "xfail", old)) + def nop(*args, **kwargs): + pass + nop.Exception = XFailed + setattr(pytest, "xfail", nop) + + config.addinivalue_line("markers", + "skip(reason=None): skip the given test function with an optional reason. " + "Example: skip(reason=\"no way of currently testing this\") skips the " + "test." + ) + config.addinivalue_line("markers", + "skipif(condition): skip the given test function if eval(condition) " + "results in a True value. Evaluation happens within the " + "module global context. Example: skipif('sys.platform == \"win32\"') " + "skips the test if we are on the win32 platform. see " + "http://pytest.org/latest/skipping.html" + ) + config.addinivalue_line("markers", + "xfail(condition, reason=None, run=True, raises=None, strict=False): " + "mark the the test function as an expected failure if eval(condition) " + "has a True value. Optionally specify a reason for better reporting " + "and run=False if you don't even want to execute the test function. " + "If only specific exception(s) are expected, you can list them in " + "raises, and if the test fails in other ways, it will be reported as " + "a true failure. See http://pytest.org/latest/skipping.html" + ) + + +def pytest_namespace(): + return dict(xfail=xfail) + + +class XFailed(pytest.fail.Exception): + """ raised from an explicit call to pytest.xfail() """ + + +def xfail(reason=""): + """ xfail an executing test or setup functions with the given reason.""" + __tracebackhide__ = True + raise XFailed(reason) +xfail.Exception = XFailed + + +class MarkEvaluator: + def __init__(self, item, name): + self.item = item + self.name = name + + @property + def holder(self): + return self.item.keywords.get(self.name) + + def __bool__(self): + return bool(self.holder) + __nonzero__ = __bool__ + + def wasvalid(self): + return not hasattr(self, 'exc') + + def invalidraise(self, exc): + raises = self.get('raises') + if not raises: + return + return not isinstance(exc, raises) + + def istrue(self): + try: + return self._istrue() + except Exception: + self.exc = sys.exc_info() + if isinstance(self.exc[1], SyntaxError): + msg = [" " * (self.exc[1].offset + 4) + "^",] + msg.append("SyntaxError: invalid syntax") + else: + msg = traceback.format_exception_only(*self.exc[:2]) + pytest.fail("Error evaluating %r expression\n" + " %s\n" + "%s" + %(self.name, self.expr, "\n".join(msg)), + pytrace=False) + + def _getglobals(self): + d = {'os': os, 'sys': sys, 'config': self.item.config} + func = self.item.obj + try: + d.update(func.__globals__) + except AttributeError: + d.update(func.func_globals) + return d + + def _istrue(self): + if hasattr(self, 'result'): + return self.result + if self.holder: + d = self._getglobals() + if self.holder.args or 'condition' in self.holder.kwargs: + self.result = False + # "holder" might be a MarkInfo or a MarkDecorator; only + # MarkInfo keeps track of all parameters it received in an + # _arglist attribute + if hasattr(self.holder, '_arglist'): + arglist = self.holder._arglist + else: + arglist = [(self.holder.args, self.holder.kwargs)] + for args, kwargs in arglist: + if 'condition' in kwargs: + args = (kwargs['condition'],) + for expr in args: + self.expr = expr + if isinstance(expr, py.builtin._basestring): + result = cached_eval(self.item.config, expr, d) + else: + if "reason" not in kwargs: + # XXX better be checked at collection time + msg = "you need to specify reason=STRING " \ + "when using booleans as conditions." + pytest.fail(msg) + result = bool(expr) + if result: + self.result = True + self.reason = kwargs.get('reason', None) + self.expr = expr + return self.result + else: + self.result = True + return getattr(self, 'result', False) + + def get(self, attr, default=None): + return self.holder.kwargs.get(attr, default) + + def getexplanation(self): + expl = getattr(self, 'reason', None) or self.get('reason', None) + if not expl: + if not hasattr(self, 'expr'): + return "" + else: + return "condition: " + str(self.expr) + return expl + + +@pytest.hookimpl(tryfirst=True) +def pytest_runtest_setup(item): + # Check if skip or skipif are specified as pytest marks + + skipif_info = item.keywords.get('skipif') + if isinstance(skipif_info, (MarkInfo, MarkDecorator)): + eval_skipif = MarkEvaluator(item, 'skipif') + if eval_skipif.istrue(): + item._evalskip = eval_skipif + pytest.skip(eval_skipif.getexplanation()) + + skip_info = item.keywords.get('skip') + if isinstance(skip_info, (MarkInfo, MarkDecorator)): + item._evalskip = True + if 'reason' in skip_info.kwargs: + pytest.skip(skip_info.kwargs['reason']) + elif skip_info.args: + pytest.skip(skip_info.args[0]) + else: + pytest.skip("unconditional skip") + + item._evalxfail = MarkEvaluator(item, 'xfail') + check_xfail_no_run(item) + + +@pytest.mark.hookwrapper +def pytest_pyfunc_call(pyfuncitem): + check_xfail_no_run(pyfuncitem) + outcome = yield + passed = outcome.excinfo is None + if passed: + check_strict_xfail(pyfuncitem) + + +def check_xfail_no_run(item): + """check xfail(run=False)""" + if not item.config.option.runxfail: + evalxfail = item._evalxfail + if evalxfail.istrue(): + if not evalxfail.get('run', True): + pytest.xfail("[NOTRUN] " + evalxfail.getexplanation()) + + +def check_strict_xfail(pyfuncitem): + """check xfail(strict=True) for the given PASSING test""" + evalxfail = pyfuncitem._evalxfail + if evalxfail.istrue(): + strict_default = pyfuncitem.config.getini('xfail_strict') + is_strict_xfail = evalxfail.get('strict', strict_default) + if is_strict_xfail: + del pyfuncitem._evalxfail + explanation = evalxfail.getexplanation() + pytest.fail('[XPASS(strict)] ' + explanation, pytrace=False) + + +@pytest.hookimpl(hookwrapper=True) +def pytest_runtest_makereport(item, call): + outcome = yield + rep = outcome.get_result() + evalxfail = getattr(item, '_evalxfail', None) + evalskip = getattr(item, '_evalskip', None) + # unitttest special case, see setting of _unexpectedsuccess + if hasattr(item, '_unexpectedsuccess') and rep.when == "call": + # we need to translate into how pytest encodes xpass + rep.wasxfail = "reason: " + repr(item._unexpectedsuccess) + rep.outcome = "failed" + elif item.config.option.runxfail: + pass # don't interefere + elif call.excinfo and call.excinfo.errisinstance(pytest.xfail.Exception): + rep.wasxfail = "reason: " + call.excinfo.value.msg + rep.outcome = "skipped" + elif evalxfail and not rep.skipped and evalxfail.wasvalid() and \ + evalxfail.istrue(): + if call.excinfo: + if evalxfail.invalidraise(call.excinfo.value): + rep.outcome = "failed" + else: + rep.outcome = "skipped" + rep.wasxfail = evalxfail.getexplanation() + elif call.when == "call": + rep.outcome = "failed" # xpass outcome + rep.wasxfail = evalxfail.getexplanation() + elif evalskip is not None and rep.skipped and type(rep.longrepr) is tuple: + # skipped by mark.skipif; change the location of the failure + # to point to the item definition, otherwise it will display + # the location of where the skip exception was raised within pytest + filename, line, reason = rep.longrepr + filename, line = item.location[:2] + rep.longrepr = filename, line, reason + +# called by terminalreporter progress reporting +def pytest_report_teststatus(report): + if hasattr(report, "wasxfail"): + if report.skipped: + return "xfailed", "x", "xfail" + elif report.failed: + return "xpassed", "X", ("XPASS", {'yellow': True}) + +# called by the terminalreporter instance/plugin +def pytest_terminal_summary(terminalreporter): + tr = terminalreporter + if not tr.reportchars: + #for name in "xfailed skipped failed xpassed": + # if not tr.stats.get(name, 0): + # tr.write_line("HINT: use '-r' option to see extra " + # "summary info about tests") + # break + return + + lines = [] + for char in tr.reportchars: + if char == "x": + show_xfailed(terminalreporter, lines) + elif char == "X": + show_xpassed(terminalreporter, lines) + elif char in "fF": + show_simple(terminalreporter, lines, 'failed', "FAIL %s") + elif char in "sS": + show_skipped(terminalreporter, lines) + elif char == "E": + show_simple(terminalreporter, lines, 'error', "ERROR %s") + elif char == 'p': + show_simple(terminalreporter, lines, 'passed', "PASSED %s") + + if lines: + tr._tw.sep("=", "short test summary info") + for line in lines: + tr._tw.line(line) + +def show_simple(terminalreporter, lines, stat, format): + failed = terminalreporter.stats.get(stat) + if failed: + for rep in failed: + pos = terminalreporter.config.cwd_relative_nodeid(rep.nodeid) + lines.append(format %(pos,)) + +def show_xfailed(terminalreporter, lines): + xfailed = terminalreporter.stats.get("xfailed") + if xfailed: + for rep in xfailed: + pos = terminalreporter.config.cwd_relative_nodeid(rep.nodeid) + reason = rep.wasxfail + lines.append("XFAIL %s" % (pos,)) + if reason: + lines.append(" " + str(reason)) + +def show_xpassed(terminalreporter, lines): + xpassed = terminalreporter.stats.get("xpassed") + if xpassed: + for rep in xpassed: + pos = terminalreporter.config.cwd_relative_nodeid(rep.nodeid) + reason = rep.wasxfail + lines.append("XPASS %s %s" %(pos, reason)) + +def cached_eval(config, expr, d): + if not hasattr(config, '_evalcache'): + config._evalcache = {} + try: + return config._evalcache[expr] + except KeyError: + import _pytest._code + exprcode = _pytest._code.compile(expr, mode="eval") + config._evalcache[expr] = x = eval(exprcode, d) + return x + + +def folded_skips(skipped): + d = {} + for event in skipped: + key = event.longrepr + assert len(key) == 3, (event, key) + d.setdefault(key, []).append(event) + l = [] + for key, events in d.items(): + l.append((len(events),) + key) + return l + +def show_skipped(terminalreporter, lines): + tr = terminalreporter + skipped = tr.stats.get('skipped', []) + if skipped: + #if not tr.hasopt('skipped'): + # tr.write_line( + # "%d skipped tests, specify -rs for more info" % + # len(skipped)) + # return + fskips = folded_skips(skipped) + if fskips: + #tr.write_sep("_", "skipped test summary") + for num, fspath, lineno, reason in fskips: + if reason.startswith("Skipped: "): + reason = reason[9:] + lines.append("SKIP [%d] %s:%d: %s" % + (num, fspath, lineno, reason)) diff --git a/python/pytest/_pytest/standalonetemplate.py b/python/pytest/_pytest/standalonetemplate.py new file mode 100755 index 0000000000..484d5d1b25 --- /dev/null +++ b/python/pytest/_pytest/standalonetemplate.py @@ -0,0 +1,89 @@ +#! /usr/bin/env python + +# Hi There! +# You may be wondering what this giant blob of binary data here is, you might +# even be worried that we're up to something nefarious (good for you for being +# paranoid!). This is a base64 encoding of a zip file, this zip file contains +# a fully functional basic pytest script. +# +# Pytest is a thing that tests packages, pytest itself is a package that some- +# one might want to install, especially if they're looking to run tests inside +# some package they want to install. Pytest has a lot of code to collect and +# execute tests, and other such sort of "tribal knowledge" that has been en- +# coded in its code base. Because of this we basically include a basic copy +# of pytest inside this blob. We do this because it let's you as a maintainer +# or application developer who wants people who don't deal with python much to +# easily run tests without installing the complete pytest package. +# +# If you're wondering how this is created: you can create it yourself if you +# have a complete pytest installation by using this command on the command- +# line: ``py.test --genscript=runtests.py``. + +sources = """ +@SOURCES@""" + +import sys +import base64 +import zlib + +class DictImporter(object): + def __init__(self, sources): + self.sources = sources + + def find_module(self, fullname, path=None): + if fullname == "argparse" and sys.version_info >= (2,7): + # we were generated with <python2.7 (which pulls in argparse) + # but we are running now on a stdlib which has it, so use that. + return None + if fullname in self.sources: + return self + if fullname + '.__init__' in self.sources: + return self + return None + + def load_module(self, fullname): + # print "load_module:", fullname + from types import ModuleType + try: + s = self.sources[fullname] + is_pkg = False + except KeyError: + s = self.sources[fullname + '.__init__'] + is_pkg = True + + co = compile(s, fullname, 'exec') + module = sys.modules.setdefault(fullname, ModuleType(fullname)) + module.__file__ = "%s/%s" % (__file__, fullname) + module.__loader__ = self + if is_pkg: + module.__path__ = [fullname] + + do_exec(co, module.__dict__) # noqa + return sys.modules[fullname] + + def get_source(self, name): + res = self.sources.get(name) + if res is None: + res = self.sources.get(name + '.__init__') + return res + +if __name__ == "__main__": + try: + import pkg_resources # noqa + except ImportError: + sys.stderr.write("ERROR: setuptools not installed\n") + sys.exit(2) + if sys.version_info >= (3, 0): + exec("def do_exec(co, loc): exec(co, loc)\n") + import pickle + sources = sources.encode("ascii") # ensure bytes + sources = pickle.loads(zlib.decompress(base64.decodebytes(sources))) + else: + import cPickle as pickle + exec("def do_exec(co, loc): exec co in loc\n") + sources = pickle.loads(zlib.decompress(base64.decodestring(sources))) + + importer = DictImporter(sources) + sys.meta_path.insert(0, importer) + entry = "@ENTRY@" + do_exec(entry, locals()) # noqa diff --git a/python/pytest/_pytest/terminal.py b/python/pytest/_pytest/terminal.py new file mode 100644 index 0000000000..825f553ef2 --- /dev/null +++ b/python/pytest/_pytest/terminal.py @@ -0,0 +1,593 @@ +""" terminal reporting of the full testing process. + +This is a good source for looking at the various reporting hooks. +""" +from _pytest.main import EXIT_OK, EXIT_TESTSFAILED, EXIT_INTERRUPTED, \ + EXIT_USAGEERROR, EXIT_NOTESTSCOLLECTED +import pytest +import py +import sys +import time +import platform + +import _pytest._pluggy as pluggy + + +def pytest_addoption(parser): + group = parser.getgroup("terminal reporting", "reporting", after="general") + group._addoption('-v', '--verbose', action="count", + dest="verbose", default=0, help="increase verbosity."), + group._addoption('-q', '--quiet', action="count", + dest="quiet", default=0, help="decrease verbosity."), + group._addoption('-r', + action="store", dest="reportchars", default=None, metavar="chars", + help="show extra test summary info as specified by chars (f)ailed, " + "(E)error, (s)skipped, (x)failed, (X)passed (w)pytest-warnings " + "(p)passed, (P)passed with output, (a)all except pP.") + group._addoption('-l', '--showlocals', + action="store_true", dest="showlocals", default=False, + help="show locals in tracebacks (disabled by default).") + group._addoption('--report', + action="store", dest="report", default=None, metavar="opts", + help="(deprecated, use -r)") + group._addoption('--tb', metavar="style", + action="store", dest="tbstyle", default='auto', + choices=['auto', 'long', 'short', 'no', 'line', 'native'], + help="traceback print mode (auto/long/short/line/native/no).") + group._addoption('--fulltrace', '--full-trace', + action="store_true", default=False, + help="don't cut any tracebacks (default is to cut).") + group._addoption('--color', metavar="color", + action="store", dest="color", default='auto', + choices=['yes', 'no', 'auto'], + help="color terminal output (yes/no/auto).") + +def pytest_configure(config): + config.option.verbose -= config.option.quiet + reporter = TerminalReporter(config, sys.stdout) + config.pluginmanager.register(reporter, 'terminalreporter') + if config.option.debug or config.option.traceconfig: + def mywriter(tags, args): + msg = " ".join(map(str, args)) + reporter.write_line("[traceconfig] " + msg) + config.trace.root.setprocessor("pytest:config", mywriter) + +def getreportopt(config): + reportopts = "" + optvalue = config.option.report + if optvalue: + py.builtin.print_("DEPRECATED: use -r instead of --report option.", + file=sys.stderr) + if optvalue: + for setting in optvalue.split(","): + setting = setting.strip() + if setting == "skipped": + reportopts += "s" + elif setting == "xfailed": + reportopts += "x" + reportchars = config.option.reportchars + if reportchars: + for char in reportchars: + if char not in reportopts and char != 'a': + reportopts += char + elif char == 'a': + reportopts = 'fEsxXw' + return reportopts + +def pytest_report_teststatus(report): + if report.passed: + letter = "." + elif report.skipped: + letter = "s" + elif report.failed: + letter = "F" + if report.when != "call": + letter = "f" + return report.outcome, letter, report.outcome.upper() + +class WarningReport: + def __init__(self, code, message, nodeid=None, fslocation=None): + self.code = code + self.message = message + self.nodeid = nodeid + self.fslocation = fslocation + + +class TerminalReporter: + def __init__(self, config, file=None): + import _pytest.config + self.config = config + self.verbosity = self.config.option.verbose + self.showheader = self.verbosity >= 0 + self.showfspath = self.verbosity >= 0 + self.showlongtestinfo = self.verbosity > 0 + self._numcollected = 0 + + self.stats = {} + self.startdir = py.path.local() + if file is None: + file = sys.stdout + self._tw = self.writer = _pytest.config.create_terminal_writer(config, + file) + self.currentfspath = None + self.reportchars = getreportopt(config) + self.hasmarkup = self._tw.hasmarkup + self.isatty = file.isatty() + + def hasopt(self, char): + char = {'xfailed': 'x', 'skipped': 's'}.get(char, char) + return char in self.reportchars + + def write_fspath_result(self, nodeid, res): + fspath = self.config.rootdir.join(nodeid.split("::")[0]) + if fspath != self.currentfspath: + self.currentfspath = fspath + fspath = self.startdir.bestrelpath(fspath) + self._tw.line() + self._tw.write(fspath + " ") + self._tw.write(res) + + def write_ensure_prefix(self, prefix, extra="", **kwargs): + if self.currentfspath != prefix: + self._tw.line() + self.currentfspath = prefix + self._tw.write(prefix) + if extra: + self._tw.write(extra, **kwargs) + self.currentfspath = -2 + + def ensure_newline(self): + if self.currentfspath: + self._tw.line() + self.currentfspath = None + + def write(self, content, **markup): + self._tw.write(content, **markup) + + def write_line(self, line, **markup): + if not py.builtin._istext(line): + line = py.builtin.text(line, errors="replace") + self.ensure_newline() + self._tw.line(line, **markup) + + def rewrite(self, line, **markup): + line = str(line) + self._tw.write("\r" + line, **markup) + + def write_sep(self, sep, title=None, **markup): + self.ensure_newline() + self._tw.sep(sep, title, **markup) + + def section(self, title, sep="=", **kw): + self._tw.sep(sep, title, **kw) + + def line(self, msg, **kw): + self._tw.line(msg, **kw) + + def pytest_internalerror(self, excrepr): + for line in py.builtin.text(excrepr).split("\n"): + self.write_line("INTERNALERROR> " + line) + return 1 + + def pytest_logwarning(self, code, fslocation, message, nodeid): + warnings = self.stats.setdefault("warnings", []) + if isinstance(fslocation, tuple): + fslocation = "%s:%d" % fslocation + warning = WarningReport(code=code, fslocation=fslocation, + message=message, nodeid=nodeid) + warnings.append(warning) + + def pytest_plugin_registered(self, plugin): + if self.config.option.traceconfig: + msg = "PLUGIN registered: %s" % (plugin,) + # XXX this event may happen during setup/teardown time + # which unfortunately captures our output here + # which garbles our output if we use self.write_line + self.write_line(msg) + + def pytest_deselected(self, items): + self.stats.setdefault('deselected', []).extend(items) + + def pytest_runtest_logstart(self, nodeid, location): + # ensure that the path is printed before the + # 1st test of a module starts running + if self.showlongtestinfo: + line = self._locationline(nodeid, *location) + self.write_ensure_prefix(line, "") + elif self.showfspath: + fsid = nodeid.split("::")[0] + self.write_fspath_result(fsid, "") + + def pytest_runtest_logreport(self, report): + rep = report + res = self.config.hook.pytest_report_teststatus(report=rep) + cat, letter, word = res + self.stats.setdefault(cat, []).append(rep) + self._tests_ran = True + if not letter and not word: + # probably passed setup/teardown + return + if self.verbosity <= 0: + if not hasattr(rep, 'node') and self.showfspath: + self.write_fspath_result(rep.nodeid, letter) + else: + self._tw.write(letter) + else: + if isinstance(word, tuple): + word, markup = word + else: + if rep.passed: + markup = {'green':True} + elif rep.failed: + markup = {'red':True} + elif rep.skipped: + markup = {'yellow':True} + line = self._locationline(rep.nodeid, *rep.location) + if not hasattr(rep, 'node'): + self.write_ensure_prefix(line, word, **markup) + #self._tw.write(word, **markup) + else: + self.ensure_newline() + if hasattr(rep, 'node'): + self._tw.write("[%s] " % rep.node.gateway.id) + self._tw.write(word, **markup) + self._tw.write(" " + line) + self.currentfspath = -2 + + def pytest_collection(self): + if not self.isatty and self.config.option.verbose >= 1: + self.write("collecting ... ", bold=True) + + def pytest_collectreport(self, report): + if report.failed: + self.stats.setdefault("error", []).append(report) + elif report.skipped: + self.stats.setdefault("skipped", []).append(report) + items = [x for x in report.result if isinstance(x, pytest.Item)] + self._numcollected += len(items) + if self.isatty: + #self.write_fspath_result(report.nodeid, 'E') + self.report_collect() + + def report_collect(self, final=False): + if self.config.option.verbose < 0: + return + + errors = len(self.stats.get('error', [])) + skipped = len(self.stats.get('skipped', [])) + if final: + line = "collected " + else: + line = "collecting " + line += str(self._numcollected) + " items" + if errors: + line += " / %d errors" % errors + if skipped: + line += " / %d skipped" % skipped + if self.isatty: + if final: + line += " \n" + self.rewrite(line, bold=True) + else: + self.write_line(line) + + def pytest_collection_modifyitems(self): + self.report_collect(True) + + @pytest.hookimpl(trylast=True) + def pytest_sessionstart(self, session): + self._sessionstarttime = time.time() + if not self.showheader: + return + self.write_sep("=", "test session starts", bold=True) + verinfo = platform.python_version() + msg = "platform %s -- Python %s" % (sys.platform, verinfo) + if hasattr(sys, 'pypy_version_info'): + verinfo = ".".join(map(str, sys.pypy_version_info[:3])) + msg += "[pypy-%s-%s]" % (verinfo, sys.pypy_version_info[3]) + msg += ", pytest-%s, py-%s, pluggy-%s" % ( + pytest.__version__, py.__version__, pluggy.__version__) + if self.verbosity > 0 or self.config.option.debug or \ + getattr(self.config.option, 'pastebin', None): + msg += " -- " + str(sys.executable) + self.write_line(msg) + lines = self.config.hook.pytest_report_header( + config=self.config, startdir=self.startdir) + lines.reverse() + for line in flatten(lines): + self.write_line(line) + + def pytest_report_header(self, config): + inifile = "" + if config.inifile: + inifile = config.rootdir.bestrelpath(config.inifile) + lines = ["rootdir: %s, inifile: %s" %(config.rootdir, inifile)] + + plugininfo = config.pluginmanager.list_plugin_distinfo() + if plugininfo: + + lines.append( + "plugins: %s" % ", ".join(_plugin_nameversions(plugininfo))) + return lines + + def pytest_collection_finish(self, session): + if self.config.option.collectonly: + self._printcollecteditems(session.items) + if self.stats.get('failed'): + self._tw.sep("!", "collection failures") + for rep in self.stats.get('failed'): + rep.toterminal(self._tw) + return 1 + return 0 + if not self.showheader: + return + #for i, testarg in enumerate(self.config.args): + # self.write_line("test path %d: %s" %(i+1, testarg)) + + def _printcollecteditems(self, items): + # to print out items and their parent collectors + # we take care to leave out Instances aka () + # because later versions are going to get rid of them anyway + if self.config.option.verbose < 0: + if self.config.option.verbose < -1: + counts = {} + for item in items: + name = item.nodeid.split('::', 1)[0] + counts[name] = counts.get(name, 0) + 1 + for name, count in sorted(counts.items()): + self._tw.line("%s: %d" % (name, count)) + else: + for item in items: + nodeid = item.nodeid + nodeid = nodeid.replace("::()::", "::") + self._tw.line(nodeid) + return + stack = [] + indent = "" + for item in items: + needed_collectors = item.listchain()[1:] # strip root node + while stack: + if stack == needed_collectors[:len(stack)]: + break + stack.pop() + for col in needed_collectors[len(stack):]: + stack.append(col) + #if col.name == "()": + # continue + indent = (len(stack) - 1) * " " + self._tw.line("%s%s" % (indent, col)) + + @pytest.hookimpl(hookwrapper=True) + def pytest_sessionfinish(self, exitstatus): + outcome = yield + outcome.get_result() + self._tw.line("") + summary_exit_codes = ( + EXIT_OK, EXIT_TESTSFAILED, EXIT_INTERRUPTED, EXIT_USAGEERROR, + EXIT_NOTESTSCOLLECTED) + if exitstatus in summary_exit_codes: + self.config.hook.pytest_terminal_summary(terminalreporter=self) + self.summary_errors() + self.summary_failures() + self.summary_warnings() + self.summary_passes() + if exitstatus == EXIT_INTERRUPTED: + self._report_keyboardinterrupt() + del self._keyboardinterrupt_memo + self.summary_deselected() + self.summary_stats() + + def pytest_keyboard_interrupt(self, excinfo): + self._keyboardinterrupt_memo = excinfo.getrepr(funcargs=True) + + def pytest_unconfigure(self): + if hasattr(self, '_keyboardinterrupt_memo'): + self._report_keyboardinterrupt() + + def _report_keyboardinterrupt(self): + excrepr = self._keyboardinterrupt_memo + msg = excrepr.reprcrash.message + self.write_sep("!", msg) + if "KeyboardInterrupt" in msg: + if self.config.option.fulltrace: + excrepr.toterminal(self._tw) + else: + self._tw.line("to show a full traceback on KeyboardInterrupt use --fulltrace", yellow=True) + excrepr.reprcrash.toterminal(self._tw) + + def _locationline(self, nodeid, fspath, lineno, domain): + def mkrel(nodeid): + line = self.config.cwd_relative_nodeid(nodeid) + if domain and line.endswith(domain): + line = line[:-len(domain)] + l = domain.split("[") + l[0] = l[0].replace('.', '::') # don't replace '.' in params + line += "[".join(l) + return line + # collect_fspath comes from testid which has a "/"-normalized path + + if fspath: + res = mkrel(nodeid).replace("::()", "") # parens-normalization + if nodeid.split("::")[0] != fspath.replace("\\", "/"): + res += " <- " + self.startdir.bestrelpath(fspath) + else: + res = "[location]" + return res + " " + + def _getfailureheadline(self, rep): + if hasattr(rep, 'location'): + fspath, lineno, domain = rep.location + return domain + else: + return "test session" # XXX? + + def _getcrashline(self, rep): + try: + return str(rep.longrepr.reprcrash) + except AttributeError: + try: + return str(rep.longrepr)[:50] + except AttributeError: + return "" + + # + # summaries for sessionfinish + # + def getreports(self, name): + l = [] + for x in self.stats.get(name, []): + if not hasattr(x, '_pdbshown'): + l.append(x) + return l + + def summary_warnings(self): + if self.hasopt("w"): + warnings = self.stats.get("warnings") + if not warnings: + return + self.write_sep("=", "pytest-warning summary") + for w in warnings: + self._tw.line("W%s %s %s" % (w.code, + w.fslocation, w.message)) + + def summary_passes(self): + if self.config.option.tbstyle != "no": + if self.hasopt("P"): + reports = self.getreports('passed') + if not reports: + return + self.write_sep("=", "PASSES") + for rep in reports: + msg = self._getfailureheadline(rep) + self.write_sep("_", msg) + self._outrep_summary(rep) + + def summary_failures(self): + if self.config.option.tbstyle != "no": + reports = self.getreports('failed') + if not reports: + return + self.write_sep("=", "FAILURES") + for rep in reports: + if self.config.option.tbstyle == "line": + line = self._getcrashline(rep) + self.write_line(line) + else: + msg = self._getfailureheadline(rep) + markup = {'red': True, 'bold': True} + self.write_sep("_", msg, **markup) + self._outrep_summary(rep) + + def summary_errors(self): + if self.config.option.tbstyle != "no": + reports = self.getreports('error') + if not reports: + return + self.write_sep("=", "ERRORS") + for rep in self.stats['error']: + msg = self._getfailureheadline(rep) + if not hasattr(rep, 'when'): + # collect + msg = "ERROR collecting " + msg + elif rep.when == "setup": + msg = "ERROR at setup of " + msg + elif rep.when == "teardown": + msg = "ERROR at teardown of " + msg + self.write_sep("_", msg) + self._outrep_summary(rep) + + def _outrep_summary(self, rep): + rep.toterminal(self._tw) + for secname, content in rep.sections: + self._tw.sep("-", secname) + if content[-1:] == "\n": + content = content[:-1] + self._tw.line(content) + + def summary_stats(self): + session_duration = time.time() - self._sessionstarttime + (line, color) = build_summary_stats_line(self.stats) + msg = "%s in %.2f seconds" % (line, session_duration) + markup = {color: True, 'bold': True} + + if self.verbosity >= 0: + self.write_sep("=", msg, **markup) + if self.verbosity == -1: + self.write_line(msg, **markup) + + def summary_deselected(self): + if 'deselected' in self.stats: + l = [] + k = self.config.option.keyword + if k: + l.append("-k%s" % k) + m = self.config.option.markexpr + if m: + l.append("-m %r" % m) + if l: + self.write_sep("=", "%d tests deselected by %r" % ( + len(self.stats['deselected']), " ".join(l)), bold=True) + +def repr_pythonversion(v=None): + if v is None: + v = sys.version_info + try: + return "%s.%s.%s-%s-%s" % v + except (TypeError, ValueError): + return str(v) + +def flatten(l): + for x in l: + if isinstance(x, (list, tuple)): + for y in flatten(x): + yield y + else: + yield x + +def build_summary_stats_line(stats): + keys = ("failed passed skipped deselected " + "xfailed xpassed warnings error").split() + key_translation = {'warnings': 'pytest-warnings'} + unknown_key_seen = False + for key in stats.keys(): + if key not in keys: + if key: # setup/teardown reports have an empty key, ignore them + keys.append(key) + unknown_key_seen = True + parts = [] + for key in keys: + val = stats.get(key, None) + if val: + key_name = key_translation.get(key, key) + parts.append("%d %s" % (len(val), key_name)) + + if parts: + line = ", ".join(parts) + else: + line = "no tests ran" + + if 'failed' in stats or 'error' in stats: + color = 'red' + elif 'warnings' in stats or unknown_key_seen: + color = 'yellow' + elif 'passed' in stats: + color = 'green' + else: + color = 'yellow' + + return (line, color) + + +def _plugin_nameversions(plugininfo): + l = [] + for plugin, dist in plugininfo: + # gets us name and version! + name = '{dist.project_name}-{dist.version}'.format(dist=dist) + # questionable convenience, but it keeps things short + if name.startswith("pytest-"): + name = name[7:] + # we decided to print python package names + # they can have more than one plugin + if name not in l: + l.append(name) + return l diff --git a/python/pytest/_pytest/tmpdir.py b/python/pytest/_pytest/tmpdir.py new file mode 100644 index 0000000000..ebc48dbe5b --- /dev/null +++ b/python/pytest/_pytest/tmpdir.py @@ -0,0 +1,123 @@ +""" support for providing temporary directories to test functions. """ +import re + +import pytest +import py +from _pytest.monkeypatch import monkeypatch + + +class TempdirFactory: + """Factory for temporary directories under the common base temp directory. + + The base directory can be configured using the ``--basetemp`` option. + """ + + def __init__(self, config): + self.config = config + self.trace = config.trace.get("tmpdir") + + def ensuretemp(self, string, dir=1): + """ (deprecated) return temporary directory path with + the given string as the trailing part. It is usually + better to use the 'tmpdir' function argument which + provides an empty unique-per-test-invocation directory + and is guaranteed to be empty. + """ + #py.log._apiwarn(">1.1", "use tmpdir function argument") + return self.getbasetemp().ensure(string, dir=dir) + + def mktemp(self, basename, numbered=True): + """Create a subdirectory of the base temporary directory and return it. + If ``numbered``, ensure the directory is unique by adding a number + prefix greater than any existing one. + """ + basetemp = self.getbasetemp() + if not numbered: + p = basetemp.mkdir(basename) + else: + p = py.path.local.make_numbered_dir(prefix=basename, + keep=0, rootdir=basetemp, lock_timeout=None) + self.trace("mktemp", p) + return p + + def getbasetemp(self): + """ return base temporary directory. """ + try: + return self._basetemp + except AttributeError: + basetemp = self.config.option.basetemp + if basetemp: + basetemp = py.path.local(basetemp) + if basetemp.check(): + basetemp.remove() + basetemp.mkdir() + else: + temproot = py.path.local.get_temproot() + user = get_user() + if user: + # use a sub-directory in the temproot to speed-up + # make_numbered_dir() call + rootdir = temproot.join('pytest-of-%s' % user) + else: + rootdir = temproot + rootdir.ensure(dir=1) + basetemp = py.path.local.make_numbered_dir(prefix='pytest-', + rootdir=rootdir) + self._basetemp = t = basetemp.realpath() + self.trace("new basetemp", t) + return t + + def finish(self): + self.trace("finish") + + +def get_user(): + """Return the current user name, or None if getuser() does not work + in the current environment (see #1010). + """ + import getpass + try: + return getpass.getuser() + except (ImportError, KeyError): + return None + +# backward compatibility +TempdirHandler = TempdirFactory + + +def pytest_configure(config): + """Create a TempdirFactory and attach it to the config object. + + This is to comply with existing plugins which expect the handler to be + available at pytest_configure time, but ideally should be moved entirely + to the tmpdir_factory session fixture. + """ + mp = monkeypatch() + t = TempdirFactory(config) + config._cleanup.extend([mp.undo, t.finish]) + mp.setattr(config, '_tmpdirhandler', t, raising=False) + mp.setattr(pytest, 'ensuretemp', t.ensuretemp, raising=False) + + +@pytest.fixture(scope='session') +def tmpdir_factory(request): + """Return a TempdirFactory instance for the test session. + """ + return request.config._tmpdirhandler + + +@pytest.fixture +def tmpdir(request, tmpdir_factory): + """return a temporary directory path object + which is unique to each test function invocation, + created as a sub directory of the base temporary + directory. The returned object is a `py.path.local`_ + path object. + """ + name = request.node.name + name = re.sub("[\W]", "_", name) + MAXVAL = 30 + if len(name) > MAXVAL: + name = name[:MAXVAL] + x = tmpdir_factory.mktemp(name, numbered=True) + return x diff --git a/python/pytest/_pytest/unittest.py b/python/pytest/_pytest/unittest.py new file mode 100644 index 0000000000..8120e94fbf --- /dev/null +++ b/python/pytest/_pytest/unittest.py @@ -0,0 +1,205 @@ +""" discovery and running of std-library "unittest" style tests. """ +from __future__ import absolute_import + +import sys +import traceback + +import pytest +# for transfering markers +import _pytest._code +from _pytest.python import transfer_markers +from _pytest.skipping import MarkEvaluator + + +def pytest_pycollect_makeitem(collector, name, obj): + # has unittest been imported and is obj a subclass of its TestCase? + try: + if not issubclass(obj, sys.modules["unittest"].TestCase): + return + except Exception: + return + # yes, so let's collect it + return UnitTestCase(name, parent=collector) + + +class UnitTestCase(pytest.Class): + # marker for fixturemanger.getfixtureinfo() + # to declare that our children do not support funcargs + nofuncargs = True + + def setup(self): + cls = self.obj + if getattr(cls, '__unittest_skip__', False): + return # skipped + setup = getattr(cls, 'setUpClass', None) + if setup is not None: + setup() + teardown = getattr(cls, 'tearDownClass', None) + if teardown is not None: + self.addfinalizer(teardown) + super(UnitTestCase, self).setup() + + def collect(self): + from unittest import TestLoader + cls = self.obj + if not getattr(cls, "__test__", True): + return + self.session._fixturemanager.parsefactories(self, unittest=True) + loader = TestLoader() + module = self.getparent(pytest.Module).obj + foundsomething = False + for name in loader.getTestCaseNames(self.obj): + x = getattr(self.obj, name) + funcobj = getattr(x, 'im_func', x) + transfer_markers(funcobj, cls, module) + yield TestCaseFunction(name, parent=self) + foundsomething = True + + if not foundsomething: + runtest = getattr(self.obj, 'runTest', None) + if runtest is not None: + ut = sys.modules.get("twisted.trial.unittest", None) + if ut is None or runtest != ut.TestCase.runTest: + yield TestCaseFunction('runTest', parent=self) + + + +class TestCaseFunction(pytest.Function): + _excinfo = None + + def setup(self): + self._testcase = self.parent.obj(self.name) + self._fix_unittest_skip_decorator() + self._obj = getattr(self._testcase, self.name) + if hasattr(self._testcase, 'setup_method'): + self._testcase.setup_method(self._obj) + if hasattr(self, "_request"): + self._request._fillfixtures() + + def _fix_unittest_skip_decorator(self): + """ + The @unittest.skip decorator calls functools.wraps(self._testcase) + The call to functools.wraps() fails unless self._testcase + has a __name__ attribute. This is usually automatically supplied + if the test is a function or method, but we need to add manually + here. + + See issue #1169 + """ + if sys.version_info[0] == 2: + setattr(self._testcase, "__name__", self.name) + + def teardown(self): + if hasattr(self._testcase, 'teardown_method'): + self._testcase.teardown_method(self._obj) + + def startTest(self, testcase): + pass + + def _addexcinfo(self, rawexcinfo): + # unwrap potential exception info (see twisted trial support below) + rawexcinfo = getattr(rawexcinfo, '_rawexcinfo', rawexcinfo) + try: + excinfo = _pytest._code.ExceptionInfo(rawexcinfo) + except TypeError: + try: + try: + l = traceback.format_exception(*rawexcinfo) + l.insert(0, "NOTE: Incompatible Exception Representation, " + "displaying natively:\n\n") + pytest.fail("".join(l), pytrace=False) + except (pytest.fail.Exception, KeyboardInterrupt): + raise + except: + pytest.fail("ERROR: Unknown Incompatible Exception " + "representation:\n%r" %(rawexcinfo,), pytrace=False) + except KeyboardInterrupt: + raise + except pytest.fail.Exception: + excinfo = _pytest._code.ExceptionInfo() + self.__dict__.setdefault('_excinfo', []).append(excinfo) + + def addError(self, testcase, rawexcinfo): + self._addexcinfo(rawexcinfo) + def addFailure(self, testcase, rawexcinfo): + self._addexcinfo(rawexcinfo) + + def addSkip(self, testcase, reason): + try: + pytest.skip(reason) + except pytest.skip.Exception: + self._evalskip = MarkEvaluator(self, 'SkipTest') + self._evalskip.result = True + self._addexcinfo(sys.exc_info()) + + def addExpectedFailure(self, testcase, rawexcinfo, reason=""): + try: + pytest.xfail(str(reason)) + except pytest.xfail.Exception: + self._addexcinfo(sys.exc_info()) + + def addUnexpectedSuccess(self, testcase, reason=""): + self._unexpectedsuccess = reason + + def addSuccess(self, testcase): + pass + + def stopTest(self, testcase): + pass + + def runtest(self): + self._testcase(result=self) + + def _prunetraceback(self, excinfo): + pytest.Function._prunetraceback(self, excinfo) + traceback = excinfo.traceback.filter( + lambda x:not x.frame.f_globals.get('__unittest')) + if traceback: + excinfo.traceback = traceback + +@pytest.hookimpl(tryfirst=True) +def pytest_runtest_makereport(item, call): + if isinstance(item, TestCaseFunction): + if item._excinfo: + call.excinfo = item._excinfo.pop(0) + try: + del call.result + except AttributeError: + pass + +# twisted trial support + +@pytest.hookimpl(hookwrapper=True) +def pytest_runtest_protocol(item): + if isinstance(item, TestCaseFunction) and \ + 'twisted.trial.unittest' in sys.modules: + ut = sys.modules['twisted.python.failure'] + Failure__init__ = ut.Failure.__init__ + check_testcase_implements_trial_reporter() + def excstore(self, exc_value=None, exc_type=None, exc_tb=None, + captureVars=None): + if exc_value is None: + self._rawexcinfo = sys.exc_info() + else: + if exc_type is None: + exc_type = type(exc_value) + self._rawexcinfo = (exc_type, exc_value, exc_tb) + try: + Failure__init__(self, exc_value, exc_type, exc_tb, + captureVars=captureVars) + except TypeError: + Failure__init__(self, exc_value, exc_type, exc_tb) + ut.Failure.__init__ = excstore + yield + ut.Failure.__init__ = Failure__init__ + else: + yield + + +def check_testcase_implements_trial_reporter(done=[]): + if done: + return + from zope.interface import classImplements + from twisted.trial.itrial import IReporter + classImplements(TestCaseFunction, IReporter) + done.append(1) diff --git a/python/pytest/_pytest/vendored_packages/README.md b/python/pytest/_pytest/vendored_packages/README.md new file mode 100644 index 0000000000..eab7c714fb --- /dev/null +++ b/python/pytest/_pytest/vendored_packages/README.md @@ -0,0 +1,13 @@ +This directory vendors the `pluggy` module. + +For a more detailed discussion for the reasons to vendoring this +package, please see [this issue](https://github.com/pytest-dev/pytest/issues/944). + +To update the current version, execute: + +``` +$ pip install -U pluggy==<version> --no-compile --target=_pytest/vendored_packages +``` + +And commit the modified files. The `pluggy-<version>.dist-info` directory +created by `pip` should be ignored. diff --git a/python/pytest/_pytest/vendored_packages/__init__.py b/python/pytest/_pytest/vendored_packages/__init__.py new file mode 100644 index 0000000000..e69de29bb2 --- /dev/null +++ b/python/pytest/_pytest/vendored_packages/__init__.py diff --git a/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/DESCRIPTION.rst b/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/DESCRIPTION.rst new file mode 100644 index 0000000000..aa3bbf8129 --- /dev/null +++ b/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/DESCRIPTION.rst @@ -0,0 +1,10 @@ +Plugin registration and hook calling for Python +=============================================== + +This is the plugin manager as used by pytest but stripped +of pytest specific details. + +During the 0.x series this plugin does not have much documentation +except extensive docstrings in the pluggy.py module. + + diff --git a/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/METADATA b/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/METADATA new file mode 100644 index 0000000000..ec81f0a6be --- /dev/null +++ b/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/METADATA @@ -0,0 +1,39 @@ +Metadata-Version: 2.0 +Name: pluggy +Version: 0.3.1 +Summary: plugin and hook calling mechanisms for python +Home-page: UNKNOWN +Author: Holger Krekel +Author-email: holger at merlinux.eu +License: MIT license +Platform: unix +Platform: linux +Platform: osx +Platform: win32 +Classifier: Development Status :: 4 - Beta +Classifier: Intended Audience :: Developers +Classifier: License :: OSI Approved :: MIT License +Classifier: Operating System :: POSIX +Classifier: Operating System :: Microsoft :: Windows +Classifier: Operating System :: MacOS :: MacOS X +Classifier: Topic :: Software Development :: Testing +Classifier: Topic :: Software Development :: Libraries +Classifier: Topic :: Utilities +Classifier: Programming Language :: Python :: 2 +Classifier: Programming Language :: Python :: 2.6 +Classifier: Programming Language :: Python :: 2.7 +Classifier: Programming Language :: Python :: 3 +Classifier: Programming Language :: Python :: 3.3 +Classifier: Programming Language :: Python :: 3.4 +Classifier: Programming Language :: Python :: 3.5 + +Plugin registration and hook calling for Python +=============================================== + +This is the plugin manager as used by pytest but stripped +of pytest specific details. + +During the 0.x series this plugin does not have much documentation +except extensive docstrings in the pluggy.py module. + + diff --git a/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/RECORD b/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/RECORD new file mode 100644 index 0000000000..9626673c43 --- /dev/null +++ b/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/RECORD @@ -0,0 +1,8 @@ +pluggy.py,sha256=v_RfWzyW6DPU1cJu_EFoL_OHq3t13qloVdR6UaMCXQA,29862 +pluggy-0.3.1.dist-info/top_level.txt,sha256=xKSCRhai-v9MckvMuWqNz16c1tbsmOggoMSwTgcpYHE,7 +pluggy-0.3.1.dist-info/pbr.json,sha256=xX3s6__wOcAyF-AZJX1sdZyW6PUXT-FkfBlM69EEUCg,47 +pluggy-0.3.1.dist-info/RECORD,, +pluggy-0.3.1.dist-info/metadata.json,sha256=nLKltOT78dMV-00uXD6Aeemp4xNsz2q59j6ORSDeLjw,1027 +pluggy-0.3.1.dist-info/METADATA,sha256=1b85Ho2u4iK30M099k7axMzcDDhLcIMb-A82JUJZnSo,1334 +pluggy-0.3.1.dist-info/WHEEL,sha256=AvR0WeTpDaxT645bl5FQxUK6NPsTls2ttpcGJg3j1Xg,110 +pluggy-0.3.1.dist-info/DESCRIPTION.rst,sha256=P5Akh1EdIBR6CeqtV2P8ZwpGSpZiTKPw0NyS7jEiD-g,306 diff --git a/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/WHEEL b/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/WHEEL new file mode 100644 index 0000000000..9dff69d861 --- /dev/null +++ b/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/WHEEL @@ -0,0 +1,6 @@ +Wheel-Version: 1.0 +Generator: bdist_wheel (0.24.0) +Root-Is-Purelib: true +Tag: py2-none-any +Tag: py3-none-any + diff --git a/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/metadata.json b/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/metadata.json new file mode 100644 index 0000000000..426a3a7ade --- /dev/null +++ b/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/metadata.json @@ -0,0 +1 @@ +{"license": "MIT license", "name": "pluggy", "metadata_version": "2.0", "generator": "bdist_wheel (0.24.0)", "summary": "plugin and hook calling mechanisms for python", "platform": "unix", "version": "0.3.1", "extensions": {"python.details": {"document_names": {"description": "DESCRIPTION.rst"}, "contacts": [{"role": "author", "email": "holger at merlinux.eu", "name": "Holger Krekel"}]}}, "classifiers": ["Development Status :: 4 - Beta", "Intended Audience :: Developers", "License :: OSI Approved :: MIT License", "Operating System :: POSIX", "Operating System :: Microsoft :: Windows", "Operating System :: MacOS :: MacOS X", "Topic :: Software Development :: Testing", "Topic :: Software Development :: Libraries", "Topic :: Utilities", "Programming Language :: Python :: 2", "Programming Language :: Python :: 2.6", "Programming Language :: Python :: 2.7", "Programming Language :: Python :: 3", "Programming Language :: Python :: 3.3", "Programming Language :: Python :: 3.4", "Programming Language :: Python :: 3.5"]}
\ No newline at end of file diff --git a/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/pbr.json b/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/pbr.json new file mode 100644 index 0000000000..d6b7986401 --- /dev/null +++ b/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/pbr.json @@ -0,0 +1 @@ +{"is_release": false, "git_version": "7d4c9cd"}
\ No newline at end of file diff --git a/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/top_level.txt b/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/top_level.txt new file mode 100644 index 0000000000..11bdb5c1f5 --- /dev/null +++ b/python/pytest/_pytest/vendored_packages/pluggy-0.3.1.dist-info/top_level.txt @@ -0,0 +1 @@ +pluggy diff --git a/python/pytest/_pytest/vendored_packages/pluggy.py b/python/pytest/_pytest/vendored_packages/pluggy.py new file mode 100644 index 0000000000..2f848b23d3 --- /dev/null +++ b/python/pytest/_pytest/vendored_packages/pluggy.py @@ -0,0 +1,777 @@ +""" +PluginManager, basic initialization and tracing. + +pluggy is the cristallized core of plugin management as used +by some 150 plugins for pytest. + +Pluggy uses semantic versioning. Breaking changes are only foreseen for +Major releases (incremented X in "X.Y.Z"). If you want to use pluggy in +your project you should thus use a dependency restriction like +"pluggy>=0.1.0,<1.0" to avoid surprises. + +pluggy is concerned with hook specification, hook implementations and hook +calling. For any given hook specification a hook call invokes up to N implementations. +A hook implementation can influence its position and type of execution: +if attributed "tryfirst" or "trylast" it will be tried to execute +first or last. However, if attributed "hookwrapper" an implementation +can wrap all calls to non-hookwrapper implementations. A hookwrapper +can thus execute some code ahead and after the execution of other hooks. + +Hook specification is done by way of a regular python function where +both the function name and the names of all its arguments are significant. +Each hook implementation function is verified against the original specification +function, including the names of all its arguments. To allow for hook specifications +to evolve over the livetime of a project, hook implementations can +accept less arguments. One can thus add new arguments and semantics to +a hook specification by adding another argument typically without breaking +existing hook implementations. + +The chosen approach is meant to let a hook designer think carefuly about +which objects are needed by an extension writer. By contrast, subclass-based +extension mechanisms often expose a lot more state and behaviour than needed, +thus restricting future developments. + +Pluggy currently consists of functionality for: + +- a way to register new hook specifications. Without a hook + specification no hook calling can be performed. + +- a registry of plugins which contain hook implementation functions. It + is possible to register plugins for which a hook specification is not yet + known and validate all hooks when the system is in a more referentially + consistent state. Setting an "optionalhook" attribution to a hook + implementation will avoid PluginValidationError's if a specification + is missing. This allows to have optional integration between plugins. + +- a "hook" relay object from which you can launch 1:N calls to + registered hook implementation functions + +- a mechanism for ordering hook implementation functions + +- mechanisms for two different type of 1:N calls: "firstresult" for when + the call should stop when the first implementation returns a non-None result. + And the other (default) way of guaranteeing that all hook implementations + will be called and their non-None result collected. + +- mechanisms for "historic" extension points such that all newly + registered functions will receive all hook calls that happened + before their registration. + +- a mechanism for discovering plugin objects which are based on + setuptools based entry points. + +- a simple tracing mechanism, including tracing of plugin calls and + their arguments. + +""" +import sys +import inspect + +__version__ = '0.3.1' +__all__ = ["PluginManager", "PluginValidationError", + "HookspecMarker", "HookimplMarker"] + +_py3 = sys.version_info > (3, 0) + + +class HookspecMarker: + """ Decorator helper class for marking functions as hook specifications. + + You can instantiate it with a project_name to get a decorator. + Calling PluginManager.add_hookspecs later will discover all marked functions + if the PluginManager uses the same project_name. + """ + + def __init__(self, project_name): + self.project_name = project_name + + def __call__(self, function=None, firstresult=False, historic=False): + """ if passed a function, directly sets attributes on the function + which will make it discoverable to add_hookspecs(). If passed no + function, returns a decorator which can be applied to a function + later using the attributes supplied. + + If firstresult is True the 1:N hook call (N being the number of registered + hook implementation functions) will stop at I<=N when the I'th function + returns a non-None result. + + If historic is True calls to a hook will be memorized and replayed + on later registered plugins. + + """ + def setattr_hookspec_opts(func): + if historic and firstresult: + raise ValueError("cannot have a historic firstresult hook") + setattr(func, self.project_name + "_spec", + dict(firstresult=firstresult, historic=historic)) + return func + + if function is not None: + return setattr_hookspec_opts(function) + else: + return setattr_hookspec_opts + + +class HookimplMarker: + """ Decorator helper class for marking functions as hook implementations. + + You can instantiate with a project_name to get a decorator. + Calling PluginManager.register later will discover all marked functions + if the PluginManager uses the same project_name. + """ + def __init__(self, project_name): + self.project_name = project_name + + def __call__(self, function=None, hookwrapper=False, optionalhook=False, + tryfirst=False, trylast=False): + + """ if passed a function, directly sets attributes on the function + which will make it discoverable to register(). If passed no function, + returns a decorator which can be applied to a function later using + the attributes supplied. + + If optionalhook is True a missing matching hook specification will not result + in an error (by default it is an error if no matching spec is found). + + If tryfirst is True this hook implementation will run as early as possible + in the chain of N hook implementations for a specfication. + + If trylast is True this hook implementation will run as late as possible + in the chain of N hook implementations. + + If hookwrapper is True the hook implementations needs to execute exactly + one "yield". The code before the yield is run early before any non-hookwrapper + function is run. The code after the yield is run after all non-hookwrapper + function have run. The yield receives an ``_CallOutcome`` object representing + the exception or result outcome of the inner calls (including other hookwrapper + calls). + + """ + def setattr_hookimpl_opts(func): + setattr(func, self.project_name + "_impl", + dict(hookwrapper=hookwrapper, optionalhook=optionalhook, + tryfirst=tryfirst, trylast=trylast)) + return func + + if function is None: + return setattr_hookimpl_opts + else: + return setattr_hookimpl_opts(function) + + +def normalize_hookimpl_opts(opts): + opts.setdefault("tryfirst", False) + opts.setdefault("trylast", False) + opts.setdefault("hookwrapper", False) + opts.setdefault("optionalhook", False) + + +class _TagTracer: + def __init__(self): + self._tag2proc = {} + self.writer = None + self.indent = 0 + + def get(self, name): + return _TagTracerSub(self, (name,)) + + def format_message(self, tags, args): + if isinstance(args[-1], dict): + extra = args[-1] + args = args[:-1] + else: + extra = {} + + content = " ".join(map(str, args)) + indent = " " * self.indent + + lines = [ + "%s%s [%s]\n" % (indent, content, ":".join(tags)) + ] + + for name, value in extra.items(): + lines.append("%s %s: %s\n" % (indent, name, value)) + return lines + + def processmessage(self, tags, args): + if self.writer is not None and args: + lines = self.format_message(tags, args) + self.writer(''.join(lines)) + try: + self._tag2proc[tags](tags, args) + except KeyError: + pass + + def setwriter(self, writer): + self.writer = writer + + def setprocessor(self, tags, processor): + if isinstance(tags, str): + tags = tuple(tags.split(":")) + else: + assert isinstance(tags, tuple) + self._tag2proc[tags] = processor + + +class _TagTracerSub: + def __init__(self, root, tags): + self.root = root + self.tags = tags + + def __call__(self, *args): + self.root.processmessage(self.tags, args) + + def setmyprocessor(self, processor): + self.root.setprocessor(self.tags, processor) + + def get(self, name): + return self.__class__(self.root, self.tags + (name,)) + + +def _raise_wrapfail(wrap_controller, msg): + co = wrap_controller.gi_code + raise RuntimeError("wrap_controller at %r %s:%d %s" % + (co.co_name, co.co_filename, co.co_firstlineno, msg)) + + +def _wrapped_call(wrap_controller, func): + """ Wrap calling to a function with a generator which needs to yield + exactly once. The yield point will trigger calling the wrapped function + and return its _CallOutcome to the yield point. The generator then needs + to finish (raise StopIteration) in order for the wrapped call to complete. + """ + try: + next(wrap_controller) # first yield + except StopIteration: + _raise_wrapfail(wrap_controller, "did not yield") + call_outcome = _CallOutcome(func) + try: + wrap_controller.send(call_outcome) + _raise_wrapfail(wrap_controller, "has second yield") + except StopIteration: + pass + return call_outcome.get_result() + + +class _CallOutcome: + """ Outcome of a function call, either an exception or a proper result. + Calling the ``get_result`` method will return the result or reraise + the exception raised when the function was called. """ + excinfo = None + + def __init__(self, func): + try: + self.result = func() + except BaseException: + self.excinfo = sys.exc_info() + + def force_result(self, result): + self.result = result + self.excinfo = None + + def get_result(self): + if self.excinfo is None: + return self.result + else: + ex = self.excinfo + if _py3: + raise ex[1].with_traceback(ex[2]) + _reraise(*ex) # noqa + +if not _py3: + exec(""" +def _reraise(cls, val, tb): + raise cls, val, tb +""") + + +class _TracedHookExecution: + def __init__(self, pluginmanager, before, after): + self.pluginmanager = pluginmanager + self.before = before + self.after = after + self.oldcall = pluginmanager._inner_hookexec + assert not isinstance(self.oldcall, _TracedHookExecution) + self.pluginmanager._inner_hookexec = self + + def __call__(self, hook, hook_impls, kwargs): + self.before(hook.name, hook_impls, kwargs) + outcome = _CallOutcome(lambda: self.oldcall(hook, hook_impls, kwargs)) + self.after(outcome, hook.name, hook_impls, kwargs) + return outcome.get_result() + + def undo(self): + self.pluginmanager._inner_hookexec = self.oldcall + + +class PluginManager(object): + """ Core Pluginmanager class which manages registration + of plugin objects and 1:N hook calling. + + You can register new hooks by calling ``addhooks(module_or_class)``. + You can register plugin objects (which contain hooks) by calling + ``register(plugin)``. The Pluginmanager is initialized with a + prefix that is searched for in the names of the dict of registered + plugin objects. An optional excludefunc allows to blacklist names which + are not considered as hooks despite a matching prefix. + + For debugging purposes you can call ``enable_tracing()`` + which will subsequently send debug information to the trace helper. + """ + + def __init__(self, project_name, implprefix=None): + """ if implprefix is given implementation functions + will be recognized if their name matches the implprefix. """ + self.project_name = project_name + self._name2plugin = {} + self._plugin2hookcallers = {} + self._plugin_distinfo = [] + self.trace = _TagTracer().get("pluginmanage") + self.hook = _HookRelay(self.trace.root.get("hook")) + self._implprefix = implprefix + self._inner_hookexec = lambda hook, methods, kwargs: \ + _MultiCall(methods, kwargs, hook.spec_opts).execute() + + def _hookexec(self, hook, methods, kwargs): + # called from all hookcaller instances. + # enable_tracing will set its own wrapping function at self._inner_hookexec + return self._inner_hookexec(hook, methods, kwargs) + + def register(self, plugin, name=None): + """ Register a plugin and return its canonical name or None if the name + is blocked from registering. Raise a ValueError if the plugin is already + registered. """ + plugin_name = name or self.get_canonical_name(plugin) + + if plugin_name in self._name2plugin or plugin in self._plugin2hookcallers: + if self._name2plugin.get(plugin_name, -1) is None: + return # blocked plugin, return None to indicate no registration + raise ValueError("Plugin already registered: %s=%s\n%s" % + (plugin_name, plugin, self._name2plugin)) + + # XXX if an error happens we should make sure no state has been + # changed at point of return + self._name2plugin[plugin_name] = plugin + + # register matching hook implementations of the plugin + self._plugin2hookcallers[plugin] = hookcallers = [] + for name in dir(plugin): + hookimpl_opts = self.parse_hookimpl_opts(plugin, name) + if hookimpl_opts is not None: + normalize_hookimpl_opts(hookimpl_opts) + method = getattr(plugin, name) + hookimpl = HookImpl(plugin, plugin_name, method, hookimpl_opts) + hook = getattr(self.hook, name, None) + if hook is None: + hook = _HookCaller(name, self._hookexec) + setattr(self.hook, name, hook) + elif hook.has_spec(): + self._verify_hook(hook, hookimpl) + hook._maybe_apply_history(hookimpl) + hook._add_hookimpl(hookimpl) + hookcallers.append(hook) + return plugin_name + + def parse_hookimpl_opts(self, plugin, name): + method = getattr(plugin, name) + res = getattr(method, self.project_name + "_impl", None) + if res is not None and not isinstance(res, dict): + # false positive + res = None + elif res is None and self._implprefix and name.startswith(self._implprefix): + res = {} + return res + + def unregister(self, plugin=None, name=None): + """ unregister a plugin object and all its contained hook implementations + from internal data structures. """ + if name is None: + assert plugin is not None, "one of name or plugin needs to be specified" + name = self.get_name(plugin) + + if plugin is None: + plugin = self.get_plugin(name) + + # if self._name2plugin[name] == None registration was blocked: ignore + if self._name2plugin.get(name): + del self._name2plugin[name] + + for hookcaller in self._plugin2hookcallers.pop(plugin, []): + hookcaller._remove_plugin(plugin) + + return plugin + + def set_blocked(self, name): + """ block registrations of the given name, unregister if already registered. """ + self.unregister(name=name) + self._name2plugin[name] = None + + def is_blocked(self, name): + """ return True if the name blogs registering plugins of that name. """ + return name in self._name2plugin and self._name2plugin[name] is None + + def add_hookspecs(self, module_or_class): + """ add new hook specifications defined in the given module_or_class. + Functions are recognized if they have been decorated accordingly. """ + names = [] + for name in dir(module_or_class): + spec_opts = self.parse_hookspec_opts(module_or_class, name) + if spec_opts is not None: + hc = getattr(self.hook, name, None) + if hc is None: + hc = _HookCaller(name, self._hookexec, module_or_class, spec_opts) + setattr(self.hook, name, hc) + else: + # plugins registered this hook without knowing the spec + hc.set_specification(module_or_class, spec_opts) + for hookfunction in (hc._wrappers + hc._nonwrappers): + self._verify_hook(hc, hookfunction) + names.append(name) + + if not names: + raise ValueError("did not find any %r hooks in %r" % + (self.project_name, module_or_class)) + + def parse_hookspec_opts(self, module_or_class, name): + method = getattr(module_or_class, name) + return getattr(method, self.project_name + "_spec", None) + + def get_plugins(self): + """ return the set of registered plugins. """ + return set(self._plugin2hookcallers) + + def is_registered(self, plugin): + """ Return True if the plugin is already registered. """ + return plugin in self._plugin2hookcallers + + def get_canonical_name(self, plugin): + """ Return canonical name for a plugin object. Note that a plugin + may be registered under a different name which was specified + by the caller of register(plugin, name). To obtain the name + of an registered plugin use ``get_name(plugin)`` instead.""" + return getattr(plugin, "__name__", None) or str(id(plugin)) + + def get_plugin(self, name): + """ Return a plugin or None for the given name. """ + return self._name2plugin.get(name) + + def get_name(self, plugin): + """ Return name for registered plugin or None if not registered. """ + for name, val in self._name2plugin.items(): + if plugin == val: + return name + + def _verify_hook(self, hook, hookimpl): + if hook.is_historic() and hookimpl.hookwrapper: + raise PluginValidationError( + "Plugin %r\nhook %r\nhistoric incompatible to hookwrapper" % + (hookimpl.plugin_name, hook.name)) + + for arg in hookimpl.argnames: + if arg not in hook.argnames: + raise PluginValidationError( + "Plugin %r\nhook %r\nargument %r not available\n" + "plugin definition: %s\n" + "available hookargs: %s" % + (hookimpl.plugin_name, hook.name, arg, + _formatdef(hookimpl.function), ", ".join(hook.argnames))) + + def check_pending(self): + """ Verify that all hooks which have not been verified against + a hook specification are optional, otherwise raise PluginValidationError""" + for name in self.hook.__dict__: + if name[0] != "_": + hook = getattr(self.hook, name) + if not hook.has_spec(): + for hookimpl in (hook._wrappers + hook._nonwrappers): + if not hookimpl.optionalhook: + raise PluginValidationError( + "unknown hook %r in plugin %r" % + (name, hookimpl.plugin)) + + def load_setuptools_entrypoints(self, entrypoint_name): + """ Load modules from querying the specified setuptools entrypoint name. + Return the number of loaded plugins. """ + from pkg_resources import iter_entry_points, DistributionNotFound + for ep in iter_entry_points(entrypoint_name): + # is the plugin registered or blocked? + if self.get_plugin(ep.name) or self.is_blocked(ep.name): + continue + try: + plugin = ep.load() + except DistributionNotFound: + continue + self.register(plugin, name=ep.name) + self._plugin_distinfo.append((plugin, ep.dist)) + return len(self._plugin_distinfo) + + def list_plugin_distinfo(self): + """ return list of distinfo/plugin tuples for all setuptools registered + plugins. """ + return list(self._plugin_distinfo) + + def list_name_plugin(self): + """ return list of name/plugin pairs. """ + return list(self._name2plugin.items()) + + def get_hookcallers(self, plugin): + """ get all hook callers for the specified plugin. """ + return self._plugin2hookcallers.get(plugin) + + def add_hookcall_monitoring(self, before, after): + """ add before/after tracing functions for all hooks + and return an undo function which, when called, + will remove the added tracers. + + ``before(hook_name, hook_impls, kwargs)`` will be called ahead + of all hook calls and receive a hookcaller instance, a list + of HookImpl instances and the keyword arguments for the hook call. + + ``after(outcome, hook_name, hook_impls, kwargs)`` receives the + same arguments as ``before`` but also a :py:class:`_CallOutcome`` object + which represents the result of the overall hook call. + """ + return _TracedHookExecution(self, before, after).undo + + def enable_tracing(self): + """ enable tracing of hook calls and return an undo function. """ + hooktrace = self.hook._trace + + def before(hook_name, methods, kwargs): + hooktrace.root.indent += 1 + hooktrace(hook_name, kwargs) + + def after(outcome, hook_name, methods, kwargs): + if outcome.excinfo is None: + hooktrace("finish", hook_name, "-->", outcome.result) + hooktrace.root.indent -= 1 + + return self.add_hookcall_monitoring(before, after) + + def subset_hook_caller(self, name, remove_plugins): + """ Return a new _HookCaller instance for the named method + which manages calls to all registered plugins except the + ones from remove_plugins. """ + orig = getattr(self.hook, name) + plugins_to_remove = [plug for plug in remove_plugins if hasattr(plug, name)] + if plugins_to_remove: + hc = _HookCaller(orig.name, orig._hookexec, orig._specmodule_or_class, + orig.spec_opts) + for hookimpl in (orig._wrappers + orig._nonwrappers): + plugin = hookimpl.plugin + if plugin not in plugins_to_remove: + hc._add_hookimpl(hookimpl) + # we also keep track of this hook caller so it + # gets properly removed on plugin unregistration + self._plugin2hookcallers.setdefault(plugin, []).append(hc) + return hc + return orig + + +class _MultiCall: + """ execute a call into multiple python functions/methods. """ + + # XXX note that the __multicall__ argument is supported only + # for pytest compatibility reasons. It was never officially + # supported there and is explicitly deprecated since 2.8 + # so we can remove it soon, allowing to avoid the below recursion + # in execute() and simplify/speed up the execute loop. + + def __init__(self, hook_impls, kwargs, specopts={}): + self.hook_impls = hook_impls + self.kwargs = kwargs + self.kwargs["__multicall__"] = self + self.specopts = specopts + + def execute(self): + all_kwargs = self.kwargs + self.results = results = [] + firstresult = self.specopts.get("firstresult") + + while self.hook_impls: + hook_impl = self.hook_impls.pop() + args = [all_kwargs[argname] for argname in hook_impl.argnames] + if hook_impl.hookwrapper: + return _wrapped_call(hook_impl.function(*args), self.execute) + res = hook_impl.function(*args) + if res is not None: + if firstresult: + return res + results.append(res) + + if not firstresult: + return results + + def __repr__(self): + status = "%d meths" % (len(self.hook_impls),) + if hasattr(self, "results"): + status = ("%d results, " % len(self.results)) + status + return "<_MultiCall %s, kwargs=%r>" % (status, self.kwargs) + + +def varnames(func, startindex=None): + """ return argument name tuple for a function, method, class or callable. + + In case of a class, its "__init__" method is considered. + For methods the "self" parameter is not included unless you are passing + an unbound method with Python3 (which has no supports for unbound methods) + """ + cache = getattr(func, "__dict__", {}) + try: + return cache["_varnames"] + except KeyError: + pass + if inspect.isclass(func): + try: + func = func.__init__ + except AttributeError: + return () + startindex = 1 + else: + if not inspect.isfunction(func) and not inspect.ismethod(func): + func = getattr(func, '__call__', func) + if startindex is None: + startindex = int(inspect.ismethod(func)) + + try: + rawcode = func.__code__ + except AttributeError: + return () + try: + x = rawcode.co_varnames[startindex:rawcode.co_argcount] + except AttributeError: + x = () + else: + defaults = func.__defaults__ + if defaults: + x = x[:-len(defaults)] + try: + cache["_varnames"] = x + except TypeError: + pass + return x + + +class _HookRelay: + """ hook holder object for performing 1:N hook calls where N is the number + of registered plugins. + + """ + + def __init__(self, trace): + self._trace = trace + + +class _HookCaller(object): + def __init__(self, name, hook_execute, specmodule_or_class=None, spec_opts=None): + self.name = name + self._wrappers = [] + self._nonwrappers = [] + self._hookexec = hook_execute + if specmodule_or_class is not None: + assert spec_opts is not None + self.set_specification(specmodule_or_class, spec_opts) + + def has_spec(self): + return hasattr(self, "_specmodule_or_class") + + def set_specification(self, specmodule_or_class, spec_opts): + assert not self.has_spec() + self._specmodule_or_class = specmodule_or_class + specfunc = getattr(specmodule_or_class, self.name) + argnames = varnames(specfunc, startindex=inspect.isclass(specmodule_or_class)) + assert "self" not in argnames # sanity check + self.argnames = ["__multicall__"] + list(argnames) + self.spec_opts = spec_opts + if spec_opts.get("historic"): + self._call_history = [] + + def is_historic(self): + return hasattr(self, "_call_history") + + def _remove_plugin(self, plugin): + def remove(wrappers): + for i, method in enumerate(wrappers): + if method.plugin == plugin: + del wrappers[i] + return True + if remove(self._wrappers) is None: + if remove(self._nonwrappers) is None: + raise ValueError("plugin %r not found" % (plugin,)) + + def _add_hookimpl(self, hookimpl): + if hookimpl.hookwrapper: + methods = self._wrappers + else: + methods = self._nonwrappers + + if hookimpl.trylast: + methods.insert(0, hookimpl) + elif hookimpl.tryfirst: + methods.append(hookimpl) + else: + # find last non-tryfirst method + i = len(methods) - 1 + while i >= 0 and methods[i].tryfirst: + i -= 1 + methods.insert(i + 1, hookimpl) + + def __repr__(self): + return "<_HookCaller %r>" % (self.name,) + + def __call__(self, **kwargs): + assert not self.is_historic() + return self._hookexec(self, self._nonwrappers + self._wrappers, kwargs) + + def call_historic(self, proc=None, kwargs=None): + self._call_history.append((kwargs or {}, proc)) + # historizing hooks don't return results + self._hookexec(self, self._nonwrappers + self._wrappers, kwargs) + + def call_extra(self, methods, kwargs): + """ Call the hook with some additional temporarily participating + methods using the specified kwargs as call parameters. """ + old = list(self._nonwrappers), list(self._wrappers) + for method in methods: + opts = dict(hookwrapper=False, trylast=False, tryfirst=False) + hookimpl = HookImpl(None, "<temp>", method, opts) + self._add_hookimpl(hookimpl) + try: + return self(**kwargs) + finally: + self._nonwrappers, self._wrappers = old + + def _maybe_apply_history(self, method): + if self.is_historic(): + for kwargs, proc in self._call_history: + res = self._hookexec(self, [method], kwargs) + if res and proc is not None: + proc(res[0]) + + +class HookImpl: + def __init__(self, plugin, plugin_name, function, hook_impl_opts): + self.function = function + self.argnames = varnames(self.function) + self.plugin = plugin + self.opts = hook_impl_opts + self.plugin_name = plugin_name + self.__dict__.update(hook_impl_opts) + + +class PluginValidationError(Exception): + """ plugin failed validation. """ + + +if hasattr(inspect, 'signature'): + def _formatdef(func): + return "%s%s" % ( + func.__name__, + str(inspect.signature(func)) + ) +else: + def _formatdef(func): + return "%s%s" % ( + func.__name__, + inspect.formatargspec(*inspect.getargspec(func)) + ) diff --git a/python/pytest/pytest.py b/python/pytest/pytest.py new file mode 100644 index 0000000000..e376e417e8 --- /dev/null +++ b/python/pytest/pytest.py @@ -0,0 +1,28 @@ +# PYTHON_ARGCOMPLETE_OK +""" +pytest: unit and functional testing with Python. +""" +__all__ = [ + 'main', + 'UsageError', + 'cmdline', + 'hookspec', + 'hookimpl', + '__version__', +] + +if __name__ == '__main__': # if run as a script or by 'python -m pytest' + # we trigger the below "else" condition by the following import + import pytest + raise SystemExit(pytest.main()) + +# else we are imported + +from _pytest.config import ( + main, UsageError, _preloadplugins, cmdline, + hookspec, hookimpl +) +from _pytest import __version__ + +_preloadplugins() # to populate pytest.* namespace so help(pytest) works + diff --git a/python/pytest/setup.cfg b/python/pytest/setup.cfg new file mode 100644 index 0000000000..bec4469e08 --- /dev/null +++ b/python/pytest/setup.cfg @@ -0,0 +1,19 @@ +[build_sphinx] +source-dir = doc/en/ +build-dir = doc/build +all_files = 1 + +[upload_sphinx] +upload-dir = doc/en/build/html + +[bdist_wheel] +universal = 1 + +[devpi:upload] +formats = sdist.tgz,bdist_wheel + +[egg_info] +tag_build = +tag_date = 0 +tag_svn_revision = 0 + diff --git a/python/pytest/setup.py b/python/pytest/setup.py new file mode 100644 index 0000000000..7cdcdfb992 --- /dev/null +++ b/python/pytest/setup.py @@ -0,0 +1,122 @@ +import os, sys +import setuptools +import pkg_resources +from setuptools import setup, Command + +classifiers = ['Development Status :: 6 - Mature', + 'Intended Audience :: Developers', + 'License :: OSI Approved :: MIT License', + 'Operating System :: POSIX', + 'Operating System :: Microsoft :: Windows', + 'Operating System :: MacOS :: MacOS X', + 'Topic :: Software Development :: Testing', + 'Topic :: Software Development :: Libraries', + 'Topic :: Utilities'] + [ + ('Programming Language :: Python :: %s' % x) for x in + '2 2.6 2.7 3 3.2 3.3 3.4 3.5'.split()] + +with open('README.rst') as fd: + long_description = fd.read() + +def get_version(): + p = os.path.join(os.path.dirname( + os.path.abspath(__file__)), "_pytest", "__init__.py") + with open(p) as f: + for line in f.readlines(): + if "__version__" in line: + return line.strip().split("=")[-1].strip(" '") + raise ValueError("could not read version") + + +def has_environment_marker_support(): + """ + Tests that setuptools has support for PEP-426 environment marker support. + + The first known release to support it is 0.7 (and the earliest on PyPI seems to be 0.7.2 + so we're using that), see: http://pythonhosted.org/setuptools/history.html#id142 + + References: + + * https://wheel.readthedocs.io/en/latest/index.html#defining-conditional-dependencies + * https://www.python.org/dev/peps/pep-0426/#environment-markers + """ + try: + return pkg_resources.parse_version(setuptools.__version__) >= pkg_resources.parse_version('0.7.2') + except Exception as exc: + sys.stderr.write("Could not test setuptool's version: %s\n" % exc) + return False + + +def main(): + install_requires = ['py>=1.4.29'] # pluggy is vendored in _pytest.vendored_packages + extras_require = {} + if has_environment_marker_support(): + extras_require[':python_version=="2.6" or python_version=="3.0" or python_version=="3.1"'] = ['argparse'] + extras_require[':sys_platform=="win32"'] = ['colorama'] + else: + if sys.version_info < (2, 7) or (3,) <= sys.version_info < (3, 2): + install_requires.append('argparse') + if sys.platform == 'win32': + install_requires.append('colorama') + + setup( + name='pytest', + description='pytest: simple powerful testing with Python', + long_description=long_description, + version=get_version(), + url='http://pytest.org', + license='MIT license', + platforms=['unix', 'linux', 'osx', 'cygwin', 'win32'], + author='Holger Krekel, Bruno Oliveira, Ronny Pfannschmidt, Floris Bruynooghe, Brianna Laugher, Florian Bruhin and others', + author_email='holger at merlinux.eu', + entry_points=make_entry_points(), + classifiers=classifiers, + cmdclass={'test': PyTest}, + # the following should be enabled for release + install_requires=install_requires, + extras_require=extras_require, + packages=['_pytest', '_pytest.assertion', '_pytest._code', '_pytest.vendored_packages'], + py_modules=['pytest'], + zip_safe=False, + ) + + +def cmdline_entrypoints(versioninfo, platform, basename): + target = 'pytest:main' + if platform.startswith('java'): + points = {'py.test-jython': target} + else: + if basename.startswith('pypy'): + points = {'py.test-%s' % basename: target} + else: # cpython + points = {'py.test-%s.%s' % versioninfo[:2] : target} + points['py.test'] = target + return points + + +def make_entry_points(): + basename = os.path.basename(sys.executable) + points = cmdline_entrypoints(sys.version_info, sys.platform, basename) + keys = list(points.keys()) + keys.sort() + l = ['%s = %s' % (x, points[x]) for x in keys] + return {'console_scripts': l} + + +class PyTest(Command): + user_options = [] + def initialize_options(self): + pass + def finalize_options(self): + pass + def run(self): + import subprocess + PPATH = [x for x in os.environ.get('PYTHONPATH', '').split(':') if x] + PPATH.insert(0, os.getcwd()) + os.environ['PYTHONPATH'] = ':'.join(PPATH) + errno = subprocess.call([sys.executable, 'pytest.py', '--ignore=doc']) + raise SystemExit(errno) + + +if __name__ == '__main__': + main() |